Spaces:
Running
Running
yzhang@u.duke.nus.edu commited on
Commit ·
4868d91
1
Parent(s): 432a60b
add sequence 2 smiles feature
Browse files- aminoacid_selective.py +557 -0
- app.py +412 -36
aminoacid_selective.py
ADDED
|
@@ -0,0 +1,557 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
#!/usr/bin/env python
|
| 2 |
+
"""Definitions and properties of amino-acids for p2smi"""
|
| 3 |
+
|
| 4 |
+
# Natural Amino-acids:
|
| 5 |
+
|
| 6 |
+
specific_aminos = {
|
| 7 |
+
"Fmoc-Aib-OH": {
|
| 8 |
+
"Code": "Aib",
|
| 9 |
+
"Formula": "C28H29NO5",
|
| 10 |
+
"Letter": "Ŷ",
|
| 11 |
+
"MolWeight": 221.141578848,
|
| 12 |
+
"SMILES": "CC(C)(N)C(=O)O",
|
| 13 |
+
"cterm": "NC(C)(C)C(=O)[*:2]",
|
| 14 |
+
"disulphide": False,
|
| 15 |
+
"ester": False,
|
| 16 |
+
"nterm": "[*:1]NC(C)(C)C(=O)O",
|
| 17 |
+
},
|
| 18 |
+
"Fmoc-Asp(OtBu)-(Dmb)Gly-OH": {
|
| 19 |
+
"Code": "Dtg",
|
| 20 |
+
"Formula": "C28H29NO5",
|
| 21 |
+
"Letter": "Ĝ",
|
| 22 |
+
"MolWeight": 221.141578848,
|
| 23 |
+
"SMILES": "N[C@@H](CC(=O)OC(C)(C)C)C(=O)N(CC1=C(C=C(C=C1)OC)OC)CC(=O)O",
|
| 24 |
+
"nterm": "[*:1]N[C@@H](CC(=O)OC(C)(C)C)C(=O)N(CC1=C(C=C(C=C1)OC)OC)CC(=O)O",
|
| 25 |
+
"cterm": "N[C@@H](CC(=O)OC(C)(C)C)C(=O)N(CC1=C(C=C(C=C1)OC)OC)CC(=O)[*:2]",
|
| 26 |
+
"disulphide": False,
|
| 27 |
+
"ester": False,
|
| 28 |
+
},
|
| 29 |
+
"Fmoc-Cys(Mmt)-OH": {
|
| 30 |
+
"Code": "Cmt",
|
| 31 |
+
"Formula": "C28H29NO5",
|
| 32 |
+
"Letter": "Ĉ",
|
| 33 |
+
"MolWeight": 221.141578848,
|
| 34 |
+
"SMILES": "COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=CC=C3)SC[C@@H](N)C(=O)O",
|
| 35 |
+
"nterm": "N([*:1])[C@@H](CSC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=C(OC)C=C3)C(=O)O",
|
| 36 |
+
"cterm": "N[C@@H](CSC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=C(OC)C=C3)C(=O)[*:2]",
|
| 37 |
+
"disulphide": False,
|
| 38 |
+
"ester": False,
|
| 39 |
+
},
|
| 40 |
+
"Fmoc-Glu(OAll)-OH": {
|
| 41 |
+
"Code": "Eal",
|
| 42 |
+
"Formula": "C28H29NO5",
|
| 43 |
+
"Letter": "Ė",
|
| 44 |
+
"MolWeight": 221.141578848,
|
| 45 |
+
"SMILES": "C=CCOC(=O)CC[C@@H](N)C(=O)O",
|
| 46 |
+
"nterm": "[*:1]N[C@@H](CCC(=O)OCC=C)C(=O)O",
|
| 47 |
+
"cterm": "N[C@@H](CCC(=O)OCC=C)C(=O)[*:2]",
|
| 48 |
+
"disulphide": False,
|
| 49 |
+
"ester": False,
|
| 50 |
+
},
|
| 51 |
+
"Fmoc-Lys(palmitoyl-Glu-OtBu)-OH": {
|
| 52 |
+
"Code": "Kpg",
|
| 53 |
+
"Formula": "C28H29NO5",
|
| 54 |
+
"Letter": "Ƙ",
|
| 55 |
+
"MolWeight": 221.141578848,
|
| 56 |
+
"SMILES": "N[C@@H](CCCNC(=O)CCC[C@@H](NC(=O)CCCCCCCCCCCCCCCC)C(=O)OC(C)(C)C)C(=O)O",
|
| 57 |
+
"nterm": "[*:1]N[C@@H](CCCN(C(=O)CCC[C@@H](NC(=O)CCCCCCCCCCCCCCCC)C(=O)OC(C)(C)C))C(=O)O",
|
| 58 |
+
"cterm": "N[C@@H](CCCN(C(=O)CCC[C@@H](NC(=O)CCCCCCCCCCCCCCCC)C(=O)OC(C)(C)C))C(=O)[*:2]",
|
| 59 |
+
"disulphide": False,
|
| 60 |
+
"ester": False,
|
| 61 |
+
},
|
| 62 |
+
"Fmoc-Thr(PO(OBzl)OH)-OH": {
|
| 63 |
+
"Code": "Tpb",
|
| 64 |
+
"Formula": "C28H29NO5",
|
| 65 |
+
"Letter": "Ṯ",
|
| 66 |
+
"MolWeight": 221.141578848,
|
| 67 |
+
"SMILES": "N[C@@H]([C@H](C)OP(=O)(O)OCc1ccccc1)C(=O)O",
|
| 68 |
+
"disulphide": False,
|
| 69 |
+
"ester": False,
|
| 70 |
+
"nterm": "[*:1]N[C@@H]([C@H](C)OP(=O)(O)OCC1=CC=CC=C1)C(=O)O",
|
| 71 |
+
"cterm": "N[C@@H]([C@H](C)OP(=O)(O)OCC1=CC=CC=C1)C(=O)[*:2]"
|
| 72 |
+
},
|
| 73 |
+
"Fmoc-Cycloleucine": {
|
| 74 |
+
"Code": "Cyl",
|
| 75 |
+
"Formula": "C28H29NO5",
|
| 76 |
+
"Letter": "Ċ",
|
| 77 |
+
"MolWeight": 221.141578848,
|
| 78 |
+
"SMILES": "NC1(CCCC1)C(=O)O",
|
| 79 |
+
"nterm": "[*:1]NC1(CCCC1)C(=O)O",
|
| 80 |
+
"cterm": "NC1(CCCC1)C(=O)[*:2]",
|
| 81 |
+
"disulphide": False,
|
| 82 |
+
"ester": False,
|
| 83 |
+
},
|
| 84 |
+
"Fmoc-N-Me-Ala-OH": {
|
| 85 |
+
"Code": "Nma",
|
| 86 |
+
"Formula": "C28H29NO5",
|
| 87 |
+
"Letter": "Ṃ",
|
| 88 |
+
"MolWeight": 221.141578848,
|
| 89 |
+
"SMILES": "CN([C@@H](C)C(=O)O)",
|
| 90 |
+
"cterm": "N(C)[C@@H](C)C(=O)[*:2]",
|
| 91 |
+
"disulphide": False,
|
| 92 |
+
"ester": False,
|
| 93 |
+
"nterm": "[*:1]N(C)[C@@H](C)C(=O)O",
|
| 94 |
+
},
|
| 95 |
+
"Fmoc-N-Me-Leu-OH": {
|
| 96 |
+
"Code": "Nml",
|
| 97 |
+
"Formula": "C28H29NO5",
|
| 98 |
+
"Letter": "Ŀ",
|
| 99 |
+
"MolWeight": 221.141578848,
|
| 100 |
+
"SMILES": "CN([C@@H](CC(C)C))C(=O)O",
|
| 101 |
+
"cterm": "CN([C@@H](CC(C)C)C(=O))[*:2]",
|
| 102 |
+
"disulphide": False,
|
| 103 |
+
"ester": False,
|
| 104 |
+
"nterm": "[*:1]N(C)[C@@H](CC(C)C)C(=O)O",
|
| 105 |
+
},
|
| 106 |
+
"Fmoc-Nle-OH": {
|
| 107 |
+
"Code": "Nle",
|
| 108 |
+
"Formula": "C28H29NO5",
|
| 109 |
+
"Letter": "Ł",
|
| 110 |
+
"MolWeight": 221.141578848,
|
| 111 |
+
"SMILES": "N[C@@H](CCCC)C(=O)O",
|
| 112 |
+
"nterm": "[*:1]N[C@@H](CCCC)C(=O)O",
|
| 113 |
+
"cterm": "N[C@@H](CCCC)C(=O)[*:2]",
|
| 114 |
+
"disulphide": False,
|
| 115 |
+
"ester": False,
|
| 116 |
+
},
|
| 117 |
+
"N-Fmoc-L-homophenylalanine": {
|
| 118 |
+
"Code": "Hph",
|
| 119 |
+
"Formula": "C28H29NO5",
|
| 120 |
+
"Letter": "Ĥ",
|
| 121 |
+
"MolWeight": 221.141578848,
|
| 122 |
+
"SMILES": "N[C@@H](CCC1=CC=CC=C1)C(=O)O",
|
| 123 |
+
"nterm": "[*:1]N[C@@H](CCC1=CC=CC=C1)C(=O)O",
|
| 124 |
+
"cterm": "N[C@@H](CCC1=CC=CC=C1)C(=O)[*:2]",
|
| 125 |
+
"disulphide": False,
|
| 126 |
+
"ester": False,
|
| 127 |
+
},
|
| 128 |
+
"Glycine": {
|
| 129 |
+
"Code": "Gly",
|
| 130 |
+
"Formula": "C2H5NO2",
|
| 131 |
+
"Letter": "G",
|
| 132 |
+
"MolWeight": "75.07",
|
| 133 |
+
"SMILES": "NCC(=O)O",
|
| 134 |
+
"cterm": False,
|
| 135 |
+
"disulphide": False,
|
| 136 |
+
"ester": False,
|
| 137 |
+
"nterm": False,
|
| 138 |
+
},
|
| 139 |
+
"L-Alanine": {
|
| 140 |
