diff --git a/.gitattributes b/.gitattributes index a6344aac8c09253b3b630fb776ae94478aa0275b..440c37e0e3841c6f85ef142e03e4947cf8ea83db 100644 --- a/.gitattributes +++ b/.gitattributes @@ -25,7 +25,6 @@ *.safetensors filter=lfs diff=lfs merge=lfs -text saved_model/**/* filter=lfs diff=lfs merge=lfs -text *.tar.* filter=lfs diff=lfs merge=lfs -text -*.tar filter=lfs diff=lfs merge=lfs -text *.tflite filter=lfs diff=lfs merge=lfs -text *.tgz filter=lfs diff=lfs merge=lfs -text *.wasm filter=lfs diff=lfs merge=lfs -text @@ -33,3 +32,4 @@ saved_model/**/* filter=lfs diff=lfs merge=lfs -text *.zip filter=lfs diff=lfs merge=lfs -text *.zst filter=lfs diff=lfs merge=lfs -text *tfevents* filter=lfs diff=lfs merge=lfs -text +*.pck filter=lfs diff=lfs merge=lfs -text diff --git a/.gitignore b/.gitignore new file mode 100644 index 0000000000000000000000000000000000000000..91f564843379b6e8073a3176e861a99535b3ca24 --- /dev/null +++ b/.gitignore @@ -0,0 +1,9 @@ +.DS_Store +node_modules +/.svelte-kit +/package +.env +.env.* +!.env.example +vite.config.js.timestamp-* +vite.config.ts.timestamp-* diff --git a/.npmrc b/.npmrc new file mode 100644 index 0000000000000000000000000000000000000000..0c05da457e450c0a6fafe36006e17fa39abc899b --- /dev/null +++ b/.npmrc @@ -0,0 +1,2 @@ +engine-strict=true +resolution-mode=highest diff --git a/README.md b/README.md index 1f7739a147a4dddc16af037e744e6306128a1e95..1573a86d03289499f000882d6864245580813bf6 100644 --- a/README.md +++ b/README.md @@ -1,11 +1,16 @@ --- -title: Super Godot Galaxy -emoji: 🔥 -colorFrom: yellow -colorTo: pink +title: Spaceship Drift Game +emoji: 🪐 +colorFrom: purple +colorTo: purple sdk: static -pinned: false +pinned: true license: mit +app_file: build/index.html +custom_headers: + cross-origin-embedder-policy: require-corp + cross-origin-opener-policy: same-origin + cross-origin-resource-policy: cross-origin --- Check out the configuration reference at https://huggingface.co/docs/hub/spaces-config-reference diff --git a/build/_app/immutable/assets/0.128f6419.css b/build/_app/immutable/assets/0.128f6419.css new file mode 100644 index 0000000000000000000000000000000000000000..5bb21170a953998b8aeefe555783241a8f7592c3 --- /dev/null +++ b/build/_app/immutable/assets/0.128f6419.css @@ -0,0 +1 @@ +*,:before,:after{box-sizing:border-box;border-width:0;border-style:solid;border-color:#e5e7eb}:before,:after{--tw-content: ""}html{line-height:1.5;-webkit-text-size-adjust:100%;-moz-tab-size:4;-o-tab-size:4;tab-size:4;font-family:ui-sans-serif,system-ui,-apple-system,BlinkMacSystemFont,Segoe UI,Roboto,Helvetica Neue,Arial,Noto Sans,sans-serif,"Apple Color Emoji","Segoe UI Emoji",Segoe UI Symbol,"Noto Color Emoji";font-feature-settings:normal;font-variation-settings:normal}body{margin:0;line-height:inherit}hr{height:0;color:inherit;border-top-width:1px}abbr:where([title]){-webkit-text-decoration:underline dotted;text-decoration:underline dotted}h1,h2,h3,h4,h5,h6{font-size:inherit;font-weight:inherit}a{color:inherit;text-decoration:inherit}b,strong{font-weight:bolder}code,kbd,samp,pre{font-family:ui-monospace,SFMono-Regular,Menlo,Monaco,Consolas,Liberation Mono,Courier New,monospace;font-size:1em}small{font-size:80%}sub,sup{font-size:75%;line-height:0;position:relative;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}table{text-indent:0;border-color:inherit;border-collapse:collapse}button,input,optgroup,select,textarea{font-family:inherit;font-size:100%;font-weight:inherit;line-height:inherit;color:inherit;margin:0;padding:0}button,select{text-transform:none}button,[type=button],[type=reset],[type=submit]{-webkit-appearance:button;background-color:transparent;background-image:none}:-moz-focusring{outline:auto}:-moz-ui-invalid{box-shadow:none}progress{vertical-align:baseline}::-webkit-inner-spin-button,::-webkit-outer-spin-button{height:auto}[type=search]{-webkit-appearance:textfield;outline-offset:-2px}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-file-upload-button{-webkit-appearance:button;font:inherit}summary{display:list-item}blockquote,dl,dd,h1,h2,h3,h4,h5,h6,hr,figure,p,pre{margin:0}fieldset{margin:0;padding:0}legend{padding:0}ol,ul,menu{list-style:none;margin:0;padding:0}textarea{resize:vertical}input::-moz-placeholder,textarea::-moz-placeholder{opacity:1;color:#9ca3af}input::placeholder,textarea::placeholder{opacity:1;color:#9ca3af}button,[role=button]{cursor:pointer}:disabled{cursor:default}img,svg,video,canvas,audio,iframe,embed,object{display:block;vertical-align:middle}img,video{max-width:100%;height:auto}[hidden]{display:none}@font-face{font-family:Hellovetica;font-weight:300;src:local("Hellovetica"),url(../../../fonts/hellovetica.ttf);font-display:swap}*,:before,:after{--tw-border-spacing-x: 0;--tw-border-spacing-y: 0;--tw-translate-x: 0;--tw-translate-y: 0;--tw-rotate: 0;--tw-skew-x: 0;--tw-skew-y: 0;--tw-scale-x: 1;--tw-scale-y: 1;--tw-pan-x: ;--tw-pan-y: ;--tw-pinch-zoom: ;--tw-scroll-snap-strictness: proximity;--tw-gradient-from-position: ;--tw-gradient-via-position: ;--tw-gradient-to-position: ;--tw-ordinal: ;--tw-slashed-zero: ;--tw-numeric-figure: ;--tw-numeric-spacing: ;--tw-numeric-fraction: ;--tw-ring-inset: ;--tw-ring-offset-width: 0px;--tw-ring-offset-color: #fff;--tw-ring-color: rgb(59 130 246 / .5);--tw-ring-offset-shadow: 0 0 #0000;--tw-ring-shadow: 0 0 #0000;--tw-shadow: 0 0 #0000;--tw-shadow-colored: 0 0 #0000;--tw-blur: ;--tw-brightness: ;--tw-contrast: ;--tw-grayscale: ;--tw-hue-rotate: ;--tw-invert: ;--tw-saturate: ;--tw-sepia: ;--tw-drop-shadow: ;--tw-backdrop-blur: ;--tw-backdrop-brightness: ;--tw-backdrop-contrast: ;--tw-backdrop-grayscale: ;--tw-backdrop-hue-rotate: ;--tw-backdrop-invert: ;--tw-backdrop-opacity: ;--tw-backdrop-saturate: ;--tw-backdrop-sepia: }::backdrop{--tw-border-spacing-x: 0;--tw-border-spacing-y: 0;--tw-translate-x: 0;--tw-translate-y: 0;--tw-rotate: 0;--tw-skew-x: 0;--tw-skew-y: 0;--tw-scale-x: 1;--tw-scale-y: 1;--tw-pan-x: ;--tw-pan-y: ;--tw-pinch-zoom: ;--tw-scroll-snap-strictness: proximity;--tw-gradient-from-position: ;--tw-gradient-via-position: ;--tw-gradient-to-position: ;--tw-ordinal: ;--tw-slashed-zero: ;--tw-numeric-figure: ;--tw-numeric-spacing: ;--tw-numeric-fraction: ;--tw-ring-inset: ;--tw-ring-offset-width: 0px;--tw-ring-offset-color: #fff;--tw-ring-color: rgb(59 130 246 / .5);--tw-ring-offset-shadow: 0 0 #0000;--tw-ring-shadow: 0 0 #0000;--tw-shadow: 0 0 #0000;--tw-shadow-colored: 0 0 #0000;--tw-blur: ;--tw-brightness: ;--tw-contrast: ;--tw-grayscale: ;--tw-hue-rotate: ;--tw-invert: ;--tw-saturate: ;--tw-sepia: ;--tw-drop-shadow: ;--tw-backdrop-blur: ;--tw-backdrop-brightness: ;--tw-backdrop-contrast: ;--tw-backdrop-grayscale: ;--tw-backdrop-hue-rotate: ;--tw-backdrop-invert: ;--tw-backdrop-opacity: ;--tw-backdrop-saturate: ;--tw-backdrop-sepia: }.fixed{position:fixed}.absolute{position:absolute}.relative{position:relative}.-bottom-\[3px\]{bottom:-3px}.-left-\[3px\]{left:-3px}.-right-\[3px\]{right:-3px}.-top-\[3px\]{top:-3px}.bottom-6{bottom:1.5rem}.z-10{z-index:10}.mt-1{margin-top:.25rem}.mt-10{margin-top:2.5rem}.mt-12{margin-top:3rem}.mt-20{margin-top:5rem}.mt-4{margin-top:1rem}.mt-6{margin-top:1.5rem}.flex{display:flex}.contents{display:contents}.h-48{height:12rem}.h-\[3px\]{height:3px}.w-\[3px\]{width:3px}.w-full{width:100%}.flex-row{flex-direction:row}.flex-col{flex-direction:column}.items-center{align-items:center}.justify-center{justify-content:center}.space-y-4>:not([hidden])~:not([hidden]){--tw-space-y-reverse: 0;margin-top:calc(1rem * calc(1 - var(--tw-space-y-reverse)));margin-bottom:calc(1rem * var(--tw-space-y-reverse))}.overflow-x-hidden{overflow-x:hidden}.border-\[3px\]{border-width:3px}.border-slate-800{--tw-border-opacity: 1;border-color:rgb(30 41 59 / var(--tw-border-opacity))}.bg-\[\#0C0F19\]{--tw-bg-opacity: 1;background-color:rgb(12 15 25 / var(--tw-bg-opacity))}.bg-slate-800{--tw-bg-opacity: 1;background-color:rgb(30 41 59 / var(--tw-bg-opacity))}.bg-cover{background-size:cover}.p-4{padding:1rem}.px-3{padding-left:.75rem;padding-right:.75rem}.py-5{padding-top:1.25rem;padding-bottom:1.25rem}.text-center{text-align:center}.font-Hellovetica{font-family:Hellovetica}.text-\[9px\]{font-size:9px}.text-xs{font-size:.75rem;line-height:1rem}.text-slate-100{--tw-text-opacity: 1;color:rgb(241 245 249 / var(--tw-text-opacity))}.text-slate-500{--tw-text-opacity: 1;color:rgb(100 116 139 / var(--tw-text-opacity))}.underline{text-decoration-line:underline}@media (min-width: 640px){.sm\:mt-20{margin-top:5rem}} diff --git a/build/_app/immutable/assets/_layout.c95767ad.css b/build/_app/immutable/assets/_layout.c95767ad.css new file mode 100644 index 0000000000000000000000000000000000000000..c7042963c8770ef67f1b123e2947d70d511f38e4 --- /dev/null +++ b/build/_app/immutable/assets/_layout.c95767ad.css @@ -0,0 +1 @@ +*,:before,:after{box-sizing:border-box;border-width:0;border-style:solid;border-color:#e5e7eb}:before,:after{--tw-content: ""}html{line-height:1.5;-webkit-text-size-adjust:100%;-moz-tab-size:4;-o-tab-size:4;tab-size:4;font-family:ui-sans-serif,system-ui,-apple-system,BlinkMacSystemFont,Segoe UI,Roboto,Helvetica Neue,Arial,Noto Sans,sans-serif,"Apple Color Emoji","Segoe UI Emoji",Segoe UI Symbol,"Noto Color Emoji";font-feature-settings:normal;font-variation-settings:normal}body{margin:0;line-height:inherit}hr{height:0;color:inherit;border-top-width:1px}abbr:where([title]){-webkit-text-decoration:underline dotted;text-decoration:underline dotted}h1,h2,h3,h4,h5,h6{font-size:inherit;font-weight:inherit}a{color:inherit;text-decoration:inherit}b,strong{font-weight:bolder}code,kbd,samp,pre{font-family:ui-monospace,SFMono-Regular,Menlo,Monaco,Consolas,Liberation Mono,Courier New,monospace;font-size:1em}small{font-size:80%}sub,sup{font-size:75%;line-height:0;position:relative;vertical-align:baseline}sub{bottom:-.25em}sup{top:-.5em}table{text-indent:0;border-color:inherit;border-collapse:collapse}button,input,optgroup,select,textarea{font-family:inherit;font-size:100%;font-weight:inherit;line-height:inherit;color:inherit;margin:0;padding:0}button,select{text-transform:none}button,[type=button],[type=reset],[type=submit]{-webkit-appearance:button;background-color:transparent;background-image:none}:-moz-focusring{outline:auto}:-moz-ui-invalid{box-shadow:none}progress{vertical-align:baseline}::-webkit-inner-spin-button,::-webkit-outer-spin-button{height:auto}[type=search]{-webkit-appearance:textfield;outline-offset:-2px}::-webkit-search-decoration{-webkit-appearance:none}::-webkit-file-upload-button{-webkit-appearance:button;font:inherit}summary{display:list-item}blockquote,dl,dd,h1,h2,h3,h4,h5,h6,hr,figure,p,pre{margin:0}fieldset{margin:0;padding:0}legend{padding:0}ol,ul,menu{list-style:none;margin:0;padding:0}textarea{resize:vertical}input::-moz-placeholder,textarea::-moz-placeholder{opacity:1;color:#9ca3af}input::placeholder,textarea::placeholder{opacity:1;color:#9ca3af}button,[role=button]{cursor:pointer}:disabled{cursor:default}img,svg,video,canvas,audio,iframe,embed,object{display:block;vertical-align:middle}img,video{max-width:100%;height:auto}[hidden]{display:none}@font-face{font-family:Hellovetica;font-weight:300;src:local("Hellovetica"),url(/fonts/hellovetica.ttf);font-display:swap}*,:before,:after{--tw-border-spacing-x: 0;--tw-border-spacing-y: 0;--tw-translate-x: 0;--tw-translate-y: 0;--tw-rotate: 0;--tw-skew-x: 0;--tw-skew-y: 0;--tw-scale-x: 1;--tw-scale-y: 1;--tw-pan-x: ;--tw-pan-y: ;--tw-pinch-zoom: ;--tw-scroll-snap-strictness: proximity;--tw-gradient-from-position: ;--tw-gradient-via-position: ;--tw-gradient-to-position: ;--tw-ordinal: ;--tw-slashed-zero: ;--tw-numeric-figure: ;--tw-numeric-spacing: ;--tw-numeric-fraction: ;--tw-ring-inset: ;--tw-ring-offset-width: 0px;--tw-ring-offset-color: #fff;--tw-ring-color: rgb(59 130 246 / .5);--tw-ring-offset-shadow: 0 0 #0000;--tw-ring-shadow: 0 0 #0000;--tw-shadow: 0 0 #0000;--tw-shadow-colored: 0 0 #0000;--tw-blur: ;--tw-brightness: ;--tw-contrast: ;--tw-grayscale: ;--tw-hue-rotate: ;--tw-invert: ;--tw-saturate: ;--tw-sepia: ;--tw-drop-shadow: ;--tw-backdrop-blur: ;--tw-backdrop-brightness: ;--tw-backdrop-contrast: ;--tw-backdrop-grayscale: ;--tw-backdrop-hue-rotate: ;--tw-backdrop-invert: ;--tw-backdrop-opacity: ;--tw-backdrop-saturate: ;--tw-backdrop-sepia: }::backdrop{--tw-border-spacing-x: 0;--tw-border-spacing-y: 0;--tw-translate-x: 0;--tw-translate-y: 0;--tw-rotate: 0;--tw-skew-x: 0;--tw-skew-y: 0;--tw-scale-x: 1;--tw-scale-y: 1;--tw-pan-x: ;--tw-pan-y: ;--tw-pinch-zoom: ;--tw-scroll-snap-strictness: proximity;--tw-gradient-from-position: ;--tw-gradient-via-position: ;--tw-gradient-to-position: ;--tw-ordinal: ;--tw-slashed-zero: ;--tw-numeric-figure: ;--tw-numeric-spacing: ;--tw-numeric-fraction: ;--tw-ring-inset: ;--tw-ring-offset-width: 0px;--tw-ring-offset-color: #fff;--tw-ring-color: rgb(59 130 246 / .5);--tw-ring-offset-shadow: 0 0 #0000;--tw-ring-shadow: 0 0 #0000;--tw-shadow: 0 0 #0000;--tw-shadow-colored: 0 0 #0000;--tw-blur: ;--tw-brightness: ;--tw-contrast: ;--tw-grayscale: ;--tw-hue-rotate: ;--tw-invert: ;--tw-saturate: ;--tw-sepia: ;--tw-drop-shadow: ;--tw-backdrop-blur: ;--tw-backdrop-brightness: ;--tw-backdrop-contrast: ;--tw-backdrop-grayscale: ;--tw-backdrop-hue-rotate: ;--tw-backdrop-invert: ;--tw-backdrop-opacity: ;--tw-backdrop-saturate: ;--tw-backdrop-sepia: }.fixed{position:fixed}.absolute{position:absolute}.relative{position:relative}.-bottom-\[3px\]{bottom:-3px}.-left-\[3px\]{left:-3px}.-right-\[3px\]{right:-3px}.-top-\[3px\]{top:-3px}.bottom-6{bottom:1.5rem}.z-10{z-index:10}.mt-1{margin-top:.25rem}.mt-10{margin-top:2.5rem}.mt-12{margin-top:3rem}.mt-20{margin-top:5rem}.mt-4{margin-top:1rem}.mt-6{margin-top:1.5rem}.flex{display:flex}.contents{display:contents}.h-48{height:12rem}.h-\[3px\]{height:3px}.w-\[3px\]{width:3px}.w-full{width:100%}.flex-row{flex-direction:row}.flex-col{flex-direction:column}.items-center{align-items:center}.justify-center{justify-content:center}.space-y-4>:not([hidden])~:not([hidden]){--tw-space-y-reverse: 0;margin-top:calc(1rem * calc(1 - var(--tw-space-y-reverse)));margin-bottom:calc(1rem * var(--tw-space-y-reverse))}.overflow-x-hidden{overflow-x:hidden}.border-\[3px\]{border-width:3px}.border-slate-800{--tw-border-opacity: 1;border-color:rgb(30 41 59 / var(--tw-border-opacity))}.bg-\[\#0C0F19\]{--tw-bg-opacity: 1;background-color:rgb(12 15 25 / var(--tw-bg-opacity))}.bg-slate-800{--tw-bg-opacity: 1;background-color:rgb(30 41 59 / var(--tw-bg-opacity))}.bg-cover{background-size:cover}.p-4{padding:1rem}.px-3{padding-left:.75rem;padding-right:.75rem}.py-5{padding-top:1.25rem;padding-bottom:1.25rem}.text-center{text-align:center}.font-Hellovetica{font-family:Hellovetica}.text-\[9px\]{font-size:9px}.text-xs{font-size:.75rem;line-height:1rem}.text-slate-100{--tw-text-opacity: 1;color:rgb(241 245 249 / var(--tw-text-opacity))}.text-slate-500{--tw-text-opacity: 1;color:rgb(100 116 139 / var(--tw-text-opacity))}.underline{text-decoration-line:underline}@media (min-width: 640px){.sm\:mt-20{margin-top:5rem}} diff --git a/build/_app/immutable/assets/preview.69504cb0.png b/build/_app/immutable/assets/preview.69504cb0.png new file mode 100644 index 0000000000000000000000000000000000000000..cc908bd4ef728ce78d75d2970c9cc9f0ee36c5f4 Binary files /dev/null and b/build/_app/immutable/assets/preview.69504cb0.png differ diff --git a/build/_app/immutable/chunks/index.0d3f7c7a.js b/build/_app/immutable/chunks/index.0d3f7c7a.js new file mode 100644 index 0000000000000000000000000000000000000000..201a9e8eabdf4ba1fc43634ee314891dd098b062 --- /dev/null +++ b/build/_app/immutable/chunks/index.0d3f7c7a.js @@ -0,0 +1 @@ +function $(){}function F(t,e){for(const n in e)t[n]=e[n];return t}function T(t){return t()}function M(){return Object.create(null)}function g(t){t.forEach(T)}function B(t){return typeof t=="function"}function at(t,e){return t!=t?e==e:t!==e||t&&typeof t=="object"||typeof t=="function"}let x;function st(t,e){return x||(x=document.createElement("a")),x.href=e,t===x.href}function H(t){return Object.keys(t).length===0}function I(t,...e){if(t==null)return $;const n=t.subscribe(...e);return n.unsubscribe?()=>n.unsubscribe():n}function ft(t,e,n){t.$$.on_destroy.push(I(e,n))}function dt(t,e,n,i){if(t){const r=L(t,e,n,i);return t[0](r)}}function L(t,e,n,i){return t[1]&&i?F(n.ctx.slice(),t[1](i(e))):n.ctx}function _t(t,e,n,i){if(t[2]&&i){const r=t[2](i(n));if(e.dirty===void 0)return r;if(typeof r=="object"){const a=[],l=Math.max(e.dirty.length,r.length);for(let o=0;o32){const e=[],n=t.ctx.length/32;for(let i=0;i>1);n(r)<=i?t=r+1:e=r}return t}function R(t){if(t.hydrate_init)return;t.hydrate_init=!0;let e=t.childNodes;if(t.nodeName==="HEAD"){const u=[];for(let c=0;c0&&e[n[r]].claim_order<=c?r+1:Q(1,r,b=>e[n[b]].claim_order,c))-1;i[u]=n[f]+1;const s=f+1;n[s]=u,r=Math.max(s,r)}const a=[],l=[];let o=e.length-1;for(let u=n[r]+1;u!=0;u=i[u-1]){for(a.push(e[u-1]);o>=u;o--)l.push(e[o]);o--}for(;o>=0;o--)l.push(e[o]);a.reverse(),l.sort((u,c)=>u.claim_order-c.claim_order);for(let u=0,c=0;u=a[c].claim_order;)c++;const f=ct.removeEventListener(e,n,i)}function xt(t){return function(e){return e.preventDefault(),t.call(this,e)}}function wt(t,e,n){n==null?t.removeAttribute(e):t.getAttribute(e)!==n&&t.setAttribute(e,n)}function Y(t){return Array.from(t.childNodes)}function Z(t){t.claim_info===void 0&&(t.claim_info={last_index:0,total_claimed:0})}function O(t,e,n,i,r=!1){Z(t);const a=(()=>{for(let l=t.claim_info.last_index;l=0;l--){const o=t[l];if(e(o)){const u=n(o);return u===void 0?t.splice(l,1):t[l]=u,r?u===void 0&&t.claim_info.last_index--:t.claim_info.last_index=l,o}}return i()})();return a.claim_order=t.claim_info.total_claimed,t.claim_info.total_claimed+=1,a}function tt(t,e,n,i){return O(t,r=>r.nodeName===e,r=>{const a=[];for(let l=0;lr.removeAttribute(l))},()=>i(e))}function $t(t,e,n){return tt(t,e,n,X)}function et(t,e){return O(t,n=>n.nodeType===3,n=>{const i=""+e;if(n.data.startsWith(i)){if(n.data.length!==i.length)return n.splitText(i.length)}else n.data=i},()=>A(e),!0)}function vt(t){return et(t," ")}function Et(t,e){e=""+e,t.data!==e&&(t.data=e)}function Nt(t,e,n,i){n==null?t.style.removeProperty(e):t.style.setProperty(e,n,i?"important":"")}function St(t,e){return new t(e)}let y;function p(t){y=t}function D(){if(!y)throw new Error("Function called outside component initialization");return y}function At(t){D().$$.on_mount.push(t)}function jt(t){D().$$.after_update.push(t)}const h=[],q=[];let m=[];const C=[],P=Promise.resolve();let N=!1;function W(){N||(N=!0,P.then(z))}function kt(){return W(),P}function S(t){m.push(t)}const E=new Set;let _=0;function z(){if(_!==0)return;const t=y;do{try{for(;_t.indexOf(i)===-1?e.push(i):n.push(i)),n.forEach(i=>i()),m=e}const w=new Set;let d;function Mt(){d={r:0,c:[],p:d}}function qt(){d.r||g(d.c),d=d.p}function rt(t,e){t&&t.i&&(w.delete(t),t.i(e))}function Ct(t,e,n,i){if(t&&t.o){if(w.has(t))return;w.add(t),d.c.push(()=>{w.delete(t),i&&(n&&t.d(1),i())}),t.o(e)}else i&&i()}const lt=["allowfullscreen","allowpaymentrequest","async","autofocus","autoplay","checked","controls","default","defer","disabled","formnovalidate","hidden","inert","ismap","loop","multiple","muted","nomodule","novalidate","open","playsinline","readonly","required","reversed","selected"];[...lt];function Tt(t){t&&t.c()}function Bt(t,e){t&&t.l(e)}function ut(t,e,n,i){const{fragment:r,after_update:a}=t.$$;r&&r.m(e,n),i||S(()=>{const l=t.$$.on_mount.map(T).filter(B);t.$$.on_destroy?t.$$.on_destroy.push(...l):g(l),t.$$.on_mount=[]}),a.forEach(S)}function ct(t,e){const n=t.$$;n.fragment!==null&&(it(n.after_update),g(n.on_destroy),n.fragment&&n.fragment.d(e),n.on_destroy=n.fragment=null,n.ctx=[])}function ot(t,e){t.$$.dirty[0]===-1&&(h.push(t),W(),t.$$.dirty.fill(0)),t.$$.dirty[e/31|0]|=1<{const k=j.length?j[0]:b;return c.ctx&&r(c.ctx[s],c.ctx[s]=k)&&(!c.skip_bound&&c.bound[s]&&c.bound[s](k),f&&ot(t,s)),b}):[],c.update(),f=!0,g(c.before_update),c.fragment=i?i(c.ctx):!1,e.target){if(e.hydrate){J();const s=Y(e.target);c.fragment&&c.fragment.l(s),s.forEach(V)}else c.fragment&&c.fragment.c();e.intro&&rt(t.$$.fragment),ut(t,e.target,e.anchor,e.customElement),K(),z()}p(u)}class Ot{$destroy(){ct(this,1),this.$destroy=$}$on(e,n){if(!B(n))return $;const i=this.$$.callbacks[e]||(this.$$.callbacks[e]=[]);return i.push(n),()=>{const r=i.indexOf(n);r!==-1&&i.splice(r,1)}}$set(e){this.$$set&&!H(e)&&(this.$$.skip_bound=!0,this.$$set(e),this.$$.skip_bound=!1)}}export{ut as A,ct as B,dt as C,ht as D,mt as E,_t as F,U as G,$ as H,ft as I,st as J,bt as K,xt as L,Ot as S,yt as a,pt as b,vt as c,Ct as d,gt as e,qt as f,rt as g,V as h,Lt as i,jt as j,X as k,$t as l,Y as m,wt as n,At as o,Nt as p,A as q,et as r,at as s,kt as t,Et as u,Mt as v,q as w,St as x,Tt as y,Bt as z}; diff --git a/build/_app/immutable/chunks/singletons.d3eb6a89.js b/build/_app/immutable/chunks/singletons.d3eb6a89.js new file mode 100644 index 0000000000000000000000000000000000000000..3054aca5b9ff39fca11710cea6fa9b01eaa9b86e --- /dev/null +++ b/build/_app/immutable/chunks/singletons.d3eb6a89.js @@ -0,0 +1 @@ +import{H as d,s as v}from"./index.0d3f7c7a.js";const c=[];function p(e,t=d){let n;const o=new Set;function a(s){if(v(e,s)&&(e=s,n)){const u=!c.length;for(const i of o)i[1](),c.push(i,e);if(u){for(let i=0;i{o.delete(i),o.size===0&&n&&(n(),n=null)}}return{set:a,update:l,subscribe:r}}var g;const E=((g=globalThis.__sveltekit_pm3ou1)==null?void 0:g.base)??"";var k;const S=((k=globalThis.__sveltekit_pm3ou1)==null?void 0:k.assets)??E,w="1697963191981",y="sveltekit:snapshot",I="sveltekit:scroll",x="sveltekit:index",_={tap:1,hover:2,viewport:3,eager:4,off:-1};function O(e){let t=e.baseURI;if(!t){const n=e.getElementsByTagName("base");t=n.length?n[0].href:e.URL}return t}function U(){return{x:pageXOffset,y:pageYOffset}}function f(e,t){return e.getAttribute(`data-sveltekit-${t}`)}const b={..._,"":_.hover};function m(e){let t=e.assignedSlot??e.parentNode;return(t==null?void 0:t.nodeType)===11&&(t=t.host),t}function L(e,t){for(;e&&e!==t;){if(e.nodeName.toUpperCase()==="A"&&e.hasAttribute("href"))return e;e=m(e)}}function N(e,t){let n;try{n=new URL(e instanceof SVGAElement?e.href.baseVal:e.href,document.baseURI)}catch{}const o=e instanceof SVGAElement?e.target.baseVal:e.target,a=!n||!!o||R(n,t)||(e.getAttribute("rel")||"").split(/\s+/).includes("external"),l=(n==null?void 0:n.origin)===location.origin&&e.hasAttribute("download");return{url:n,external:a,target:o,download:l}}function P(e){let t=null,n=null,o=null,a=null,l=null,r=null,s=e;for(;s&&s!