id
int64 0
300k
| molecules
dict | ground_truth
stringlengths 2
23
| messages
listlengths 3
3
|
|---|---|---|---|
132 | {
"selfies": "[C][C][Branch1][C][C][C][O][C][=C][C][=C][Branch1][O][C][N][Branch1][Ring2][C][C][O][C][C][O][C][=C][Ring1][=C][N+1][=Branch1][C][=O][O-1]",
"smiles": "CC(C)COc1ccc(CN(CCO)CCO)cc1[N+](=O)[O-]"
} | C15H24N2O5 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Convert the representation of a molecule <molecule_2d> into molecular formula.",
"role": "user"
},
{
"content": "C15H24N2O5",
"role": "assistant"
}
] |
133 | {
"selfies": "[C][C][C][Branch1][C][C][O][P][=Branch1][C][=O][Branch2][Ring1][Ring2][O][C][=C][C][=C][C][Branch1][=Branch2][N+1][Branch1][C][C][Branch1][C][C][C][=C][Ring1][#Branch2][O][C][Branch1][C][C][C][C]",
"smiles": "CCC(C)OP(=O)(Oc1cccc([N+](C)(C)C)c1)OC(C)CC"
} | C17H31NO4P+ | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "<molecule_2d> is the representation of a molecule. What is its molecular formula?",
"role": "user"
},
{
"content": "C17H31NO4P+",
"role": "assistant"
}
] |
134 | {
"selfies": "[C][N][Branch1][C][C][C][C][O][C][C][O][C][=Branch1][C][=O][C][=C][C][=C][Branch1][C][N][C][=C][Ring1][#Branch1]",
"smiles": "CN(C)CCOCCOC(=O)c1ccc(N)cc1"
} | C13H20N2O3 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "I'd like to know the molecular formula of <molecule_2d> . Can you tell me?",
"role": "user"
},
{
"content": "C13H20N2O3",
"role": "assistant"
}
] |
135 | {
"selfies": "[C][N][C][C][O][C][Ring1][Branch1][C][=C][C][=C][Branch1][Ring1][C][#N][C][=C][Ring1][Branch2]",
"smiles": "CN1CCOC1c1ccc(C#N)cc1"
} | C11H12N2O | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Convert the representation of a molecule <molecule_2d> into molecular formula.",
"role": "user"
},
{
"content": "C11H12N2O",
"role": "assistant"
}
] |
136 | {
"selfies": "[O][=C][C][=C][C][=C][Branch2][Ring1][#Branch1][O][C][C][C][N][C][C][N][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][Ring1][N][C][=C][Ring2][Ring1][=Branch1]",
"smiles": "O=Cc1ccc(OCCCN2CCN(c3ccccc3)CC2)cc1"
} | C20H24N2O2 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Can you tell me the molecular formula of <molecule_2d> ?",
"role": "user"
},
{
"content": "C20H24N2O2",
"role": "assistant"
}
] |
137 | {
"selfies": "[C][O][C][=C][C][Branch2][Ring1][C][C][=Branch1][C][=O][O][C][C][N][C][C][C][Ring1][=Branch1][C][C][Ring1][=Branch1][=C][C][Branch1][Ring1][O][C][=C][Ring2][Ring1][Ring1][O][C]",
"smiles": "COc1cc(C(=O)OC2CN3CCC2CC3)cc(OC)c1OC"
} | C17H23NO5 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Can you give the molecular molecular formula of <molecule_2d> ?",
"role": "user"
},
{
"content": "C17H23NO5",
"role": "assistant"
}
] |
138 | {
"selfies": "[C][C][Branch1][=Branch2][N][C][C][N][Branch1][C][C][C][C][=Branch1][C][=O][O]",
"smiles": "CC(NCCN(C)C)C(=O)O"
} | C7H16N2O2 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "What is the formula of the molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "C7H16N2O2",
"role": "assistant"
}
] |
139 | {
"selfies": "[C][C][=C][Branch2][Ring1][N][C][O][C][=Branch1][C][=O][C][Branch1][C][O][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][C][C][C][Ring1][Branch1][C][N][Branch1][C][C][C][C][Ring2][Ring1][Branch2]",
"smiles": "CC1=C(COC(=O)C(O)(c2ccccc2)C2CCCC2)CN(C)CC1"
} | C21H29NO3 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "What is the molecular formula for the molecule denoted by <molecule_2d> ?",
"role": "user"
},
{
"content": "C21H29NO3",
"role": "assistant"
}
] |
140 | {
"selfies": "[C][C][C][C][=Branch1][C][=O][N][Branch1][C][C][C][=Branch1][C][=O][O][N][=C][C][S][C][C][S][Ring1][=Branch1]",
"smiles": "CCCC(=O)N(C)C(=O)ON=C1CSCCS1"
} | C10H16N2O3S2 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Given the representation <molecule_2d>, what would be its molecular formula?",
"role": "user"
},
{
"content": "C10H16N2O3S2",
"role": "assistant"
}
] |
141 | {
"selfies": "[C][O][C][=C][C][=C][Branch2][Ring2][=Branch2][C][=Branch1][C][=O][N][C][=C][C][=C][Branch2][Ring1][Branch2][C][=Branch1][C][=O][N][N][=C][C][=C][C][=C][Branch1][Ring1][O][C][C][Branch1][Ring1][O][C][=C][Ring1][#Branch2][C][=C][Ring2][Ring1][Branch1][C][=C][Ring2][Ring1][=C]",
"smiles": "COc1ccc(C(=O)Nc2ccc(C(=O)NN=Cc3ccc(OC)c(OC)c3)cc2)cc1"
} | C24H23N3O5 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Please provide the molecular formula for <molecule_2d> .",
"role": "user"
},
{
"content": "C24H23N3O5",
"role": "assistant"
}
] |
143 | {
"selfies": "[C][=C][C][O][C][=C][Branch1][Ring2][C][C][=C][C][=C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][=C][Ring1][N][C][C][=C]",
"smiles": "C=CCOc1c(CC=C)cc(C(=O)O)cc1CC=C"
} | C16H18O3 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Considering the code <molecule_2d>, can you determine the corresponding molecular formula?",
"role": "user"
},
{
"content": "C16H18O3",
"role": "assistant"
}
] |
144 | {
"selfies": "[C][C][C][C][N][C][=C][Branch1][=C][C][=Branch1][C][=O][C][=Branch1][C][=O][N][Branch1][C][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring1][S]",