+
"Code": "Ala",
|
| 141 |
+
"Formula": "C3H7NO2",
|
| 142 |
+
"Letter": "A",
|
| 143 |
+
"MolWeight": "89.09",
|
| 144 |
+
"SMILES": "N[C@@H](C)C(=O)O",
|
| 145 |
+
"cterm": False,
|
| 146 |
+
"disulphide": False,
|
| 147 |
+
"ester": False,
|
| 148 |
+
"nterm": False,
|
| 149 |
+
},
|
| 150 |
+
"L-Arginine": {
|
| 151 |
+
"Code": "Arg",
|
| 152 |
+
"Formula": "C6H14N4O2",
|
| 153 |
+
"Letter": "R",
|
| 154 |
+
"MolWeight": "174.20",
|
| 155 |
+
"SMILES": "N[C@@H](CCCNC(=N)N)C(=O)O",
|
| 156 |
+
"cterm": False,
|
| 157 |
+
"disulphide": False,
|
| 158 |
+
"ester": False,
|
| 159 |
+
"nterm": "N[C@@H](CCCNC(=N*)N)C(=O)O",
|
| 160 |
+
},
|
| 161 |
+
"L-Asparagine": {
|
| 162 |
+
"Code": "Asn",
|
| 163 |
+
"Formula": "C4H8N2O3",
|
| 164 |
+
"Letter": "N",
|
| 165 |
+
"MolWeight": "132.12",
|
| 166 |
+
"SMILES": "N[C@@H](CC(=O)N)C(=O)O",
|
| 167 |
+
"cterm": False,
|
| 168 |
+
"disulphide": False,
|
| 169 |
+
"ester": False,
|
| 170 |
+
"nterm": "N[C@@H](CC(=O)N*)C(=O)O",
|
| 171 |
+
},
|
| 172 |
+
"L-Aspartic_Acid": {
|
| 173 |
+
"Code": "Asp",
|
| 174 |
+
"Formula": "C4H7NO4",
|
| 175 |
+
"Letter": "D",
|
| 176 |
+
"MolWeight": "133.10",
|
| 177 |
+
"SMILES": "N[C@@H](CC(=O)O)C(=O)O",
|
| 178 |
+
"cterm": "N[C@@H](CC*(=O))C(=O)O",
|
| 179 |
+
"disulphide": False,
|
| 180 |
+
"ester": False,
|
| 181 |
+
"nterm": False,
|
| 182 |
+
},
|
| 183 |
+
"L-Cysteine": {
|
| 184 |
+
"Code": "Cys",
|
| 185 |
+
"Formula": "C3H7NO2S",
|
| 186 |
+
"Letter": "C",
|
| 187 |
+
"MolWeight": "121.16",
|
| 188 |
+
"SMILES": "N[C@@H](CS)C(=O)O",
|
| 189 |
+
"cterm": False,
|
| 190 |
+
"disulphide": "N[C@@H](CS*)C(=O)O",
|
| 191 |
+
"ester": False,
|
| 192 |
+
"nterm": False,
|
| 193 |
+
},
|
| 194 |
+
"L-Glutamic_Acid": {
|
| 195 |
+
"Code": "Glu",
|
| 196 |
+
"Formula": "C5H9NO4",
|
| 197 |
+
"Letter": "E",
|
| 198 |
+
"MolWeight": "147.13",
|
| 199 |
+
"SMILES": "N[C@@H](CCC(=O)O)C(=O)O",
|
| 200 |
+
"cterm": "N[C@@H](CCC*(=O))C(=O)O",
|
| 201 |
+
"disulphide": False,
|
| 202 |
+
"ester": False,
|
| 203 |
+
"nterm": False,
|
| 204 |
+
},
|
| 205 |
+
"L-Glutamine": {
|
| 206 |
+
"Code": "Gln",
|
| 207 |
+
"Formula": "C5H10N2O3",
|
| 208 |
+
"Letter": "Q",
|
| 209 |
+
"MolWeight": "146.15",
|
| 210 |
+
"SMILES": "N[C@@H](CCC(=O)N)C(=O)O",
|
| 211 |
+
"cterm": False,
|
| 212 |
+
"disulphide": False,
|
| 213 |
+
"ester": False,
|
| 214 |
+
"nterm": "N[C@@H](CCC(=O)N*)C(=O)O",
|
| 215 |
+
},
|
| 216 |
+
"L-Histidine": {
|
| 217 |
+
"Code": "His",
|
| 218 |
+
"Formula": "C6H9N3O2",
|
| 219 |
+
"Letter": "H",
|
| 220 |
+
"MolWeight": "155.16",
|
| 221 |
+
"SMILES": "N[C@@H](CC1=CNC=N1)C(=O)O",
|
| 222 |
+
"cterm": False,
|
| 223 |
+
"disulphide": False,
|
| 224 |
+
"ester": False,
|
| 225 |
+
"nterm": False,
|
| 226 |
+
},
|
| 227 |
+
"L-Isoleucine": {
|
| 228 |
+
"Code": "Ile",
|
| 229 |
+
"Formula": "C6H13NO2",
|
| 230 |
+
"Letter": "I",
|
| 231 |
+
"MolWeight": "131.18",
|
| 232 |
+
"SMILES": "N[C@@H]([C@H](CC)C)C(=O)O",
|
| 233 |
+
"cterm": False,
|
| 234 |
+
"disulphide": False,
|
| 235 |
+
"ester": False,
|
| 236 |
+
"nterm": False,
|
| 237 |
+
},
|
| 238 |
+
"L-Leucine": {
|
| 239 |
+
"Code": "Leu",
|
| 240 |
+
"Formula": "C6H13NO2",
|
| 241 |
+
"Letter": "L",
|
| 242 |
+
"MolWeight": "131.18",
|
| 243 |
+
"SMILES": "N[C@@H](CC(C)C)C(=O)O",
|
| 244 |
+
"cterm": False,
|
| 245 |
+
"disulphide": False,
|
| 246 |
+
"ester": False,
|
| 247 |
+
"nterm": False,
|
| 248 |
+
},
|
| 249 |
+
"L-Lysine": {
|
| 250 |
+
"Code": "Lys",
|
| 251 |
+
"Formula": "C6H12N2O2",
|
| 252 |
+
"Letter": "K",
|
| 253 |
+
"MolWeight": "146.19",
|
| 254 |
+
"SMILES": "N[C@@H](CCCCN)C(=O)O",
|
| 255 |
+
"cterm": False,
|
| 256 |
+
"disulphide": False,
|
| 257 |
+
"ester": False,
|
| 258 |
+
"nterm": "N[C@@H](CCCCN*)C(=O)O",
|
| 259 |
+
},
|
| 260 |
+
"L-Methionine": {
|
| 261 |
+
"Code": "Met",
|
| 262 |
+
"Formula": "C5H11NO2S",
|
| 263 |
+
"Letter": "M",
|
| 264 |
+
"MolWeight": "149.21",
|
| 265 |
+
"SMILES": "N[C@@H](CCSC)C(=O)O",
|
| 266 |
+
"cterm": False,
|
| 267 |
+
"disulphide": False,
|
| 268 |
+
"ester": False,
|
| 269 |
+
"nterm": False,
|
| 270 |
+
},
|
| 271 |
+
"L-Phenylalanine": {
|
| 272 |
+
"Code": "Phe",
|
| 273 |
+
"Formula": "C9H11NO2",
|
| 274 |
+
"Letter": "F",
|
| 275 |
+
"MolWeight": "165.19",
|
| 276 |
+
"SMILES": "N[C@@H](Cc1ccccc1)C(=O)O",
|
| 277 |
+
"cterm": False,
|
| 278 |
+
"disulphide": False,
|
| 279 |
+
"ester": False,
|
| 280 |
+
"nterm": False,
|
| 281 |
+
},
|
| 282 |
+
"L-Proline": {
|
| 283 |
+
"Code": "Pro",
|
| 284 |
+
"Formula": "C5H9NO2",
|
| 285 |
+
"Letter": "P",
|
| 286 |
+
"MolWeight": "115.13",
|
| 287 |
+
"SMILES": "N1[C@@H](CCC1)C(=O)O",
|
| 288 |
+
"cterm": False,
|
| 289 |
+
"disulphide": False,
|
| 290 |
+
"ester": False,
|
| 291 |
+
"nterm": False,
|
| 292 |
+
},
|
| 293 |
+
"L-Serine": {
|
| 294 |
+
"Code": "Ser",
|
| 295 |
+
"Formula": "C3H7NO2",
|
| 296 |
+
"Letter": "S",
|
| 297 |
+
"MolWeight": "105.09",
|
| 298 |
+
"SMILES": "N[C@@H](CO)C(=O)O",
|
| 299 |
+
"cterm": False,
|
| 300 |
+
"disulphide": False,
|
| 301 |
+
"ester": "N[C@@H](CO*)C(=O)O",
|
| 302 |
+
"nterm": False,
|
| 303 |
+
},
|
| 304 |
+
"L-Threonine": {
|
| 305 |
+
"Code": "Thr",
|
| 306 |
+
"Formula": "C4H9NO3",
|
| 307 |
+
"Letter": "T",
|
| 308 |
+
"MolWeight": "119.12",
|
| 309 |
+
"SMILES": "N[C@@H]([C@H](O)C)C(=O)O",
|
| 310 |
+
"cterm": False,
|
| 311 |
+
"disulphide": False,
|
| 312 |
+
"ester": "N[C@@H]([C@H](O*)C)C(=O)O",
|
| 313 |
+
"nterm": False,
|
| 314 |
+
},
|
| 315 |
+
"L-Tryptophan": {
|
| 316 |
+
"Code": "Trp",
|
| 317 |
+