==document.documentElement;)o===null&&(o=f(s,"preload-code")),a===null&&(a=f(s,"preload-data")),t===null&&(t=f(s,"keepfocus")),n===null&&(n=f(s,"noscroll")),l===null&&(l=f(s,"reload")),r===null&&(r=f(s,"replacestate")),s=m(s);return{preload_code:b[o??"off"],preload_data:b[a??"off"],keep_focus:t==="off"?!1:t===""?!0:null,noscroll:n==="off"?!1:n===""?!0:null,reload:l==="off"?!1:l===""?!0:null,replace_state:r==="off"?!1:r===""?!0:null}}function h(e){const t=p(e);let n=!0;function o(){n=!0,t.update(r=>r)}function a(r){n=!1,t.set(r)}function l(r){let s;return t.subscribe(u=>{(s===void 0||n&&u!==s)&&r(s=u)})}return{notify:o,set:a,subscribe:l}}function A(){const{set:e,subscribe:t}=p(!1);let n;async function o(){clearTimeout(n);try{const a=await fetch(`${S}/_app/version.json`,{headers:{pragma:"no-cache","cache-control":"no-cache"}});if(!a.ok)return!1;const r=(await a.json()).version!==w;return r&&(e(!0),clearTimeout(n)),r}catch{return!1}}return{subscribe:t,check:o}}function R(e,t){return e.origin!==location.origin||!e.pathname.startsWith(t)}function V(e){e.client}const Y={url:h({}),page:h({}),navigating:p(null),updated:A()};export{x as I,_ as P,I as S,y as a,N as b,P as c,U as d,E as e,L as f,O as g,V as h,R as i,Y as s}; diff --git a/build/_app/immutable/chunks/stores.fe367015.js b/build/_app/immutable/chunks/stores.fe367015.js new file mode 100644 index 0000000000000000000000000000000000000000..39529c16464d2b350017d88f78cf1b0f39b6b8df --- /dev/null +++ b/build/_app/immutable/chunks/stores.fe367015.js @@ -0,0 +1 @@ +import"./index.0d3f7c7a.js";import{s as e}from"./singletons.d3eb6a89.js";const r=()=>{const s=e;return{page:{subscribe:s.page.subscribe},navigating:{subscribe:s.navigating.subscribe},updated:s.updated}},b={subscribe(s){return r().page.subscribe(s)}};export{b as p}; diff --git a/build/_app/immutable/entry/app.2d02feb4.js b/build/_app/immutable/entry/app.2d02feb4.js new file mode 100644 index 0000000000000000000000000000000000000000..1cec316b7dd539d67dd0a6248e0913dcac1c73e1 --- /dev/null +++ b/build/_app/immutable/entry/app.2d02feb4.js @@ -0,0 +1 @@ +import{S as V,i as q,s as U,a as j,e as h,c as z,b as w,d as p,f as y,g as d,h as g,j as W,o as F,k as G,l as H,m as J,n as N,p as m,q as K,r as M,u as Q,v as L,w as P,x as k,y as v,z as A,A as E,B as R}from"../chunks/index.0d3f7c7a.js";const X="modulepreload",Y=function(a,e){return new URL(a,e).href},B={},S=function(e,n,i){if(!n||n.length===0)return e();const s=document.getElementsByTagName("link");return Promise.all(n.map(f=>{if(f=Y(f,i),f in B)return;B[f]=!0;const t=f.endsWith(".css"),r=t?'[rel="stylesheet"]':"";if(!!i)for(let l=s.length-1;l>=0;l--){const _=s[l];if(_.href===f&&(!t||_.rel==="stylesheet"))return}else if(document.querySelector(`link[href="${f}"]${r}`))return;const o=document.createElement("link");if(o.rel=t?"stylesheet":X,t||(o.as="script",o.crossOrigin=""),o.href=f,document.head.appendChild(o),t)return new Promise((l,_)=>{o.addEventListener("load",l),o.addEventListener("error",()=>_(new Error(`Unable to preload CSS for ${f}`)))})})).then(()=>e())},ie={};function Z(a){let e,n,i;var s=a[1][0];function f(t){return{props:{data:t[3],form:t[2]}}}return s&&(e=k(s,f(a)),a[12](e)),{c(){e&&v(e.$$.fragment),n=h()},l(t){e&&A(e.$$.fragment,t),n=h()},m(t,r){e&&E(e,t,r),w(t,n,r),i=!0},p(t,r){const u={};if(r&8&&(u.data=t[3]),r&4&&(u.form=t[2]),r&2&&s!==(s=t[1][0])){if(e){L();const o=e;p(o.$$.fragment,1,0,()=>{R(o,1)}),y()}s?(e=k(s,f(t)),t[12](e),v(e.$$.fragment),d(e.$$.fragment,1),E(e,n.parentNode,n)):e=null}else s&&e.$set(u)},i(t){i||(e&&d(e.$$.fragment,t),i=!0)},o(t){e&&p(e.$$.fragment,t),i=!1},d(t){a[12](null),t&&g(n),e&&R(e,t)}}}function $(a){let e,n,i;var s=a[1][0];function f(t){return{props:{data:t[3],$$slots:{default:[x]},$$scope:{ctx:t}}}}return s&&(e=k(s,f(a)),a[11](e)),{c(){e&&v(e.$$.fragment),n=h()},l(t){e&&A(e.$$.fragment,t),n=h()},m(t,r){e&&E(e,t,r),w(t,n,r),i=!0},p(t,r){const u={};if(r&8&&(u.data=t[3]),r&8215&&(u.$$scope={dirty:r,ctx:t}),r&2&&s!==(s=t[1][0])){if(e){L();const o=e;p(o.$$.fragment,1,0,()=>{R(o,1)}),y()}s?(e=k(s,f(t)),t[11](e),v(e.$$.fragment),d(e.$$.fragment,1),E(e,n.parentNode,n)):e=null}else s&&e.$set(u)},i(t){i||(e&&d(e.$$.fragment,t),i=!0)},o(t){e&&p(e.$$.fragment,t),i=!1},d(t){a[11](null),t&&g(n),e&&R(e,t)}}}function x(a){let e,n,i;var s=a[1][1];function f(t){return{props:{data:t[4],form:t[2]}}}return s&&(e=k(s,f(a)),a[10](e)),{c(){e&&v(e.$$.fragment),n=h()},l(t){e&&A(e.$$.fragment,t),n=h()},m(t,r){e&&E(e,t,r),w(t,n,r),i=!0},p(t,r){const u={};if(r&16&&(u.data=t[4]),r&4&&(u.form=t[2]),r&2&&s!==(s=t[1][1])){if(e){L();const o=e;p(o.$$.fragment,1,0,()=>{R(o,1)}),y()}s?(e=k(s,f(t)),t[10](e),v(e.$$.fragment),d(e.$$.fragment,1),E(e,n.parentNode,n)):e=null}else s&&e.$set(u)},i(t){i||(e&&d(e.$$.fragment,t),i=!0)},o(t){e&&p(e.$$.fragment,t),i=!1},d(t){a[10](null),t&&g(n),e&&R(e,t)}}}function C(a){let e,n=a[6]&&D(a);return{c(){e=G("div"),n&&n.c(),this.h()},l(i){e=H(i,"DIV",{id:!0,"aria-live":!0,"aria-atomic":!0,style:!0});var s=J(e);n&&n.l(s),s.forEach(g),this.h()},h(){N(e,"id","svelte-announcer"),N(e,"aria-live","assertive"),N(e,"aria-atomic","true"),m(e,"position","absolute"),m(e,"left","0"),m(e,"top","0"),m(e,"clip","rect(0 0 0 0)"),m(e,"clip-path","inset(50%)"),m(e,"overflow","hidden"),m(e,"white-space","nowrap"),m(e,"width","1px"),m(e,"height","1px")},m(i,s){w(i,e,s),n&&n.m(e,null)},p(i,s){i[6]?n?n.p(i,s):(n=D(i),n.c(),n.m(e,null)):n&&(n.d(1),n=null)},d(i){i&&g(e),n&&n.d()}}}function D(a){let e;return{c(){e=K(a[7])},l(n){e=M(n,a[7])},m(n,i){w(n,e,i)},p(n,i){i&128&&Q(e,n[7])},d(n){n&&g(e)}}}function ee(a){let e,n,i,s,f;const t=[$,Z],r=[];function u(l,_){return l[1][1]?0:1}e=u(a),n=r[e]=t[e](a);let o=a[5]&&C(a);return{c(){n.c(),i=j(),o&&o.c(),s=h()},l(l){n.l(l),i=z(l),o&&o.l(l),s=h()},m(l,_){r[e].m(l,_),w(l,i,_),o&&o.m(l,_),w(l,s,_),f=!0},p(l,[_]){let b=e;e=u(l),e===b?r[e].p(l,_):(L(),p(r[b],1,1,()=>{r[b]=null}),y(),n=r[e],n?n.p(l,_):(n=r[e]=t[e](l),n.c()),d(n,1),n.m(i.parentNode,i)),l[5]?o?o.p(l,_):(o=C(l),o.c(),o.m(s.parentNode,s)):o&&(o.d(1),o=null)},i(l){f||(d(n),f=!0)},o(l){p(n),f=!1},d(l){r[e].d(l),l&&g(i),o&&o.d(l),l&&g(s)}}}function te(a,e,n){let{stores:i}=e,{page:s}=e,{constructors:f}=e,{components:t=[]}=e,{form:r}=e,{data_0:u=null}=e,{data_1:o=null}=e;W(i.page.notify);let l=!1,_=!1,b=null;F(()=>{const c=i.page.subscribe(()=>{l&&(n(6,_=!0),n(7,b=document.title||"untitled page"))});return n(5,l=!0),c});function I(c){P[c?"unshift":"push"](()=>{t[1]=c,n(0,t)})}function O(c){P[c?"unshift":"push"](()=>{t[0]=c,n(0,t)})}function T(c){P[c?"unshift":"push"](()=>{t[0]=c,n(0,t)})}return a.$$set=c=>{"stores"in c&&n(8,i=c.stores),"page"in c&&n(9,s=c.page),"constructors"in c&&n(1,f=c.constructors),"components"in c&&n(0,t=c.components),"form"in c&&n(2,r=c.form),"data_0"in c&&n(3,u=c.data_0),"data_1"in c&&n(4,o=c.data_1)},a.$$.update=()=>{a.$$.dirty&768&&i.page.set(s)},[t,f,r,u,o,l,_,b,i,s,I,O,T]}class se extends V{constructor(e){super(),q(this,e,te,ee,U,{stores:8,page:9,constructors:1,components:0,form:2,data_0:3,data_1:4})}}const re=[()=>S(()=>import("../nodes/0.79a9f441.js"),["../nodes/0.79a9f441.js","../chunks/index.0d3f7c7a.js","../assets/0.128f6419.css"],import.meta.url),()=>S(()=>import("../nodes/1.045d0063.js"),["../nodes/1.045d0063.js","../chunks/index.0d3f7c7a.js","../chunks/stores.fe367015.js","../chunks/singletons.d3eb6a89.js"],import.meta.url),()=>S(()=>import("../nodes/2.884f839f.js"),["../nodes/2.884f839f.js","../chunks/index.0d3f7c7a.js","../chunks/stores.fe367015.js","../chunks/singletons.d3eb6a89.js"],import.meta.url)],oe=[],ae={"/":[2]},le={handleError:({error:a})=>{console.error(a)}};export{ae as dictionary,le as hooks,ie as matchers,re as nodes,se as root,oe as server_loads}; diff --git a/build/_app/immutable/entry/start.16f78682.js b/build/_app/immutable/entry/start.16f78682.js new file mode 100644 index 0000000000000000000000000000000000000000..f2b1fe7ecd8be025c85e380812792f01f5bd2798 --- /dev/null +++ b/build/_app/immutable/entry/start.16f78682.js @@ -0,0 +1,3 @@ +import{o as Ce,t as ye}from"../chunks/index.0d3f7c7a.js";import{S as Ge,a as Je,I as q,g as De,f as qe,b as we,c as le,s as V,i as _e,d as Q,e as J,P as Fe,h as We}from"../chunks/singletons.d3eb6a89.js";function Xe(t,o){return t==="/"||o==="ignore"?t:o==="never"?t.endsWith("/")?t.slice(0,-1):t:o==="always"&&!t.endsWith("/")?t+"/":t}function Ze(t){return t.split("%25").map(decodeURI).join("%25")}function Qe(t){for(const o in t)t[o]=decodeURIComponent(t[o]);return t}const et=["href","pathname","search","searchParams","toString","toJSON"];function tt(t,o){const u=new URL(t);for(const i of et)Object.defineProperty(u,i,{get(){return o(),t[i]},enumerable:!0,configurable:!0});return nt(u),u}function nt(t){Object.defineProperty(t,"hash",{get(){throw new Error("Cannot access event.url.hash. Consider using `$page.url.hash` inside a component instead")}})}const at="/__data.json";function rt(t){return t.replace(/\/$/,"")+at}function Ke(t){try{return JSON.parse(sessionStorage[t])}catch{}}function Me(t,o){const u=JSON.stringify(o);try{sessionStorage[t]=u}catch{}}function ot(...t){let o=5381;for(const u of t)if(typeof u=="string"){let i=u.length;for(;i;)o=o*33^u.charCodeAt(--i)}else if(ArrayBuffer.isView(u)){const i=new Uint8Array(u.buffer,u.byteOffset,u.byteLength);let d=i.length;for(;d;)o=o*33^i[--d]}else throw new TypeError("value must be a string or TypedArray");return(o>>>0).toString(36)}const fe=window.fetch;window.fetch=(t,o)=>((t instanceof Request?t.method:(o==null?void 0:o.method)||"GET")!=="GET"&&te.delete(Se(t)),fe(t,o));const te=new Map;function it(t,o){const u=Se(t,o),i=document.querySelector(u);if(i!=null&&i.textContent){const{body:d,...f}=JSON.parse(i.textContent),S=i.getAttribute("data-ttl");return S&&te.set(u,{body:d,init:f,ttl:1e3*Number(S)}),Promise.resolve(new Response(d,f))}return fe(t,o)}function st(t,o,u){if(te.size>0){const i=Se(t,u),d=te.get(i);if(d){if(performance.now(){const d=/^\[\.\.\.(\w+)(?:=(\w+))?\]$/.exec(i);if(d)return o.push({name:d[1],matcher:d[2],optional:!1,rest:!0,chained:!0}),"(?:/(.*))?";const f=/^\[\[(\w+)(?:=(\w+))?\]\]$/.exec(i);if(f)return o.push({name:f[1],matcher:f[2],optional:!0,rest:!1,chained:!0}),"(?:/([^/]+))?";if(!i)return;const S=i.split(/\[(.+?)\](?!\])/);return"/"+S.map((b,w)=>{if(w%2){if(b.startsWith("x+"))return be(String.fromCharCode(parseInt(b.slice(2),16)));if(b.startsWith("u+"))return be(String.fromCharCode(...b.slice(2).split("-").map(P=>parseInt(P,16))));const p=ct.exec(b);if(!p)throw new Error(`Invalid param: ${b}. Params and matcher names can only have underscores and alphanumeric characters.`);const[,C,N,k,T]=p;return o.push({name:k,matcher:T,optional:!!C,rest:!!N,chained:N?w===1&&S[0]==="":!1}),N?"(.*?)":C?"([^/]*)?":"([^/]+?)"}return be(b)}).join("")}).join("")}/?$`),params:o}}function ft(t){return!/^\([^)]+\)$/.test(t)}function ut(t){return t.slice(1).split("/").filter(ft)}function dt(t,o,u){const i={},d=t.slice(1);let f=0;for(let S=0;Sw).join("/"),f=0;continue}if(b===void 0){l.rest&&(i[l.name]="");continue}if(!l.matcher||u[l.matcher](b)){i[l.name]=b;const w=o[S+1],p=d[S+1];w&&!w.rest&&w.optional&&p&&(f=0);continue}if(l.optional&&l.chained){f++;continue}return}if(!f)return i}function be(t){return t.normalize().replace(/[[\]]/g,"\\$&").replace(/%/g,"%25").replace(/\//g,"%2[Ff]").replace(/\?/g,"%3[Ff]").replace(/#/g,"%23").replace(/[.*+?^${}()|\\]/g,"\\$&")}function pt({nodes:t,server_loads:o,dictionary:u,matchers:i}){const d=new Set(o);return Object.entries(u).map(([l,[b,w,p]])=>{const{pattern:C,params:N}=lt(l),k={id:l,exec:T=>{const P=C.exec(T);if(P)return dt(P,N,i)},errors:[1,...p||[]].map(T=>t[T]),layouts:[0,...w||[]].map(S),leaf:f(b)};return k.errors.length=k.layouts.length=Math.max(k.errors.length,k.layouts.length),k});function f(l){const b=l<0;return b&&(l=~l),[b,t[l]]}function S(l){return l===void 0?l:[d.has(l),t[l]]}}let ee=class{constructor(o,u){this.status=o,typeof u=="string"?this.body={message:u}:u?this.body=u:this.body={message:`Error: ${o}`}}toString(){return JSON.stringify(this.body)}},Ve=class{constructor(o,u){this.status=o,this.location=u}};async function ht(t){var o;for(const u in t)if(typeof((o=t[u])==null?void 0:o.then)=="function")return Object.fromEntries(await Promise.all(Object.entries(t).map(async([i,d])=>[i,await d])));return t}Object.getOwnPropertyNames(Object.prototype).sort().join("\0");const gt=-1,mt=-2,yt=-3,wt=-4,_t=-5,bt=-6;function vt(t,o){if(typeof t=="number")return d(t,!0);if(!Array.isArray(t)||t.length===0)throw new Error("Invalid input");const u=t,i=Array(u.length);function d(f,S=!1){if(f===gt)return;if(f===yt)return NaN;if(f===wt)return 1/0;if(f===_t)return-1/0;if(f===bt)return-0;if(S)throw new Error("Invalid input");if(f in i)return i[f];const l=u[f];if(!l||typeof l!="object")i[f]=l;else if(Array.isArray(l))if(typeof l[0]=="string"){const b=l[0],w=o==null?void 0:o[b];if(w)return i[f]=w(d(l[1]));switch(b){case"Date":i[f]=new Date(l[1]);break;case"Set":const p=new Set;i[f]=p;for(let k=1;ko!=null)}const kt="x-sveltekit-invalidated",K=Ke(Ge)??{},Z=Ke(Je)??{};function ve(t){K[t]=Q()}function Rt(t,o){var xe;const u=pt(t),i=t.nodes[0],d=t.nodes[1];i(),d();const f=document.documentElement,S=[],l=[];let b=null;const w={before_navigate:[],after_navigate:[]};let p={branch:[],error:null,url:null},C=!1,N=!1,k=!0,T=!1,P=!1,z=!1,H=!1,F,j=(xe=history.state)==null?void 0:xe[q];j||(j=Date.now(),history.replaceState({...history.state,[q]:j},"",location.href));const ue=K[j];ue&&(history.scrollRestoration="manual",scrollTo(ue.x,ue.y));let M,ne,ae;async function ke(){ae=ae||Promise.resolve(),await ae,ae=null;const e=new URL(location.href),n=W(e,!0);b=null;const r=ne={},a=n&&await he(n);if(r===ne&&a){if(a.type==="redirect")return re(new URL(a.location,e).href,{},[e.pathname],r);a.props.page!==void 0&&(M=a.props.page),F.$set(a.props)}}function Re(e){l.some(n=>n==null?void 0:n.snapshot)&&(Z[e]=l.map(n=>{var r;return(r=n==null?void 0:n.snapshot)==null?void 0:r.capture()}))}function Ae(e){var n;(n=Z[e])==null||n.forEach((r,a)=>{var s,c;(c=(s=l[a])==null?void 0:s.snapshot)==null||c.restore(r)})}function Le(){ve(j),Me(Ge,K),Re(j),Me(Je,Z)}async function re(e,{noScroll:n=!1,replaceState:r=!1,keepFocus:a=!1,state:s={},invalidateAll:c=!1},g,m){return typeof e=="string"&&(e=new URL(e,De(document))),ce({url:e,scroll:n?Q():null,keepfocus:a,redirect_chain:g,details:{state:s,replaceState:r},nav_token:m,accepted:()=>{c&&(H=!0)},blocked:()=>{},type:"goto"})}async function Oe(e){return b={id:e.id,promise:he(e).then(n=>(n.type==="loaded"&&n.state.error&&(b=null),n))},b.promise}async function oe(...e){const r=u.filter(a=>e.some(s=>a.exec(s))).map(a=>Promise.all([...a.layouts,a.leaf].map(s=>s==null?void 0:s[1]())));await Promise.all(r)}function Ie(e){var a;p=e.state;const n=document.querySelector("style[data-sveltekit]");n&&n.remove(),M=e.props.page,F=new t.root({target:o,props:{...e.props,stores:V,components:l},hydrate:!0}),Ae(j);const r={from:null,to:{params:p.params,route:{id:((a=p.route)==null?void 0:a.id)??null},url:new URL(location.href)},willUnload:!1,type:"enter"};w.after_navigate.forEach(s=>s(r)),N=!0}async function Y({url:e,params:n,branch:r,status:a,error:s,route:c,form:g}){let m="never";for(const _ of r)(_==null?void 0:_.slash)!==void 0&&(m=_.slash);e.pathname=Xe(e.pathname,m),e.search=e.search;const v={type:"loaded",state:{url:e,params:n,branch:r,error:s,route:c},props:{constructors:St(r).map(_=>_.node.component)}};g!==void 0&&(v.props.form=g);let y={},R=!M,L=0;for(let _=0;_(m.params.add(U),h[U])}),data:(c==null?void 0:c.data)??null,url:tt(r,()=>{m.url=!0}),async fetch(h,U){let x;h instanceof Request?(x=h.url,U={body:h.method==="GET"||h.method==="HEAD"?void 0:await h.blob(),cache:h.cache,credentials:h.credentials,headers:h.headers,integrity:h.integrity,keepalive:h.keepalive,method:h.method,mode:h.mode,redirect:h.redirect,referrer:h.referrer,referrerPolicy:h.referrerPolicy,signal:h.signal,...U}):x=h;const D=new URL(x,r);return I(D.href),D.origin===r.origin&&(x=D.href.slice(r.origin.length)),N?st(x,D.href,U):it(x,U)},setHeaders:()=>{},depends:I,parent(){return m.parent=!0,n()}};g=await v.universal.load.call(null,_)??null,g=g?await ht(g):null}return{node:v,loader:e,server:c,universal:(R=v.universal)!=null&&R.load?{type:"data",data:g,uses:m}:null,data:g??(c==null?void 0:c.data)??null,slash:((L=v.universal)==null?void 0:L.trailingSlash)??(c==null?void 0:c.slash)}}function Pe(e,n,r,a,s){if(H)return!0;if(!a)return!1;if(a.parent&&e||a.route&&n||a.url&&r)return!0;for(const c of a.params)if(s[c]!==p.params[c])return!0;for(const c of a.dependencies)if(S.some(g=>g(new URL(c))))return!0;return!1}function pe(e,n){return(e==null?void 0:e.type)==="data"?e:(e==null?void 0:e.type)==="skip"?n??null:null}async function he({id:e,invalidating:n,url:r,params:a,route:s}){if((b==null?void 0:b.id)===e)return b.promise;const{errors:c,layouts:g,leaf:m}=s,v=[...g,m];c.forEach(E=>E==null?void 0:E().catch(()=>{})),v.forEach(E=>E==null?void 0:E[1]().catch(()=>{}));let y=null;const R=p.url?e!==p.url.pathname+p.url.search:!1,L=p.route?s.id!==p.route.id:!1;let I=!1;const _=v.map((E,O)=>{var G;const A=p.branch[O],$=!!(E!=null&&E[0])&&((A==null?void 0:A.loader)!==E[1]||Pe(I,L,R,(G=A.server)==null?void 0:G.uses,a));return $&&(I=!0),$});if(_.some(Boolean)){try{y=await He(r,_)}catch(E){return ie({status:E instanceof ee?E.status:500,error:await X(E,{url:r,params:a,route:{id:s.id}}),url:r,route:s})}if(y.type==="redirect")return y}const h=y==null?void 0:y.nodes;let U=!1;const x=v.map(async(E,O)=>{var ge;if(!E)return;const A=p.branch[O],$=h==null?void 0:h[O];if((!$||$.type==="skip")&&E[1]===(A==null?void 0:A.loader)&&!Pe(U,L,R,(ge=A.universal)==null?void 0:ge.uses,a))return A;if(U=!0,($==null?void 0:$.type)==="error")throw $;return de({loader:E[1],url:r,params:a,route:s,parent:async()=>{var $e;const je={};for(let me=0;me{});const D=[];for(let E=0;EPromise.resolve({}),server_data_node:pe(c)}),v={node:await d(),loader:d,universal:null,server:null,data:null};return await Y({url:r,params:s,branch:[m,v],status:e,error:n,route:null})}function W(e,n){if(_e(e,J))return;const r=se(e);for(const a of u){const s=a.exec(r);if(s)return{id:e.pathname+e.search,invalidating:n,route:a,params:Qe(s),url:e}}}function se(e){return Ze(e.pathname.slice(J.length)||"/")}function Ne({url:e,type:n,intent:r,delta:a}){var m,v;let s=!1;const c={from:{params:p.params,route:{id:((m=p.route)==null?void 0:m.id)??null},url:p.url},to:{params:(r==null?void 0:r.params)??null,route:{id:((v=r==null?void 0:r.route)==null?void 0:v.id)??null},url:e},willUnload:!r,type:n};a!==void 0&&(c.delta=a);const g={...c,cancel:()=>{s=!0}};return P||w.before_navigate.forEach(y=>y(g)),s?null:c}async function ce({url:e,scroll:n,keepfocus:r,redirect_chain:a,details:s,type:c,delta:g,nav_token:m={},accepted:v,blocked:y}){var x,D,E;const R=W(e,!1),L=Ne({url:e,type:c,delta:g,intent:R});if(!L){y();return}const I=j;v(),P=!0,N&&V.navigating.set(L),ne=m;let _=R&&await he(R);if(!_){if(_e(e,J))return await B(e);_=await Te(e,{id:null},await X(new Error(`Not found: ${e.pathname}`),{url:e,params:{},route:{id:null}}),404)}if(e=(R==null?void 0:R.url)||e,ne!==m)return!1;if(_.type==="redirect")if(a.length>10||a.includes(e.pathname))_=await ie({status:500,error:await X(new Error("Redirect loop"),{url:e,params:{},route:{id:null}}),url:e,route:{id:null}});else return re(new URL(_.location,e).href,{},[...a,e.pathname],m),!1;else((x=_.props.page)==null?void 0:x.status)>=400&&await V.updated.check()&&await B(e);if(S.length=0,H=!1,T=!0,ve(I),Re(I),(D=_.props.page)!=null&&D.url&&_.props.page.url.pathname!==e.pathname&&(e.pathname=(E=_.props.page)==null?void 0:E.url.pathname),s){const O=s.replaceState?0:1;if(s.state[q]=j+=O,history[s.replaceState?"replaceState":"pushState"](s.state,"",e),!s.replaceState){let A=j+1;for(;Z[A]||K[A];)delete Z[A],delete K[A],A+=1}}b=null,N?(p=_.state,_.props.page&&(_.props.page.url=e),F.$set(_.props)):Ie(_);const{activeElement:h}=document;if(await ye(),k){const O=e.hash&&document.getElementById(decodeURIComponent(e.hash.slice(1)));n?scrollTo(n.x,n.y):O?O.scrollIntoView():scrollTo(0,0)}const U=document.activeElement!==h&&document.activeElement!==document.body;!r&&!U&&Ee(),k=!0,_.props.page&&(M=_.props.page),P=!1,c==="popstate"&&Ae(j),w.after_navigate.forEach(O=>O(L)),V.navigating.set(null),T=!1}async function Te(e,n,r,a){return e.origin===location.origin&&e.pathname===location.pathname&&!C?await ie({status:a,error:r,url:e,route:n}):await B(e)}function B(e){return location.href=e.href,new Promise(()=>{})}function Ye(){let e;f.addEventListener("mousemove",c=>{const g=c.target;clearTimeout(e),e=setTimeout(()=>{a(g,2)},20)});function n(c){a(c.composedPath()[0],1)}f.addEventListener("mousedown",n),f.addEventListener("touchstart",n,{passive:!0});const r=new IntersectionObserver(c=>{for(const g of c)g.isIntersecting&&(oe(se(new URL(g.target.href))),r.unobserve(g.target))},{threshold:0});function a(c,g){const m=qe(c,f);if(!m)return;const{url:v,external:y,download:R}=we(m,J);if(y||R)return;const L=le(m);if(!L.reload)if(g<=L.preload_data){const I=W(v,!1);I&&Oe(I)}else g<=L.preload_code&&oe(se(v))}function s(){r.disconnect();for(const c of f.querySelectorAll("a")){const{url:g,external:m,download:v}=we(c,J);if(m||v)continue;const y=le(c);y.reload||(y.preload_code===Fe.viewport&&r.observe(c),y.preload_code===Fe.eager&&oe(se(g)))}}w.after_navigate.push(s),s()}function X(e,n){return e instanceof ee?e.body:t.hooks.handleError({error:e,event:n})??{message:n.route.id!=null?"Internal Error":"Not Found"}}return{after_navigate:e=>{Ce(()=>(w.after_navigate.push(e),()=>{const n=w.after_navigate.indexOf(e);w.after_navigate.splice(n,1)}))},before_navigate:e=>{Ce(()=>(w.before_navigate.push(e),()=>{const n=w.before_navigate.indexOf(e);w.before_navigate.splice(n,1)}))},disable_scroll_handling:()=>{(T||!N)&&(k=!1)},goto:(e,n={})=>re(e,n,[]),invalidate:e=>{if(typeof e=="function")S.push(e);else{const{href:n}=new URL(e,location.href);S.push(r=>r.href===n)}return ke()},invalidate_all:()=>(H=!0,ke()),preload_data:async e=>{const n=new URL(e,De(document)),r=W(n,!1);if(!r)throw new Error(`Attempted to preload a URL that does not belong to this app: ${n}`);await Oe(r)},preload_code:oe,apply_action:async e=>{if(e.type==="error"){const n=new URL(location.href),{branch:r,route:a}=p;if(!a)return;const s=await Ue(p.branch.length,r,a.errors);if(s){const c=await Y({url:n,params:p.params,branch:r.slice(0,s.idx).concat(s.node),status:e.status??500,error:e.error,route:a});p=c.state,F.