"smiles": "CCCCn1cc(C(=O)C(=O)N(C)C)c2ccccc21"
} | C16H20N2O2 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Please provide the molecular formula for <molecule_2d> .",
"role": "user"
},
{
"content": "C16H20N2O2",
"role": "assistant"
}
] |
145 | {
"selfies": "[O][=C][N][=C][C][N][Ring1][Branch1][C][=N][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][S][Ring1][Branch2]",
"smiles": "O=C1N=CCN1c1ncc([N+](=O)[O-])s1"
} | C6H4N4O3S | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "<molecule_2d> is the representation of a molecule. What is its molecular formula?",
"role": "user"
},
{
"content": "C6H4N4O3S",
"role": "assistant"
}
] |
147 | {
"selfies": "[C][=C][Branch1][C][C][C][Branch1][C][O][Branch2][Ring1][#Branch2][C][=Branch1][C][=O][O][C][C][C][Branch1][C][C][N][Branch1][C][C][C][Branch1][C][C][Branch1][C][C][C][Ring1][#Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"smiles": "C=C(C)C(O)(C(=O)OC1CC(C)N(C)C(C)(C)C1)c1ccccc1"
} | C20H29NO3 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "What is the molecular formula for the molecule denoted by <molecule_2d> ?",
"role": "user"
},
{
"content": "C20H29NO3",
"role": "assistant"
}
] |
148 | {
"selfies": "[C][C][#C][C][Branch1][C][O][Branch2][Ring1][C][C][=Branch1][C][=O][O][C][C][N][C][C][C][Ring1][=Branch1][C][C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"smiles": "CC#CC(O)(C(=O)OC1CN2CCC1CC2)c1ccccc1"
} | C18H21NO3 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Considering the code <molecule_2d>, can you determine the corresponding molecular formula?",
"role": "user"
},
{
"content": "C18H21NO3",
"role": "assistant"
}
] |
149 | {
"selfies": "[C][C][O][C][=Branch1][C][=O][C][Branch1][O][C][N][Branch1][Ring2][C][C][Cl][C][C][Cl][Branch1][Branch2][C][=Branch1][C][=O][O][C][C][N+1][=Branch1][C][=O][O-1]",
"smiles": "CCOC(=O)C(CN(CCCl)CCCl)(C(=O)OCC)[N+](=O)[O-]"
} | C12H20Cl2N2O6 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "What is the molecular formula for the molecule denoted by <molecule_2d> ?",
"role": "user"
},
{
"content": "C12H20Cl2N2O6",
"role": "assistant"
}
] |
150 | {
"selfies": "[C][C][N][Branch1][Ring1][C][C][C][C][S][C][C][=Branch1][C][=O][N][C][=C][C][=C][C][=C][Ring1][=Branch1][C]",
"smiles": "CCN(CC)CCSCC(=O)Nc1ccccc1C"
} | C15H24N2OS | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "<molecule_2d> is the representation of a molecule. What is its molecular formula?",
"role": "user"
},
{
"content": "C15H24N2OS",
"role": "assistant"
}
] |
151 | {
"selfies": "[C][N+1][Branch1][C][C][Branch1][C][C][C][C][C][N][C][C][C][C][C][C][Branch1][Ring2][C][Ring1][Branch2][N+1][Ring1][#Branch1][Branch1][C][C][C]",
"smiles": "C[N+](C)(C)CCCN1CC2CCCC(C1)[N+]2(C)C"
} | C15H33N3+2 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "The representation <molecule_2d> represents a specific molecule. Can you reveal its molecular formula?",
"role": "user"
},
{
"content": "C15H33N3+2",
"role": "assistant"
}
] |
152 | {
"selfies": "[C][C][O][C][=Branch1][C][=O][C][Branch1][O][C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][N][C][Branch1][C][C][C][=Branch1][C][=O][N][N][=C][Branch1][=Branch2][C][Branch1][C][C][Branch1][C][C][C][S][C][Ring1][=Branch2][C][=Branch1][C][=O][O]",
"smiles": "CCOC(=O)C(CCc1ccccc1)NC(C)C(=O)N1N=C(C(C)(C)C)SC1C(=O)O"
} | C22H31N3O5S | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Considering the code <molecule_2d>, can you determine the corresponding molecular formula?",
"role": "user"
},
{
"content": "C22H31N3O5S",
"role": "assistant"
}
] |
154 | {
"selfies": "[O][=C][Branch1][C][O][C][N][C][C][Branch1][C][O][N][C][C][=Branch1][C][=O][O]",
"smiles": "O=C(O)CNCC(O)NCC(=O)O"
} | C6H12N2O5 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "What is the molecular formula of <molecule_2d> ?",
"role": "user"
},
{
"content": "C6H12N2O5",
"role": "assistant"
}
] |
156 | {
"selfies": "[C][C][C][C][O][C][C][O][C][Branch1][C][C][C][O]",
"smiles": "CCCCOCCOC(C)CO"
} | C9H20O3 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Given the representation <molecule_2d>, what would be its molecular formula?",
"role": "user"
},
{
"content": "C9H20O3",
"role": "assistant"
}
] |
157 | {
"selfies": "[C][C][=N][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][N][Ring1][O][C][C][C][N][C][C][C][C][C][Ring1][=Branch1]",
"smiles": "Cc1nc2ccccc2c(=O)n1CCCN1CCCCC1"
} | C17H23N3O | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Convert the representation of a molecule <molecule_2d> into molecular formula.",
"role": "user"
},
{
"content": "C17H23N3O",
"role": "assistant"
}
] |
158 | {
"selfies": "[C][C][=C][Branch1][C][O][C][=C][C][=C][Ring1][#Branch1][N][C][Branch1][Ring1][C][F][=N][C][=C][C][=C][Branch1][C][N][C][=C][Ring1][#Branch1][C][Ring1][=N][=O]",
"smiles": "Cc1c(O)cccc1-n1c(CF)nc2ccc(N)cc2c1=O"
} | C16H14FN3O2 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "The representation <molecule_2d> represents a specific molecule. Can you reveal its molecular formula?",
"role": "user"
},
{
"content": "C16H14FN3O2",