"Formula": "C11H12N2O2",
|
| 318 |
+
"Letter": "W",
|
| 319 |
+
"MolWeight": "204.23",
|
| 320 |
+
"SMILES": "N[C@@H](CC(=CN2)C1=C2C=CC=C1)C(=O)O",
|
| 321 |
+
"cterm": False,
|
| 322 |
+
"disulphide": False,
|
| 323 |
+
"ester": False,
|
| 324 |
+
"nterm": False,
|
| 325 |
+
},
|
| 326 |
+
"L-Tyrosine": {
|
| 327 |
+
"Code": "Tyr",
|
| 328 |
+
"Formula": "C9H11NO3",
|
| 329 |
+
"Letter": "Y",
|
| 330 |
+
"MolWeight": "181.19",
|
| 331 |
+
"SMILES": "N[C@@H](Cc1ccc(O)cc1)C(=O)O",
|
| 332 |
+
"cterm": False,
|
| 333 |
+
"disulphide": False,
|
| 334 |
+
"ester": "N[C@@H](Cc1ccc(O*)cc1)C(=O)O",
|
| 335 |
+
"nterm": False,
|
| 336 |
+
},
|
| 337 |
+
"L-Valine": {
|
| 338 |
+
"Code": "Val",
|
| 339 |
+
"Formula": "C5H11NO2",
|
| 340 |
+
"Letter": "V",
|
| 341 |
+
"MolWeight": "117.15",
|
| 342 |
+
"SMILES": "N[C@@H](C(C)C)C(=O)O",
|
| 343 |
+
"cterm": False,
|
| 344 |
+
"disulphide": False,
|
| 345 |
+
"ester": False,
|
| 346 |
+
"nterm": False,
|
| 347 |
+
},
|
| 348 |
+
"D-Alanine": {
|
| 349 |
+
"Code": "ala",
|
| 350 |
+
"Formula": "C3H7NO2",
|
| 351 |
+
"Letter": "a",
|
| 352 |
+
"MolWeight": "89.09",
|
| 353 |
+
"SMILES": "N[C@H](C)C(=O)O",
|
| 354 |
+
"cterm": False,
|
| 355 |
+
"disulphide": False,
|
| 356 |
+
"ester": False,
|
| 357 |
+
"nterm": False,
|
| 358 |
+
},
|
| 359 |
+
"D-Arginine": {
|
| 360 |
+
"Code": "arg",
|
| 361 |
+
"Formula": "C6H14N4O2",
|
| 362 |
+
"Letter": "r",
|
| 363 |
+
"MolWeight": "174.20",
|
| 364 |
+
"SMILES": "N[C@H](CCCNC(=N)N)C(=O)O",
|
| 365 |
+
"cterm": False,
|
| 366 |
+
"disulphide": False,
|
| 367 |
+
"ester": False,
|
| 368 |
+
"nterm": "N[C@H](CCCNC(=N*)N)C(=O)O",
|
| 369 |
+
},
|
| 370 |
+
"D-Asparagine": {
|
| 371 |
+
"Code": "asn",
|
| 372 |
+
"Formula": "C4H8N2O3",
|
| 373 |
+
"Letter": "n",
|
| 374 |
+
"MolWeight": "132.12",
|
| 375 |
+
"SMILES": "N[C@H](CC(=O)N)C(=O)O",
|
| 376 |
+
"cterm": False,
|
| 377 |
+
"disulphide": False,
|
| 378 |
+
"ester": False,
|
| 379 |
+
"nterm": "N[C@H](CC(=O)N*)C(=O)O",
|
| 380 |
+
},
|
| 381 |
+
"D-Aspartic_Acid": {
|
| 382 |
+
"Code": "asp",
|
| 383 |
+
"Formula": "C4H7NO4",
|
| 384 |
+
"Letter": "d",
|
| 385 |
+
"MolWeight": "133.10",
|
| 386 |
+
"SMILES": "N[C@H](CC(=O)O)C(=O)O",
|
| 387 |
+
"cterm": "N[C@H](CC*(=O))C(=O)O",
|
| 388 |
+
"disulphide": False,
|
| 389 |
+
"ester": False,
|
| 390 |
+
"nterm": False,
|
| 391 |
+
},
|
| 392 |
+
"D-Cysteine": {
|
| 393 |
+
"Code": "cys",
|
| 394 |
+
"Formula": "C3H7NO2S",
|
| 395 |
+
"Letter": "c",
|
| 396 |
+
"MolWeight": "121.16",
|
| 397 |
+
"SMILES": "N[C@H](CS)C(=O)O",
|
| 398 |
+
"cterm": False,
|
| 399 |
+
"disulphide": "N[C@H](CS*)C(=O)O",
|
| 400 |
+
"ester": False,
|
| 401 |
+
"nterm": False,
|
| 402 |
+
},
|
| 403 |
+
"D-Glutamic_Acid": {
|
| 404 |
+
"Code": "glu",
|
| 405 |
+
"Formula": "C5H9NO4",
|
| 406 |
+
"Letter": "e",
|
| 407 |
+
"MolWeight": "147.13",
|
| 408 |
+
"SMILES": "N[C@H](CCC(=O)O)C(=O)O",
|
| 409 |
+
"cterm": "N[C@H](CCC*(=O))C(=O)O",
|
| 410 |
+
"disulphide": False,
|
| 411 |
+
"ester": False,
|
| 412 |
+
"nterm": False,
|
| 413 |
+
},
|
| 414 |
+
"D-Glutamine": {
|
| 415 |
+
"Code": "gln",
|
| 416 |
+
"Formula": "C5H10N2O3",
|
| 417 |
+
"Letter": "q",
|
| 418 |
+
"MolWeight": "146.15",
|
| 419 |
+
"SMILES": "N[C@H](CCC(=O)N)C(=O)O",
|
| 420 |
+
"cterm": False,
|
| 421 |
+
"disulphide": False,
|
| 422 |
+
"ester": False,
|
| 423 |
+
"nterm": "N[C@H](CCC(=O)N*)C(=O)O",
|
| 424 |
+
},
|
| 425 |
+
"D-Histidine": {
|
| 426 |
+
"Code": "his",
|
| 427 |
+
"Formula": "C6H9N3O2",
|
| 428 |
+
"Letter": "h",
|
| 429 |
+
"MolWeight": "155.16",
|
| 430 |
+
"SMILES": "N[C@H](CC1=CNC=N1)C(=O)O",
|
| 431 |
+
"cterm": False,
|
| 432 |
+
"disulphide": False,
|
| 433 |
+
"ester": False,
|
| 434 |
+
"nterm": False,
|
| 435 |
+
},
|
| 436 |
+
"D-Isoleucine": {
|
| 437 |
+
"Code": "ile",
|
| 438 |
+
"Formula": "C6H13NO2",
|
| 439 |
+
"Letter": "i",
|
| 440 |
+
"MolWeight": "131.18",
|
| 441 |
+
"SMILES": "N[C@H]([C@@H](CC)C)C(=O)O",
|
| 442 |
+
"cterm": False,
|
| 443 |
+
"disulphide": False,
|
| 444 |
+
"ester": False,
|
| 445 |
+
"nterm": False,
|
| 446 |
+
},
|
| 447 |
+
"D-Leucine": {
|
| 448 |
+
"Code": "leu",
|
| 449 |
+
"Formula": "C6H13NO2",
|
| 450 |
+
"Letter": "l",
|
| 451 |
+
"MolWeight": "131.18",
|
| 452 |
+
"SMILES": "N[C@H](CC(C)C)C(=O)O",
|
| 453 |
+
"cterm": False,
|
| 454 |
+
"disulphide": False,
|
| 455 |
+
"ester": False,
|
| 456 |
+
"nterm": False,
|
| 457 |
+
},
|
| 458 |
+
"D-Lysine": {
|
| 459 |
+
"Code": "lys",
|
| 460 |
+
"Formula": "C6H12N2O2",
|
| 461 |
+
"Letter": "k",
|
| 462 |
+
"MolWeight": "146.19",
|
| 463 |
+
"SMILES": "N[C@H](CCCCN)C(=O)O",
|
| 464 |
+
"cterm": False,
|
| 465 |
+
"disulphide": False,
|
| 466 |
+
"ester": False,
|
| 467 |
+
"nterm": "N[C@H](CCCCN*)C(=O)O",
|
| 468 |
+
},
|
| 469 |
+
"D-Methionine": {
|
| 470 |
+
"Code": "met",
|
| 471 |
+
"Formula": "C5H11NO2S",
|
| 472 |
+
"Letter": "m",
|
| 473 |
+
"MolWeight": "149.21",
|
| 474 |
+
"SMILES": "N[C@H](CCSC)C(=O)O",
|
| 475 |
+
"cterm": False,
|
| 476 |
+
"disulphide": False,
|
| 477 |
+
"ester": False,
|
| 478 |
+
"nterm": False,
|
| 479 |
+
},
|
| 480 |
+
"D-Phenylalanine": {
|
| 481 |
+
"Code": "phe",
|
| 482 |
+
"Formula": "C9H11NO2",
|
| 483 |
+
"Letter": "f",
|
| 484 |
+
"MolWeight": "165.19",
|
| 485 |
+
"SMILES": "N[C@H](Cc1ccccc1)C(=O)O",
|
| 486 |
+
"cterm": False,
|
| 487 |
+
"disulphide": False,
|
| 488 |
+
"ester": False,
|
| 489 |
+
"nterm": False,
|
| 490 |
+
},
|
| 491 |
+
"D-Proline": {
|
| 492 |
+
"Code": "pro",
|
| 493 |
+
"Formula": "C5H9NO2",
|
| 494 |
+
"Letter": "p",
|
| 495 |