$set(c.props),ye().then(Ee)}}else e.type==="redirect"?re(e.location,{invalidateAll:!0},[]):(F.$set({form:null,page:{...M,form:e.data,status:e.status}}),await ye(),F.$set({form:e.data}),e.type==="success"&&Ee())},_start_router:()=>{var e;history.scrollRestoration="manual",addEventListener("beforeunload",n=>{var a;let r=!1;if(Le(),!P){const s={from:{params:p.params,route:{id:((a=p.route)==null?void 0:a.id)??null},url:p.url},to:null,willUnload:!0,type:"leave",cancel:()=>r=!0};w.before_navigate.forEach(c=>c(s))}r?(n.preventDefault(),n.returnValue=""):history.scrollRestoration="auto"}),addEventListener("visibilitychange",()=>{document.visibilityState==="hidden"&&Le()}),(e=navigator.connection)!=null&&e.saveData||Ye(),f.addEventListener("click",n=>{if(n.button||n.which!==1||n.metaKey||n.ctrlKey||n.shiftKey||n.altKey||n.defaultPrevented)return;const r=qe(n.composedPath()[0],f);if(!r)return;const{url:a,external:s,target:c,download:g}=we(r,J);if(!a)return;if(c==="_parent"||c==="_top"){if(window.parent!==window)return}else if(c&&c!=="_self")return;const m=le(r);if(!(r instanceof SVGAElement)&&a.protocol!==location.protocol&&!(a.protocol==="https:"||a.protocol==="http:")||g)return;if(s||m.reload){Ne({url:a,type:"link"})?P=!0:n.preventDefault();return}const[y,R]=a.href.split("#");if(R!==void 0&&y===location.href.split("#")[0]){if(z=!0,ve(j),p.url=a,V.page.set({...M,url:a}),V.page.notify(),!m.replace_state)return;z=!1,n.preventDefault()}ce({url:a,scroll:m.noscroll?Q():null,keepfocus:m.keep_focus??!1,redirect_chain:[],details:{state:{},replaceState:m.replace_state??a.href===location.href},accepted:()=>n.preventDefault(),blocked:()=>n.preventDefault(),type:"link"})}),f.addEventListener("submit",n=>{if(n.defaultPrevented)return;const r=HTMLFormElement.prototype.cloneNode.call(n.target),a=n.submitter;if(((a==null?void 0:a.formMethod)||r.method)!=="get")return;const c=new URL((a==null?void 0:a.hasAttribute("formaction"))&&(a==null?void 0:a.formAction)||r.action);if(_e(c,J))return;const g=n.target,{keep_focus:m,noscroll:v,reload:y,replace_state:R}=le(g);if(y)return;n.preventDefault(),n.stopPropagation();const L=new FormData(g),I=a==null?void 0:a.getAttribute("name");I&&L.append(I,(a==null?void 0:a.getAttribute("value"))??""),c.search=new URLSearchParams(L).toString(),ce({url:c,scroll:v?Q():null,keepfocus:m??!1,redirect_chain:[],details:{state:{},replaceState:R??c.href===location.href},nav_token:{},accepted:()=>{},blocked:()=>{},type:"form"})}),addEventListener("popstate",async n=>{var r;if((r=n.state)!=null&&r[q]){if(n.state[q]===j)return;const a=K[n.state[q]];if(p.url.href.split("#")[0]===location.href.split("#")[0]){K[j]=Q(),j=n.state[q],scrollTo(a.x,a.y);return}const s=n.state[q]-j;await ce({url:new URL(location.href),scroll:a,keepfocus:!1,redirect_chain:[],details:null,accepted:()=>{j=n.state[q]},blocked:()=>{history.go(-s)},type:"popstate",delta:s})}}),addEventListener("hashchange",()=>{z&&(z=!1,history.replaceState({...history.state,[q]:++j},"",location.href))});for(const n of document.querySelectorAll("link"))n.rel==="icon"&&(n.href=n.href);addEventListener("pageshow",n=>{n.persisted&&V.navigating.set(null)})},_hydrate:async({status:e=200,error:n,node_ids:r,params:a,route:s,data:c,form:g})=>{C=!0;const m=new URL(location.href);({params:a={},route:s={id:null}}=W(m,!1)||{});let v;try{const y=r.map(async(I,_)=>{const h=c[_];return h!=null&&h.uses&&(h.uses=Be(h.uses)),de({loader:t.nodes[I],url:m,params:a,route:s,parent:async()=>{const U={};for(let x=0;x<_;x+=1)Object.assign(U,(await y[x]).data);return U},server_data_node:pe(h)})}),R=await Promise.all(y),L=u.find(({id:I})=>I===s.id);if(L){const I=L.layouts;for(let _=0;_d?"1":"0").join(""));const i=await fe(u.href);if(!i.ok)throw new ee(i.status,await i.json());return new Promise(async d=>{var p;const f=new Map,S=i.body.getReader(),l=new TextDecoder;function b(C){return vt(C,{Promise:N=>new Promise((k,T)=>{f.set(N,{fulfil:k,reject:T})})})}let w="";for(;;){const{done:C,value:N}=await S.read();if(C&&!w)break;for(w+=!N&&w?` +`:l.decode(N);;){const k=w.indexOf(` +`);if(k===-1)break;const T=JSON.parse(w.slice(0,k));if(w=w.slice(k+1),T.type==="redirect")return d(T);if(T.type==="data")(p=T.nodes)==null||p.forEach(P=>{(P==null?void 0:P.type)==="data"&&(P.uses=Be(P.uses),P.data=b(P.data))}),d(T);else if(T.type==="chunk"){const{id:P,data:z,error:H}=T,F=f.get(P);f.delete(P),H?F.reject(b(H)):F.fulfil(b(z))}}}})}function Be(t){return{dependencies:new Set((t==null?void 0:t.dependencies)??[]),params:new Set((t==null?void 0:t.params)??[]),parent:!!(t!=null&&t.parent),route:!!(t!=null&&t.route),url:!!(t!=null&&t.url)}}function Ee(){const t=document.querySelector("[autofocus]");if(t)t.focus();else{const o=document.body,u=o.getAttribute("tabindex");o.tabIndex=-1,o.focus({preventScroll:!0,focusVisible:!1}),u!==null?o.setAttribute("tabindex",u):o.removeAttribute("tabindex");const i=getSelection();if(i&&i.type!=="None"){const d=[];for(let f=0;f{if(i.rangeCount===d.length){for(let f=0;f{"$$scope"in o&&a(0,e=o.$$scope)},[e,t]}class S extends l{constructor(s){super(),r(this,s,g,$,i,{})}}export{S as component,y as universal}; diff --git a/build/_app/immutable/nodes/1.045d0063.js b/build/_app/immutable/nodes/1.045d0063.js new file mode 100644 index 0000000000000000000000000000000000000000..3c30f7ccb78c27f0c07f6df1bef18cd52e95701a --- /dev/null +++ b/build/_app/immutable/nodes/1.045d0063.js @@ -0,0 +1 @@ +import{S as x,i as H,s as S,k as u,q as h,a as g,l as d,m as v,r as b,h as m,c as k,b as _,G as E,u as $,H as q,I as y}from"../chunks/index.0d3f7c7a.js";import{p as C}from"../chunks/stores.fe367015.js";function G(l){var f;let a,t=l[0].status+"",r,o,n,p=((f=l[0].error)==null?void 0:f.message)+"",c;return{c(){a=u("h1"),r=h(t),o=g(),n=u("p"),c=h(p)},l(e){a=d(e,"H1",{});var s=v(a);r=b(s,t),s.forEach(m),o=k(e),n=d(e,"P",{});var i=v(n);c=b(i,p),i.forEach(m)},m(e,s){_(e,a,s),E(a,r),_(e,o,s),_(e,n,s),E(n,c)},p(e,[s]){var i;s&1&&t!==(t=e[0].status+"")&&$(r,t),s&1&&p!==(p=((i=e[0].error)==null?void 0:i.message)+"")&&$(c,p)},i:q,o:q,d(e){e&&m(a),e&&m(o),e&&m(n)}}}function I(l,a,t){let r;return y(l,C,o=>t(0,r=o)),[r]}class w extends x{constructor(a){super(),H(this,a,I,G,S,{})}}export{w as component}; diff --git a/build/_app/immutable/nodes/2.884f839f.js b/build/_app/immutable/nodes/2.884f839f.js new file mode 100644 index 0000000000000000000000000000000000000000..30d66b50b0874189de088346b109b36963094e59 --- /dev/null +++ b/build/_app/immutable/nodes/2.884f839f.js @@ -0,0 +1,9 @@ +import{S as Q,i as X,s as Y,k as o,a as z,q as I,l as c,m as n,h as a,c as M,r as D,J as W,n as e,b as L,G as s,H as O,I as Z,o as $,K as tt,L as et,u as st}from"../chunks/index.0d3f7c7a.js";import{p as lt}from"../chunks/stores.fe367015.js";function R(V){let t,l,h,w,f,m,u,x,r,A,i,v,E,d,S,k,C;return{c(){t=o("div"),l=o("iframe"),w=z(),f=o("div"),m=z(),u=o("div"),x=z(),r=o("div"),A=z(),i=o("div"),v=z(),E=o("div"),d=o("p"),S=I("SPACE to jump. "),k=o("a"),C=I("Full shaders game demo"),this.h()},l(b){t=c(b,"DIV",{class:!0});var p=n(t);l=c(p,"IFRAME",{src:!0,frameborder:!0,title:!0,height:!0,width:!0,class:!0}),n(l).forEach(a),w=M(p),f=c(p,"DIV",{class:!0}),n(f).forEach(a),m=M(p),u=c(p,"DIV",{class:!0}),n(u).forEach(a),x=M(p),r=c(p,"DIV",{class:!0}),n(r).forEach(a),A=M(p),i=c(p,"DIV",{class:!0}),n(i).forEach(a),p.forEach(a),v=M(b),E=c(b,"DIV",{class:!0});var j=n(E);d=c(j,"P",{});var G=n(d);S=D(G,"SPACE to jump. "),k=c(G,"A",{href:!0,target:!0,class:!0});var H=n(k);C=D(H,"Full shaders game demo"),H.forEach(a),G.forEach(a),j.forEach(a),this.h()},h(){W(l.src,h="smg/index.html")||e(l,"src",h),e(l,"frameborder","0"),e(l,"title","Spaceship Drift"),e(l,"height","512"),e(l,"width","768"),e(l,"class",""),e(f,"class","h-[3px] bg-[#0C0F19] w-[3px] z-10 absolute -top-[3px] -left-[3px]"),e(u,"class","h-[3px] bg-[#0C0F19] w-[3px] z-10 absolute -bottom-[3px] -left-[3px]"),e(r,"class","h-[3px] bg-[#0C0F19] w-[3px] z-10 absolute -top-[3px] -right-[3px]"),e(i,"class","h-[3px] bg-[#0C0F19] w-[3px] z-10 absolute -bottom-[3px] -right-[3px]"),e(t,"class","relative mt-6 border-slate-800 border-[3px]"),e(k,"href","https://x.com/HugoDuprez/status/1712093324528541831?s=20"),e(k,"target","_blank"),e(k,"class","underline"),e(E,"class","flex flex-row justify-center items-center text-[9px] mt-4 text-slate-500")},m(b,p){L(b,t,p),s(t,l),s(t,w),s(t,f),s(t,m),s(t,u),s(t,x),s(t,r),s(t,A),s(t,i),L(b,v,p),L(b,E,p),s(E,d),s(d,S),s(d,k),s(k,C)},d(b){b&&a(t),b&&a(v),b&&a(E)}}}function U(V){let t,l,h,w,f,m,u=V[1]?"Copied!":"Copy the link for later",x,r,A;return{c(){t=o("div"),l=o("p"),h=I("Looks like you're on mobile! Please visit on your laptop."),w=z(),f=o("button"),m=o("p"),x=I(u),this.h()},l(i){t=c(i,"DIV",{class:!0});var v=n(t);l=c(v,"P",{class:!0});var E=n(l);h=D(E,"Looks like you're on mobile! Please visit on your laptop."),E.forEach(a),w=M(v),f=c(v,"BUTTON",{class:!0});var d=n(f);m=c(d,"P",{class:!0});var S=n(m);x=D(S,u),S.forEach(a),d.forEach(a),v.forEach(a),this.h()},h(){e(l,"class","text-xs text-slate-500 mt-6"),e(m,"class","mt-1"),e(f,"class","flex flex-row justify-center items-center px-3 py-5 text-xs w-full bg-slate-800 mt-6"),e(t,"class","flex flex-col justify-center items-center mt-10 text-center")},m(i,v){L(i,t,v),s(t,l),s(l,h),s(t,w),s(t,f),s(f,m),s(m,x),r||(A=tt(f,"click",et(V[2])),r=!0)},p(i,v){v&2&&u!==(u=i[1]?"Copied!":"Copy the link for later")&&st(x,u)},d(i){i&&a(t),r=!1,A()}}}function at(V){let t,l,h,w,f,m,u,x,r,A,i,v,E,d,S,k,C,b,p,j,G,H,g=!V[0]&&R(),_=V[0]&&U(V);return{c(){t=o("div"),l=o("div"),h=o("img"),f=z(),g&&g.c(),m=z(),_&&_.c(),u=z(),x=o("div"),r=o("p"),A=I("Made by "),i=o("a"),v=I("Hugo"),E=I(` + with + `),d=o("a"),S=I("Godot"),k=I(`, + `),C=o("a"),b=I("Svelte"),p=I(`, and + `),j=o("a"),G=I("Kenney assets"),this.h()},l(P){t=c(P,"DIV",{class:!0});var y=n(t);l=c(y,"DIV",{class:!0});var T=n(l);h=c(T,"IMG",{src:!0,alt:!0,class:!0}),T.forEach(a),f=M(y),g&&g.l(y),m=M(y),_&&_.l(y),u=M(y),x=c(y,"DIV",{class:!0});var q=n(x);r=c(q,"P",{});var F=n(r);A=D(F,"Made by "),i=c(F,"A",{href:!0,target:!0,class:!0});var K=n(i);v=D(K,"Hugo"),K.forEach(a),E=D(F,` + with + `),d=c(F,"A",{href:!0,target:!0,class:!0});var B=n(d);S=D(B,"Godot"),B.forEach(a),k=D(F,`, + `),C=c(F,"A",{href:!0,target:!0,class:!0});var J=n(C);b=D(J,"Svelte"),J.forEach(a),p=D(F,`, and + `),j=c(F,"A",{href:!0,target:!0,class:!0});var N=n(j);G=D(N,"Kenney assets"),N.forEach(a),F.forEach(a),q.forEach(a),y.forEach(a),this.h()},h(){W(h.src,w="images/png_title.png")||e(h,"src",w),e(h,"alt","Game title"),e(h,"class","h-48"),e(l,"class","flex flex-col justify-center items-center space-y-4 text-center sm:mt-20 mt-12"),e(i,"href","https://www.hugoduprez.com/"),e(i,"target","_blank"),e(i,"class","underline"),e(d,"href","https://godotengine.org/"),e(d,"target","_blank"),e(d,"class","underline"),e(C,"href","https://svelte.dev/"),e(C,"target","_blank"),e(C,"class","underline"),e(j,"href","https://www.kenney.nl/tools"),e(j,"target","_blank"),e(j,"class","underline"),e(x,"class",H="flex flex-row justify-center items-center text-center "+(V[0]?"mt-20":"fixed bottom-6")+" text-[9px] text-slate-500"),e(t,"class","flex flex-col justify-center text-slate-100 font-Hellovetica items-center p-4 w-full")},m(P,y){L(P,t,y),s(t,l),s(l,h),s(t,f),g&&g.m(t,null),s(t,m),_&&_.m(t,null),s(t,u),s(t,x),s(x,r),s(r,A),s(r,i),s(i,v),s(r,E),s(r,d),s(d,S),s(r,k),s(r,C),s(C,b),s(r,p),s(r,j),s(j,G)},p(P,[y]){P[0]?g&&(g.d(1),g=null):g||(g=R(),g.c(),g.m(t,m)),P[0]?_?_.p(P,y):(_=U(P),_.c(),_.m(t,u)):_&&(_.d(1),_=null),y&1&&H!==(H="flex flex-row justify-center items-center text-center "+(P[0]?"mt-20":"fixed bottom-6")+" text-[9px] text-slate-500")&&e(x,"class",H)},i:O,o:O,d(P){P&&a(t),g&&g.d(),_&&_.d()}}}function rt(V,t,l){let h;Z(V,lt,u=>l(3,h=u));let w=!1,f=!1;$(()=>{window.innerWidth<768&&l(0,w=!0)});function m(){navigator.clipboard.writeText(h.url.toString()),l(1,f=!0)}return[w,f,m]}class ct extends Q{constructor(t){super(),X(this,t,rt,at,Y,{})}}export{ct as component}; diff --git a/build/_app/version.json b/build/_app/version.json new file mode 100644 index 0000000000000000000000000000000000000000..19746d68bb224a68e4e771fe00916a64f2ed91b7 --- /dev/null +++ b/build/_app/version.json @@ -0,0 +1 @@ +{"version":"1697963191981"} \ No newline at end of file diff --git a/build/favicon.png b/build/favicon.png new file mode 100644 index 0000000000000000000000000000000000000000..825b9e65af7c104cfb07089bb28659393b4f2097 Binary files /dev/null and b/build/favicon.png differ diff --git a/build/fonts/hellovetica.ttf b/build/fonts/hellovetica.ttf new file mode 100644 index 0000000000000000000000000000000000000000..f9d262b4210a8ceb00a374e0ab95ca48f66c9e48 Binary files /dev/null and b/build/fonts/hellovetica.ttf differ diff --git a/build/images/png_title.png b/build/images/png_title.png new file mode 100644 index 0000000000000000000000000000000000000000..b9112a835c486a37c01bc6e482821fb3260b69a7 Binary files /dev/null and b/build/images/png_title.png differ diff --git a/build/images/sky.png b/build/images/sky.png new file mode 100644 index 0000000000000000000000000000000000000000..dd831dddcd3a6dfe0474db37389893205030c73f Binary files /dev/null and b/build/images/sky.png differ diff --git a/build/index.html b/build/index.html new file mode 100644 index 0000000000000000000000000000000000000000..3d9b6933177543591e0841eb5715a0c6b968cb3d --- /dev/null +++ b/build/index.html @@ -0,0 +1,75 @@ + + + + Spaceship freeride + + + + + + + + + + + + + + + +
+ + + +
+
Game title
+ +
+ + +
+
+
+
+ + +

SPACE to jump. Full shaders game demo

+ + + + +

Made by Hugo + with + Godot, + Svelte, and + Kenney assets

+ + + + +
+ + diff --git a/build/smg/coi-serviceworker.min.js b/build/smg/coi-serviceworker.min.js new file mode 100644 index 0000000000000000000000000000000000000000..e79fce1c13cda3300ae32e9e2e91348da818a5f8 --- /dev/null +++ b/build/smg/coi-serviceworker.min.js @@ -0,0 +1,2 @@ +/*! coi-serviceworker v0.1.7 - Guido Zuidhof and contributors, licensed under MIT */ +let coepCredentialless=!1;"undefined"==typeof window?(self.addEventListener("install",(()=>self.skipWaiting())),self.addEventListener("activate",(e=>e.waitUntil(self.clients.claim()))),self.addEventListener("message",(e=>{e.data&&("deregister"===e.data.type?self.registration.unregister().then((()=>self.clients.matchAll())).then((e=>{e.forEach((e=>e.navigate(e.url)))})):"coepCredentialless"===e.data.type&&(coepCredentialless=e.data.value))})),self.addEventListener("fetch",(function(e){const r=e.request;if("only-if-cached"===r.cache&&"same-origin"!==r.mode)return;const s=coepCredentialless&&"no-cors"===r.mode?new Request(r,{credentials:"omit"}):r;e.respondWith(fetch(s).then((e=>{if(0===e.status)return e;const r=new Headers(e.headers);return r.set("Cross-Origin-Embedder-Policy",coepCredentialless?"credentialless":"require-corp"),coepCredentialless||r.set("Cross-Origin-Resource-Policy","cross-origin"),r.set("Cross-Origin-Opener-Policy","same-origin"),new Response(e.body,{status:e.status,statusText:e.statusText,headers:r})})).catch((e=>console.error(e))))}))):(()=>{const e={shouldRegister:()=>!0,shouldDeregister:()=>!1,coepCredentialless:()=>(window.chrome!==undefined||window.netscape!==undefined),doReload:()=>window.location.reload(),quiet:!1,...window.coi},r=navigator;r.serviceWorker&&r.serviceWorker.controller&&(r.serviceWorker.controller.postMessage({type:"coepCredentialless",value:e.coepCredentialless()}),e.shouldDeregister()&&r.serviceWorker.controller.postMessage({type:"deregister"})),!1===window.crossOriginIsolated&&e.shouldRegister()&&(window.isSecureContext?r.serviceWorker&&r.serviceWorker.register(window.document.currentScript.src).then((s=>{!e.quiet&&console.log("COOP/COEP Service Worker registered",s.scope),s.addEventListener("updatefound",(()=>{!e.quiet&&console.log("Reloading page to make use of updated COOP/COEP Service Worker."),e.doReload()})),s.active&&!r.serviceWorker.controller&&(!e.quiet&&console.log("Reloading page to make use of COOP/COEP Service Worker."),e.doReload())}),(r=>{!e.quiet&&console.error("COOP/COEP Service Worker failed to register:",r)})):!e.quiet&&console.log("COOP/COEP Service Worker not registered, a secure context is required."))})(); diff --git a/build/smg/index.apple-touch-icon.png b/build/smg/index.apple-touch-icon.png new file mode 100644 index 0000000000000000000000000000000000000000..b086a998f0c979fac120939a54eb051bd4b13f47 Binary files /dev/null and b/build/smg/index.apple-touch-icon.png differ diff --git a/build/smg/index.audio.worklet.js b/build/smg/index.audio.worklet.js new file mode 100644 index 0000000000000000000000000000000000000000..89b581b3d6fae0561c19549bc1f3471e9d1c4762 --- /dev/null +++ b/build/smg/index.audio.worklet.js @@ -0,0 +1,213 @@ +/**************************************************************************/ +/* audio.worklet.js */ +/**************************************************************************/ +/* This file is part of: */ +/* GODOT ENGINE */ +/* https://godotengine.org */ +/**************************************************************************/ +/* Copyright (c) 2014-present Godot Engine contributors (see AUTHORS.md). */ +/* Copyright (c) 2007-2014 Juan Linietsky, Ariel Manzur. */ +/* */ +/* Permission is hereby granted, free of charge, to any person obtaining */ +/* a copy of this software and associated documentation files (the */ +/* "Software"), to deal in the Software without restriction, including */ +/* without limitation the rights to use, copy, modify, merge, publish, */ +/* distribute, sublicense, and/or sell copies of the Software, and to */ +/* permit persons to whom the Software is furnished to do so, subject to */ +/* the following conditions: */ +/* */ +/* The above copyright notice and this permission notice shall be */ +/* included in all copies or substantial portions of the Software. */ +/* */ +/* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, */ +/* EXPRESS OR IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF */ +/* MERCHANTABILITY, FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. */ +/* IN NO EVENT SHALL THE AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY */ +/* CLAIM, DAMAGES OR OTHER LIABILITY, WHETHER IN AN ACTION OF CONTRACT, */ +/* TORT OR OTHERWISE, ARISING FROM, OUT OF OR IN CONNECTION WITH THE */ +/* SOFTWARE OR THE USE OR OTHER DEALINGS IN THE SOFTWARE. */ +/**************************************************************************/ + +class RingBuffer { + constructor(p_buffer, p_state, p_threads) { + this.buffer = p_buffer; + this.avail = p_state; + this.threads = p_threads; + this.rpos = 0; + this.wpos = 0; + } + + data_left() { + return this.threads ? Atomics.load(this.avail, 0) : this.avail; + } + + space_left() { + return this.buffer.length - this.data_left(); + } + + read(output) { + const size = this.buffer.length; + let from = 0; + let to_write = output.length; + if (this.rpos + to_write > size) { + const high = size - this.rpos; + output.set(this.buffer.subarray(this.rpos, size)); + from = high; + to_write -= high; + this.rpos = 0; + } + if (to_write) { + output.set(this.buffer.subarray(this.rpos, this.rpos + to_write), from); + } + this.rpos += to_write; + if (this.threads) { + Atomics.add(this.avail, 0, -output.length); + Atomics.notify(this.avail, 0); + } else { + this.avail -= output.length; + } + } + + write(p_buffer) { + const to_write = p_buffer.length; + const mw = this.buffer.length - this.wpos; + if (mw >= to_write) { + this.buffer.set(p_buffer, this.wpos); + this.wpos += to_write; + if (mw === to_write) { + this.wpos = 0; + } + } else { + const high = p_buffer.subarray(0, mw); + const low = p_buffer.subarray(mw); + this.buffer.set(high, this.wpos); + this.buffer.set(low); + this.wpos = low.length; + } + if (this.threads) { + Atomics.add(this.avail, 0, to_write); + Atomics.notify(this.avail, 0); + } else { + this.avail += to_write; + } + } +} + +class GodotProcessor extends AudioWorkletProcessor { + constructor() { + super(); + this.threads = false; + this.running = true; + this.lock = null; + this.notifier = null; + this.output = null; + this.output_buffer = new Float32Array(); + this.input = null; + this.input_buffer = new Float32Array(); + this.port.onmessage = (event) => { + const cmd = event.data['cmd']; + const data = event.data['data']; + this.parse_message(cmd, data); + }; + } + + process_notify() { + if (this.notifier) { + Atomics.add(this.notifier, 0, 1); + Atomics.notify(this.notifier, 0); + } + } + + parse_message(p_cmd, p_data) { + if (p_cmd === 'start' && p_data) { + const state = p_data[0]; + let idx = 0; + this.threads = true; + this.lock = state.subarray(idx, ++idx); + this.notifier = state.subarray(idx, ++idx); + const avail_in = state.subarray(idx, ++idx); + const avail_out = state.subarray(idx, ++idx); + this.input = new RingBuffer(p_data[1], avail_in, true); + this.output = new RingBuffer(p_data[2], avail_out, true); + } else if (p_cmd === 'stop') { + this.running = false; + this.output = null; + this.input = null; + this.lock = null; + this.notifier = null; + } else if (p_cmd === 'start_nothreads') { + this.output = new RingBuffer(p_data[0], p_data[0].length, false); + } else if (p_cmd === 'chunk') { + this.output.write(p_data); + } + } + + static array_has_data(arr) { + return arr.length && arr[0].length && arr[0][0].length; + } + + process(inputs, outputs, parameters) { + if (!this.running) { + return false; // Stop processing. + } + if (this.output === null) { + return true; // Not ready yet, keep processing. + } + const process_input = GodotProcessor.array_has_data(inputs); + if (process_input) { + const input = inputs[0]; + const chunk = input[0].length * input.length; + if (this.input_buffer.length !== chunk) { + this.input_buffer = new Float32Array(chunk); + } + if (!this.threads) { + GodotProcessor.write_input(this.input_buffer, input); + this.port.postMessage({ 'cmd': 'input', 'data': this.input_buffer }); + } else if (this.input.space_left() >= chunk) { + GodotProcessor.write_input(this.input_buffer, input); + this.input.write(this.input_buffer); + } else { + this.port.postMessage('Input buffer is full! Skipping input frame.'); + } + } + const process_output = GodotProcessor.array_has_data(outputs); + if (process_output) { + const output = outputs[0]; + const chunk = output[0].length * output.length; + if (this.output_buffer.length !== chunk) { + this.output_buffer = new Float32Array(chunk); + } + if (this.output.data_left() >= chunk) { + this.output.read(this.output_buffer); + GodotProcessor.write_output(output, this.output_buffer); + if (!this.threads) { + this.port.postMessage({ 'cmd': 'read', 'data': chunk }); + } + } else { + this.port.postMessage('Output buffer has not enough frames! Skipping output frame.'); + } + } + this.process_notify(); + return true; + } + + static write_output(dest, source) { + const channels = dest.length; + for (let ch = 0; ch < channels; ch++) { + for (let sample = 0; sample < dest[ch].length; sample++) { + dest[ch][sample] = source[sample * channels + ch]; + } + } + } + + static write_input(dest, source) { + const channels = source.length; + for (let ch = 0; ch < channels; ch++) { + for (let sample = 0; sample < source[ch].length; sample++) { + dest[sample * channels + ch] = source[ch][sample]; + } + } + } +} + +registerProcessor('godot-processor', GodotProcessor); diff --git a/build/smg/index.html b/build/smg/index.html new file mode 100644 index 0000000000000000000000000000000000000000..e8ce8d641344ac9d48e35098a40e3f4e7b7498f0 --- /dev/null +++ b/build/smg/index.html @@ -0,0 +1,255 @@ + + + + + + Super Godot Galaxy + + + + + + + + HTML5 canvas appears to be unsupported in the current browser.