"role": "assistant"
}
] |
159 | {
"selfies": "[O][=C][Branch2][Ring1][Branch2][N][C][C][C][C][C][C][C][Branch1][O][C][C][Branch1][Ring2][C][Ring1][=Branch1][C][Ring1][=Branch2][C][Ring1][#Branch2][C][=C][C][=C][C][=N][Ring1][=Branch1]",
"smiles": "O=C(NCCC12CC3CC(CC(C3)C1)C2)c1ccccn1"
} | C18H24N2O | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Considering the code <molecule_2d>, can you determine the corresponding molecular formula?",
"role": "user"
},
{
"content": "C18H24N2O",
"role": "assistant"
}
] |
160 | {
"selfies": "[C][O][C][=C][C][=C][Branch2][Ring2][C][C][C][N][Branch1][C][C][C][C][C][N][C][C][C][=C][C][Branch1][Ring1][O][C][=C][Branch1][Ring1][O][C][C][=C][Ring1][#Branch2][C][C][Ring1][#C][=O][C][=C][Ring2][Ring1][=N][O][C]",
"smiles": "COc1ccc(CCN(C)CCCN2CCc3cc(OC)c(OC)cc3CC2=O)cc1OC"
} | C26H36N2O5 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "<molecule_2d> is the representation of a molecule. What is its molecular formula?",
"role": "user"
},
{
"content": "C26H36N2O5",
"role": "assistant"
}
] |
161 | {
"selfies": "[N][C][=Branch1][C][=O][C][N][=C][NH1][C][=Ring1][Branch1][C][Branch1][C][N][=O]",
"smiles": "NC(=O)c1nc[nH]c1C(N)=O"
} | C5H6N4O2 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "What is the molecular formula for the molecule denoted by <molecule_2d> ?",
"role": "user"
},
{
"content": "C5H6N4O2",
"role": "assistant"
}
] |
162 | {
"selfies": "[C][C][Branch1][C][C][C][=N][N][=C][Branch2][Ring1][Ring2][N][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][C][N][C][=C][Ring1][#Branch1][S][Ring1][S]",
"smiles": "CC(C)c1nnc(NS(=O)(=O)c2ccc(N)cc2)s1"
} | C11H14N4O2S2 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Convert the representation of a molecule <molecule_2d> into molecular formula.",
"role": "user"
},
{
"content": "C11H14N4O2S2",
"role": "assistant"
}
] |
163 | {
"selfies": "[O][=C][Branch1][C][O][C][=N][C][=C][N][=C][Ring1][=Branch1][C][=Branch1][C][=O][O]",
"smiles": "O=C(O)c1nccnc1C(=O)O"
} | C6H4N2O4 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "What is the molecular formula of <molecule_2d> ?",
"role": "user"
},
{
"content": "C6H4N2O4",
"role": "assistant"
}
] |
164 | {
"selfies": "[C][C][Branch1][C][C][O][C][C][C][#N]",
"smiles": "CC(C)OCCC#N"
} | C6H11NO | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Please write the molecular formula of the molecule <molecule_2d> .",
"role": "user"
},
{
"content": "C6H11NO",
"role": "assistant"
}
] |
165 | {
"selfies": "[O][=C][Branch2][Ring1][=N][N][C][=C][C][=C][C][Branch1][C][O][=C][C][Branch1][=Branch2][S][=Branch1][C][=O][=Branch1][C][=O][O][=C][C][Ring1][O][=C][Ring1][#C][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=Branch2]",
"smiles": "O=C(Nc1ccc2c(O)cc(S(=O)(=O)O)cc2c1)c1ccc([N+](=O)[O-])cc1"
} | C17H12N2O7S | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Can you tell me the molecular formula of <molecule_2d> ?",
"role": "user"
},
{
"content": "C17H12N2O7S",
"role": "assistant"
}
] |
166 | {
"selfies": "[O][=C][Branch1][P][N][C][=C][C][=C][C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][=C][Ring1][=Branch2][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=Branch2]",
"smiles": "O=C(Nc1cccc([N+](=O)[O-])c1)c1ccc([N+](=O)[O-])cc1"
} | C13H9N3O5 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "What is the formula of the molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "C13H9N3O5",
"role": "assistant"
}
] |
167 | {
"selfies": "[N][#C][C][Branch1][C][F][Branch1][C][F][C][Branch1][C][F][Branch1][C][F][F]",
"smiles": "N#CC(F)(F)C(F)(F)F"
} | C3F5N | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Can you tell me the molecular formula of <molecule_2d> ?",
"role": "user"
},
{
"content": "C3F5N",
"role": "assistant"
}
] |
168 | {
"selfies": "[C][C][O][C][=C][C][=C][C][Branch1][Ring1][C][=O][=C][Ring1][Branch2][O]",
"smiles": "CCOc1cccc(C=O)c1O"
} | C9H10O3 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "What is the formula of the molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "C9H10O3",
"role": "assistant"
}
] |
169 | {
"selfies": "[C][C][N][Branch1][Ring1][C][C][C][C][O][C][=Branch1][C][=O][C][N][C][=Branch1][C][=O][C][Branch2][Ring1][Ring2][N][C][=Branch1][C][=O][C][=C][Branch1][Ring1][O][C][C][=C][C][=C][Ring1][Branch2][O][C][C][Ring2][Ring1][C][S][C][Ring2][Ring1][Branch1][Branch1][C][C][C]",
"smiles": "CCN(CC)CCOC(=O)C1N2C(=O)C(NC(=O)c3c(OC)cccc3OC)C2SC1(C)C"
} | C23H33N3O6S | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "I'd like to know the molecular formula of <molecule_2d> . Can you tell me?",
"role": "user"
},
{
"content": "C23H33N3O6S",
"role": "assistant"
}
] |
170 | {
"selfies": "[O][=C][C][=C][Branch1][C][O][C][=Branch1][C][=O][C][=C][Ring1][Branch2][O]",
"smiles": "O=C1C=C(O)C(=O)C=C1O"
} | C6H4O4 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Given the representation <molecule_2d>, what would be its molecular formula?",
"role": "user"
},
{
"content": "C6H4O4",
"role": "assistant"
}
] |
171 | {
"selfies": "[C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][C][Ring1][Branch1]",