+
"MolWeight": "115.13",
|
| 496 |
+
"SMILES": "N1[C@H](CCC1)C(=O)O",
|
| 497 |
+
"cterm": False,
|
| 498 |
+
"disulphide": False,
|
| 499 |
+
"ester": False,
|
| 500 |
+
"nterm": False,
|
| 501 |
+
},
|
| 502 |
+
"D-Serine": {
|
| 503 |
+
"Code": "ser",
|
| 504 |
+
"Formula": "C3H7NO2",
|
| 505 |
+
"Letter": "s",
|
| 506 |
+
"MolWeight": "105.09",
|
| 507 |
+
"SMILES": "N[C@H](CO)C(=O)O",
|
| 508 |
+
"cterm": False,
|
| 509 |
+
"disulphide": False,
|
| 510 |
+
"ester": "N[C@H](CO*)C(=O)O",
|
| 511 |
+
"nterm": False,
|
| 512 |
+
},
|
| 513 |
+
"D-Tryptophan": {
|
| 514 |
+
"Code": "trp",
|
| 515 |
+
"Formula": "C11H12N2O2",
|
| 516 |
+
"Letter": "w",
|
| 517 |
+
"MolWeight": "204.23",
|
| 518 |
+
"SMILES": "N[C@H](CC(=CN2)C1=C2C=CC=C1)C(=O)O",
|
| 519 |
+
"cterm": False,
|
| 520 |
+
"disulphide": False,
|
| 521 |
+
"ester": False,
|
| 522 |
+
"nterm": False,
|
| 523 |
+
},
|
| 524 |
+
"D-Tyrosine": {
|
| 525 |
+
"Code": "tyr",
|
| 526 |
+
"Formula": "C9H11NO3",
|
| 527 |
+
"Letter": "y",
|
| 528 |
+
"MolWeight": "181.19",
|
| 529 |
+
"SMILES": "N[C@H](Cc1ccc(O)cc1)C(=O)O",
|
| 530 |
+
"cterm": False,
|
| 531 |
+
"disulphide": False,
|
| 532 |
+
"ester": "N[C@H](Cc1ccc(O*)cc1)C(=O)O",
|
| 533 |
+
"nterm": False,
|
| 534 |
+
},
|
| 535 |
+
"D-Valine": {
|
| 536 |
+
"Code": "val",
|
| 537 |
+
"Formula": "C5H11NO2",
|
| 538 |
+
"Letter": "v",
|
| 539 |
+
"MolWeight": "117.15",
|
| 540 |
+
"SMILES": "N[C@H](C(C)C)C(=O)O",
|
| 541 |
+
"cterm": False,
|
| 542 |
+
"disulphide": False,
|
| 543 |
+
"ester": False,
|
| 544 |
+
"nterm": False,
|
| 545 |
+
},
|
| 546 |
+
"D-Threonine": {
|
| 547 |
+
"Code": "thr",
|
| 548 |
+
"Formula": "C4H9NO3",
|
| 549 |
+
"Letter": "t",
|
| 550 |
+
"MolWeight": "119.12",
|
| 551 |
+
"SMILES": "N[C@H]([C@@H](O)C)C(=O)O",
|
| 552 |
+
"cterm": False,
|
| 553 |
+
"disulphide": False,
|
| 554 |
+
"ester": "N[C@H]([C@@H](O*)C)C(=O)O",
|
| 555 |
+
"nterm": False,
|
| 556 |
+
},
|
| 557 |
+
}
|
app.py
CHANGED
|
@@ -24,6 +24,39 @@ from io import BytesIO
|
|
| 24 |
import tempfile
|
| 25 |
from rdkit import Chem
|
| 26 |
from swisssidechain import all_aminos
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 27 |
|
| 28 |
class PeptideAnalyzer:
|
| 29 |
def __init__(self):
|
|
@@ -71,27 +104,40 @@ class PeptideAnalyzer:
|
|
| 71 |
self._build_swisssidechain_lookups()
|
| 72 |
|
| 73 |
def _build_swisssidechain_lookups(self):
|
| 74 |
-
"""Side chain lookups for SwissSidechain UAAs"""
|
| 75 |
-
# Exact SMILES match
|
| 76 |
self.exact_smiles_lookup = {}
|
| 77 |
-
|
| 78 |
-
# Clean SMILES lookup (without stereochemistry)
|
| 79 |
self.clean_smiles_lookup = {}
|
| 80 |
-
|
|
|
|
|
|
|
| 81 |
for uaa_name, uaa_data in all_aminos.items():
|
| 82 |
-
code
|
| 83 |
-
|
| 84 |
-
|
| 85 |
-
|
| 86 |
-
|
| 87 |
-
|
| 88 |
-
|
| 89 |
-
|
| 90 |
-
|
| 91 |
-
|
| 92 |
-
|
| 93 |
-
|
| 94 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 95 |
|
| 96 |
def _remove_stereochemistry(self, smiles):
|
| 97 |
"""Remove stereochemistry from SMILES"""
|
|
@@ -106,52 +152,61 @@ class PeptideAnalyzer:
|
|
| 106 |
return cleaned
|
| 107 |
|
| 108 |
def preprocess_complex_residues(self, smiles):
|
| 109 |
-
"""Identify and protect complex residues with internal peptide bonds - improved to prevent overlaps"""
|
| 110 |
complex_positions = []
|
| 111 |
-
|
| 112 |
for pattern, residue_type in self.complex_residue_patterns:
|
| 113 |
for match in re.finditer(pattern, smiles):
|
| 114 |
if not any(pos['start'] <= match.start() < pos['end'] or
|
| 115 |
-
|
| 116 |
complex_positions.append({
|
| 117 |
'start': match.start(),
|
| 118 |
'end': match.end(),
|
| 119 |
'type': residue_type,
|
| 120 |
'pattern': match.group()
|
| 121 |
})
|
| 122 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 123 |
complex_positions.sort(key=lambda x: x['start'])
|
| 124 |
-
|
| 125 |
if not complex_positions:
|
| 126 |
return smiles, []
|
| 127 |
-
|
| 128 |
preprocessed_smiles = smiles
|
| 129 |
offset = 0
|
| 130 |
-
|
| 131 |
protected_residues = []
|
| 132 |
-
|
| 133 |
for pos in complex_positions:
|
| 134 |
start = pos['start'] + offset
|
| 135 |
-
end
|
| 136 |
-
|
| 137 |
complex_part = preprocessed_smiles[start:end]
|
| 138 |
-
|
|
|
|
| 139 |
if not ('[C@H]' in complex_part or '[C@@H]' in complex_part):
|
| 140 |
-
|
| 141 |
-
|
|
|
|
|
|
|
| 142 |
placeholder = f"COMPLEX_RESIDUE_{len(protected_residues)}"
|
| 143 |
-
|
| 144 |
preprocessed_smiles = preprocessed_smiles[:start] + placeholder + preprocessed_smiles[end:]
|
| 145 |
-
|
| 146 |
offset += len(placeholder) - (end - start)
|
| 147 |
-
|
| 148 |
protected_residues.append({
|
| 149 |
'placeholder': placeholder,
|
| 150 |
'type': pos['type'],
|
| 151 |
'content': complex_part
|
| 152 |
})
|
| 153 |
-
|
| 154 |
return preprocessed_smiles, protected_residues
|
|
|
|
| 155 |
def split_on_bonds(self, smiles, protected_residues=None):
|
| 156 |
"""Split SMILES into segments based on peptide bonds, with improved handling of protected residues"""
|
| 157 |
positions = []
|
|
@@ -310,7 +365,11 @@ class PeptideAnalyzer:
|
|
| 310 |
def identify_residue(self, segment):
|
| 311 |
if 'complex_type' in segment:
|
| 312 |
return segment['complex_type'], []
|
| 313 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
| 314 |
content = self.clean_terminal_carboxyl(segment)
|
| 315 |
mods = self.get_modifications(segment)
|
| 316 |
|
|
@@ -901,6 +960,175 @@ class PeptideStructureGenerator:
|
|
| 901 |
|
| 902 |
return sio.getvalue().encode('utf-8')
|
| 903 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 904 |