+ Please try updating or use a different browser. + +
+ + + +
+ + + + + + + + diff --git a/build/smg/index.icon.png b/build/smg/index.icon.png new file mode 100644 index 0000000000000000000000000000000000000000..394ea0c94d1037ba3c9febbd9abe93aefa2e6a30 Binary files /dev/null and b/build/smg/index.icon.png differ diff --git a/build/smg/index.js b/build/smg/index.js new file mode 100644 index 0000000000000000000000000000000000000000..0d2932842955c0d78e3f58e7ef81f67448f090a4 --- /dev/null +++ b/build/smg/index.js @@ -0,0 +1,14532 @@ + +var Godot = (() => { + var _scriptDir = typeof document !== 'undefined' && document.currentScript ? document.currentScript.src : undefined; + + return ( +function(Godot) { + Godot = Godot || {}; + + + +// Support for growable heap + pthreads, where the buffer may change, so JS views +// must be updated. +function GROWABLE_HEAP_I8() { + if (wasmMemory.buffer != buffer) { + updateGlobalBufferAndViews(wasmMemory.buffer); + } + return HEAP8; +} +function GROWABLE_HEAP_U8() { + if (wasmMemory.buffer != buffer) { + updateGlobalBufferAndViews(wasmMemory.buffer); + } + return HEAPU8; +} +function GROWABLE_HEAP_I16() { + if (wasmMemory.buffer != buffer) { + updateGlobalBufferAndViews(wasmMemory.buffer); + } + return HEAP16; +} +function GROWABLE_HEAP_U16() { + if (wasmMemory.buffer != buffer) { + updateGlobalBufferAndViews(wasmMemory.buffer); + } + return HEAPU16; +} +function GROWABLE_HEAP_I32() { + if (wasmMemory.buffer != buffer) { + updateGlobalBufferAndViews(wasmMemory.buffer); + } + return HEAP32; +} +function GROWABLE_HEAP_U32() { + if (wasmMemory.buffer != buffer) { + updateGlobalBufferAndViews(wasmMemory.buffer); + } + return HEAPU32; +} +function GROWABLE_HEAP_F32() { + if (wasmMemory.buffer != buffer) { + updateGlobalBufferAndViews(wasmMemory.buffer); + } + return HEAPF32; +} +function GROWABLE_HEAP_F64() { + if (wasmMemory.buffer != buffer) { + updateGlobalBufferAndViews(wasmMemory.buffer); + } + return HEAPF64; +} + +var Module = typeof Godot != "undefined" ? Godot : {}; + +var readyPromiseResolve, readyPromiseReject; + +Module["ready"] = new Promise(function(resolve, reject) { + readyPromiseResolve = resolve; + readyPromiseReject = reject; +}); + +[ "_main", "__emscripten_thread_init", "__emscripten_thread_exit", "__emscripten_thread_crashed", "__emscripten_tls_init", "_pthread_self", "executeNotifiedProxyingQueue", "establishStackSpace", "invokeEntryPoint", "PThread", "_emscripten_webgl_commit_frame", "__Z14godot_web_mainiPPc", "_fflush", "__emwebxr_on_input_event", "__emwebxr_on_simple_event", "__emscripten_proxy_execute_task_queue", "onRuntimeInitialized" ].forEach(prop => { + if (!Object.getOwnPropertyDescriptor(Module["ready"], prop)) { + Object.defineProperty(Module["ready"], prop, { + get: () => abort("You are getting " + prop + " on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js"), + set: () => abort("You are setting " + prop + " on the Promise object, instead of the instance. Use .then() to get called back with the instance, see the MODULARIZE docs in src/settings.js") + }); + } +}); + +var moduleOverrides = Object.assign({}, Module); + +var arguments_ = []; + +var thisProgram = "./this.program"; + +var quit_ = (status, toThrow) => { + throw toThrow; +}; + +var ENVIRONMENT_IS_WEB = typeof window == "object"; + +var ENVIRONMENT_IS_WORKER = typeof importScripts == "function"; + +var ENVIRONMENT_IS_NODE = typeof process == "object" && typeof process.versions == "object" && typeof process.versions.node == "string"; + +var ENVIRONMENT_IS_SHELL = !ENVIRONMENT_IS_WEB && !ENVIRONMENT_IS_NODE && !ENVIRONMENT_IS_WORKER; + +if (Module["ENVIRONMENT"]) { + throw new Error("Module.ENVIRONMENT has been deprecated. To force the environment, use the ENVIRONMENT compile-time option (for example, -sENVIRONMENT=web or -sENVIRONMENT=node)"); +} + +var ENVIRONMENT_IS_PTHREAD = Module["ENVIRONMENT_IS_PTHREAD"] || false; + +var scriptDirectory = ""; + +function locateFile(path) { + if (Module["locateFile"]) { + return Module["locateFile"](path, scriptDirectory); + } + return scriptDirectory + path; +} + +var read_, readAsync, readBinary, setWindowTitle; + +function logExceptionOnExit(e) { + if (e instanceof ExitStatus) return; + let toLog = e; + if (e && typeof e == "object" && e.stack) { + toLog = [ e, e.stack ]; + } + err("exiting due to exception: " + toLog); +} + +if (ENVIRONMENT_IS_SHELL) { + if (typeof process == "object" && typeof require === "function" || typeof window == "object" || typeof importScripts == "function") throw new Error("not compiled for this environment (did you build to HTML and try to run it not on the web, or set ENVIRONMENT to something - like node - and run it someplace else - like on the web?)"); + if (typeof read != "undefined") { + read_ = function shell_read(f) { + return read(f); + }; + } + readBinary = function readBinary(f) { + let data; + if (typeof readbuffer == "function") { + return new Uint8Array(readbuffer(f)); + } + data = read(f, "binary"); + assert(typeof data == "object"); + return data; + }; + readAsync = function readAsync(f, onload, onerror) { + setTimeout(() => onload(readBinary(f)), 0); + }; + if (typeof scriptArgs != "undefined") { + arguments_ = scriptArgs; + } else if (typeof arguments != "undefined") { + arguments_ = arguments; + } + if (typeof quit == "function") { + quit_ = (status, toThrow) => { + if (runtimeKeepaliveCounter) { + throw toThrow; + } + logExceptionOnExit(toThrow); + quit(status); + }; + } + if (typeof print != "undefined") { + if (typeof console == "undefined") console = {}; + console.log = print; + console.warn = console.error = typeof printErr != "undefined" ? printErr : print; + } +} else if (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER) { + if (ENVIRONMENT_IS_WORKER) { + scriptDirectory = self.location.href; + } else if (typeof document != "undefined" && document.currentScript) { + scriptDirectory = document.currentScript.src; + } + if (_scriptDir) { + scriptDirectory = _scriptDir; + } + if (scriptDirectory.indexOf("blob:") !== 0) { + scriptDirectory = scriptDirectory.substr(0, scriptDirectory.replace(/[?#].*/, "").lastIndexOf("/") + 1); + } else { + scriptDirectory = ""; + } + if (!(typeof window == "object" || typeof importScripts == "function")) throw new Error("not compiled for this environment (did you build to HTML and try to run it not on the web, or set ENVIRONMENT to something - like node - and run it someplace else - like on the web?)"); + { + read_ = url => { + var xhr = new XMLHttpRequest(); + xhr.open("GET", url, false); + xhr.send(null); + return xhr.responseText; + }; + if (ENVIRONMENT_IS_WORKER) { + readBinary = url => { + var xhr = new XMLHttpRequest(); + xhr.open("GET", url, false); + xhr.responseType = "arraybuffer"; + xhr.send(null); + return new Uint8Array(xhr.response); + }; + } + readAsync = (url, onload, onerror) => { + var xhr = new XMLHttpRequest(); + xhr.open("GET", url, true); + xhr.responseType = "arraybuffer"; + xhr.onload = () => { + if (xhr.status == 200 || xhr.status == 0 && xhr.response) { + onload(xhr.response); + return; + } + onerror(); + }; + xhr.onerror = onerror; + xhr.send(null); + }; + } + setWindowTitle = title => document.title = title; +} else { + throw new Error("environment detection error"); +} + +var out = Module["print"] || console.log.bind(console); + +var err = Module["printErr"] || console.warn.bind(console); + +Object.assign(Module, moduleOverrides); + +moduleOverrides = null; + +checkIncomingModuleAPI(); + +if (Module["arguments"]) arguments_ = Module["arguments"]; + +legacyModuleProp("arguments", "arguments_"); + +if (Module["thisProgram"]) thisProgram = Module["thisProgram"]; + +legacyModuleProp("thisProgram", "thisProgram"); + +if (Module["quit"]) quit_ = Module["quit"]; + +legacyModuleProp("quit", "quit_"); + +assert(typeof Module["memoryInitializerPrefixURL"] == "undefined", "Module.memoryInitializerPrefixURL option was removed, use Module.locateFile instead"); + +assert(typeof Module["pthreadMainPrefixURL"] == "undefined", "Module.pthreadMainPrefixURL option was removed, use Module.locateFile instead"); + +assert(typeof Module["cdInitializerPrefixURL"] == "undefined", "Module.cdInitializerPrefixURL option was removed, use Module.locateFile instead"); + +assert(typeof Module["filePackagePrefixURL"] == "undefined", "Module.filePackagePrefixURL option was removed, use Module.locateFile instead"); + +assert(typeof Module["read"] == "undefined", "Module.read option was removed (modify read_ in JS)"); + +assert(typeof Module["readAsync"] == "undefined", "Module.readAsync option was removed (modify readAsync in JS)"); + +assert(typeof Module["readBinary"] == "undefined", "Module.readBinary option was removed (modify readBinary in JS)"); + +assert(typeof Module["setWindowTitle"] == "undefined", "Module.setWindowTitle option was removed (modify setWindowTitle in JS)"); + +assert(typeof Module["TOTAL_MEMORY"] == "undefined", "Module.TOTAL_MEMORY has been renamed Module.INITIAL_MEMORY"); + +legacyModuleProp("read", "read_"); + +legacyModuleProp("readAsync", "readAsync"); + +legacyModuleProp("readBinary", "readBinary"); + +legacyModuleProp("setWindowTitle", "setWindowTitle"); + +var PROXYFS = "PROXYFS is no longer included by default; build with -lproxyfs.js"; + +var WORKERFS = "WORKERFS is no longer included by default; build with -lworkerfs.js"; + +var NODEFS = "NODEFS is no longer included by default; build with -lnodefs.js"; + +assert(ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER || ENVIRONMENT_IS_NODE, "Pthreads do not work in this environment yet (need Web Workers, or an alternative to them)"); + +assert(!ENVIRONMENT_IS_NODE, "node environment detected but not enabled at build time. Add 'node' to `-sENVIRONMENT` to enable."); + +assert(!ENVIRONMENT_IS_SHELL, "shell environment detected but not enabled at build time. Add 'shell' to `-sENVIRONMENT` to enable."); + +var STACK_ALIGN = 16; + +var POINTER_SIZE = 4; + +function getNativeTypeSize(type) { + switch (type) { + case "i1": + case "i8": + case "u8": + return 1; + + case "i16": + case "u16": + return 2; + + case "i32": + case "u32": + return 4; + + case "i64": + case "u64": + return 8; + + case "float": + return 4; + + case "double": + return 8; + + default: + { + if (type[type.length - 1] === "*") { + return POINTER_SIZE; + } + if (type[0] === "i") { + const bits = Number(type.substr(1)); + assert(bits % 8 === 0, "getNativeTypeSize invalid bits " + bits + ", type " + type); + return bits / 8; + } + return 0; + } + } +} + +function legacyModuleProp(prop, newName) { + if (!Object.getOwnPropertyDescriptor(Module, prop)) { + Object.defineProperty(Module, prop, { + configurable: true, + get: function() { + abort("Module." + prop + " has been replaced with plain " + newName + " (the initial value can be provided on Module, but after startup the value is only looked for on a local variable of that name)"); + } + }); + } +} + +function ignoredModuleProp(prop) { + if (Object.getOwnPropertyDescriptor(Module, prop)) { + abort("`Module." + prop + "` was supplied but `" + prop + "` not included in INCOMING_MODULE_JS_API"); + } +} + +function isExportedByForceFilesystem(name) { + return name === "FS_createPath" || name === "FS_createDataFile" || name === "FS_createPreloadedFile" || name === "FS_unlink" || name === "addRunDependency" || name === "FS_createLazyFile" || name === "FS_createDevice" || name === "removeRunDependency"; +} + +function missingLibrarySymbol(sym) { + if (typeof globalThis !== "undefined" && !Object.getOwnPropertyDescriptor(globalThis, sym)) { + Object.defineProperty(globalThis, sym, { + configurable: true, + get: function() { + var msg = "`" + sym + "` is a library symbol and not included by default; add it to your library.js __deps or to DEFAULT_LIBRARY_FUNCS_TO_INCLUDE on the command line"; + if (isExportedByForceFilesystem(sym)) { + msg += ". Alternatively, forcing filesystem support (-sFORCE_FILESYSTEM) can export this for you"; + } + warnOnce(msg); + return undefined; + } + }); + } +} + +function unexportedRuntimeSymbol(sym) { + if (!Object.getOwnPropertyDescriptor(Module, sym)) { + Object.defineProperty(Module, sym, { + configurable: true, + get: function() { + var msg = "'" + sym + "' was not exported. add it to EXPORTED_RUNTIME_METHODS (see the FAQ)"; + if (isExportedByForceFilesystem(sym)) { + msg += ". Alternatively, forcing filesystem support (-sFORCE_FILESYSTEM) can export this for you"; + } + abort(msg); + } + }); + } +} + +var tempRet0 = 0; + +var setTempRet0 = value => { + tempRet0 = value; +}; + +var getTempRet0 = () => tempRet0; + +var Atomics_load = Atomics.load; + +var Atomics_store = Atomics.store; + +var Atomics_compareExchange = Atomics.compareExchange; + +var wasmBinary; + +if (Module["wasmBinary"]) wasmBinary = Module["wasmBinary"]; + +legacyModuleProp("wasmBinary", "wasmBinary"); + +var noExitRuntime = Module["noExitRuntime"] || false; + +legacyModuleProp("noExitRuntime", "noExitRuntime"); + +if (typeof WebAssembly != "object") { + abort("no native wasm support detected"); +} + +var wasmMemory; + +var wasmModule; + +var ABORT = false; + +var EXITSTATUS; + +function assert(condition, text) { + if (!condition) { + abort("Assertion failed" + (text ? ": " + text : "")); + } +} + +var UTF8Decoder = typeof TextDecoder != "undefined" ? new TextDecoder("utf8") : undefined; + +function UTF8ArrayToString(heapOrArray, idx, maxBytesToRead) { + var endIdx = idx + maxBytesToRead; + var endPtr = idx; + while (heapOrArray[endPtr] && !(endPtr >= endIdx)) ++endPtr; + if (endPtr - idx > 16 && heapOrArray.buffer && UTF8Decoder) { + return UTF8Decoder.decode(heapOrArray.buffer instanceof SharedArrayBuffer ? heapOrArray.slice(idx, endPtr) : heapOrArray.subarray(idx, endPtr)); + } + var str = ""; + while (idx < endPtr) { + var u0 = heapOrArray[idx++]; + if (!(u0 & 128)) { + str += String.fromCharCode(u0); + continue; + } + var u1 = heapOrArray[idx++] & 63; + if ((u0 & 224) == 192) { + str += String.fromCharCode((u0 & 31) << 6 | u1); + continue; + } + var u2 = heapOrArray[idx++] & 63; + if ((u0 & 240) == 224) { + u0 = (u0 & 15) << 12 | u1 << 6 | u2; + } else { + if ((u0 & 248) != 240) warnOnce("Invalid UTF-8 leading byte 0x" + u0.toString(16) + " encountered when deserializing a UTF-8 string in wasm memory to a JS string!"); + u0 = (u0 & 7) << 18 | u1 << 12 | u2 << 6 | heapOrArray[idx++] & 63; + } + if (u0 < 65536) { + str += String.fromCharCode(u0); + } else { + var ch = u0 - 65536; + str += String.fromCharCode(55296 | ch >> 10, 56320 | ch & 1023); + } + } + return str; +} + +function UTF8ToString(ptr, maxBytesToRead) { + return ptr ? UTF8ArrayToString(GROWABLE_HEAP_U8(), ptr, maxBytesToRead) : ""; +} + +function stringToUTF8Array(str, heap, outIdx, maxBytesToWrite) { + if (!(maxBytesToWrite > 0)) return 0; + var startIdx = outIdx; + var endIdx = outIdx + maxBytesToWrite - 1; + for (var i = 0; i < str.length; ++i) { + var u = str.charCodeAt(i); + if (u >= 55296 && u <= 57343) { + var u1 = str.charCodeAt(++i); + u = 65536 + ((u & 1023) << 10) | u1 & 1023; + } + if (u <= 127) { + if (outIdx >= endIdx) break; + heap[outIdx++] = u; + } else if (u <= 2047) { + if (outIdx + 1 >= endIdx) break; + heap[outIdx++] = 192 | u >> 6; + heap[outIdx++] = 128 | u & 63; + } else if (u <= 65535) { + if (outIdx + 2 >= endIdx) break; + heap[outIdx++] = 224 | u >> 12; + heap[outIdx++] = 128 | u >> 6 & 63; + heap[outIdx++] = 128 | u & 63; + } else { + if (outIdx + 3 >= endIdx) break; + if (u > 1114111) warnOnce("Invalid Unicode code point 0x" + u.toString(16) + " encountered when serializing a JS string to a UTF-8 string in wasm memory! (Valid unicode code points should be in range 0-0x10FFFF)."); + heap[outIdx++] = 240 | u >> 18; + heap[outIdx++] = 128 | u >> 12 & 63; + heap[outIdx++] = 128 | u >> 6 & 63; + heap[outIdx++] = 128 | u & 63; + } + } + heap[outIdx] = 0; + return outIdx - startIdx; +} + +function stringToUTF8(str, outPtr, maxBytesToWrite) { + assert(typeof maxBytesToWrite == "number", "stringToUTF8(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!"); + return stringToUTF8Array(str, GROWABLE_HEAP_U8(), outPtr, maxBytesToWrite); +} + +function lengthBytesUTF8(str) { + var len = 0; + for (var i = 0; i < str.length; ++i) { + var c = str.charCodeAt(i); + if (c <= 127) { + len++; + } else if (c <= 2047) { + len += 2; + } else if (c >= 55296 && c <= 57343) { + len += 4; + ++i; + } else { + len += 3; + } + } + return len; +} + +var HEAP, buffer, HEAP8, HEAPU8, HEAP16, HEAPU16, HEAP32, HEAPU32, HEAPF32, HEAPF64; + +if (ENVIRONMENT_IS_PTHREAD) { + buffer = Module["buffer"]; +} + +function updateGlobalBufferAndViews(buf) { + buffer = buf; + Module["HEAP8"] = HEAP8 = new Int8Array(buf); + Module["HEAP16"] = HEAP16 = new Int16Array(buf); + Module["HEAP32"] = HEAP32 = new Int32Array(buf); + Module["HEAPU8"] = HEAPU8 = new Uint8Array(buf); + Module["HEAPU16"] = HEAPU16 = new Uint16Array(buf); + Module["HEAPU32"] = HEAPU32 = new Uint32Array(buf); + Module["HEAPF32"] = HEAPF32 = new Float32Array(buf); + Module["HEAPF64"] = HEAPF64 = new Float64Array(buf); +} + +var TOTAL_STACK = 5242880; + +if (Module["TOTAL_STACK"]) assert(TOTAL_STACK === Module["TOTAL_STACK"], "the stack size can no longer be determined at runtime"); + +var INITIAL_MEMORY = Module["INITIAL_MEMORY"] || 33554432; + +legacyModuleProp("INITIAL_MEMORY", "INITIAL_MEMORY"); + +assert(INITIAL_MEMORY >= TOTAL_STACK, "INITIAL_MEMORY should be larger than TOTAL_STACK, was " + INITIAL_MEMORY + "! (TOTAL_STACK=" + TOTAL_STACK + ")"); + +assert(typeof Int32Array != "undefined" && typeof Float64Array !== "undefined" && Int32Array.prototype.subarray != undefined && Int32Array.prototype.set != undefined, "JS engine does not provide full typed array support"); + +if (ENVIRONMENT_IS_PTHREAD) { + wasmMemory = Module["wasmMemory"]; + buffer = Module["buffer"]; +} else { + if (Module["wasmMemory"]) { + wasmMemory = Module["wasmMemory"]; + } else { + wasmMemory = new WebAssembly.Memory({ + "initial": INITIAL_MEMORY / 65536, + "maximum": 2147483648 / 65536, + "shared": true + }); + if (!(wasmMemory.buffer instanceof SharedArrayBuffer)) { + err("requested a shared WebAssembly.Memory but the returned buffer is not a SharedArrayBuffer, indicating that while the browser has SharedArrayBuffer it does not have WebAssembly threads support - you may need to set a flag"); + if (ENVIRONMENT_IS_NODE) { + console.log("(on node you may need: --experimental-wasm-threads --experimental-wasm-bulk-memory and also use a recent version)"); + } + throw Error("bad memory"); + } + } +} + +if (wasmMemory) { + buffer = wasmMemory.buffer; +} + +INITIAL_MEMORY = buffer.byteLength; + +assert(INITIAL_MEMORY % 65536 === 0); + +updateGlobalBufferAndViews(buffer); + +var wasmTable; + +function writeStackCookie() { + var max = _emscripten_stack_get_end(); + assert((max & 3) == 0); + GROWABLE_HEAP_I32()[max >> 2] = 34821223; + GROWABLE_HEAP_I32()[max + 4 >> 2] = 2310721022; + GROWABLE_HEAP_U32()[0] = 1668509029; +} + +function checkStackCookie() { + if (ABORT) return; + var max = _emscripten_stack_get_end(); + var cookie1 = GROWABLE_HEAP_U32()[max >> 2]; + var cookie2 = GROWABLE_HEAP_U32()[max + 4 >> 2]; + if (cookie1 != 34821223 || cookie2 != 2310721022) { + abort("Stack overflow! Stack cookie has been overwritten at 0x" + max.toString(16) + ", expected hex dwords 0x89BACDFE and 0x2135467, but received 0x" + cookie2.toString(16) + " 0x" + cookie1.toString(16)); + } + if (GROWABLE_HEAP_U32()[0] !== 1668509029) abort("Runtime error: The application has corrupted its heap memory area (address zero)!"); +} + +(function() { + var h16 = new Int16Array(1); + var h8 = new Int8Array(h16.buffer); + h16[0] = 25459; + if (h8[0] !== 115 || h8[1] !