"smiles": "c1ccc2c(c1)CC2"
} | C8H8 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Please provide the molecular formula for <molecule_2d> .",
"role": "user"
},
{
"content": "C8H8",
"role": "assistant"
}
] |
172 | {
"selfies": "[O][=S][=Branch1][C][=O][Branch1][C][Cl][C][C][F]",
"smiles": "O=S(=O)(Cl)CCF"
} | C2H4ClFO2S | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Given the representation <molecule_2d>, what would be its molecular formula?",
"role": "user"
},
{
"content": "C2H4ClFO2S",
"role": "assistant"
}
] |
173 | {
"selfies": "[C][SiH2][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"smiles": "C[SiH2]c1ccccc1"
} | C7H10Si | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "<molecule_2d> is the representation of a molecule. What is its molecular formula?",
"role": "user"
},
{
"content": "C7H10Si",
"role": "assistant"
}
] |
174 | {
"selfies": "[C][C][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][N][N]",
"smiles": "CC(C)(C)OC(=O)NN"
} | C5H12N2O2 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Considering the code <molecule_2d>, can you determine the corresponding molecular formula?",
"role": "user"
},
{
"content": "C5H12N2O2",
"role": "assistant"
}
] |
175 | {
"selfies": "[N][N][C][=Branch1][C][=O][C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"smiles": "NNC(=O)Cc1ccccc1"
} | C8H10N2O | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "The representation <molecule_2d> represents a specific molecule. Can you reveal its molecular formula?",
"role": "user"
},
{
"content": "C8H10N2O",
"role": "assistant"
}
] |
176 | {
"selfies": "[C][Si][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][Si][Branch1][C][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"smiles": "C[Si](c1ccccc1)(c1ccccc1)[Si](C)(c1ccccc1)c1ccccc1"
} | C26H26Si2 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Convert the representation of a molecule <molecule_2d> into molecular formula.",
"role": "user"
},
{
"content": "C26H26Si2",
"role": "assistant"
}
] |
177 | {
"selfies": "[C][C][Branch1][C][C][S][C][C][Branch2][Ring1][#Branch2][N][C][=Branch1][C][=O][C][Branch1][#Branch2][O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][N][Ring2][Ring1][=Branch1][C][Ring2][Ring1][#Branch2][C][=Branch1][C][=O][O]",
"smiles": "CC1(C)SC2C(NC(=O)C(Oc3ccccc3)c3ccccc3)C(=O)N2C1C(=O)O"
} | C22H22N2O5S | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Can you tell me the molecular formula of <molecule_2d> ?",
"role": "user"
},
{
"content": "C22H22N2O5S",
"role": "assistant"
}
] |
178 | {
"selfies": "[C][C][Branch1][C][C][N][C][C][Branch1][C][O][C][O][C][=C][C][=C][C][NH1][C][=C][C][=C][C][=C][Ring1][=Branch1][C][Ring1][=N][=Ring1][=Branch2]",
"smiles": "CC(C)NCC(O)COc1cccc2[nH]c3ccccc3c12"
} | C18H22N2O2 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "The representation <molecule_2d> represents a specific molecule. Can you reveal its molecular formula?",
"role": "user"
},
{
"content": "C18H22N2O2",
"role": "assistant"
}
] |
179 | {
"selfies": "[C][C][=C][N][Branch1][#C][C][C][C][Branch1][C][O][C][Branch1][Ring1][C][O][O][Ring1][Branch2][C][=Branch1][C][=O][NH1][C][Ring1][#C][=O]",
"smiles": "Cc1cn(C2CC(O)C(CO)O2)c(=O)[nH]c1=O"
} | C10H14N2O5 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "<molecule_2d> is the representation of a molecule. What is its molecular formula?",
"role": "user"
},
{
"content": "C10H14N2O5",
"role": "assistant"
}
] |
180 | {
"selfies": "[C][C][Branch1][C][C][C][Branch2][Ring2][=Branch2][N][C][=Branch1][C][=O][C][Branch1][#Branch2][C][C][C][N][=C][Branch1][C][N][N][N][C][=Branch1][C][=O][N][C][Branch1][#Branch2][C][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=Branch1][C][=O][O][C][=Branch1][C][=O][N][C][Branch1][Ring1][C][=O][C][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"smiles": "CC(C)C(NC(=O)C(CCCN=C(N)N)NC(=O)NC(Cc1ccccc1)C(=O)O)C(=O)NC(C=O)Cc1ccccc1"
} | C30H41N7O6 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "I'd like to know the molecular formula of <molecule_2d> . Can you tell me?",
"role": "user"
},
{
"content": "C30H41N7O6",
"role": "assistant"
}
] |
181 | {
"selfies": "[O][=C][NH1][C][=Branch1][C][=O][N][Branch1][=Branch1][C][O][C][C][O][C][=C][Ring1][N][F]",
"smiles": "O=c1[nH]c(=O)n(COCCO)cc1F"
} | C7H9FN2O4 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Can you tell me the molecular formula of <molecule_2d> ?",
"role": "user"
},
{
"content": "C7H9FN2O4",
"role": "assistant"
}
] |
183 | {
"selfies": "[C][=C][C][=Branch1][C][=O][O][C][C][C][Branch1][C][C][C][C][C][C][Branch1][C][C][C][Ring1][Branch2][=C][C][Ring1][S][Ring1][N]",
"smiles": "C=C1C(=O)OC2CC3(C)CCCC(C)C3=CC12"
} | C15H20O2 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Considering the code <molecule_2d>, can you determine the corresponding molecular formula?",
"role": "user"
},
{
"content": "C15H20O2",
"role": "assistant"
}
] |
184 | {
"selfies": "[N][C][=C][C][=C][C][=Branch1][Ring2][=C][Ring1][=Branch1][C][=Branch1][C][=O][N][C][Ring1][#Branch1][=O]",
"smiles": "Nc1ccc2c(c1)C(=O)NC2=O"