def process_input(
|
| 905 |
smiles_input=None,
|
| 906 |
file_obj=None,
|
|
@@ -1045,6 +1273,153 @@ def process_input(
|
|
| 1045 |
#structure_files if structure_files else []
|
| 1046 |
)
|
| 1047 |
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1048 |
iface = gr.Interface(
|
| 1049 |
fn=process_input,
|
| 1050 |
inputs=[
|
|
@@ -1105,6 +1480,7 @@ iface = gr.Interface(
|
|
| 1105 |
if __name__ == "__main__":
|
| 1106 |
iface.launch(share=True)
|
| 1107 |
|
|
|
|
| 1108 |
"""
|
| 1109 |
5. Optional linear representation
|
| 1110 |
6. Optional 3D structure generation (ETKDG and UFF methods)
|
|
|
|
| 24 |
import tempfile
|
| 25 |
from rdkit import Chem
|
| 26 |
from swisssidechain import all_aminos
|
| 27 |
+
from aminoacid_selective import specific_aminos
|
| 28 |
+
|
| 29 |
+
def _internal_from_cterm(cterm: str) -> str:
|
| 30 |
+
s = cterm.strip()
|
| 31 |
+
s = re.sub(r'C\(=O\)\[\*:\s*2\]\s*$', '', s) # drop trailing carbonyl anchor
|
| 32 |
+
s = re.sub(r'^\[\*:\s*1\]', '', s) # drop leading anchor
|
| 33 |
+
s = re.sub(r'^\(?N\)?', '', s) # drop leading N
|
| 34 |
+
return s
|
| 35 |
+
|
| 36 |
+
def _internal_from_nterm(nterm: str) -> str:
|
| 37 |
+
s = nterm.strip()
|
| 38 |
+
s = re.sub(r'^\[\*:\s*1\]', '', s) # drop leading anchor
|
| 39 |
+
s = re.sub(r'^\(?N\)?', '', s) # drop leading N
|
| 40 |
+
s = re.sub(r'C\(=O\)O\s*$', '', s) # drop trailing COOH
|
| 41 |
+
return s
|
| 42 |
+
|
| 43 |
+
def _chirality_agnostic_regex(literal_smiles: str) -> re.Pattern:
|
| 44 |
+
"""
|
| 45 |
+
Make a regex that matches the literal SMILES but ignores stereo/ring digit specifics.
|
| 46 |
+
- Escapes all chars
|
| 47 |
+
- Makes '@' optional (so [C@@H] / [C@H] / [CH] all match)
|
| 48 |
+
- Allows any ring digit where a digit appears
|
| 49 |
+
"""
|
| 50 |
+
esc = re.escape(literal_smiles)
|
| 51 |
+
|
| 52 |
+
# make any '@' optional (two steps to handle @@)
|
| 53 |
+
esc = esc.replace(r'\@\@', r'\@?\@?')
|
| 54 |
+
esc = esc.replace(r'\@', r'\@?')
|
| 55 |
+
|
| 56 |
+
# allow any ring digit(s) where digits appear
|
| 57 |
+
esc = re.sub(r'\\\d+', r'\\d+', esc)
|
| 58 |
+
|
| 59 |
+
return re.compile(esc)
|
| 60 |
|
| 61 |
class PeptideAnalyzer:
|
| 62 |
def __init__(self):
|
|
|
|
| 104 |
self._build_swisssidechain_lookups()
|
| 105 |
|
| 106 |
def _build_swisssidechain_lookups(self):
|
|
|
|
|
|
|
| 107 |
self.exact_smiles_lookup = {}
|
|
|
|
|
|
|
| 108 |
self.clean_smiles_lookup = {}
|
| 109 |
+
self.uaa_internal_exact = {}
|
| 110 |
+
self.uaa_internal_patterns = []
|
| 111 |
+
|
| 112 |
for uaa_name, uaa_data in all_aminos.items():
|
| 113 |
+
code = uaa_data["Code"]
|
| 114 |
+
smiles = uaa_data.get("SMILES", "")
|
| 115 |
+
nterm = uaa_data.get("nterm", "")
|
| 116 |
+
cterm = uaa_data.get("cterm", "")
|
| 117 |
+
letter = uaa_data.get("Letter")
|
| 118 |
+
|
| 119 |
+
# keep existing full-aa lookups
|
| 120 |
+
if smiles:
|
| 121 |
+
self.exact_smiles_lookup[smiles] = code
|
| 122 |
+
clean = self._remove_stereochemistry(smiles)
|
| 123 |
+
self.clean_smiles_lookup.setdefault(clean, []).append(code)
|
| 124 |
+
|
| 125 |
+
internal = ""
|
| 126 |
+
if cterm:
|
| 127 |
+
internal = _internal_from_cterm(cterm)
|
| 128 |
+
elif nterm:
|
| 129 |
+
internal = _internal_from_nterm(nterm)
|
| 130 |
+
|
| 131 |
+
if internal:
|
| 132 |
+
self.exact_smiles_lookup[internal] = code
|
| 133 |
+
clean_int = self._remove_stereochemistry(internal)
|
| 134 |
+
self.clean_smiles_lookup.setdefault(clean_int, []).append(code)
|
| 135 |
+
|
| 136 |
+
self.uaa_internal_exact[code] = internal
|
| 137 |
+
self.uaa_internal_patterns.append((_chirality_agnostic_regex(internal), code))
|
| 138 |
+
|
| 139 |
+
if letter:
|
| 140 |
+
self.three_to_one[code] = letter
|
| 141 |
|
| 142 |
def _remove_stereochemistry(self, smiles):
|
| 143 |
"""Remove stereochemistry from SMILES"""
|
|
|
|
| 152 |
return cleaned
|
| 153 |
|
| 154 |
def preprocess_complex_residues(self, smiles):
|
|
|
|
| 155 |
complex_positions = []
|
| 156 |
+
|
| 157 |
for pattern, residue_type in self.complex_residue_patterns:
|
| 158 |
for match in re.finditer(pattern, smiles):
|
| 159 |
if not any(pos['start'] <= match.start() < pos['end'] or
|
| 160 |
+
pos['start'] < match.end() <= pos['end'] for pos in complex_positions):
|
| 161 |
complex_positions.append({
|
| 162 |
'start': match.start(),
|
| 163 |
'end': match.end(),
|
| 164 |
'type': residue_type,
|
| 165 |
'pattern': match.group()
|
| 166 |
})
|
| 167 |
+
|
| 168 |
+
for rgx, code in getattr(self, 'uaa_internal_patterns', []):
|
| 169 |
+
for match in rgx.finditer(smiles):
|
| 170 |
+
if not any(pos['start'] <= match.start() < pos['end'] or
|
| 171 |
+
pos['start'] < match.end() <= pos['end'] for pos in complex_positions):
|
| 172 |
+
complex_positions.append({
|
| 173 |
+
'start': match.start(),
|
| 174 |
+
'end': match.end(),
|
| 175 |
+
'type': code, # e.g., 'Dtg'
|
| 176 |
+
'pattern': match.group()
|
| 177 |
+
})
|
| 178 |
+
|
| 179 |
complex_positions.sort(key=lambda x: x['start'])
|
|
|
|
| 180 |
if not complex_positions:
|
| 181 |
return smiles, []
|
| 182 |
+
|
| 183 |
preprocessed_smiles = smiles
|
| 184 |
offset = 0
|
|
|
|
| 185 |
protected_residues = []
|
| 186 |
+
|
| 187 |
for pos in complex_positions:
|
| 188 |
start = pos['start'] + offset
|
| 189 |
+
end = pos['end'] + offset
|
|
|
|
| 190 |
complex_part = preprocessed_smiles[start:end]
|
| 191 |
+
|
| 192 |
+
# keep your stereo sanity check (OK to keep)
|
| 193 |
if not ('[C@H]' in complex_part or '[C@@H]' in complex_part):