== 99) throw "Runtime error: expected the system to be little-endian! (Run with -sSUPPORT_BIG_ENDIAN to bypass)"; +})(); + +var __ATPRERUN__ = []; + +var __ATINIT__ = []; + +var __ATMAIN__ = []; + +var __ATEXIT__ = []; + +var __ATPOSTRUN__ = []; + +var runtimeInitialized = false; + +var runtimeExited = false; + +var runtimeKeepaliveCounter = 0; + +function keepRuntimeAlive() { + return noExitRuntime || runtimeKeepaliveCounter > 0; +} + +function preRun() { + assert(!ENVIRONMENT_IS_PTHREAD); + if (Module["preRun"]) { + if (typeof Module["preRun"] == "function") Module["preRun"] = [ Module["preRun"] ]; + while (Module["preRun"].length) { + addOnPreRun(Module["preRun"].shift()); + } + } + callRuntimeCallbacks(__ATPRERUN__); +} + +function initRuntime() { + assert(!runtimeInitialized); + runtimeInitialized = true; + if (ENVIRONMENT_IS_PTHREAD) return; + checkStackCookie(); + if (!Module["noFSInit"] && !FS.init.initialized) FS.init(); + FS.ignorePermissions = false; + TTY.init(); + SOCKFS.root = FS.mount(SOCKFS, {}, null); + callRuntimeCallbacks(__ATINIT__); +} + +function preMain() { + checkStackCookie(); + if (ENVIRONMENT_IS_PTHREAD) return; + callRuntimeCallbacks(__ATMAIN__); +} + +function exitRuntime() { + checkStackCookie(); + if (ENVIRONMENT_IS_PTHREAD) return; + ___funcs_on_exit(); + callRuntimeCallbacks(__ATEXIT__); + FS.quit(); + TTY.shutdown(); + IDBFS.quit(); + PThread.terminateAllThreads(); + runtimeExited = true; +} + +function postRun() { + checkStackCookie(); + if (ENVIRONMENT_IS_PTHREAD) return; + if (Module["postRun"]) { + if (typeof Module["postRun"] == "function") Module["postRun"] = [ Module["postRun"] ]; + while (Module["postRun"].length) { + addOnPostRun(Module["postRun"].shift()); + } + } + callRuntimeCallbacks(__ATPOSTRUN__); +} + +function addOnPreRun(cb) { + __ATPRERUN__.unshift(cb); +} + +function addOnInit(cb) { + __ATINIT__.unshift(cb); +} + +function addOnPreMain(cb) { + __ATMAIN__.unshift(cb); +} + +function addOnExit(cb) { + __ATEXIT__.unshift(cb); +} + +function addOnPostRun(cb) { + __ATPOSTRUN__.unshift(cb); +} + +assert(Math.imul, "This browser does not support Math.imul(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill"); + +assert(Math.fround, "This browser does not support Math.fround(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill"); + +assert(Math.clz32, "This browser does not support Math.clz32(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill"); + +assert(Math.trunc, "This browser does not support Math.trunc(), build with LEGACY_VM_SUPPORT or POLYFILL_OLD_MATH_FUNCTIONS to add in a polyfill"); + +var runDependencies = 0; + +var runDependencyWatcher = null; + +var dependenciesFulfilled = null; + +var runDependencyTracking = {}; + +function getUniqueRunDependency(id) { + var orig = id; + while (1) { + if (!runDependencyTracking[id]) return id; + id = orig + Math.random(); + } +} + +function addRunDependency(id) { + runDependencies++; + if (Module["monitorRunDependencies"]) { + Module["monitorRunDependencies"](runDependencies); + } + if (id) { + assert(!runDependencyTracking[id]); + runDependencyTracking[id] = 1; + if (runDependencyWatcher === null && typeof setInterval != "undefined") { + runDependencyWatcher = setInterval(function() { + if (ABORT) { + clearInterval(runDependencyWatcher); + runDependencyWatcher = null; + return; + } + var shown = false; + for (var dep in runDependencyTracking) { + if (!shown) { + shown = true; + err("still waiting on run dependencies:"); + } + err("dependency: " + dep); + } + if (shown) { + err("(end of list)"); + } + }, 1e4); + } + } else { + err("warning: run dependency added without ID"); + } +} + +function removeRunDependency(id) { + runDependencies--; + if (Module["monitorRunDependencies"]) { + Module["monitorRunDependencies"](runDependencies); + } + if (id) { + assert(runDependencyTracking[id]); + delete runDependencyTracking[id]; + } else { + err("warning: run dependency removed without ID"); + } + if (runDependencies == 0) { + if (runDependencyWatcher !== null) { + clearInterval(runDependencyWatcher); + runDependencyWatcher = null; + } + if (dependenciesFulfilled) { + var callback = dependenciesFulfilled; + dependenciesFulfilled = null; + callback(); + } + } +} + +function abort(what) { + if (ENVIRONMENT_IS_PTHREAD) { + postMessage({ + "cmd": "onAbort", + "arg": what + }); + } else { + if (Module["onAbort"]) { + Module["onAbort"](what); + } + } + what = "Aborted(" + what + ")"; + err(what); + ABORT = true; + EXITSTATUS = 1; + var e = new WebAssembly.RuntimeError(what); + readyPromiseReject(e); + throw e; +} + +var dataURIPrefix = "data:application/octet-stream;base64,"; + +function isDataURI(filename) { + return filename.startsWith(dataURIPrefix); +} + +function isFileURI(filename) { + return filename.startsWith("file://"); +} + +function createExportWrapper(name, fixedasm) { + return function() { + var displayName = name; + var asm = fixedasm; + if (!fixedasm) { + asm = Module["asm"]; + } + assert(runtimeInitialized, "native function `" + displayName + "` called before runtime initialization"); + assert(!runtimeExited, "native function `" + displayName + "` called after runtime exit (use NO_EXIT_RUNTIME to keep it alive after main() exits)"); + if (!asm[name]) { + assert(asm[name], "exported native function `" + displayName + "` not found"); + } + return asm[name].apply(null, arguments); + }; +} + +var wasmBinaryFile; + +wasmBinaryFile = "godot.web.template_debug.wasm32.wasm"; + +if (!isDataURI(wasmBinaryFile)) { + wasmBinaryFile = locateFile(wasmBinaryFile); +} + +function getBinary(file) { + try { + if (file == wasmBinaryFile && wasmBinary) { + return new Uint8Array(wasmBinary); + } + if (readBinary) { + return readBinary(file); + } + throw "both async and sync fetching of the wasm failed"; + } catch (err) { + abort(err); + } +} + +function getBinaryPromise() { + if (!wasmBinary && (ENVIRONMENT_IS_WEB || ENVIRONMENT_IS_WORKER)) { + if (typeof fetch == "function") { + return fetch(wasmBinaryFile, { + credentials: "same-origin" + }).then(function(response) { + if (!response["ok"]) { + throw "failed to load wasm binary file at '" + wasmBinaryFile + "'"; + } + return response["arrayBuffer"](); + }).catch(function() { + return getBinary(wasmBinaryFile); + }); + } + } + return Promise.resolve().then(function() { + return getBinary(wasmBinaryFile); + }); +} + +function createWasm() { + var info = { + "env": asmLibraryArg, + "wasi_snapshot_preview1": asmLibraryArg + }; + function receiveInstance(instance, module) { + var exports = instance.exports; + Module["asm"] = exports; + registerTLSInit(Module["asm"]["_emscripten_tls_init"]); + wasmTable = Module["asm"]["__indirect_function_table"]; + assert(wasmTable, "table not found in wasm exports"); + addOnInit(Module["asm"]["__wasm_call_ctors"]); + wasmModule = module; + if (!ENVIRONMENT_IS_PTHREAD) { + var numWorkersToLoad = PThread.unusedWorkers.length; + PThread.unusedWorkers.forEach(function(w) { + PThread.loadWasmModuleToWorker(w, function() { + if (!--numWorkersToLoad) removeRunDependency("wasm-instantiate"); + }); + }); + } + } + if (!ENVIRONMENT_IS_PTHREAD) { + addRunDependency("wasm-instantiate"); + } + var trueModule = Module; + function receiveInstantiationResult(result) { + assert(Module === trueModule, "the Module object should not be replaced during async compilation - perhaps the order of HTML elements is wrong?"); + trueModule = null; + receiveInstance(result["instance"], result["module"]); + } + function instantiateArrayBuffer(receiver) { + return getBinaryPromise().then(function(binary) { + return WebAssembly.instantiate(binary, info); + }).then(function(instance) { + return instance; + }).then(receiver, function(reason) { + err("failed to asynchronously prepare wasm: " + reason); + if (isFileURI(wasmBinaryFile)) { + err("warning: Loading from a file URI (" + wasmBinaryFile + ") is not supported in most browsers. See https://emscripten.org/docs/getting_started/FAQ.html#how-do-i-run-a-local-webserver-for-testing-why-does-my-program-stall-in-downloading-or-preparing"); + } + abort(reason); + }); + } + function instantiateAsync() { + if (!wasmBinary && typeof WebAssembly.instantiateStreaming == "function" && !isDataURI(wasmBinaryFile) && typeof fetch == "function") { + return fetch(wasmBinaryFile, { + credentials: "same-origin" + }).then(function(response) { + var result = WebAssembly.instantiateStreaming(response, info); + return result.then(receiveInstantiationResult, function(reason) { + err("wasm streaming compile failed: " + reason); + err("falling back to ArrayBuffer instantiation"); + return instantiateArrayBuffer(receiveInstantiationResult); + }); + }); + } else { + return instantiateArrayBuffer(receiveInstantiationResult); + } + } + if (Module["instantiateWasm"]) { + try { + var exports = Module["instantiateWasm"](info, receiveInstance); + return exports; + } catch (e) { + err("Module.instantiateWasm callback failed with error: " + e); + return false; + } + } + instantiateAsync().catch(readyPromiseReject); + return {}; +} + +var tempDouble; + +var tempI64; + +var ASM_CONSTS = {}; + +function ExitStatus(status) { + this.name = "ExitStatus"; + this.message = "Program terminated with exit(" + status + ")"; + this.status = status; +} + +function killThread(pthread_ptr) { + assert(!ENVIRONMENT_IS_PTHREAD, "Internal Error! killThread() can only ever be called from main application thread!"); + assert(pthread_ptr, "Internal Error! Null pthread_ptr in killThread!"); + var worker = PThread.pthreads[pthread_ptr]; + delete PThread.pthreads[pthread_ptr]; + worker.terminate(); + __emscripten_thread_free_data(pthread_ptr); + PThread.runningWorkers.splice(PThread.runningWorkers.indexOf(worker), 1); + worker.pthread_ptr = 0; +} + +function cancelThread(pthread_ptr) { + assert(!ENVIRONMENT_IS_PTHREAD, "Internal Error! cancelThread() can only ever be called from main application thread!"); + assert(pthread_ptr, "Internal Error! Null pthread_ptr in cancelThread!"); + var worker = PThread.pthreads[pthread_ptr]; + worker.postMessage({ + "cmd": "cancel" + }); +} + +function cleanupThread(pthread_ptr) { + assert(!ENVIRONMENT_IS_PTHREAD, "Internal Error! cleanupThread() can only ever be called from main application thread!"); + assert(pthread_ptr, "Internal Error! Null pthread_ptr in cleanupThread!"); + var worker = PThread.pthreads[pthread_ptr]; + assert(worker); + PThread.returnWorkerToPool(worker); +} + +function zeroMemory(address, size) { + GROWABLE_HEAP_U8().fill(0, address, address + size); +} + +function spawnThread(threadParams) { + assert(!ENVIRONMENT_IS_PTHREAD, "Internal Error! spawnThread() can only ever be called from main application thread!"); + assert(threadParams.pthread_ptr, "Internal error, no pthread ptr!"); + var worker = PThread.getNewWorker(); + if (!worker) { + return 6; + } + assert(!worker.pthread_ptr, "Internal error!"); + PThread.runningWorkers.push(worker); + PThread.pthreads[threadParams.pthread_ptr] = worker; + worker.pthread_ptr = threadParams.pthread_ptr; + var msg = { + "cmd": "run", + "start_routine": threadParams.startRoutine, + "arg": threadParams.arg, + "pthread_ptr": threadParams.pthread_ptr + }; + worker.runPthread = () => { + msg.time = performance.now(); + worker.postMessage(msg, threadParams.transferList); + }; + if (worker.loaded) { + worker.runPthread(); + delete worker.runPthread; + } + return 0; +} + +var PATH = { + isAbs: path => path.charAt(0) === "/", + splitPath: filename => { + var splitPathRe = /^(\/?|)([\s\S]*?)((?:\.{1,2}|[^\/]+?|)(\.[^.\/]*|))(?:[\/]*)$/; + return splitPathRe.exec(filename).slice(1); + }, + normalizeArray: (parts, allowAboveRoot) => { + var up = 0; + for (var i = parts.length - 1; i >= 0; i--) { + var last = parts[i]; + if (last === ".") { + parts.splice(i, 1); + } else if (last === "..") { + parts.splice(i, 1); + up++; + } else if (up) { + parts.splice(i, 1); + up--; + } + } + if (allowAboveRoot) { + for (;up; up--) { + parts.unshift(".."); + } + } + return parts; + }, + normalize: path => { + var isAbsolute = PATH.isAbs(path), trailingSlash = path.substr(-1) === "/"; + path = PATH.normalizeArray(path.split("/").filter(p => !!p), !isAbsolute).join("/"); + if (!path && !isAbsolute) { + path = "."; + } + if (path && trailingSlash) { + path += "/"; + } + return (isAbsolute ? "/" : "") + path; + }, + dirname: path => { + var result = PATH.splitPath(path), root = result[0], dir = result[1]; + if (!root && !dir) { + return "."; + } + if (dir) { + dir = dir.substr(0, dir.length - 1); + } + return root + dir; + }, + basename: path => { + if (path === "/") return "/"; + path = PATH.normalize(path); + path = path.replace(/\/$/, ""); + var lastSlash = path.lastIndexOf("/"); + if (lastSlash === -1) return path; + return path.substr(lastSlash + 1); + }, + join: function() { + var paths = Array.prototype.slice.call(arguments, 0); + return PATH.normalize(paths.join("/")); + }, + join2: (l, r) => { + return PATH.normalize(l + "/" + r); + } +}; + +function getRandomDevice() { + if (typeof crypto == "object" && typeof crypto["getRandomValues"] == "function") { + var randomBuffer = new Uint8Array(1); + return () => { + crypto.getRandomValues(randomBuffer); + return randomBuffer[0]; + }; + } else return () => abort("no cryptographic support found for randomDevice. consider polyfilling it if you want to use something insecure like Math.random(), e.g. put this in a --pre-js: var crypto = { getRandomValues: function(array) { for (var i = 0; i < array.length; i++) array[i] = (Math.random()*256)|0 } };"); +} + +var PATH_FS = { + resolve: function() { + var resolvedPath = "", resolvedAbsolute = false; + for (var i = arguments.length - 1; i >= -1 && !resolvedAbsolute; i--) { + var path = i >= 0 ? arguments[i] : FS.cwd(); + if (typeof path != "string") { + throw new TypeError("Arguments to path.resolve must be strings"); + } else if (!path) { + return ""; + } + resolvedPath = path + "/" + resolvedPath; + resolvedAbsolute = PATH.isAbs(path); + } + resolvedPath = PATH.normalizeArray(resolvedPath.split("/").filter(p => !!p), !resolvedAbsolute).join("/"); + return (resolvedAbsolute ? "/" : "") + resolvedPath || "."; + }, + relative: (from, to) => { + from = PATH_FS.resolve(from).substr(1); + to = PATH_FS.resolve(to).substr(1); + function trim(arr) { + var start = 0; + for (;start < arr.length; start++) { + if (arr[start] !== "") break; + } + var end = arr.length - 1; + for (;end >= 0; end--) { + if (arr[end] !== "") break; + } + if (start > end) return []; + return arr.slice(start, end - start + 1); + } + var fromParts = trim(from.split("/")); + var toParts = trim(to.split("/")); + var length = Math.min(fromParts.length, toParts.length); + var samePartsLength = length; + for (var i = 0; i < length; i++) { + if (fromParts[i] !== toParts[i]) { + samePartsLength = i; + break; + } + } + var outputParts = []; + for (var i = samePartsLength; i < fromParts.length; i++) { + outputParts.push(".."); + } + outputParts = outputParts.concat(toParts.slice(samePartsLength)); + return outputParts.join("/"); + } +}; + +function intArrayFromString(stringy, dontAddNull, length) { + var len = length > 0 ? length : lengthBytesUTF8(stringy) + 1; + var u8array = new Array(len); + var numBytesWritten = stringToUTF8Array(stringy, u8array, 0, u8array.length); + if (dontAddNull) u8array.length = numBytesWritten; + return u8array; +} + +var TTY = { + ttys: [], + init: function() {}, + shutdown: function() {}, + register: function(dev, ops) { + TTY.ttys[dev] = { + input: [], + output: [], + ops: ops + }; + FS.registerDevice(dev, TTY.stream_ops); + }, + stream_ops: { + open: function(stream) { + var tty = TTY.ttys[stream.node.rdev]; + if (!tty) { + throw new FS.ErrnoError(43); + } + stream.tty = tty; + stream.seekable = false; + }, + close: function(stream) { + stream.tty.ops.flush(stream.tty); + }, + flush: function(stream) { + stream.tty.ops.flush(stream.tty); + }, + read: function(stream, buffer, offset, length, pos) { + if (!stream.tty || !stream.tty.ops.get_char) { + throw new FS.ErrnoError(60); + } + var bytesRead = 0; + for (var i = 0; i < length; i++) { + var result; + try { + result = stream.tty.ops.get_char(stream.tty); + } catch (e) { + throw new FS.ErrnoError(29); + } + if (result === undefined && bytesRead === 0) { + throw new FS.ErrnoError(6); + } + if (result === null || result === undefined) break; + bytesRead++; + buffer[offset + i] = result; + } + if (bytesRead) { + stream.node.timestamp = Date.now(); + } + return bytesRead; + }, + write: function(stream, buffer, offset, length, pos) { + if (!stream.tty || !stream.tty.ops.put_char) { + throw new FS.ErrnoError(60); + } + try { + for (var i = 0; i < length; i++) { + stream.tty.ops.put_char(stream.tty, buffer[offset + i]); + } + } catch (e) { + throw new FS.ErrnoError(29); + } + if (length) { + stream.node.timestamp = Date.now(); + } + return i; + } + }, + default_tty_ops: { + get_char: function(tty) { + if (!tty.input.length) { + var result = null; + if (typeof window != "undefined" && typeof window.prompt == "function") { + result = window.prompt("Input: "); + if (result !== null) { + result += "\n"; + } + } else if (typeof readline == "function") { + result = readline(); + if (result !== null) { + result += "\n"; + } + } + if (!result) { + return null; + } + tty.input = intArrayFromString(result, true); + } + return tty.input.shift(); + }, + put_char: function(tty, val) { + if (val === null || val === 10) { + out(UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } else { + if (val != 0) tty.output.push(val); + } + }, + flush: function(tty) { + if (tty.output && tty.output.length > 0) { + out(UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } + } + }, + default_tty1_ops: { + put_char: function(tty, val) { + if (val === null || val === 10) { + err(UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } else { + if (val != 0) tty.output.push(val); + } + }, + flush: function(tty) { + if (tty.output && tty.output.length > 0) { + err(UTF8ArrayToString(tty.output, 0)); + tty.output = []; + } + } + } +}; + +function alignMemory(size, alignment) { + assert(alignment, "alignment argument is required"); + return Math.ceil(size / alignment) * alignment; +} + +function mmapAlloc(size) { + size = alignMemory(size, 65536); + var ptr = _emscripten_builtin_memalign(65536, size); + if (!ptr) return 0; + zeroMemory(ptr, size); + return ptr; +} + +var MEMFS = { + ops_table: null, + mount: function(mount) { + return MEMFS.createNode(null, "/", 16384 | 511, 0); + }, + createNode: function(parent, name, mode, dev) { + if (FS.isBlkdev(mode) || FS.isFIFO(mode)) { + throw new FS.ErrnoError(63); + } + if (!MEMFS.ops_table) { + MEMFS.ops_table = { + dir: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr, + lookup: MEMFS.node_ops.lookup, + mknod: MEMFS.node_ops.mknod, + rename: MEMFS.node_ops.rename, + unlink: MEMFS.node_ops.unlink, + rmdir: MEMFS.node_ops.rmdir, + readdir: MEMFS.node_ops.readdir, + symlink: MEMFS.node_ops.symlink + }, + stream: { + llseek: MEMFS.stream_ops.llseek + } + }, + file: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr + }, + stream: { + llseek: MEMFS.stream_ops.llseek, + read: MEMFS.stream_ops.read, + write: MEMFS.stream_ops.write, + allocate: MEMFS.stream_ops.allocate, + mmap: MEMFS.stream_ops.mmap, + msync: MEMFS.stream_ops.msync + } + }, + link: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr, + readlink: MEMFS.node_ops.readlink + }, + stream: {} + }, + chrdev: { + node: { + getattr: MEMFS.node_ops.getattr, + setattr: MEMFS.node_ops.setattr + }, + stream: FS.chrdev_stream_ops + } + }; + } + var node = FS.createNode(parent, name, mode, dev); + if (FS.isDir(node.mode)) { + node.node_ops = MEMFS.ops_table.dir.node; + node.stream_ops = MEMFS.ops_table.dir.stream; + node.contents = {}; + } else if (FS.isFile(node.mode)) { + node.node_ops = MEMFS.ops_table.file.node; + node.stream_ops = MEMFS.ops_table.file.stream; + node.usedBytes = 0; + node.contents = null; + } else if (FS.isLink(node.mode)) { + node.node_ops = MEMFS.ops_table.link.node; + node.stream_ops = MEMFS.ops_table.link.stream; + } else if (FS.isChrdev(node.mode)) { + node.node_ops = MEMFS.ops_table.chrdev.node; + node.stream_ops = MEMFS.ops_table.chrdev.stream; + } + node.timestamp = Date.now(); + if (parent) { + parent.contents[name] = node; + parent.timestamp = node.timestamp; + } + return node; + }, + getFileDataAsTypedArray: function(node) { + if (!node.contents) return new Uint8Array(0); + if (node.contents.subarray) return node.contents.subarray(0, node.usedBytes); + return new Uint8Array(node.contents); + }, + expandFileStorage: function(node, newCapacity) { + var prevCapacity = node.contents ? node.contents.length : 0; + if (prevCapacity >= newCapacity) return; + var CAPACITY_DOUBLING_MAX = 1024 * 1024; + newCapacity = Math.max(newCapacity, prevCapacity * (prevCapacity < CAPACITY_DOUBLING_MAX ? 2 : 1.125) >>> 0); + if (prevCapacity != 0) newCapacity = Math.max(newCapacity, 256); + var oldContents = node.contents; + node.contents = new Uint8Array(newCapacity); + if (node.usedBytes > 0) node.contents.set(oldContents.subarray(0, node.usedBytes), 0); + }, + resizeFileStorage: function(node, newSize) { + if (node.usedBytes == newSize) return; + if (newSize == 0) { + node.contents = null; + node.usedBytes = 0; + } else { + var oldContents = node.contents; + node.contents = new Uint8Array(newSize); + if (oldContents) { + node.contents.set(oldContents.subarray(0, Math.min(newSize, node.usedBytes))); + } + node.usedBytes = newSize; + } + }, + node_ops: { + getattr: function(node) { + var attr = {}; + attr.dev = FS.isChrdev(node.mode) ? node.id : 1; + attr.ino = node.id; + attr.mode = node.mode; + attr.nlink = 1; + attr.uid = 0; + attr.gid = 0; + attr.rdev = node.rdev; + if (FS.isDir(node.mode)) { + attr.size = 4096; + } else if (FS.isFile(node.mode)) { + attr.size = node.usedBytes; + } else if (FS.isLink(node.mode)) { + attr.size = node.link.length; + } else { + attr.size = 0; + } + attr.atime = new Date(node.timestamp); + attr.mtime = new Date(node.timestamp); + attr.ctime = new Date(node.timestamp); + attr.blksize = 4096; + attr.blocks = Math.ceil(attr.size / attr.blksize); + return attr; + }, + setattr: function(node, attr) { + if (attr.mode !== undefined) { + node.mode = attr.mode; + } + if (attr.timestamp !== undefined) { + node.timestamp = attr.timestamp; + } + if (attr.size !== undefined) { + MEMFS.resizeFileStorage(node, attr.size); + } + }, + lookup: function(parent, name) { + throw FS.genericErrors[44]; + }, + mknod: function(parent, name, mode, dev) { + return MEMFS.createNode(parent, name, mode, dev); + }, + rename: function(old_node, new_dir, new_name) { + if (FS.isDir(old_node.mode)) { + var new_node; + try { + new_node = FS.lookupNode(new_dir, new_name); + } catch (e) {} + if (new_node) { + for (var i in new_node.contents) { + throw new FS.ErrnoError(55); + } + } + } + delete old_node.parent.contents[old_node.name]; + old_node.parent.timestamp = Date.now(); + old_node.name = new_name; + new_dir.contents[new_name] = old_node; + new_dir.timestamp = old_node.parent.timestamp; + old_node.parent = new_dir; + }, + unlink: function(parent, name) { + delete parent.contents[name]; + parent.timestamp = Date.now(); + }, + rmdir: function(parent, name) { + var node = FS.lookupNode(parent, name); + for (var i in node.contents) { + throw new FS.ErrnoError(55); + } + delete parent.contents[name]; + parent.timestamp = Date.now(); + }, + readdir: function(node) { + var entries = [ ".", ".." ]; + for (var key in node.contents) { + if (!node.contents.hasOwnProperty(key)) { + continue; + } + entries.push(key); + } + return entries; + }, + symlink: function(parent, newname, oldpath) { + var node = MEMFS.createNode(parent, newname, 511 | 40960, 0); + node.link = oldpath; + return node; + }, + readlink: function(node) { + if (!FS.isLink(node.mode)) { + throw new FS.ErrnoError(28); + } + return node.link; + } + }, + stream_ops: { + read: function(stream, buffer, offset, length, position) { + var contents = stream.node.contents; + if (position >= stream.node.usedBytes) return 0; + var size = Math.min(stream.node.usedBytes - position, length); + assert(size >= 0); + if (size > 8 && contents.subarray) { + buffer.set(contents.subarray(position, position + size), offset); + } else { + for (var i = 0; i < size; i++) buffer[offset + i] = contents[position + i]; + } + return size; + }, + write: function(stream, buffer, offset, length, position, canOwn) { + assert(!