} | C8H6N2O2 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "I'd like to know the molecular formula of <molecule_2d> . Can you tell me?",
"role": "user"
},
{
"content": "C8H6N2O2",
"role": "assistant"
}
] |
185 | {
"selfies": "[C][O][C][=C][C][=C][Branch2][Branch1][S][C][C][C][=Branch1][C][=O][C][=C][Branch1][C][O][C][=C][Branch2][Ring2][#Branch1][O][C][O][C][Branch1][Ring1][C][O][C][Branch1][C][O][C][Branch1][C][O][C][Ring1][#Branch2][O][C][O][C][Branch1][C][C][C][Branch1][C][O][C][Branch1][C][O][C][Ring1][=Branch2][O][C][=C][Ring2][Ring1][=N][O][Ring2][Ring2][C][C][=C][Ring2][Ring2][Branch2][O]",
"smiles": "COc1ccc(C2CC(=O)c3c(O)cc(OC4OC(CO)C(O)C(O)C4OC4OC(C)C(O)C(O)C4O)cc3O2)cc1O"
} | C28H34O15 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Considering the code <molecule_2d>, can you determine the corresponding molecular formula?",
"role": "user"
},
{
"content": "C28H34O15",
"role": "assistant"
}
] |
186 | {
"selfies": "[N][#C][N][C][C][O][C][C][Ring1][=Branch1]",
"smiles": "N#CN1CCOCC1"
} | C5H8N2O | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "What is the molecular formula of <molecule_2d> ?",
"role": "user"
},
{
"content": "C5H8N2O",
"role": "assistant"
}
] |
187 | {
"selfies": "[Cl][C][Branch1][C][Cl][Si][Branch1][C][Cl][Branch1][C][Cl][Cl]",
"smiles": "ClC(Cl)[Si](Cl)(Cl)Cl"
} | CHCl5Si | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "What is the molecular formula of <molecule_2d> ?",
"role": "user"
},
{
"content": "CHCl5Si",
"role": "assistant"
}
] |
188 | {
"selfies": "[C][O][C][=Branch1][C][=O][C][C][C][C][=Branch1][C][=O][Cl]",
"smiles": "COC(=O)CCCC(=O)Cl"
} | C6H9ClO3 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Convert the representation of a molecule <molecule_2d> into molecular formula.",
"role": "user"
},
{
"content": "C6H9ClO3",
"role": "assistant"
}
] |
189 | {
"selfies": "[C][=C][C][=C][Branch2][Ring1][C][C][=C][C][=C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][S][Ring1][O][C][=C][Ring1][P]",
"smiles": "c1ccc(-c2ccc(-c3ccccc3)s2)cc1"
} | C16H12S | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Can you give the molecular molecular formula of <molecule_2d> ?",
"role": "user"
},
{
"content": "C16H12S",
"role": "assistant"
}
] |
190 | {
"selfies": "[O][C][C][N][C][=C][N][=C][Ring1][Branch1]",
"smiles": "OCCn1ccnc1"
} | C5H8N2O | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Convert the representation of a molecule <molecule_2d> into molecular formula.",
"role": "user"
},
{
"content": "C5H8N2O",
"role": "assistant"
}
] |
191 | {
"selfies": "[C][Si][Branch1][C][C][O][Si][Branch1][C][C][Branch1][C][C][O][Si][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][O][Si][Branch1][C][C][Branch1][C][C][O][Ring2][Ring1][=Branch2]",
"smiles": "C[Si]1(C)O[Si](C)(C)O[Si](c2ccccc2)(c2ccccc2)O[Si](C)(C)O1"
} | C18H28O4Si4 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Considering the code <molecule_2d>, can you determine the corresponding molecular formula?",
"role": "user"
},
{
"content": "C18H28O4Si4",
"role": "assistant"
}
] |
192 | {
"selfies": "[C][=C][Branch1][C][C][O][Si][Branch1][C][C][Branch1][C][C][C]",
"smiles": "C=C(C)O[Si](C)(C)C"
} | C6H14OSi | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "What is the molecular formula of <molecule_2d> ?",
"role": "user"
},
{
"content": "C6H14OSi",
"role": "assistant"
}
] |
194 | {
"selfies": "[C][C][=C][C][=C][C][Branch2][Ring1][N][N][=N][C][=C][C][=C][Branch1][#C][N][=N][C][=C][C][Branch1][C][C][=C][C][=C][Ring1][#Branch1][O][C][=C][Ring1][S][C][=C][Ring2][Ring1][=Branch2]",
"smiles": "Cc1cccc(N=Nc2ccc(N=Nc3cc(C)ccc3O)cc2C)c1"
} | C21H20N4O | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "What is the formula of the molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "C21H20N4O",
"role": "assistant"
}
] |
195 | {
"selfies": "[C][C][=Branch1][C][=O][N][C][=C][C][=C][Branch1][=N][C][=Branch1][C][=O][O][C][C][N][Branch1][C][C][C][C][=C][Ring1][=C]",
"smiles": "CC(=O)Nc1ccc(C(=O)OCCN(C)C)cc1"
} | C13H18N2O3 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Can you tell me the molecular formula of <molecule_2d> ?",
"role": "user"
},
{
"content": "C13H18N2O3",
"role": "assistant"
}
] |
196 | {
"selfies": "[N][C][=C][C][=C][C][Branch1][=N][C][=C][C][=C][C][=C][C][=C][Ring1][=Branch1][Ring1][#Branch2][=C][Ring1][=C]",
"smiles": "Nc1ccc2c(ccc3ccccc32)c1"
} | C14H11N | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "I'd like to know the molecular formula of <molecule_2d> . Can you tell me?",
"role": "user"
},
{
"content": "C14H11N",
"role": "assistant"
}
] |
197 | {
"selfies": "[C][C][=C][C][Branch1][C][C][=N+1][Branch1][C][O-1][C][Branch1][C][C][=C][Ring1][=Branch2]",
"smiles": "Cc1cc(C)[n+]([O-])c(C)c1"
} | C8H11NO | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Please provide the molecular formula for <molecule_2d> .",
"role": "user"
},
{
"content": "C8H11NO",
"role": "assistant"
}
] |
198 | {
"selfies": "[O][=C][Branch1][P][C][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"smiles": "O=C(CS(=O)(=O)c1ccccc1)c1ccccc1"