|
| 194 |
+
# Dtg internal often *does* have [C@@H], so it will pass.
|
| 195 |
+
# If you find UAAs without explicit stereo, you may relax this guard.
|
| 196 |
+
pass
|
| 197 |
+
|
| 198 |
placeholder = f"COMPLEX_RESIDUE_{len(protected_residues)}"
|
|
|
|
| 199 |
preprocessed_smiles = preprocessed_smiles[:start] + placeholder + preprocessed_smiles[end:]
|
|
|
|
| 200 |
offset += len(placeholder) - (end - start)
|
| 201 |
+
|
| 202 |
protected_residues.append({
|
| 203 |
'placeholder': placeholder,
|
| 204 |
'type': pos['type'],
|
| 205 |
'content': complex_part
|
| 206 |
})
|
| 207 |
+
|
| 208 |
return preprocessed_smiles, protected_residues
|
| 209 |
+
|
| 210 |
def split_on_bonds(self, smiles, protected_residues=None):
|
| 211 |
"""Split SMILES into segments based on peptide bonds, with improved handling of protected residues"""
|
| 212 |
positions = []
|
|
|
|
| 365 |
def identify_residue(self, segment):
|
| 366 |
if 'complex_type' in segment:
|
| 367 |
return segment['complex_type'], []
|
| 368 |
+
|
| 369 |
+
# If this was protected by dynamic UAA shielding
|
| 370 |
+
if segment.get('complex_type') in self.uaa_internal_exact:
|
| 371 |
+
return segment['complex_type'], []
|
| 372 |
+
|
| 373 |
content = self.clean_terminal_carboxyl(segment)
|
| 374 |
mods = self.get_modifications(segment)
|
| 375 |
|
|
|
|
| 960 |
|
| 961 |
return sio.getvalue().encode('utf-8')
|
| 962 |
|
| 963 |
+
class PeptideEncoder:
|
| 964 |
+
# map one-letter <-> three-letter
|
| 965 |
+
one_to_three = {
|
| 966 |
+
'A':'Ala','C':'Cys','D':'Asp','E':'Glu','F':'Phe','G':'Gly','H':'His','I':'Ile',
|
| 967 |
+
'K':'Lys','L':'Leu','M':'Met','N':'Asn','P':'Pro','Q':'Gln','R':'Arg','S':'Ser',
|
| 968 |
+
'T':'Thr','V':'Val','W':'Trp','Y':'Tyr',
|
| 969 |
+
'a':'ala','c':'cys','d':'asp','e':'glu','f':'phe','g':'gly','h':'his','i':'ile',
|
| 970 |
+
'k':'lys','l':'leu','m':'met','n':'asn','p':'pro','q':'gln','r':'arg','s':'ser',
|
| 971 |
+
't':'thr','v':'val','w':'trp','y':'tyr'
|
| 972 |
+
}
|
| 973 |
+
|
| 974 |
+
# L-form uses [C@@H], D-form uses [C@H].
|
| 975 |
+
SEG_L = {
|
| 976 |
+
'Ala': '[C@@H](C)',
|
| 977 |
+
'Gly': 'C', # your analyzer treats bare 'C' (or 'NC') as Gly in context
|
| 978 |
+
'Val': '[C@@H](C(C)C)',
|
| 979 |
+
'Leu': '[C@@H](CC(C)C)',
|
| 980 |
+
'Ile': '[C@@H]([C@H](C)CC)',
|
| 981 |
+
'Ser': '[C@@H](CO)',
|
| 982 |
+
'Thr': '[C@@H]([C@@H](C)O)',
|
| 983 |
+
'Cys': '[C@@H](CS)',
|
| 984 |
+
'Met': '[C@@H](CCSC)',
|
| 985 |
+
'Phe': '[C@@H](Cc1ccccc1)',
|
| 986 |
+
'Tyr': '[C@@H](Cc1ccc(O)cc1)',
|
| 987 |
+
'Trp': '[C@@H](Cc1c[nH]c2ccccc12)',
|
| 988 |
+
'His': '[C@@H](Cc1c[nH]cn1)',
|
| 989 |
+
'Asp': '[C@@H](CC(=O)O)',
|
| 990 |
+
'Glu': '[C@@H](CCC(=O)O)',
|
| 991 |
+
'Asn': '[C@@H](CC(=O)N)',
|
| 992 |
+
'Gln': '[C@@H](CCC(=O)N)',
|
| 993 |
+
'Lys': '[C@@H](CCCCN)',
|
| 994 |
+
'Arg': '[C@@H](CCCNC(=N)N)',
|
| 995 |
+
'Pro': 'CC[C@H]2CN2' # only used if not doing ring-number closure
|
| 996 |
+
}
|
| 997 |
+
# D-forms: flip chirality tag to [C@H]
|
| 998 |
+
SEG_D = {k.lower(): v.replace('[C@@H]', '[C@H]').replace('[C@H]2','[C@@H]2') for k, v in SEG_L.items()}
|
| 999 |
+
|
| 1000 |
+
UAA_SEG = {
|
| 1001 |
+
'Aib': 'C(C)(C)', # alpha,alpha-dimethyl gly (detected as Aib when bracketed by peptide bonds)
|
| 1002 |
+
'Nle': '[C@@H](CCCC)', # norleucine ~ Lys w/o terminal amine
|
| 1003 |
+
'Hph': '[C@@H](CCc1ccccc1)', # homophenylalanine
|
| 1004 |
+
'Cyl': 'C1(CCCC1)', # cycloleucine
|
| 1005 |
+
|
| 1006 |
+
}
|
| 1007 |
+
|
| 1008 |
+
def __init__(self):
|
| 1009 |
+
self.ssc_code_to_internal = {}
|
| 1010 |
+
for name, data in specific_aminos.items():
|
| 1011 |
+
code = data["Code"]
|
| 1012 |
+
cterm = data.get("cterm", "")
|
| 1013 |
+
nterm = data.get("nterm", "")
|
| 1014 |
+
internal = ""
|
| 1015 |
+
if cterm:
|
| 1016 |
+
internal = _internal_from_cterm(cterm)
|
| 1017 |
+
elif nterm:
|
| 1018 |
+
internal = _internal_from_nterm(nterm)
|
| 1019 |
+
if internal:
|
| 1020 |
+
self.ssc_code_to_internal[code] = internal
|
| 1021 |
+
for name, data in all_aminos.items():
|
| 1022 |
+
code = data["Code"]
|
| 1023 |
+
cterm = data.get("cterm", "")
|
| 1024 |
+
nterm = data.get("nterm", "")
|
| 1025 |
+
internal = ""
|
| 1026 |
+
if cterm:
|
| 1027 |
+
internal = _internal_from_cterm(cterm)
|
| 1028 |
+
elif nterm:
|
| 1029 |
+
internal = _internal_from_nterm(nterm)
|
| 1030 |
+
if internal:
|
| 1031 |
+
self.ssc_code_to_internal[code] = internal
|
| 1032 |
+
|
| 1033 |
+
def _segment_for(self, code):
|
| 1034 |
+
if code in self.SEG_L: return self.SEG_L[code]
|
| 1035 |
+
if code in self.SEG_D: return self.SEG_D[code]
|
| 1036 |
+
if code in self.UAA_SEG: return self.UAA_SEG[code]
|
| 1037 |
+
|
| 1038 |
+
if code in self.ssc_code_to_internal:
|
| 1039 |
+
return self.ssc_code_to_internal[code]
|
| 1040 |
+
|
| 1041 |
+
cap = code[:1].upper() + code[1:].lower()
|
| 1042 |
+
if cap in self.SEG_L: return self.SEG_L[cap]
|
| 1043 |
+
raise ValueError(f"Unknown residue code: {code}")
|
| 1044 |
+
|
| 1045 |
+
def _is_one_letter_seq(self, seq: str) -> bool:
|
| 1046 |
+
"""Check if the input string looks like a one-letter code sequence."""