(buffer instanceof ArrayBuffer)); + if (buffer.buffer === GROWABLE_HEAP_I8().buffer) { + canOwn = false; + } + if (!length) return 0; + var node = stream.node; + node.timestamp = Date.now(); + if (buffer.subarray && (!node.contents || node.contents.subarray)) { + if (canOwn) { + assert(position === 0, "canOwn must imply no weird position inside the file"); + node.contents = buffer.subarray(offset, offset + length); + node.usedBytes = length; + return length; + } else if (node.usedBytes === 0 && position === 0) { + node.contents = buffer.slice(offset, offset + length); + node.usedBytes = length; + return length; + } else if (position + length <= node.usedBytes) { + node.contents.set(buffer.subarray(offset, offset + length), position); + return length; + } + } + MEMFS.expandFileStorage(node, position + length); + if (node.contents.subarray && buffer.subarray) { + node.contents.set(buffer.subarray(offset, offset + length), position); + } else { + for (var i = 0; i < length; i++) { + node.contents[position + i] = buffer[offset + i]; + } + } + node.usedBytes = Math.max(node.usedBytes, position + length); + return length; + }, + llseek: function(stream, offset, whence) { + var position = offset; + if (whence === 1) { + position += stream.position; + } else if (whence === 2) { + if (FS.isFile(stream.node.mode)) { + position += stream.node.usedBytes; + } + } + if (position < 0) { + throw new FS.ErrnoError(28); + } + return position; + }, + allocate: function(stream, offset, length) { + MEMFS.expandFileStorage(stream.node, offset + length); + stream.node.usedBytes = Math.max(stream.node.usedBytes, offset + length); + }, + mmap: function(stream, length, position, prot, flags) { + if (!FS.isFile(stream.node.mode)) { + throw new FS.ErrnoError(43); + } + var ptr; + var allocated; + var contents = stream.node.contents; + if (!(flags & 2) && contents.buffer === buffer) { + allocated = false; + ptr = contents.byteOffset; + } else { + if (position > 0 || position + length < contents.length) { + if (contents.subarray) { + contents = contents.subarray(position, position + length); + } else { + contents = Array.prototype.slice.call(contents, position, position + length); + } + } + allocated = true; + ptr = mmapAlloc(length); + if (!ptr) { + throw new FS.ErrnoError(48); + } + GROWABLE_HEAP_I8().set(contents, ptr); + } + return { + ptr: ptr, + allocated: allocated + }; + }, + msync: function(stream, buffer, offset, length, mmapFlags) { + if (!FS.isFile(stream.node.mode)) { + throw new FS.ErrnoError(43); + } + if (mmapFlags & 2) { + return 0; + } + var bytesWritten = MEMFS.stream_ops.write(stream, buffer, 0, length, offset, false); + return 0; + } + } +}; + +function asyncLoad(url, onload, onerror, noRunDep) { + var dep = !noRunDep ? getUniqueRunDependency("al " + url) : ""; + readAsync(url, arrayBuffer => { + assert(arrayBuffer, 'Loading data file "' + url + '" failed (no arrayBuffer).'); + onload(new Uint8Array(arrayBuffer)); + if (dep) removeRunDependency(dep); + }, event => { + if (onerror) { + onerror(); + } else { + throw 'Loading data file "' + url + '" failed.'; + } + }); + if (dep) addRunDependency(dep); +} + +var IDBFS = { + dbs: {}, + indexedDB: () => { + if (typeof indexedDB != "undefined") return indexedDB; + var ret = null; + if (typeof window == "object") ret = window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB; + assert(ret, "IDBFS used, but indexedDB not supported"); + return ret; + }, + DB_VERSION: 21, + DB_STORE_NAME: "FILE_DATA", + mount: function(mount) { + return MEMFS.mount.apply(null, arguments); + }, + syncfs: (mount, populate, callback) => { + IDBFS.getLocalSet(mount, (err, local) => { + if (err) return callback(err); + IDBFS.getRemoteSet(mount, (err, remote) => { + if (err) return callback(err); + var src = populate ? remote : local; + var dst = populate ? local : remote; + IDBFS.reconcile(src, dst, callback); + }); + }); + }, + quit: () => { + Object.values(IDBFS.dbs).forEach(value => value.close()); + IDBFS.dbs = {}; + }, + getDB: (name, callback) => { + var db = IDBFS.dbs[name]; + if (db) { + return callback(null, db); + } + var req; + try { + req = IDBFS.indexedDB().open(name, IDBFS.DB_VERSION); + } catch (e) { + return callback(e); + } + if (!req) { + return callback("Unable to connect to IndexedDB"); + } + req.onupgradeneeded = e => { + var db = e.target.result; + var transaction = e.target.transaction; + var fileStore; + if (db.objectStoreNames.contains(IDBFS.DB_STORE_NAME)) { + fileStore = transaction.objectStore(IDBFS.DB_STORE_NAME); + } else { + fileStore = db.createObjectStore(IDBFS.DB_STORE_NAME); + } + if (!fileStore.indexNames.contains("timestamp")) { + fileStore.createIndex("timestamp", "timestamp", { + unique: false + }); + } + }; + req.onsuccess = () => { + db = req.result; + IDBFS.dbs[name] = db; + callback(null, db); + }; + req.onerror = e => { + callback(this.error); + e.preventDefault(); + }; + }, + getLocalSet: (mount, callback) => { + var entries = {}; + function isRealDir(p) { + return p !== "." && p !== ".."; + } + function toAbsolute(root) { + return p => { + return PATH.join2(root, p); + }; + } + var check = FS.readdir(mount.mountpoint).filter(isRealDir).map(toAbsolute(mount.mountpoint)); + while (check.length) { + var path = check.pop(); + var stat; + try { + stat = FS.stat(path); + } catch (e) { + return callback(e); + } + if (FS.isDir(stat.mode)) { + check.push.apply(check, FS.readdir(path).filter(isRealDir).map(toAbsolute(path))); + } + entries[path] = { + "timestamp": stat.mtime + }; + } + return callback(null, { + type: "local", + entries: entries + }); + }, + getRemoteSet: (mount, callback) => { + var entries = {}; + IDBFS.getDB(mount.mountpoint, (err, db) => { + if (err) return callback(err); + try { + var transaction = db.transaction([ IDBFS.DB_STORE_NAME ], "readonly"); + transaction.onerror = e => { + callback(this.error); + e.preventDefault(); + }; + var store = transaction.objectStore(IDBFS.DB_STORE_NAME); + var index = store.index("timestamp"); + index.openKeyCursor().onsuccess = event => { + var cursor = event.target.result; + if (!cursor) { + return callback(null, { + type: "remote", + db: db, + entries: entries + }); + } + entries[cursor.primaryKey] = { + "timestamp": cursor.key + }; + cursor.continue(); + }; + } catch (e) { + return callback(e); + } + }); + }, + loadLocalEntry: (path, callback) => { + var stat, node; + try { + var lookup = FS.lookupPath(path); + node = lookup.node; + stat = FS.stat(path); + } catch (e) { + return callback(e); + } + if (FS.isDir(stat.mode)) { + return callback(null, { + "timestamp": stat.mtime, + "mode": stat.mode + }); + } else if (FS.isFile(stat.mode)) { + node.contents = MEMFS.getFileDataAsTypedArray(node); + return callback(null, { + "timestamp": stat.mtime, + "mode": stat.mode, + "contents": node.contents + }); + } else { + return callback(new Error("node type not supported")); + } + }, + storeLocalEntry: (path, entry, callback) => { + try { + if (FS.isDir(entry["mode"])) { + FS.mkdirTree(path, entry["mode"]); + } else if (FS.isFile(entry["mode"])) { + FS.writeFile(path, entry["contents"], { + canOwn: true + }); + } else { + return callback(new Error("node type not supported")); + } + FS.chmod(path, entry["mode"]); + FS.utime(path, entry["timestamp"], entry["timestamp"]); + } catch (e) { + return callback(e); + } + callback(null); + }, + removeLocalEntry: (path, callback) => { + try { + var stat = FS.stat(path); + if (FS.isDir(stat.mode)) { + FS.rmdir(path); + } else if (FS.isFile(stat.mode)) { + FS.unlink(path); + } + } catch (e) { + return callback(e); + } + callback(null); + }, + loadRemoteEntry: (store, path, callback) => { + var req = store.get(path); + req.onsuccess = event => { + callback(null, event.target.result); + }; + req.onerror = e => { + callback(this.error); + e.preventDefault(); + }; + }, + storeRemoteEntry: (store, path, entry, callback) => { + try { + var req = store.put(entry, path); + } catch (e) { + callback(e); + return; + } + req.onsuccess = () => { + callback(null); + }; + req.onerror = e => { + callback(this.error); + e.preventDefault(); + }; + }, + removeRemoteEntry: (store, path, callback) => { + var req = store.delete(path); + req.onsuccess = () => { + callback(null); + }; + req.onerror = e => { + callback(this.error); + e.preventDefault(); + }; + }, + reconcile: (src, dst, callback) => { + var total = 0; + var create = []; + Object.keys(src.entries).forEach(function(key) { + var e = src.entries[key]; + var e2 = dst.entries[key]; + if (!e2 || e["timestamp"].getTime() != e2["timestamp"].getTime()) { + create.push(key); + total++; + } + }); + var remove = []; + Object.keys(dst.entries).forEach(function(key) { + if (!src.entries[key]) { + remove.push(key); + total++; + } + }); + if (!total) { + return callback(null); + } + var errored = false; + var db = src.type === "remote" ? src.db : dst.db; + var transaction = db.transaction([ IDBFS.DB_STORE_NAME ], "readwrite"); + var store = transaction.objectStore(IDBFS.DB_STORE_NAME); + function done(err) { + if (err && !errored) { + errored = true; + return callback(err); + } + } + transaction.onerror = e => { + done(this.error); + e.preventDefault(); + }; + transaction.oncomplete = e => { + if (!errored) { + callback(null); + } + }; + create.sort().forEach(path => { + if (dst.type === "local") { + IDBFS.loadRemoteEntry(store, path, (err, entry) => { + if (err) return done(err); + IDBFS.storeLocalEntry(path, entry, done); + }); + } else { + IDBFS.loadLocalEntry(path, (err, entry) => { + if (err) return done(err); + IDBFS.storeRemoteEntry(store, path, entry, done); + }); + } + }); + remove.sort().reverse().forEach(path => { + if (dst.type === "local") { + IDBFS.removeLocalEntry(path, done); + } else { + IDBFS.removeRemoteEntry(store, path, done); + } + }); + } +}; + +var ERRNO_MESSAGES = { + 0: "Success", + 1: "Arg list too long", + 2: "Permission denied", + 3: "Address already in use", + 4: "Address not available", + 5: "Address family not supported by protocol family", + 6: "No more processes", + 7: "Socket already connected", + 8: "Bad file number", + 9: "Trying to read unreadable message", + 10: "Mount device busy", + 11: "Operation canceled", + 12: "No children", + 13: "Connection aborted", + 14: "Connection refused", + 15: "Connection reset by peer", + 16: "File locking deadlock error", + 17: "Destination address required", + 18: "Math arg out of domain of func", + 19: "Quota exceeded", + 20: "File exists", + 21: "Bad address", + 22: "File too large", + 23: "Host is unreachable", + 24: "Identifier removed", + 25: "Illegal byte sequence", + 26: "Connection already in progress", + 27: "Interrupted system call", + 28: "Invalid argument", + 29: "I/O error", + 30: "Socket is already connected", + 31: "Is a directory", + 32: "Too many symbolic links", + 33: "Too many open files", + 34: "Too many links", + 35: "Message too long", + 36: "Multihop attempted", + 37: "File or path name too long", + 38: "Network interface is not configured", + 39: "Connection reset by network", + 40: "Network is unreachable", + 41: "Too many open files in system", + 42: "No buffer space available", + 43: "No such device", + 44: "No such file or directory", + 45: "Exec format error", + 46: "No record locks available", + 47: "The link has been severed", + 48: "Not enough core", + 49: "No message of desired type", + 50: "Protocol not available", + 51: "No space left on device", + 52: "Function not implemented", + 53: "Socket is not connected", + 54: "Not a directory", + 55: "Directory not empty", + 56: "State not recoverable", + 57: "Socket operation on non-socket", + 59: "Not a typewriter", + 60: "No such device or address", + 61: "Value too large for defined data type", + 62: "Previous owner died", + 63: "Not super-user", + 64: "Broken pipe", + 65: "Protocol error", + 66: "Unknown protocol", + 67: "Protocol wrong type for socket", + 68: "Math result not representable", + 69: "Read only file system", + 70: "Illegal seek", + 71: "No such process", + 72: "Stale file handle", + 73: "Connection timed out", + 74: "Text file busy", + 75: "Cross-device link", + 100: "Device not a stream", + 101: "Bad font file fmt", + 102: "Invalid slot", + 103: "Invalid request code", + 104: "No anode", + 105: "Block device required", + 106: "Channel number out of range", + 107: "Level 3 halted", + 108: "Level 3 reset", + 109: "Link number out of range", + 110: "Protocol driver not attached", + 111: "No CSI structure available", + 112: "Level 2 halted", + 113: "Invalid exchange", + 114: "Invalid request descriptor", + 115: "Exchange full", + 116: "No data (for no delay io)", + 117: "Timer expired", + 118: "Out of streams resources", + 119: "Machine is not on the network", + 120: "Package not installed", + 121: "The object is remote", + 122: "Advertise error", + 123: "Srmount error", + 124: "Communication error on send", + 125: "Cross mount point (not really error)", + 126: "Given log. name not unique", + 127: "f.d. invalid for this operation", + 128: "Remote address changed", + 129: "Can access a needed shared lib", + 130: "Accessing a corrupted shared lib", + 131: ".lib section in a.out corrupted", + 132: "Attempting to link in too many libs", + 133: "Attempting to exec a shared library", + 135: "Streams pipe error", + 136: "Too many users", + 137: "Socket type not supported", + 138: "Not supported", + 139: "Protocol family not supported", + 140: "Can't send after socket shutdown", + 141: "Too many references", + 142: "Host is down", + 148: "No medium (in tape drive)", + 156: "Level 2 not synchronized" +}; + +var ERRNO_CODES = {}; + +var FS = { + root: null, + mounts: [], + devices: {}, + streams: [], + nextInode: 1, + nameTable: null, + currentPath: "/", + initialized: false, + ignorePermissions: true, + ErrnoError: null, + genericErrors: {}, + filesystems: null, + syncFSRequests: 0, + lookupPath: (path, opts = {}) => { + path = PATH_FS.resolve(FS.cwd(), path); + if (!path) return { + path: "", + node: null + }; + var defaults = { + follow_mount: true, + recurse_count: 0 + }; + opts = Object.assign(defaults, opts); + if (opts.recurse_count > 8) { + throw new FS.ErrnoError(32); + } + var parts = PATH.normalizeArray(path.split("/").filter(p => !!p), false); + var current = FS.root; + var current_path = "/"; + for (var i = 0; i < parts.length; i++) { + var islast = i === parts.length - 1; + if (islast && opts.parent) { + break; + } + current = FS.lookupNode(current, parts[i]); + current_path = PATH.join2(current_path, parts[i]); + if (FS.isMountpoint(current)) { + if (!islast || islast && opts.follow_mount) { + current = current.mounted.root; + } + } + if (!islast || opts.follow) { + var count = 0; + while (FS.isLink(current.mode)) { + var link = FS.readlink(current_path); + current_path = PATH_FS.resolve(PATH.dirname(current_path), link); + var lookup = FS.lookupPath(current_path, { + recurse_count: opts.recurse_count + 1 + }); + current = lookup.node; + if (count++ > 40) { + throw new FS.ErrnoError(32); + } + } + } + } + return { + path: current_path, + node: current + }; + }, + getPath: node => { + var path; + while (true) { + if (FS.isRoot(node)) { + var mount = node.mount.mountpoint; + if (!path) return mount; + return mount[mount.length - 1] !== "/" ? mount + "/" + path : mount + path; + } + path = path ? node.name + "/" + path : node.name; + node = node.parent; + } + }, + hashName: (parentid, name) => { + var hash = 0; + for (var i = 0; i < name.length; i++) { + hash = (hash << 5) - hash + name.charCodeAt(i) | 0; + } + return (parentid + hash >>> 0) % FS.nameTable.length; + }, + hashAddNode: node => { + var hash = FS.hashName(node.parent.id, node.name); + node.name_next = FS.nameTable[hash]; + FS.nameTable[hash] = node; + }, + hashRemoveNode: node => { + var hash = FS.hashName(node.parent.id, node.name); + if (FS.nameTable[hash] === node) { + FS.nameTable[hash] = node.name_next; + } else { + var current = FS.nameTable[hash]; + while (current) { + if (current.name_next === node) { + current.name_next = node.name_next; + break; + } + current = current.name_next; + } + } + }, + lookupNode: (parent, name) => { + var errCode = FS.mayLookup(parent); + if (errCode) { + throw new FS.ErrnoError(errCode, parent); + } + var hash = FS.hashName(parent.id, name); + for (var node = FS.nameTable[hash]; node; node = node.name_next) { + var nodeName = node.name; + if (node.parent.id === parent.id && nodeName === name) { + return node; + } + } + return FS.lookup(parent, name); + }, + createNode: (parent, name, mode, rdev) => { + assert(typeof parent == "object"); + var node = new FS.FSNode(parent, name, mode, rdev); + FS.hashAddNode(node); + return node; + }, + destroyNode: node => { + FS.hashRemoveNode(node); + }, + isRoot: node => { + return node === node.parent; + }, + isMountpoint: node => { + return !!node.mounted; + }, + isFile: mode => { + return (mode & 61440) === 32768; + }, + isDir: mode => { + return (mode & 61440) === 16384; + }, + isLink: mode => { + return (mode & 61440) === 40960; + }, + isChrdev: mode => { + return (mode & 61440) === 8192; + }, + isBlkdev: mode => { + return (mode & 61440) === 24576; + }, + isFIFO: mode => { + return (mode & 61440) === 4096; + }, + isSocket: mode => { + return (mode & 49152) === 49152; + }, + flagModes: { + "r": 0, + "r+": 2, + "w": 577, + "w+": 578, + "a": 1089, + "a+": 1090 + }, + modeStringToFlags: str => { + var flags = FS.flagModes[str]; + if (typeof flags == "undefined") { + throw new Error("Unknown file open mode: " + str); + } + return flags; + }, + flagsToPermissionString: flag => { + var perms = [ "r", "w", "rw" ][flag & 3]; + if (flag & 512) { + perms += "w"; + } + return perms; + }, + nodePermissions: (node, perms) => { + if (FS.ignorePermissions) { + return 0; + } + if (perms.includes("r") && !(node.mode & 292)) { + return 2; + } else if (perms.includes("w") && !(node.mode & 146)) { + return 2; + } else if (perms.includes("x") && !(node.mode & 73)) { + return 2; + } + return 0; + }, + mayLookup: dir => { + var errCode = FS.nodePermissions(dir, "x"); + if (errCode) return errCode; + if (!dir.node_ops.lookup) return 2; + return 0; + }, + mayCreate: (dir, name) => { + try { + var node = FS.lookupNode(dir, name); + return 20; + } catch (e) {} + return FS.nodePermissions(dir, "wx"); + }, + mayDelete: (dir, name, isdir) => { + var node; + try { + node = FS.lookupNode(dir, name); + } catch (e) { + return e.errno; + } + var errCode = FS.nodePermissions(dir, "wx"); + if (errCode) { + return errCode; + } + if (isdir) { + if (!FS.isDir(node.mode)) { + return 54; + } + if (FS.isRoot(node) || FS.getPath(node) === FS.cwd()) { + return 10; + } + } else { + if (FS.isDir(node.mode)) { + return 31; + } + } + return 0; + }, + mayOpen: (node, flags) => { + if (!node) { + return 44; + } + if (FS.isLink(node.mode)) { + return 32; + } else if (FS.isDir(node.mode)) { + if (FS.flagsToPermissionString(flags) !== "r" || flags & 512) { + return 31; + } + } + return FS.nodePermissions(node, FS.flagsToPermissionString(flags)); + }, + MAX_OPEN_FDS: 4096, + nextfd: (fd_start = 0, fd_end = FS.MAX_OPEN_FDS) => { + for (var fd = fd_start; fd <= fd_end; fd++) { + if (!FS.streams[fd]) { + return fd; + } + } + throw new FS.ErrnoError(33); + }, + getStream: fd => FS.streams[fd], + createStream: (stream, fd_start, fd_end) => { + if (!FS.FSStream) { + FS.FSStream = function() { + this.shared = {}; + }; + FS.FSStream.prototype = {}; + Object.defineProperties(FS.FSStream.prototype, { + object: { + get: function() { + return this.node; + }, + set: function(val) { + this.node = val; + } + }, + isRead: { + get: function() { + return (this.flags & 2097155) !== 1; + } + }, + isWrite: { + get: function() { + return (this.flags & 2097155) !== 0; + } + }, + isAppend: { + get: function() { + return this.flags & 1024; + } + }, + flags: { + get: function() { + return this.shared.flags; + }, + set: function(val) { + this.shared.flags = val; + } + }, + position: { + get: function() { + return this.shared.position; + }, + set: function(val) { + this.shared.position = val; + } + } + }); + } + stream = Object.assign(new FS.FSStream(), stream); + var fd = FS.nextfd(fd_start, fd_end); + stream.fd = fd; + FS.streams[fd] = stream; + return stream; + }, + closeStream: fd => { + FS.streams[fd] = null; + }, + chrdev_stream_ops: { + open: stream => { + var device = FS.getDevice(stream.node.rdev); + stream.stream_ops = device.stream_ops; + if (stream.stream_ops.open) { + stream.stream_ops.open(stream); + } + }, + llseek: () => { + throw new FS.ErrnoError(70); + } + }, + major: dev => dev >> 8, + minor: dev => dev & 255, + makedev: (ma, mi) => ma << 8 | mi, + registerDevice: (dev, ops) => { + FS.devices[dev] = { + stream_ops: ops + }; + }, + getDevice: dev => FS.devices[dev], + getMounts: mount => { + var mounts = []; + var check = [ mount ]; + while (check.length) { + var m = check.pop(); + mounts.push(m); + check.push.apply(check, m.mounts); + } + return mounts; + }, + syncfs: (populate, callback) => { + if (typeof populate == "function") { + callback = populate; + populate = false; + } + FS.syncFSRequests++; + if (FS.syncFSRequests > 1) { + err("warning: " + FS.syncFSRequests + " FS.syncfs operations in flight at once, probably just doing extra work"); + } + var mounts = FS.getMounts(FS.root.mount); + var completed = 0; + function doCallback(errCode) { + assert(FS.syncFSRequests > 0); + FS.syncFSRequests--; + return callback(errCode); + } + function done(errCode) { + if (errCode) { + if (!done.errored) { + done.errored = true; + return doCallback(errCode); + } + return; + } + if (++completed >= mounts.length) { + doCallback(null); + } + } + mounts.forEach(mount => { + if (!mount.type.syncfs) { + return done(null); + } + mount.type.syncfs(mount, populate, done); + }); + }, + mount: (type, opts, mountpoint) => { + if (typeof type == "string") { + throw type; + } + var root = mountpoint === "/"; + var pseudo = !mountpoint; + var node; + if (root && FS.root) { + throw new FS.ErrnoError(10); + } else if (!root && !pseudo) { + var lookup = FS.lookupPath(mountpoint, { + follow_mount: false + }); + mountpoint = lookup.path; + node = lookup.node; + if (FS.isMountpoint(node)) { + throw new FS.ErrnoError(10); + } + if (!FS.isDir(node.mode)) { + throw new FS.ErrnoError(54); + } + } + var mount = { + type: type, + opts: opts, + mountpoint: mountpoint, + mounts: [] + }; + var mountRoot = type.mount(mount); + mountRoot.mount = mount; + mount.root = mountRoot; + if (root) { + FS.root = mountRoot; + } else if (node) { + node.mounted = mount; + if (node.mount) { + node.mount.mounts.push(mount); + } + } + return mountRoot; + }, + unmount: mountpoint => { + var lookup = FS.lookupPath(mountpoint, { + follow_mount: false + }); + if (!FS.isMountpoint(lookup.node)) { + throw new FS.ErrnoError(28); + } + var node = lookup.node; + var mount = node.mounted; + var mounts = FS.getMounts(mount); + Object.keys(FS.nameTable).forEach(hash => { + var current = FS.nameTable[hash]; + while (current) { + var next = current.name_next; + if (mounts.includes(current.mount)) { + FS.destroyNode(current); + } + current = next; + } + }); + node.mounted = null; + var idx = node.mount.mounts.indexOf(mount); + assert(idx !