} | C14H12O3S | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Please write the molecular formula of the molecule <molecule_2d> .",
"role": "user"
},
{
"content": "C14H12O3S",
"role": "assistant"
}
] |
200 | {
"selfies": "[F][C][Branch1][C][F][=C][Branch1][C][F][C][C][S][C][=N][C][=C][C][=N][Ring1][=Branch1]",
"smiles": "FC(F)=C(F)CCSc1ncccn1"
} | C8H7F3N2S | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Please write the molecular formula of the molecule <molecule_2d> .",
"role": "user"
},
{
"content": "C8H7F3N2S",
"role": "assistant"
}
] |
201 | {
"selfies": "[O][=C][Branch1][Ring1][C][Br][C][Branch1][C][F][Branch1][C][F][F]",
"smiles": "O=C(CBr)C(F)(F)F"
} | C3H2BrF3O | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "What is the molecular formula for the molecule denoted by <molecule_2d> ?",
"role": "user"
},
{
"content": "C3H2BrF3O",
"role": "assistant"
}
] |
202 | {
"selfies": "[O][=C][Branch1][C][S][C][Cl]",
"smiles": "O=C(S)CCl"
} | C2H3ClOS | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "What is the molecular formula for the molecule denoted by <molecule_2d> ?",
"role": "user"
},
{
"content": "C2H3ClOS",
"role": "assistant"
}
] |
203 | {
"selfies": "[C][C][C][C][C][C][C][C][C][C][C][C][S][C][=Branch1][Ring1][=N][C][N][C]",
"smiles": "CCCCCCCCCCCCSC(=NC)NC"
} | C15H32N2S | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "I'd like to know the molecular formula of <molecule_2d> . Can you tell me?",
"role": "user"
},
{
"content": "C15H32N2S",
"role": "assistant"
}
] |
204 | {
"selfies": "[C][C][N][Branch1][Ring1][C][C][C][C][C][N][C]",
"smiles": "CCN(CC)CCCNC"
} | C8H20N2 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "What is the molecular formula for the molecule denoted by <molecule_2d> ?",
"role": "user"
},
{
"content": "C8H20N2",
"role": "assistant"
}
] |
205 | {
"selfies": "[C][C][Branch1][C][C][O][C][=Branch1][C][=O][C][Branch1][Branch1][C][C][Ring1][Ring1][C][=Branch1][C][=O][O][Ring1][O]",
"smiles": "CC1(C)OC(=O)C2(CC2)C(=O)O1"
} | C8H10O4 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "What is the molecular formula for the molecule denoted by <molecule_2d> ?",
"role": "user"
},
{
"content": "C8H10O4",
"role": "assistant"
}
] |
206 | {
"selfies": "[C][C][C][C][C][N][C][C][C][Ring1][=Branch2]",
"smiles": "C1CCCCNCCC1"
} | C8H17N | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Given the representation <molecule_2d>, what would be its molecular formula?",
"role": "user"
},
{
"content": "C8H17N",
"role": "assistant"
}
] |
207 | {
"selfies": "[C][C][=C][C][=C][Branch1][O][S][=Branch1][C][=O][=Branch1][C][=O][C][C][#N][C][=C][Ring1][N]",
"smiles": "Cc1ccc(S(=O)(=O)CC#N)cc1"
} | C9H9NO2S | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "What is the molecular formula for the molecule denoted by <molecule_2d> ?",
"role": "user"
},
{
"content": "C9H9NO2S",
"role": "assistant"
}
] |
208 | {
"selfies": "[O][=C][Branch1][O][O][C][=C][C][=C][C][=C][Ring1][=Branch1][O][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"smiles": "O=C(Oc1ccccc1O)c1ccccc1"
} | C13H10O3 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "What is the molecular formula of <molecule_2d> ?",
"role": "user"
},
{
"content": "C13H10O3",
"role": "assistant"
}
] |
209 | {
"selfies": "[O][=C][O][C][=Branch1][C][=O][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][C][=C][C][Ring1][S][=C][Ring1][=N][Ring1][=Branch1]",
"smiles": "O=C1OC(=O)c2ccc([N+](=O)[O-])c3cccc1c23"
} | C12H5NO5 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "What is the molecular formula of <molecule_2d> ?",
"role": "user"
},
{
"content": "C12H5NO5",
"role": "assistant"
}
] |
211 | {
"selfies": "[C][=C][C][=Branch1][C][=O][O][C][C][Branch1][Ring1][C][C][Branch1][Ring1][C][O][C][O]",
"smiles": "C=CC(=O)OCC(CC)(CO)CO"
} | C9H16O4 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Can you tell me the molecular formula of <molecule_2d> ?",
"role": "user"
},
{
"content": "C9H16O4",
"role": "assistant"
}
] |
212 | {
"selfies": "[O][=C][Branch1][Ring1][N][O][N][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"smiles": "O=C(NO)Nc1ccccc1"
} | C7H8N2O2 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Convert the representation of a molecule <molecule_2d> into molecular formula.",
"role": "user"
},
{
"content": "C7H8N2O2",
"role": "assistant"
}
] |
213 | {
"selfies": "[C][C][C][Sn][=Branch1][C][=O][C][C][C]",
"smiles": "CCC[Sn](=O)CCC"
} | C6H14OSn | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Can you give the molecular molecular formula of <molecule_2d> ?",
"role": "user"
},
{
"content": "C6H14OSn",
"role": "assistant"
}
] |
214 | {
"selfies": "[C][O][C][C][N][C][C][O][C][C][Ring1][=Branch1]",
"smiles": "COCCN1CCOCC1"
} | C7H15NO2 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Please write the molecular formula of the molecule <molecule_2d> .",
"role": "user"
},
{
"content": "C7H15NO2",
"role": "assistant"
}
] |
215 | {
"selfies": "[C][O][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=Branch2][C][#N]",
"smiles": "COc1ccc([N+](=O)[O-])cc1C#N"