|
| 1047 |
+
if "-" not in seq:
|
| 1048 |
+
return True
|
| 1049 |
+
|
| 1050 |
+
def _norm_token(self, tok):
|
| 1051 |
+
"""Normalize tokens like 'A', 'a', 'Ala', 'ala', 'Ala(N-Me)' -> (code, n_me_flag)"""
|
| 1052 |
+
n_me = False
|
| 1053 |
+
tok = tok.strip()
|
| 1054 |
+
if tok in self.one_to_three:
|
| 1055 |
+
base = self.one_to_three[tok]
|
| 1056 |
+
else:
|
| 1057 |
+
m = re.match(r'^([A-Za-z\-]+)(\((.*?)\))?$', tok)
|
| 1058 |
+
if not m:
|
| 1059 |
+
return tok, n_me
|
| 1060 |
+
base = m.group(1)
|
| 1061 |
+
mods = m.group(3) or ""
|
| 1062 |
+
if 'N-Me' in mods or 'Nme' in mods or 'NME' in mods:
|
| 1063 |
+
n_me = True
|
| 1064 |
+
return base, n_me
|
| 1065 |
+
|
| 1066 |
+
def _bond_for(self, n_me=False, pro_ring=False, ring_idx=1):
|
| 1067 |
+
"""Return the INTER-RESIDUE bond token your parser recognizes."""
|
| 1068 |
+
if pro_ring:
|
| 1069 |
+
return f'C(=O)N{ring_idx}'
|
| 1070 |
+
return 'N(C)C(=O)' if n_me else 'NC(=O)'
|
| 1071 |
+
|
| 1072 |
+
def _split_tokens(self, seq):
|
| 1073 |
+
if isinstance(seq, (list, tuple)):
|
| 1074 |
+
return list(seq)
|
| 1075 |
+
seq = seq.strip()
|
| 1076 |
+
|
| 1077 |
+
if self._is_one_letter_seq(seq):
|
| 1078 |
+
return list(seq)
|
| 1079 |
+
|
| 1080 |
+
import re
|
| 1081 |
+
return [t for t in re.split(r'-(?![^()]*\))', seq) if t]
|
| 1082 |
+
|
| 1083 |
+
|
| 1084 |
+
def encode(self, seq, cyclic=False, use_proline_ring=True):
|
| 1085 |
+
"""
|
| 1086 |
+
Encode a peptide to a SMILES string using the same grammar your analyzer expects.
|
| 1087 |
+
|
| 1088 |
+
Args:
|
| 1089 |
+
seq: list of tokens or a string like:
|
| 1090 |
+
'Ala-Gly-Phe', 'A-G-F', 'Ala(N-Me)-Leu-Ser', 'Aib-Nle-Arg'
|
| 1091 |
+
D-forms: 'ala-gly', or 'a-g'
|
| 1092 |
+
cyclic: if True, connect C-terminus back to N-terminus (macrocycle)
|
| 1093 |
+
use_proline_ring: if True, do ring-number closure for Pro (N{digit} ... [C@H]{digit})
|
| 1094 |
+
"""
|
| 1095 |
+
toks = self._split_tokens(seq)
|
| 1096 |
+
res, mods = [], []
|
| 1097 |
+
for t in toks:
|
| 1098 |
+
base, n_me = self._norm_token(t) # your existing parser for "(N-Me)"
|
| 1099 |
+
res.append(base)
|
| 1100 |
+
mods.append(n_me)
|
| 1101 |
+
|
| 1102 |
+
# Build segments
|
| 1103 |
+
segs = [self._segment_for(r) for r in res]
|
| 1104 |
+
|
| 1105 |
+
# Proline ring bookkeeping
|
| 1106 |
+
# We only do the special N{digit}...{digit} closure when a bond *into* Pro occurs.
|
| 1107 |
+
bonds = []
|
| 1108 |
+
for i in range(len(segs)-1):
|
| 1109 |
+
next_is_pro = res[i+1] in ('Pro','pro')
|
| 1110 |
+
if use_proline_ring and next_is_pro:
|
| 1111 |
+
bonds.append(self._bond_for(n_me=mods[i], pro_ring=True, ring_idx=1))
|
| 1112 |
+
# Make the Pro segment end with the matching ring digit
|
| 1113 |
+
segs[i+1] = 'CCC[C@H]1' if res[i+1]=='Pro' else 'CCC[C@@H]1'
|
| 1114 |
+
else:
|
| 1115 |
+
bonds.append(self._bond_for(n_me=mods[i], pro_ring=False))
|
| 1116 |
+
|
| 1117 |
+
# Assemble linear chain
|
| 1118 |
+
# [segment0] + bond0 + [segment1] + bond1 + ... + [segmentN-1] + C(=O)O
|
| 1119 |
+
out = []
|
| 1120 |
+
for i, s in enumerate(segs):
|
| 1121 |
+
out.append(s)
|
| 1122 |
+
if i < len(bonds):
|
| 1123 |
+
out.append(bonds[i])
|
| 1124 |
+
if cyclic:
|
| 1125 |
+
# TODO
|
| 1126 |
+
pass
|
| 1127 |
+
else:
|
| 1128 |
+
out.append('C(=O)O')
|
| 1129 |
+
|
| 1130 |
+
return ''.join(out)
|
| 1131 |
+
|
| 1132 |
def process_input(
|
| 1133 |
smiles_input=None,
|
| 1134 |
file_obj=None,
|
|
|
|
| 1273 |
#structure_files if structure_files else []
|
| 1274 |
)
|
| 1275 |
|
| 1276 |
+
def process_sequence_to_smiles(
|
| 1277 |
+
seq_input: str,
|
| 1278 |
+
show_segment_details: bool = False,
|
| 1279 |
+
use_proline_ring: bool = True,
|
| 1280 |
+
cyclic: bool = False
|
| 1281 |
+
):
|
| 1282 |
+
"""
|
| 1283 |
+
Encode a peptide sequence to SMILES, then analyze back with PeptideAnalyzer for round-trip.