== -1); + node.mount.mounts.splice(idx, 1); + }, + lookup: (parent, name) => { + return parent.node_ops.lookup(parent, name); + }, + mknod: (path, mode, dev) => { + var lookup = FS.lookupPath(path, { + parent: true + }); + var parent = lookup.node; + var name = PATH.basename(path); + if (!name || name === "." || name === "..") { + throw new FS.ErrnoError(28); + } + var errCode = FS.mayCreate(parent, name); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + if (!parent.node_ops.mknod) { + throw new FS.ErrnoError(63); + } + return parent.node_ops.mknod(parent, name, mode, dev); + }, + create: (path, mode) => { + mode = mode !== undefined ? mode : 438; + mode &= 4095; + mode |= 32768; + return FS.mknod(path, mode, 0); + }, + mkdir: (path, mode) => { + mode = mode !== undefined ? mode : 511; + mode &= 511 | 512; + mode |= 16384; + return FS.mknod(path, mode, 0); + }, + mkdirTree: (path, mode) => { + var dirs = path.split("/"); + var d = ""; + for (var i = 0; i < dirs.length; ++i) { + if (!dirs[i]) continue; + d += "/" + dirs[i]; + try { + FS.mkdir(d, mode); + } catch (e) { + if (e.errno != 20) throw e; + } + } + }, + mkdev: (path, mode, dev) => { + if (typeof dev == "undefined") { + dev = mode; + mode = 438; + } + mode |= 8192; + return FS.mknod(path, mode, dev); + }, + symlink: (oldpath, newpath) => { + if (!PATH_FS.resolve(oldpath)) { + throw new FS.ErrnoError(44); + } + var lookup = FS.lookupPath(newpath, { + parent: true + }); + var parent = lookup.node; + if (!parent) { + throw new FS.ErrnoError(44); + } + var newname = PATH.basename(newpath); + var errCode = FS.mayCreate(parent, newname); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + if (!parent.node_ops.symlink) { + throw new FS.ErrnoError(63); + } + return parent.node_ops.symlink(parent, newname, oldpath); + }, + rename: (old_path, new_path) => { + var old_dirname = PATH.dirname(old_path); + var new_dirname = PATH.dirname(new_path); + var old_name = PATH.basename(old_path); + var new_name = PATH.basename(new_path); + var lookup, old_dir, new_dir; + lookup = FS.lookupPath(old_path, { + parent: true + }); + old_dir = lookup.node; + lookup = FS.lookupPath(new_path, { + parent: true + }); + new_dir = lookup.node; + if (!old_dir || !new_dir) throw new FS.ErrnoError(44); + if (old_dir.mount !== new_dir.mount) { + throw new FS.ErrnoError(75); + } + var old_node = FS.lookupNode(old_dir, old_name); + var relative = PATH_FS.relative(old_path, new_dirname); + if (relative.charAt(0) !== ".") { + throw new FS.ErrnoError(28); + } + relative = PATH_FS.relative(new_path, old_dirname); + if (relative.charAt(0) !== ".") { + throw new FS.ErrnoError(55); + } + var new_node; + try { + new_node = FS.lookupNode(new_dir, new_name); + } catch (e) {} + if (old_node === new_node) { + return; + } + var isdir = FS.isDir(old_node.mode); + var errCode = FS.mayDelete(old_dir, old_name, isdir); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + errCode = new_node ? FS.mayDelete(new_dir, new_name, isdir) : FS.mayCreate(new_dir, new_name); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + if (!old_dir.node_ops.rename) { + throw new FS.ErrnoError(63); + } + if (FS.isMountpoint(old_node) || new_node && FS.isMountpoint(new_node)) { + throw new FS.ErrnoError(10); + } + if (new_dir !== old_dir) { + errCode = FS.nodePermissions(old_dir, "w"); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + } + FS.hashRemoveNode(old_node); + try { + old_dir.node_ops.rename(old_node, new_dir, new_name); + } catch (e) { + throw e; + } finally { + FS.hashAddNode(old_node); + } + }, + rmdir: path => { + var lookup = FS.lookupPath(path, { + parent: true + }); + var parent = lookup.node; + var name = PATH.basename(path); + var node = FS.lookupNode(parent, name); + var errCode = FS.mayDelete(parent, name, true); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + if (!parent.node_ops.rmdir) { + throw new FS.ErrnoError(63); + } + if (FS.isMountpoint(node)) { + throw new FS.ErrnoError(10); + } + parent.node_ops.rmdir(parent, name); + FS.destroyNode(node); + }, + readdir: path => { + var lookup = FS.lookupPath(path, { + follow: true + }); + var node = lookup.node; + if (!node.node_ops.readdir) { + throw new FS.ErrnoError(54); + } + return node.node_ops.readdir(node); + }, + unlink: path => { + var lookup = FS.lookupPath(path, { + parent: true + }); + var parent = lookup.node; + if (!parent) { + throw new FS.ErrnoError(44); + } + var name = PATH.basename(path); + var node = FS.lookupNode(parent, name); + var errCode = FS.mayDelete(parent, name, false); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + if (!parent.node_ops.unlink) { + throw new FS.ErrnoError(63); + } + if (FS.isMountpoint(node)) { + throw new FS.ErrnoError(10); + } + parent.node_ops.unlink(parent, name); + FS.destroyNode(node); + }, + readlink: path => { + var lookup = FS.lookupPath(path); + var link = lookup.node; + if (!link) { + throw new FS.ErrnoError(44); + } + if (!link.node_ops.readlink) { + throw new FS.ErrnoError(28); + } + return PATH_FS.resolve(FS.getPath(link.parent), link.node_ops.readlink(link)); + }, + stat: (path, dontFollow) => { + var lookup = FS.lookupPath(path, { + follow: !dontFollow + }); + var node = lookup.node; + if (!node) { + throw new FS.ErrnoError(44); + } + if (!node.node_ops.getattr) { + throw new FS.ErrnoError(63); + } + return node.node_ops.getattr(node); + }, + lstat: path => { + return FS.stat(path, true); + }, + chmod: (path, mode, dontFollow) => { + var node; + if (typeof path == "string") { + var lookup = FS.lookupPath(path, { + follow: !dontFollow + }); + node = lookup.node; + } else { + node = path; + } + if (!node.node_ops.setattr) { + throw new FS.ErrnoError(63); + } + node.node_ops.setattr(node, { + mode: mode & 4095 | node.mode & ~4095, + timestamp: Date.now() + }); + }, + lchmod: (path, mode) => { + FS.chmod(path, mode, true); + }, + fchmod: (fd, mode) => { + var stream = FS.getStream(fd); + if (!stream) { + throw new FS.ErrnoError(8); + } + FS.chmod(stream.node, mode); + }, + chown: (path, uid, gid, dontFollow) => { + var node; + if (typeof path == "string") { + var lookup = FS.lookupPath(path, { + follow: !dontFollow + }); + node = lookup.node; + } else { + node = path; + } + if (!node.node_ops.setattr) { + throw new FS.ErrnoError(63); + } + node.node_ops.setattr(node, { + timestamp: Date.now() + }); + }, + lchown: (path, uid, gid) => { + FS.chown(path, uid, gid, true); + }, + fchown: (fd, uid, gid) => { + var stream = FS.getStream(fd); + if (!stream) { + throw new FS.ErrnoError(8); + } + FS.chown(stream.node, uid, gid); + }, + truncate: (path, len) => { + if (len < 0) { + throw new FS.ErrnoError(28); + } + var node; + if (typeof path == "string") { + var lookup = FS.lookupPath(path, { + follow: true + }); + node = lookup.node; + } else { + node = path; + } + if (!node.node_ops.setattr) { + throw new FS.ErrnoError(63); + } + if (FS.isDir(node.mode)) { + throw new FS.ErrnoError(31); + } + if (!FS.isFile(node.mode)) { + throw new FS.ErrnoError(28); + } + var errCode = FS.nodePermissions(node, "w"); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + node.node_ops.setattr(node, { + size: len, + timestamp: Date.now() + }); + }, + ftruncate: (fd, len) => { + var stream = FS.getStream(fd); + if (!stream) { + throw new FS.ErrnoError(8); + } + if ((stream.flags & 2097155) === 0) { + throw new FS.ErrnoError(28); + } + FS.truncate(stream.node, len); + }, + utime: (path, atime, mtime) => { + var lookup = FS.lookupPath(path, { + follow: true + }); + var node = lookup.node; + node.node_ops.setattr(node, { + timestamp: Math.max(atime, mtime) + }); + }, + open: (path, flags, mode) => { + if (path === "") { + throw new FS.ErrnoError(44); + } + flags = typeof flags == "string" ? FS.modeStringToFlags(flags) : flags; + mode = typeof mode == "undefined" ? 438 : mode; + if (flags & 64) { + mode = mode & 4095 | 32768; + } else { + mode = 0; + } + var node; + if (typeof path == "object") { + node = path; + } else { + path = PATH.normalize(path); + try { + var lookup = FS.lookupPath(path, { + follow: !(flags & 131072) + }); + node = lookup.node; + } catch (e) {} + } + var created = false; + if (flags & 64) { + if (node) { + if (flags & 128) { + throw new FS.ErrnoError(20); + } + } else { + node = FS.mknod(path, mode, 0); + created = true; + } + } + if (!node) { + throw new FS.ErrnoError(44); + } + if (FS.isChrdev(node.mode)) { + flags &= ~512; + } + if (flags & 65536 && !FS.isDir(node.mode)) { + throw new FS.ErrnoError(54); + } + if (!created) { + var errCode = FS.mayOpen(node, flags); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + } + if (flags & 512 && !created) { + FS.truncate(node, 0); + } + flags &= ~(128 | 512 | 131072); + var stream = FS.createStream({ + node: node, + path: FS.getPath(node), + flags: flags, + seekable: true, + position: 0, + stream_ops: node.stream_ops, + ungotten: [], + error: false + }); + if (stream.stream_ops.open) { + stream.stream_ops.open(stream); + } + if (Module["logReadFiles"] && !(flags & 1)) { + if (!FS.readFiles) FS.readFiles = {}; + if (!(path in FS.readFiles)) { + FS.readFiles[path] = 1; + } + } + return stream; + }, + close: stream => { + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8); + } + if (stream.getdents) stream.getdents = null; + try { + if (stream.stream_ops.close) { + stream.stream_ops.close(stream); + } + } catch (e) { + throw e; + } finally { + FS.closeStream(stream.fd); + } + stream.fd = null; + }, + isClosed: stream => { + return stream.fd === null; + }, + llseek: (stream, offset, whence) => { + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8); + } + if (!stream.seekable || !stream.stream_ops.llseek) { + throw new FS.ErrnoError(70); + } + if (whence != 0 && whence != 1 && whence != 2) { + throw new FS.ErrnoError(28); + } + stream.position = stream.stream_ops.llseek(stream, offset, whence); + stream.ungotten = []; + return stream.position; + }, + read: (stream, buffer, offset, length, position) => { + if (length < 0 || position < 0) { + throw new FS.ErrnoError(28); + } + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8); + } + if ((stream.flags & 2097155) === 1) { + throw new FS.ErrnoError(8); + } + if (FS.isDir(stream.node.mode)) { + throw new FS.ErrnoError(31); + } + if (!stream.stream_ops.read) { + throw new FS.ErrnoError(28); + } + var seeking = typeof position != "undefined"; + if (!seeking) { + position = stream.position; + } else if (!stream.seekable) { + throw new FS.ErrnoError(70); + } + var bytesRead = stream.stream_ops.read(stream, buffer, offset, length, position); + if (!seeking) stream.position += bytesRead; + return bytesRead; + }, + write: (stream, buffer, offset, length, position, canOwn) => { + if (length < 0 || position < 0) { + throw new FS.ErrnoError(28); + } + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8); + } + if ((stream.flags & 2097155) === 0) { + throw new FS.ErrnoError(8); + } + if (FS.isDir(stream.node.mode)) { + throw new FS.ErrnoError(31); + } + if (!stream.stream_ops.write) { + throw new FS.ErrnoError(28); + } + if (stream.seekable && stream.flags & 1024) { + FS.llseek(stream, 0, 2); + } + var seeking = typeof position != "undefined"; + if (!seeking) { + position = stream.position; + } else if (!stream.seekable) { + throw new FS.ErrnoError(70); + } + var bytesWritten = stream.stream_ops.write(stream, buffer, offset, length, position, canOwn); + if (!seeking) stream.position += bytesWritten; + return bytesWritten; + }, + allocate: (stream, offset, length) => { + if (FS.isClosed(stream)) { + throw new FS.ErrnoError(8); + } + if (offset < 0 || length <= 0) { + throw new FS.ErrnoError(28); + } + if ((stream.flags & 2097155) === 0) { + throw new FS.ErrnoError(8); + } + if (!FS.isFile(stream.node.mode) && !FS.isDir(stream.node.mode)) { + throw new FS.ErrnoError(43); + } + if (!stream.stream_ops.allocate) { + throw new FS.ErrnoError(138); + } + stream.stream_ops.allocate(stream, offset, length); + }, + mmap: (stream, length, position, prot, flags) => { + if ((prot & 2) !== 0 && (flags & 2) === 0 && (stream.flags & 2097155) !== 2) { + throw new FS.ErrnoError(2); + } + if ((stream.flags & 2097155) === 1) { + throw new FS.ErrnoError(2); + } + if (!stream.stream_ops.mmap) { + throw new FS.ErrnoError(43); + } + return stream.stream_ops.mmap(stream, length, position, prot, flags); + }, + msync: (stream, buffer, offset, length, mmapFlags) => { + if (!stream || !stream.stream_ops.msync) { + return 0; + } + return stream.stream_ops.msync(stream, buffer, offset, length, mmapFlags); + }, + munmap: stream => 0, + ioctl: (stream, cmd, arg) => { + if (!stream.stream_ops.ioctl) { + throw new FS.ErrnoError(59); + } + return stream.stream_ops.ioctl(stream, cmd, arg); + }, + readFile: (path, opts = {}) => { + opts.flags = opts.flags || 0; + opts.encoding = opts.encoding || "binary"; + if (opts.encoding !== "utf8" && opts.encoding !== "binary") { + throw new Error('Invalid encoding type "' + opts.encoding + '"'); + } + var ret; + var stream = FS.open(path, opts.flags); + var stat = FS.stat(path); + var length = stat.size; + var buf = new Uint8Array(length); + FS.read(stream, buf, 0, length, 0); + if (opts.encoding === "utf8") { + ret = UTF8ArrayToString(buf, 0); + } else if (opts.encoding === "binary") { + ret = buf; + } + FS.close(stream); + return ret; + }, + writeFile: (path, data, opts = {}) => { + opts.flags = opts.flags || 577; + var stream = FS.open(path, opts.flags, opts.mode); + if (typeof data == "string") { + var buf = new Uint8Array(lengthBytesUTF8(data) + 1); + var actualNumBytes = stringToUTF8Array(data, buf, 0, buf.length); + FS.write(stream, buf, 0, actualNumBytes, undefined, opts.canOwn); + } else if (ArrayBuffer.isView(data)) { + FS.write(stream, data, 0, data.byteLength, undefined, opts.canOwn); + } else { + throw new Error("Unsupported data type"); + } + FS.close(stream); + }, + cwd: () => FS.currentPath, + chdir: path => { + var lookup = FS.lookupPath(path, { + follow: true + }); + if (lookup.node === null) { + throw new FS.ErrnoError(44); + } + if (!FS.isDir(lookup.node.mode)) { + throw new FS.ErrnoError(54); + } + var errCode = FS.nodePermissions(lookup.node, "x"); + if (errCode) { + throw new FS.ErrnoError(errCode); + } + FS.currentPath = lookup.path; + }, + createDefaultDirectories: () => { + FS.mkdir("/tmp"); + FS.mkdir("/home"); + FS.mkdir("/home/web_user"); + }, + createDefaultDevices: () => { + FS.mkdir("/dev"); + FS.registerDevice(FS.makedev(1, 3), { + read: () => 0, + write: (stream, buffer, offset, length, pos) => length + }); + FS.mkdev("/dev/null", FS.makedev(1, 3)); + TTY.register(FS.makedev(5, 0), TTY.default_tty_ops); + TTY.register(FS.makedev(6, 0), TTY.default_tty1_ops); + FS.mkdev("/dev/tty", FS.makedev(5, 0)); + FS.mkdev("/dev/tty1", FS.makedev(6, 0)); + var random_device = getRandomDevice(); + FS.createDevice("/dev", "random", random_device); + FS.createDevice("/dev", "urandom", random_device); + FS.mkdir("/dev/shm"); + FS.mkdir("/dev/shm/tmp"); + }, + createSpecialDirectories: () => { + FS.mkdir("/proc"); + var proc_self = FS.mkdir("/proc/self"); + FS.mkdir("/proc/self/fd"); + FS.mount({ + mount: () => { + var node = FS.createNode(proc_self, "fd", 16384 | 511, 73); + node.node_ops = { + lookup: (parent, name) => { + var fd = +name; + var stream = FS.getStream(fd); + if (!stream) throw new FS.ErrnoError(8); + var ret = { + parent: null, + mount: { + mountpoint: "fake" + }, + node_ops: { + readlink: () => stream.path + } + }; + ret.parent = ret; + return ret; + } + }; + return node; + } + }, {}, "/proc/self/fd"); + }, + createStandardStreams: () => { + if (Module["stdin"]) { + FS.createDevice("/dev", "stdin", Module["stdin"]); + } else { + FS.symlink("/dev/tty", "/dev/stdin"); + } + if (Module["stdout"]) { + FS.createDevice("/dev", "stdout", null, Module["stdout"]); + } else { + FS.symlink("/dev/tty", "/dev/stdout"); + } + if (Module["stderr"]) { + FS.createDevice("/dev", "stderr", null, Module["stderr"]); + } else { + FS.symlink("/dev/tty1", "/dev/stderr"); + } + var stdin = FS.open("/dev/stdin", 0); + var stdout = FS.open("/dev/stdout", 1); + var stderr = FS.open("/dev/stderr", 1); + assert(stdin.fd === 0, "invalid handle for stdin (" + stdin.fd + ")"); + assert(stdout.fd === 1, "invalid handle for stdout (" + stdout.fd + ")"); + assert(stderr.fd === 2, "invalid handle for stderr (" + stderr.fd + ")"); + }, + ensureErrnoError: () => { + if (FS.ErrnoError) return; + FS.ErrnoError = function ErrnoError(errno, node) { + this.node = node; + this.setErrno = function(errno) { + this.errno = errno; + for (var key in ERRNO_CODES) { + if (ERRNO_CODES[key] === errno) { + this.code = key; + break; + } + } + }; + this.setErrno(errno); + this.message = ERRNO_MESSAGES[errno]; + if (this.stack) { + Object.defineProperty(this, "stack", { + value: new Error().stack, + writable: true + }); + this.stack = demangleAll(this.stack); + } + }; + FS.ErrnoError.prototype = new Error(); + FS.ErrnoError.prototype.constructor = FS.ErrnoError; + [ 44 ].forEach(code => { + FS.genericErrors[code] = new FS.ErrnoError(code); + FS.genericErrors[code].stack = ""; + }); + }, + staticInit: () => { + FS.ensureErrnoError(); + FS.nameTable = new Array(4096); + FS.mount(MEMFS, {}, "/"); + FS.createDefaultDirectories(); + FS.createDefaultDevices(); + FS.createSpecialDirectories(); + FS.filesystems = { + "MEMFS": MEMFS, + "IDBFS": IDBFS + }; + }, + init: (input, output, error) => { + assert(!FS.init.initialized, "FS.init was previously called. If you want to initialize later with custom parameters, remove any earlier calls (note that one is automatically added to the generated code)"); + FS.init.initialized = true; + FS.ensureErrnoError(); + Module["stdin"] = input || Module["stdin"]; + Module["stdout"] = output || Module["stdout"]; + Module["stderr"] = error || Module["stderr"]; + FS.createStandardStreams(); + }, + quit: () => { + FS.init.initialized = false; + _fflush(0); + for (var i = 0; i < FS.streams.length; i++) { + var stream = FS.streams[i]; + if (!stream) { + continue; + } + FS.close(stream); + } + }, + getMode: (canRead, canWrite) => { + var mode = 0; + if (canRead) mode |= 292 | 73; + if (canWrite) mode |= 146; + return mode; + }, + findObject: (path, dontResolveLastLink) => { + var ret = FS.analyzePath(path, dontResolveLastLink); + if (!ret.exists) { + return null; + } + return ret.object; + }, + analyzePath: (path, dontResolveLastLink) => { + try { + var lookup = FS.lookupPath(path, { + follow: !dontResolveLastLink + }); + path = lookup.path; + } catch (e) {} + var ret = { + isRoot: false, + exists: false, + error: 0, + name: null, + path: null, + object: null, + parentExists: false, + parentPath: null, + parentObject: null + }; + try { + var lookup = FS.lookupPath(path, { + parent: true + }); + ret.parentExists = true; + ret.parentPath = lookup.path; + ret.parentObject = lookup.node; + ret.name = PATH.basename(path); + lookup = FS.lookupPath(path, { + follow: !dontResolveLastLink + }); + ret.exists = true; + ret.path = lookup.path; + ret.object = lookup.node; + ret.name = lookup.node.name; + ret.isRoot = lookup.path === "/"; + } catch (e) { + ret.error = e.errno; + } + return ret; + }, + createPath: (parent, path, canRead, canWrite) => { + parent = typeof parent == "string" ? parent : FS.getPath(parent); + var parts = path.split("/").reverse(); + while (parts.length) { + var part = parts.pop(); + if (!part) continue; + var current = PATH.join2(parent, part); + try { + FS.mkdir(current); + } catch (e) {} + parent = current; + } + return current; + }, + createFile: (parent, name, properties, canRead, canWrite) => { + var path = PATH.join2(typeof parent == "string" ? parent : FS.getPath(parent), name); + var mode = FS.getMode(canRead, canWrite); + return FS.create(path, mode); + }, + createDataFile: (parent, name, data, canRead, canWrite, canOwn) => { + var path = name; + if (parent) { + parent = typeof parent == "string" ? parent : FS.getPath(parent); + path = name ? PATH.join2(parent, name) : parent; + } + var mode = FS.getMode(canRead, canWrite); + var node = FS.create(path, mode); + if (data) { + if (typeof data == "string") { + var arr = new Array(data.length); + for (var i = 0, len = data.length; i < len; ++i) arr[i] = data.charCodeAt(i); + data = arr; + } + FS.chmod(node, mode | 146); + var stream = FS.open(node, 577); + FS.write(stream, data, 0, data.length, 0, canOwn); + FS.close(stream); + FS.chmod(node, mode); + } + return node; + }, + createDevice: (parent, name, input, output) => { + var path = PATH.join2(typeof parent == "string" ? parent : FS.getPath(parent), name); + var mode = FS.getMode(!!input, !!output); + if (!FS.createDevice.major) FS.createDevice.major = 64; + var dev = FS.makedev(FS.createDevice.major++, 0); + FS.registerDevice(dev, { + open: stream => { + stream.seekable = false; + }, + close: stream => { + if (output && output.buffer && output.buffer.length) { + output(10); + } + }, + read: (stream, buffer, offset, length, pos) => { + var bytesRead = 0; + for (var i = 0; i < length; i++) { + var result; + try { + result = input(); + } catch (e) { + throw new FS.ErrnoError(29); + } + if (result === undefined && bytesRead === 0) { + throw new FS.ErrnoError(6); + } + if (result === null || result === undefined) break; + bytesRead++; + buffer[offset + i] = result; + } + if (bytesRead) { + stream.node.timestamp = Date.now(); + } + return bytesRead; + }, + write: (stream, buffer, offset, length, pos) => { + for (var i = 0; i < length; i++) { + try { + output(buffer[offset + i]); + } catch (e) { + throw new FS.ErrnoError(29); + } + } + if (length) { + stream.node.timestamp = Date.now(); + } + return i; + } + }); + return FS.mkdev(path, mode, dev); + }, + forceLoadFile: obj => { + if (obj.isDevice || obj.isFolder || obj.link || obj.contents) return true; + if (typeof XMLHttpRequest != "undefined") { + throw new Error("Lazy loading should have been performed (contents set) in createLazyFile, but it was not. Lazy loading only works in web workers. Use --embed-file or --preload-file in emcc on the main thread."); + } else if (read_) { + try { + obj.contents = intArrayFromString(read_(obj.url), true); + obj.usedBytes = obj.contents.length; + } catch (e) { + throw new FS.ErrnoError(29); + } + } else { + throw new Error("Cannot load without read() or XMLHttpRequest."); + } + }, + createLazyFile: (parent, name, url, canRead, canWrite) => { + function LazyUint8Array() { + this.lengthKnown = false; + this.chunks = []; + } + LazyUint8Array.prototype.get = function LazyUint8Array_get(idx) { + if (idx > this.length - 1 || idx < 0) { + return undefined; + } + var chunkOffset = idx % this.chunkSize; + var chunkNum = idx / this.chunkSize | 0; + return this.getter(chunkNum)[chunkOffset]; + }; + LazyUint8Array.prototype.setDataGetter = function LazyUint8Array_setDataGetter(getter) { + this.getter = getter; + }; + LazyUint8Array.prototype.cacheLength = function LazyUint8Array_cacheLength() { + var xhr = new XMLHttpRequest(); + xhr.open("HEAD", url, false); + xhr.send(null); + if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status); + var datalength = Number(xhr.getResponseHeader("Content-length")); + var header; + var hasByteServing = (header = xhr.getResponseHeader("Accept-Ranges")) && header === "bytes"; + var usesGzip = (header = xhr.getResponseHeader("Content-Encoding")) && header === "gzip"; + var chunkSize = 1024 * 1024; + if (!hasByteServing) chunkSize = datalength; + var doXHR = (from, to) => { + if (from > to) throw new Error("invalid range (" + from + ", " + to + ") or no bytes requested!"); + if (to > datalength - 1) throw new Error("only " + datalength + " bytes available! programmer error!"); + var xhr = new XMLHttpRequest(); + xhr.open("GET", url, false); + if (datalength !