} | C8H6N2O3 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Convert the representation of a molecule <molecule_2d> into molecular formula.",
"role": "user"
},
{
"content": "C8H6N2O3",
"role": "assistant"
}
] |
217 | {
"selfies": "[C][C][C][S][P][Branch1][C][C][=Branch1][C][=O][O][C][C]",
"smiles": "CCCSP(C)(=O)OCC"
} | C6H15O2PS | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "What is the molecular formula of <molecule_2d> ?",
"role": "user"
},
{
"content": "C6H15O2PS",
"role": "assistant"
}
] |
219 | {
"selfies": "[C][O][C][=Branch1][C][=O][C][C][Branch1][=C][C][C][=Branch1][C][=O][C][=C][C][=C][C][=C][Ring1][=Branch1][C][C][C][C][C][Ring1][S][N][Ring1][Branch1][C]",
"smiles": "COC(=O)C1C(CC(=O)c2ccccc2)CC2CCC1N2C"
} | C18H23NO3 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Please provide the molecular formula for <molecule_2d> .",
"role": "user"
},
{
"content": "C18H23NO3",
"role": "assistant"
}
] |
220 | {
"selfies": "[O][=C][Branch2][Ring1][Branch1][C][C][C][C][C][C][N][C][=Branch1][C][=O][N][C][Ring1][=Branch1][C][S][Ring1][=Branch2][=O][N][C][C][N][C][=Branch1][C][=O][C][C][C][=C][C][=C][Branch1][C][O][C][Branch1][C][I][=C][Ring1][Branch2]",
"smiles": "O=C(CCCCC1C2NC(=O)NC2CS1=O)NCCNC(=O)CCc1ccc(O)c(I)c1"
} | C21H29IN4O5S | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Considering the code <molecule_2d>, can you determine the corresponding molecular formula?",
"role": "user"
},
{
"content": "C21H29IN4O5S",
"role": "assistant"
}
] |
221 | {
"selfies": "[C][O][C][=Branch1][C][=O][C][=N][C][Branch1][C][Cl][=C][Branch1][C][Cl][C][Branch1][C][N][=C][Ring1][=Branch2][Cl]",
"smiles": "COC(=O)c1nc(Cl)c(Cl)c(N)c1Cl"
} | C7H5Cl3N2O2 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "What is the molecular formula of <molecule_2d> ?",
"role": "user"
},
{
"content": "C7H5Cl3N2O2",
"role": "assistant"
}
] |
222 | {
"selfies": "[C][C][Branch1][C][C][C][O][P][=Branch1][C][=O][Branch1][#Branch2][C][C][=C][C][=C][C][=C][Ring1][=Branch1][O][C][Ring1][#C]",
"smiles": "CC1(C)COP(=O)(Cc2ccccc2)OC1"
} | C12H17O3P | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Please write the molecular formula of the molecule <molecule_2d> .",
"role": "user"
},
{
"content": "C12H17O3P",
"role": "assistant"
}
] |
223 | {
"selfies": "[C][C][O][C][Branch1][=Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][O][C][C][N][Branch1][C][C][C][Ring1][=N][C]",
"smiles": "CCOC1(c2ccccc2)OCCN(C)C1C"
} | C14H21NO2 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Can you tell me the molecular formula of <molecule_2d> ?",
"role": "user"
},
{
"content": "C14H21NO2",
"role": "assistant"
}
] |
224 | {
"selfies": "[C][C][Branch1][C][C][O][C][=Branch1][C][=O][C][Branch2][Ring1][#Branch1][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][=Branch1][N+1][=Branch1][C][=O][O-1][C][=C][Ring1][=Branch2][C][C][C][Ring1][S]",
"smiles": "CC(C)OC(=O)C1(S(=O)(=O)c2ccc([N+](=O)[O-])cc2)CCC1"
} | C14H17NO6S | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Convert the representation of a molecule <molecule_2d> into molecular formula.",
"role": "user"
},
{
"content": "C14H17NO6S",
"role": "assistant"
}
] |
225 | {
"selfies": "[Cl][C][=C][Branch1][C][Cl][C][Branch1][C][Cl][C][C][Branch1][C][Br][C][Branch1][C][Br][C][C][Ring1][#Branch1][C][Ring1][=N][Branch1][C][Cl][C][Ring1][N][Branch1][C][Cl][Cl]",
"smiles": "ClC1=C(Cl)C2(Cl)C3C(Br)C(Br)CC3C1(Cl)C2(Cl)Cl"
} | C10H6Br2Cl6 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Please provide the molecular formula for <molecule_2d> .",
"role": "user"
},
{
"content": "C10H6Br2Cl6",
"role": "assistant"
}
] |
226 | {
"selfies": "[C][C][C][C][Branch1][Branch2][C][C][C][Branch1][C][C][C][C][=Branch1][C][=O][N][C][=Branch1][C][=O][N][C][Ring1][=N][=O]",
"smiles": "CCCC1(CCC(C)C)C(=O)NC(=O)NC1=O"
} | C12H20N2O3 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Can you give the molecular molecular formula of <molecule_2d> ?",
"role": "user"
},
{
"content": "C12H20N2O3",
"role": "assistant"
}
] |
227 | {
"selfies": "[C][Si][Branch1][C][C][Branch1][C][C][O][C][=Branch1][C][=O][C][C][=Branch1][C][=O][O][Si][Branch1][C][C][Branch1][C][C][C]",
"smiles": "C[Si](C)(C)OC(=O)CC(=O)O[Si](C)(C)C"
} | C9H20O4Si2 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Can you give the molecular molecular formula of <molecule_2d> ?",
"role": "user"
},
{
"content": "C9H20O4Si2",
"role": "assistant"
}
] |
228 | {
"selfies": "[C][C][C][C][C][C][C][C][C][=Branch1][C][=O][O][C][C][O][C][C][C][C]",
"smiles": "CCCCCCCCC(=O)OCCOCCCC"
} | C15H30O3 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "What is the molecular formula of <molecule_2d> ?",
"role": "user"
},
{
"content": "C15H30O3",
"role": "assistant"
}
] |
229 | {
"selfies": "[C][C][N][Branch1][Ring1][C][C][C][=C][C][=C][Branch1][=Branch1][C][=Branch1][C][=O][O][C][Branch1][C][O][=C][Ring1][#Branch2]",
"smiles": "CCN(CC)c1ccc(C(=O)O)c(O)c1"
} | C11H15NO3 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Please provide the molecular formula for <molecule_2d> .",
"role": "user"
},