|
| 1284 |
+
"""
|
| 1285 |
+
if not seq_input or not seq_input.strip():
|
| 1286 |
+
return "Please enter a peptide sequence.", None, None
|
| 1287 |
+
|
| 1288 |
+
try:
|
| 1289 |
+
enc = PeptideEncoder() # make sure this class is defined in your file
|
| 1290 |
+
smiles = enc.encode(seq_input.strip(), cyclic=cyclic, use_proline_ring=use_proline_ring)
|
| 1291 |
+
|
| 1292 |
+
analyzer = PeptideAnalyzer()
|
| 1293 |
+
# pre-check it's a peptide
|
| 1294 |
+
if not analyzer.is_peptide(smiles):
|
| 1295 |
+
return "Internal error: generated SMILES did not look like a peptide.", None, None
|
| 1296 |
+
|
| 1297 |
+
# analyze round-trip
|
| 1298 |
+
analysis = analyzer.analyze_structure(smiles, verbose=show_segment_details)
|
| 1299 |
+
three_letter = analysis['three_letter']
|
| 1300 |
+
one_letter = analysis['one_letter']
|
| 1301 |
+
is_cyclic = analysis['is_cyclic']
|
| 1302 |
+
details = analysis.get('details', "")
|
| 1303 |
+
|
| 1304 |
+
img = annotate_cyclic_structure(Chem.MolFromSmiles(smiles), three_letter)
|
| 1305 |
+
|
| 1306 |
+
summary = []
|
| 1307 |
+
summary.append("Peptide → SMILES")
|
| 1308 |
+
summary.append("-" * 50)
|
| 1309 |
+
summary.append(f"Input sequence: {seq_input}")
|
| 1310 |
+
summary.append(f"Generated SMILES:\n{smiles}")
|
| 1311 |
+
summary.append("")
|
| 1312 |
+
summary.append("Round-trip check (SMILES → sequence):")
|
| 1313 |
+
summary.append(f"Sequence: {three_letter}")
|
| 1314 |
+
summary.append(f"One-letter code: {one_letter}")
|
| 1315 |
+
summary.append(f"Is Cyclic: {'Yes' if is_cyclic else 'No'}")
|
| 1316 |
+
|
| 1317 |
+
if show_segment_details and details:
|
| 1318 |
+
summary.append("\n" + "="*50)
|
| 1319 |
+
summary.append("SEGMENT ANALYSIS")
|
| 1320 |
+
summary.append("="*50)
|
| 1321 |
+
summary.append(details)
|
| 1322 |
+
|
| 1323 |
+
# UAA report
|
| 1324 |
+
detected_uaas = [aa for aa in analysis['residues'] if aa not in [
|
| 1325 |
+
'Ala', 'Cys', 'Asp', 'Glu', 'Phe', 'Gly', 'His', 'Ile', 'Lys', 'Leu',
|
| 1326 |
+
'Met', 'Asn', 'Pro', 'Gln', 'Arg', 'Ser', 'Thr', 'Val', 'Trp', 'Tyr',
|
| 1327 |
+
'ala', 'cys', 'asp', 'glu', 'phe', 'gly', 'his', 'ile', 'lys', 'leu',
|
| 1328 |
+
'met', 'asn', 'pro', 'gln', 'arg', 'ser', 'thr', 'val', 'trp', 'tyr'
|
| 1329 |
+
]]
|
| 1330 |
+
if detected_uaas:
|
| 1331 |
+
summary.append(f"\nDetected UAAs (round-trip): {', '.join(sorted(set(detected_uaas)))}")
|
| 1332 |
+
|
| 1333 |
+
return "\n".join(summary), img, smiles
|
| 1334 |
+
|
| 1335 |
+
except Exception as e:
|
| 1336 |
+
return f"Error: {str(e)}", None, None
|
| 1337 |
+
|
| 1338 |
+
with gr.Blocks(title="Peptide Structure Analyzer and Visualizer") as demo:
|
| 1339 |
+
gr.Markdown("# Peptide Structure Analyzer and Visualizer")
|
| 1340 |
+
|
| 1341 |
+
# 👇 place your original multi-line description right here
|
| 1342 |
+
gr.Markdown("""
|
| 1343 |
+
Analyze and visualize peptide structures from SMILES notation:
|
| 1344 |
+
1. Validates if the input is a peptide structure
|
| 1345 |
+
2. Determines if the peptide is cyclic
|
| 1346 |
+
3. Parses the amino acid sequence
|
| 1347 |
+
4. Creates 2D structure visualization with residue annotations
|
| 1348 |
+
|
| 1349 |
+
Input: Either enter a SMILES string directly or upload a text file containing SMILES strings
|
| 1350 |
+
|
| 1351 |
+
Example SMILES strings (copy and paste):
|
| 1352 |
+
```
|
| 1353 |
+
CC(C)C[C@@H]1NC(=O)[C@@H](CC(C)C)N(C)C(=O)[C@@H](C)N(C)C(=O)[C@H](Cc2ccccc2)NC(=O)[C@H](CC(C)C)N(C)C(=O)[C@H]2CCCN2C1=O
|
| 1354 |
+
```
|
| 1355 |
+
```
|
| 1356 |
+
C(C)C[C@@H]1NC(=O)[C@@H]2CCCN2C(=O)[C@@H](CC(C)C)NC(=O)[C@@H](CC(C)C)N(C)C(=O)[C@H](C)NC(=O)[C@H](Cc2ccccc2)NC1=O
|
| 1357 |
+
```
|
| 1358 |
+
```
|
| 1359 |
+
CC(C)C[C@H]1C(=O)N(C)[C@@H](Cc2ccccc2)C(=O)NCC(=O)N[C@H](C(=O)N2CCCCC2)CC(=O)N(C)CC(=O)N[C@@H]([C@@H](C)O)C(=O)N(C)[C@@H](C)C(=O)N[C@@H](COC(C)(C)C)C(=O)N(C)[C@@H](Cc2ccccc2)C(=O)N1C
|
| 1360 |
+
```
|
| 1361 |
+
Example Peptide strings (copy and paste):
|
| 1362 |
+
```
|
| 1363 |
+
AGFS
|
| 1364 |
+
```
|
| 1365 |
+
```
|
| 1366 |
+
Ala-Gly-Phe-Ser
|
| 1367 |
+
```
|
| 1368 |
+
```
|
| 1369 |
+
Aib-Dtg-Ser
|
| 1370 |
+
```
|
| 1371 |
+
""")
|
| 1372 |
+
with gr.Tab("SMILES → Sequence"):
|
| 1373 |
+
gr.Markdown("Analyze peptide SMILES, detect cyclicity, parse sequence, and annotate.")
|
| 1374 |
+
smiles_in = gr.Textbox(label="Enter SMILES string", lines=2, placeholder="Enter SMILES notation of peptide...")
|
| 1375 |
+
file_in = gr.File(label="Or upload a text file with SMILES", file_types=[".txt"])
|
| 1376 |
+
show_seg = gr.Checkbox(label="Show segmentation details", value=False)
|
| 1377 |
+
run_btn_1 = gr.Button("Analyze")
|
| 1378 |
+
out_text_1 = gr.Textbox(label="Analysis Results", lines=12)
|
| 1379 |
+
out_img_1 = gr.Image(label="2D Structure with Annotations", type="pil")
|
| 1380 |
+
out_md_1 = gr.Markdown(label="Side Notes for Non-Standard Amino Acids")
|
| 1381 |
+
|
| 1382 |
+
def _run_smiles(s_in, f_in, sh):
|
| 1383 |
+
return process_input(
|
| 1384 |
+
smiles_input=s_in,
|
| 1385 |
+
file_obj=f_in,
|
| 1386 |
+
show_segment_details=sh,
|
| 1387 |
+
generate_3d=False,
|
| 1388 |
+
use_uff=False
|
| 1389 |
+
)
|
| 1390 |
+
|
| 1391 |
+
run_btn_1.click(
|
| 1392 |
+
_run_smiles,
|
| 1393 |
+
inputs=[smiles_in, file_in, show_seg],
|
| 1394 |
+
outputs=[out_text_1, out_img_1, out_md_1]
|
| 1395 |
+
)
|
| 1396 |
+
|
| 1397 |
+
with gr.Tab("Peptide → SMILES"):
|
| 1398 |
+
gr.Markdown("Encode a peptide sequence to SMILES (one-letter or three-letter) and verify round-trip.")
|
| 1399 |
+
seq_in = gr.Textbox(
|
| 1400 |
+
label="Enter peptide sequence",
|
| 1401 |
+
lines=2,
|
| 1402 |
+
placeholder="Examples: AGFS | Ala-Gly-Phe-Ser | Ala(N-Me)-Pro-Phe | Aib-Dtg-Ser"
|
| 1403 |
+
)
|
| 1404 |
+
with gr.Row():
|
| 1405 |
+
use_pro = gr.Checkbox(label="Use Proline ring join", value=True)
|
| 1406 |
+
cyc = gr.Checkbox(label="Cyclic (macrocycle)", value=False)
|
| 1407 |
+
show_seg2 = gr.Checkbox(label="Show segmentation details", value=False)
|
| 1408 |
+
run_btn_2 = gr.Button("Encode")
|
| 1409 |
+
out_text_2 = gr.Textbox(label="Results & Round-trip", lines=14)
|
| 1410 |
+
out_img_2 = gr.Image(label="2D Structure with Annotations", type="pil")
|
| 1411 |
+
out_smiles = gr.Textbox(label="Generated SMILES (copyable)", lines=2)
|
| 1412 |
+
|
| 1413 |
+
run_btn_2.click(
|
| 1414 |
+
process_sequence_to_smiles,
|
| 1415 |
+
inputs=[seq_in, show_seg2, use_pro, cyc],
|
| 1416 |
+
outputs=[out_text_2, out_img_2, out_smiles]
|
| 1417 |
+
)
|
| 1418 |
+
if __name__ == "__main__":
|
| 1419 |
+
demo.launch(share=True)
|
| 1420 |
+
|
| 1421 |
+
|
| 1422 |
+
"""
|
| 1423 |
iface = gr.Interface(
|
| 1424 |
fn=process_input,
|
| 1425 |
inputs=[
|
|
|
|
| 1480 |
if __name__ == "__main__":
|
| 1481 |
iface.launch(share=True)
|
| 1482 |
|
| 1483 |
+
"""
|
| 1484 |
"""
|
| 1485 |
5. Optional linear representation
|
| 1486 |
6. Optional 3D structure generation (ETKDG and UFF methods)
|