{
"content": "C11H15NO3",
"role": "assistant"
}
] |
230 | {
"selfies": "[C][C][O][N][=C][Branch1][#Branch2][C][=C][C][=C][C][=C][Ring1][=Branch1][Cl][C][=Ring1][N][C][=Branch1][C][=O][O]",
"smiles": "Cc1onc(-c2ccccc2Cl)c1C(=O)O"
} | C11H8ClNO3 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Convert the representation of a molecule <molecule_2d> into molecular formula.",
"role": "user"
},
{
"content": "C11H8ClNO3",
"role": "assistant"
}
] |
231 | {
"selfies": "[O][=C][C][C][C][=Branch1][C][=O][N][Ring1][=Branch1][C][=C][C][Branch1][C][Cl][=C][C][Branch1][C][Cl][=C][Ring1][Branch2]",
"smiles": "O=C1CCC(=O)N1c1cc(Cl)cc(Cl)c1"
} | C10H7Cl2NO2 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Given the representation <molecule_2d>, what would be its molecular formula?",
"role": "user"
},
{
"content": "C10H7Cl2NO2",
"role": "assistant"
}
] |
232 | {
"selfies": "[C][C][C][=C][C][=C][C][=C][Ring1][=Branch1][N][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=Branch1][Ring1][=N+1][=N-1][C][=C][C][Ring1][Branch2][=N][S][=Branch1][C][=O][=Branch1][C][=O][C][=C][C][=C][Branch1][C][C][C][=C][Ring1][#Branch1]",
"smiles": "CCc1ccccc1NS(=O)(=O)C1=CC(=[N+]=[N-])C=CC1=NS(=O)(=O)c1ccc(C)cc1"
} | C21H20N4O4S2 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Can you give the molecular molecular formula of <molecule_2d> ?",
"role": "user"
},
{
"content": "C21H20N4O4S2",
"role": "assistant"
}
] |
233 | {
"selfies": "[C][C][C][Branch1][C][C][O][C][=Branch1][C][=O][C][Branch1][C][C][C]",
"smiles": "CCC(C)OC(=O)C(C)C"
} | C8H16O2 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "What is the formula of the molecule <molecule_2d> ?",
"role": "user"
},
{
"content": "C8H16O2",
"role": "assistant"
}
] |
234 | {
"selfies": "[N][#C][C][Branch2][Ring1][Branch1][O][C][O][C][Branch1][Ring1][C][O][C][Branch1][C][O][C][Branch1][C][O][C][Ring1][#Branch2][O][C][=C][C][=C][C][=C][Ring1][=Branch1]",
"smiles": "N#CC(OC1OC(CO)C(O)C(O)C1O)c1ccccc1"
} | C14H17NO6 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "What is the molecular formula of <molecule_2d> ?",
"role": "user"
},
{
"content": "C14H17NO6",
"role": "assistant"
}
] |
235 | {
"selfies": "[C][C][=C][C][C][C][Branch1][C][C][O][C][Ring1][Ring2][C][C][Ring1][#Branch2]",
"smiles": "CC1=CCCC2(C)OC2CC1"
} | C10H16O | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "I'd like to know the molecular formula of <molecule_2d> . Can you tell me?",
"role": "user"
},
{
"content": "C10H16O",
"role": "assistant"
}
] |
236 | {
"selfies": "[C][C][Branch1][C][C][C][C][C][Branch1][C][C][C][C][=C][C][Branch1][C][C][Branch2][Ring1][S][C][C][C][C][Ring1][#Branch1][Branch1][C][C][C][C][C][C][Branch1][C][C][Branch1][C][C][C][Branch1][C][O][C][C][C][Ring1][=C][Ring1][=Branch2][C][C][Ring2][Ring1][=Branch2][C][Ring2][Ring1][=C]",
"smiles": "CC1(C)CCC2(C)CC=C3C(C)(CCC4C3(C)CCC3C(C)(C)C(O)CCC43C)C2C1"
} | C30H50O | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "I'd like to know the molecular formula of <molecule_2d> . Can you tell me?",
"role": "user"
},
{
"content": "C30H50O",
"role": "assistant"
}
] |
237 | {
"selfies": "[C][C][C][C][C][C][C][C][P][=Branch1][C][=O][Branch1][#Branch1][C][C][C][C][C][C][C][C][C][C][C][C][C][C]",
"smiles": "CCCCCCCCP(=O)(CCCCCC)CCCCCCCC"
} | C22H47OP | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Can you tell me the molecular formula of <molecule_2d> ?",
"role": "user"
},
{
"content": "C22H47OP",
"role": "assistant"
}
] |
238 | {
"selfies": "[C][C][=Branch1][Ring2][=C][C][=O][C][C][C][C][Branch1][C][C][C]",
"smiles": "CC(=CC=O)CCCC(C)C"
} | C10H18O | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "I'd like to know the molecular formula of <molecule_2d> . Can you tell me?",
"role": "user"
},
{
"content": "C10H18O",
"role": "assistant"
}
] |
239 | {
"selfies": "[C][C][O][P][Branch1][Ring2][O][C][C][N][C][=N][C][=N][Ring1][Branch1]",
"smiles": "CCOP(OCC)n1cncn1"
} | C6H12N3O2P | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "The representation <molecule_2d> represents a specific molecule. Can you reveal its molecular formula?",
"role": "user"
},
{
"content": "C6H12N3O2P",
"role": "assistant"
}
] |
240 | {
"selfies": "[C][C][Branch1][C][C][=C][C][#N]",
"smiles": "CC(C)=CC#N"
} | C5H7N | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Given the representation <molecule_2d>, what would be its molecular formula?",
"role": "user"
},
{
"content": "C5H7N",
"role": "assistant"
}
] |
241 | {
"selfies": "[C][C][C][Branch2][Ring1][=C][C][O][P][Branch1][C][C][=Branch1][C][=O][O][C][C][Branch1][Ring1][C][C][C][O][P][Branch1][C][C][=Branch1][C][=O][O][C][Ring1][#Branch2][C][O][P][Branch1][C][C][=Branch1][C][=O][O][C][Ring2][Ring1][=Branch2]",
"smiles": "CCC1(COP(C)(=O)OCC2(CC)COP(C)(=O)OC2)COP(C)(=O)OC1"
} | C15H31O9P3 | [
{
"content": "You are a chemist. Please follow the instructions to convert the structure to the corresponding name.",
"role": "system"
},
{
"content": "Please provide the molecular formula for <molecule_2d> .",
"role": "user"
},
{
"content": "C15H31O9P3",
"role": "assistant"
}
] |