== chunkSize) xhr.setRequestHeader("Range", "bytes=" + from + "-" + to); + xhr.responseType = "arraybuffer"; + if (xhr.overrideMimeType) { + xhr.overrideMimeType("text/plain; charset=x-user-defined"); + } + xhr.send(null); + if (!(xhr.status >= 200 && xhr.status < 300 || xhr.status === 304)) throw new Error("Couldn't load " + url + ". Status: " + xhr.status); + if (xhr.response !== undefined) { + return new Uint8Array(xhr.response || []); + } + return intArrayFromString(xhr.responseText || "", true); + }; + var lazyArray = this; + lazyArray.setDataGetter(chunkNum => { + var start = chunkNum * chunkSize; + var end = (chunkNum + 1) * chunkSize - 1; + end = Math.min(end, datalength - 1); + if (typeof lazyArray.chunks[chunkNum] == "undefined") { + lazyArray.chunks[chunkNum] = doXHR(start, end); + } + if (typeof lazyArray.chunks[chunkNum] == "undefined") throw new Error("doXHR failed!"); + return lazyArray.chunks[chunkNum]; + }); + if (usesGzip || !datalength) { + chunkSize = datalength = 1; + datalength = this.getter(0).length; + chunkSize = datalength; + out("LazyFiles on gzip forces download of the whole file when length is accessed"); + } + this._length = datalength; + this._chunkSize = chunkSize; + this.lengthKnown = true; + }; + if (typeof XMLHttpRequest != "undefined") { + if (!ENVIRONMENT_IS_WORKER) throw "Cannot do synchronous binary XHRs outside webworkers in modern browsers. Use --embed-file or --preload-file in emcc"; + var lazyArray = new LazyUint8Array(); + Object.defineProperties(lazyArray, { + length: { + get: function() { + if (!this.lengthKnown) { + this.cacheLength(); + } + return this._length; + } + }, + chunkSize: { + get: function() { + if (!this.lengthKnown) { + this.cacheLength(); + } + return this._chunkSize; + } + } + }); + var properties = { + isDevice: false, + contents: lazyArray + }; + } else { + var properties = { + isDevice: false, + url: url + }; + } + var node = FS.createFile(parent, name, properties, canRead, canWrite); + if (properties.contents) { + node.contents = properties.contents; + } else if (properties.url) { + node.contents = null; + node.url = properties.url; + } + Object.defineProperties(node, { + usedBytes: { + get: function() { + return this.contents.length; + } + } + }); + var stream_ops = {}; + var keys = Object.keys(node.stream_ops); + keys.forEach(key => { + var fn = node.stream_ops[key]; + stream_ops[key] = function forceLoadLazyFile() { + FS.forceLoadFile(node); + return fn.apply(null, arguments); + }; + }); + function writeChunks(stream, buffer, offset, length, position) { + var contents = stream.node.contents; + if (position >= contents.length) return 0; + var size = Math.min(contents.length - position, length); + assert(size >= 0); + if (contents.slice) { + for (var i = 0; i < size; i++) { + buffer[offset + i] = contents[position + i]; + } + } else { + for (var i = 0; i < size; i++) { + buffer[offset + i] = contents.get(position + i); + } + } + return size; + } + stream_ops.read = (stream, buffer, offset, length, position) => { + FS.forceLoadFile(node); + return writeChunks(stream, buffer, offset, length, position); + }; + stream_ops.mmap = (stream, length, position, prot, flags) => { + FS.forceLoadFile(node); + var ptr = mmapAlloc(length); + if (!ptr) { + throw new FS.ErrnoError(48); + } + writeChunks(stream, GROWABLE_HEAP_I8(), ptr, length, position); + return { + ptr: ptr, + allocated: true + }; + }; + node.stream_ops = stream_ops; + return node; + }, + createPreloadedFile: (parent, name, url, canRead, canWrite, onload, onerror, dontCreateFile, canOwn, preFinish) => { + var fullname = name ? PATH_FS.resolve(PATH.join2(parent, name)) : parent; + var dep = getUniqueRunDependency("cp " + fullname); + function processData(byteArray) { + function finish(byteArray) { + if (preFinish) preFinish(); + if (!dontCreateFile) { + FS.createDataFile(parent, name, byteArray, canRead, canWrite, canOwn); + } + if (onload) onload(); + removeRunDependency(dep); + } + if (Browser.handledByPreloadPlugin(byteArray, fullname, finish, () => { + if (onerror) onerror(); + removeRunDependency(dep); + })) { + return; + } + finish(byteArray); + } + addRunDependency(dep); + if (typeof url == "string") { + asyncLoad(url, byteArray => processData(byteArray), onerror); + } else { + processData(url); + } + }, + indexedDB: () => { + return window.indexedDB || window.mozIndexedDB || window.webkitIndexedDB || window.msIndexedDB; + }, + DB_NAME: () => { + return "EM_FS_" + window.location.pathname; + }, + DB_VERSION: 20, + DB_STORE_NAME: "FILE_DATA", + saveFilesToDB: (paths, onload, onerror) => { + onload = onload || (() => {}); + onerror = onerror || (() => {}); + var indexedDB = FS.indexedDB(); + try { + var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION); + } catch (e) { + return onerror(e); + } + openRequest.onupgradeneeded = () => { + out("creating db"); + var db = openRequest.result; + db.createObjectStore(FS.DB_STORE_NAME); + }; + openRequest.onsuccess = () => { + var db = openRequest.result; + var transaction = db.transaction([ FS.DB_STORE_NAME ], "readwrite"); + var files = transaction.objectStore(FS.DB_STORE_NAME); + var ok = 0, fail = 0, total = paths.length; + function finish() { + if (fail == 0) onload(); else onerror(); + } + paths.forEach(path => { + var putRequest = files.put(FS.analyzePath(path).object.contents, path); + putRequest.onsuccess = () => { + ok++; + if (ok + fail == total) finish(); + }; + putRequest.onerror = () => { + fail++; + if (ok + fail == total) finish(); + }; + }); + transaction.onerror = onerror; + }; + openRequest.onerror = onerror; + }, + loadFilesFromDB: (paths, onload, onerror) => { + onload = onload || (() => {}); + onerror = onerror || (() => {}); + var indexedDB = FS.indexedDB(); + try { + var openRequest = indexedDB.open(FS.DB_NAME(), FS.DB_VERSION); + } catch (e) { + return onerror(e); + } + openRequest.onupgradeneeded = onerror; + openRequest.onsuccess = () => { + var db = openRequest.result; + try { + var transaction = db.transaction([ FS.DB_STORE_NAME ], "readonly"); + } catch (e) { + onerror(e); + return; + } + var files = transaction.objectStore(FS.DB_STORE_NAME); + var ok = 0, fail = 0, total = paths.length; + function finish() { + if (fail == 0) onload(); else onerror(); + } + paths.forEach(path => { + var getRequest = files.get(path); + getRequest.onsuccess = () => { + if (FS.analyzePath(path).exists) { + FS.unlink(path); + } + FS.createDataFile(PATH.dirname(path), PATH.basename(path), getRequest.result, true, true, true); + ok++; + if (ok + fail == total) finish(); + }; + getRequest.onerror = () => { + fail++; + if (ok + fail == total) finish(); + }; + }); + transaction.onerror = onerror; + }; + openRequest.onerror = onerror; + }, + absolutePath: () => { + abort("FS.absolutePath has been removed; use PATH_FS.resolve instead"); + }, + createFolder: () => { + abort("FS.createFolder has been removed; use FS.mkdir instead"); + }, + createLink: () => { + abort("FS.createLink has been removed; use FS.symlink instead"); + }, + joinPath: () => { + abort("FS.joinPath has been removed; use PATH.join instead"); + }, + mmapAlloc: () => { + abort("FS.mmapAlloc has been replaced by the top level function mmapAlloc"); + }, + standardizePath: () => { + abort("FS.standardizePath has been removed; use PATH.normalize instead"); + } +}; + +var SYSCALLS = { + DEFAULT_POLLMASK: 5, + calculateAt: function(dirfd, path, allowEmpty) { + if (PATH.isAbs(path)) { + return path; + } + var dir; + if (dirfd === -100) { + dir = FS.cwd(); + } else { + var dirstream = FS.getStream(dirfd); + if (!dirstream) throw new FS.ErrnoError(8); + dir = dirstream.path; + } + if (path.length == 0) { + if (!allowEmpty) { + throw new FS.ErrnoError(44); + } + return dir; + } + return PATH.join2(dir, path); + }, + doStat: function(func, path, buf) { + try { + var stat = func(path); + } catch (e) { + if (e && e.node && PATH.normalize(path) !== PATH.normalize(FS.getPath(e.node))) { + return -54; + } + throw e; + } + GROWABLE_HEAP_I32()[buf >> 2] = stat.dev; + GROWABLE_HEAP_I32()[buf + 8 >> 2] = stat.ino; + GROWABLE_HEAP_I32()[buf + 12 >> 2] = stat.mode; + GROWABLE_HEAP_I32()[buf + 16 >> 2] = stat.nlink; + GROWABLE_HEAP_I32()[buf + 20 >> 2] = stat.uid; + GROWABLE_HEAP_I32()[buf + 24 >> 2] = stat.gid; + GROWABLE_HEAP_I32()[buf + 28 >> 2] = stat.rdev; + tempI64 = [ stat.size >>> 0, (tempDouble = stat.size, +Math.abs(tempDouble) >= 1 ? tempDouble > 0 ? (Math.min(+Math.floor(tempDouble / 4294967296), 4294967295) | 0) >>> 0 : ~~+Math.ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0 : 0) ], + GROWABLE_HEAP_I32()[buf + 40 >> 2] = tempI64[0], GROWABLE_HEAP_I32()[buf + 44 >> 2] = tempI64[1]; + GROWABLE_HEAP_I32()[buf + 48 >> 2] = 4096; + GROWABLE_HEAP_I32()[buf + 52 >> 2] = stat.blocks; + tempI64 = [ Math.floor(stat.atime.getTime() / 1e3) >>> 0, (tempDouble = Math.floor(stat.atime.getTime() / 1e3), + +Math.abs(tempDouble) >= 1 ? tempDouble > 0 ? (Math.min(+Math.floor(tempDouble / 4294967296), 4294967295) | 0) >>> 0 : ~~+Math.ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0 : 0) ], + GROWABLE_HEAP_I32()[buf + 56 >> 2] = tempI64[0], GROWABLE_HEAP_I32()[buf + 60 >> 2] = tempI64[1]; + GROWABLE_HEAP_I32()[buf + 64 >> 2] = 0; + tempI64 = [ Math.floor(stat.mtime.getTime() / 1e3) >>> 0, (tempDouble = Math.floor(stat.mtime.getTime() / 1e3), + +Math.abs(tempDouble) >= 1 ? tempDouble > 0 ? (Math.min(+Math.floor(tempDouble / 4294967296), 4294967295) | 0) >>> 0 : ~~+Math.ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0 : 0) ], + GROWABLE_HEAP_I32()[buf + 72 >> 2] = tempI64[0], GROWABLE_HEAP_I32()[buf + 76 >> 2] = tempI64[1]; + GROWABLE_HEAP_I32()[buf + 80 >> 2] = 0; + tempI64 = [ Math.floor(stat.ctime.getTime() / 1e3) >>> 0, (tempDouble = Math.floor(stat.ctime.getTime() / 1e3), + +Math.abs(tempDouble) >= 1 ? tempDouble > 0 ? (Math.min(+Math.floor(tempDouble / 4294967296), 4294967295) | 0) >>> 0 : ~~+Math.ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0 : 0) ], + GROWABLE_HEAP_I32()[buf + 88 >> 2] = tempI64[0], GROWABLE_HEAP_I32()[buf + 92 >> 2] = tempI64[1]; + GROWABLE_HEAP_I32()[buf + 96 >> 2] = 0; + tempI64 = [ stat.ino >>> 0, (tempDouble = stat.ino, +Math.abs(tempDouble) >= 1 ? tempDouble > 0 ? (Math.min(+Math.floor(tempDouble / 4294967296), 4294967295) | 0) >>> 0 : ~~+Math.ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0 : 0) ], + GROWABLE_HEAP_I32()[buf + 104 >> 2] = tempI64[0], GROWABLE_HEAP_I32()[buf + 108 >> 2] = tempI64[1]; + return 0; + }, + doMsync: function(addr, stream, len, flags, offset) { + var buffer = GROWABLE_HEAP_U8().slice(addr, addr + len); + FS.msync(stream, buffer, offset, len, flags); + }, + varargs: undefined, + get: function() { + assert(SYSCALLS.varargs != undefined); + SYSCALLS.varargs += 4; + var ret = GROWABLE_HEAP_I32()[SYSCALLS.varargs - 4 >> 2]; + return ret; + }, + getStr: function(ptr) { + var ret = UTF8ToString(ptr); + return ret; + }, + getStreamFromFD: function(fd) { + var stream = FS.getStream(fd); + if (!stream) throw new FS.ErrnoError(8); + return stream; + } +}; + +function _proc_exit(code) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(1, 1, code); + EXITSTATUS = code; + if (!keepRuntimeAlive()) { + PThread.terminateAllThreads(); + if (Module["onExit"]) Module["onExit"](code); + ABORT = true; + } + quit_(code, new ExitStatus(code)); +} + +function exitJS(status, implicit) { + EXITSTATUS = status; + if (!implicit) { + if (ENVIRONMENT_IS_PTHREAD) { + exitOnMainThread(status); + throw "unwind"; + } else {} + } + if (!keepRuntimeAlive()) { + exitRuntime(); + } + if (keepRuntimeAlive() && !implicit) { + var msg = "program exited (with status: " + status + "), but keepRuntimeAlive() is set (counter=" + runtimeKeepaliveCounter + ") due to an async operation, so halting execution but not exiting the runtime or preventing further async execution (you can use emscripten_force_exit, if you want to force a true shutdown)"; + readyPromiseReject(msg); + err(msg); + } + _proc_exit(status); +} + +var _exit = exitJS; + +function ptrToString(ptr) { + return "0x" + ptr.toString(16).padStart(8, "0"); +} + +function handleException(e) { + if (e instanceof ExitStatus || e == "unwind") { + return EXITSTATUS; + } + quit_(1, e); +} + +var PThread = { + unusedWorkers: [], + runningWorkers: [], + tlsInitFunctions: [], + pthreads: {}, + init: function() { + if (ENVIRONMENT_IS_PTHREAD) { + PThread.initWorker(); + } else { + PThread.initMainThread(); + } + }, + initMainThread: function() { + var pthreadPoolSize = 8; + for (var i = 0; i < pthreadPoolSize; ++i) { + PThread.allocateUnusedWorker(); + } + }, + initWorker: function() { + noExitRuntime = false; + }, + setExitStatus: function(status) { + EXITSTATUS = status; + }, + terminateAllThreads: function() { + assert(!ENVIRONMENT_IS_PTHREAD, "Internal Error! terminateAllThreads() can only ever be called from main application thread!"); + for (var t in PThread.pthreads) { + var worker = PThread.pthreads[t]; + if (worker) { + PThread.returnWorkerToPool(worker); + } + } + assert(Object.keys(PThread.pthreads).length === 0); + assert(PThread.runningWorkers.length === 0); + for (var i = 0; i < PThread.unusedWorkers.length; ++i) { + var worker = PThread.unusedWorkers[i]; + assert(!worker.pthread_ptr); + worker.terminate(); + } + PThread.unusedWorkers = []; + }, + returnWorkerToPool: function(worker) { + var pthread_ptr = worker.pthread_ptr; + delete PThread.pthreads[pthread_ptr]; + PThread.unusedWorkers.push(worker); + PThread.runningWorkers.splice(PThread.runningWorkers.indexOf(worker), 1); + worker.pthread_ptr = 0; + __emscripten_thread_free_data(pthread_ptr); + }, + receiveObjectTransfer: function(data) {}, + threadInitTLS: function() { + for (var i in PThread.tlsInitFunctions) { + if (PThread.tlsInitFunctions.hasOwnProperty(i)) PThread.tlsInitFunctions[i](); + } + }, + loadWasmModuleToWorker: function(worker, onFinishedLoading) { + worker.onmessage = e => { + var d = e["data"]; + var cmd = d["cmd"]; + if (worker.pthread_ptr) PThread.currentProxiedOperationCallerThread = worker.pthread_ptr; + if (d["targetThread"] && d["targetThread"] != _pthread_self()) { + var targetWorker = PThread.pthreads[d.targetThread]; + if (targetWorker) { + targetWorker.postMessage(d, d["transferList"]); + } else { + err('Internal error! Worker sent a message "' + cmd + '" to target pthread ' + d["targetThread"] + ", but that thread no longer exists!"); + } + PThread.currentProxiedOperationCallerThread = undefined; + return; + } + if (cmd === "processProxyingQueue") { + executeNotifiedProxyingQueue(d["queue"]); + } else if (cmd === "spawnThread") { + spawnThread(d); + } else if (cmd === "cleanupThread") { + cleanupThread(d["thread"]); + } else if (cmd === "killThread") { + killThread(d["thread"]); + } else if (cmd === "cancelThread") { + cancelThread(d["thread"]); + } else if (cmd === "loaded") { + worker.loaded = true; + if (onFinishedLoading) onFinishedLoading(worker); + if (worker.runPthread) { + worker.runPthread(); + delete worker.runPthread; + } + } else if (cmd === "print") { + out("Thread " + d["threadId"] + ": " + d["text"]); + } else if (cmd === "printErr") { + err("Thread " + d["threadId"] + ": " + d["text"]); + } else if (cmd === "alert") { + alert("Thread " + d["threadId"] + ": " + d["text"]); + } else if (d.target === "setimmediate") { + worker.postMessage(d); + } else if (cmd === "onAbort") { + if (Module["onAbort"]) { + Module["onAbort"](d["arg"]); + } + } else if (cmd) { + err("worker sent an unknown command " + cmd); + } + PThread.currentProxiedOperationCallerThread = undefined; + }; + worker.onerror = e => { + var message = "worker sent an error!"; + if (worker.pthread_ptr) { + message = "Pthread " + ptrToString(worker.pthread_ptr) + " sent an error!"; + } + err(message + " " + e.filename + ":" + e.lineno + ": " + e.message); + throw e; + }; + assert(wasmMemory instanceof WebAssembly.Memory, "WebAssembly memory should have been loaded by now!"); + assert(wasmModule instanceof WebAssembly.Module, "WebAssembly Module should have been loaded by now!"); + worker.postMessage({ + "cmd": "load", + "urlOrBlob": Module["mainScriptUrlOrBlob"] || _scriptDir, + "wasmMemory": wasmMemory, + "wasmModule": wasmModule + }); + }, + allocateUnusedWorker: function() { + var pthreadMainJs = locateFile("godot.web.template_debug.wasm32.worker.js"); + PThread.unusedWorkers.push(new Worker(pthreadMainJs)); + }, + getNewWorker: function() { + if (PThread.unusedWorkers.length == 0) { + err("Tried to spawn a new thread, but the thread pool is exhausted.\n" + "This might result in a deadlock unless some threads eventually exit or the code explicitly breaks out to the event loop.\n" + "If you want to increase the pool size, use setting `-sPTHREAD_POOL_SIZE=...`." + "\nIf you want to throw an explicit error instead of the risk of deadlocking in those cases, use setting `-sPTHREAD_POOL_SIZE_STRICT=2`."); + PThread.allocateUnusedWorker(); + PThread.loadWasmModuleToWorker(PThread.unusedWorkers[0]); + } + return PThread.unusedWorkers.pop(); + } +}; + +Module["PThread"] = PThread; + +function callRuntimeCallbacks(callbacks) { + while (callbacks.length > 0) { + callbacks.shift()(Module); + } +} + +function withStackSave(f) { + var stack = stackSave(); + var ret = f(); + stackRestore(stack); + return ret; +} + +function demangle(func) { + warnOnce("warning: build with -sDEMANGLE_SUPPORT to link in libcxxabi demangling"); + return func; +} + +function demangleAll(text) { + var regex = /\b_Z[\w\d_]+/g; + return text.replace(regex, function(x) { + var y = demangle(x); + return x === y ? x : y + " [" + x + "]"; + }); +} + +function establishStackSpace() { + var pthread_ptr = _pthread_self(); + var stackTop = GROWABLE_HEAP_I32()[pthread_ptr + 44 >> 2]; + var stackSize = GROWABLE_HEAP_I32()[pthread_ptr + 48 >> 2]; + var stackMax = stackTop - stackSize; + assert(stackTop != 0); + assert(stackMax != 0); + assert(stackTop > stackMax, "stackTop must be higher then stackMax"); + _emscripten_stack_set_limits(stackTop, stackMax); + stackRestore(stackTop); + writeStackCookie(); +} + +Module["establishStackSpace"] = establishStackSpace; + +function exitOnMainThread(returnCode) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(2, 0, returnCode); + try { + _exit(returnCode); + } catch (e) { + handleException(e); + } +} + +function getValue(ptr, type = "i8") { + if (type.endsWith("*")) type = "*"; + switch (type) { + case "i1": + return GROWABLE_HEAP_I8()[ptr >> 0]; + + case "i8": + return GROWABLE_HEAP_I8()[ptr >> 0]; + + case "i16": + return GROWABLE_HEAP_I16()[ptr >> 1]; + + case "i32": + return GROWABLE_HEAP_I32()[ptr >> 2]; + + case "i64": + return GROWABLE_HEAP_I32()[ptr >> 2]; + + case "float": + return GROWABLE_HEAP_F32()[ptr >> 2]; + + case "double": + return GROWABLE_HEAP_F64()[ptr >> 3]; + + case "*": + return GROWABLE_HEAP_U32()[ptr >> 2]; + + default: + abort("invalid type for getValue: " + type); + } + return null; +} + +var wasmTableMirror = []; + +function getWasmTableEntry(funcPtr) { + var func = wasmTableMirror[funcPtr]; + if (!func) { + if (funcPtr >= wasmTableMirror.length) wasmTableMirror.length = funcPtr + 1; + wasmTableMirror[funcPtr] = func = wasmTable.get(funcPtr); + } + assert(wasmTable.get(funcPtr) == func, "JavaScript-side Wasm function table mirror is out of date!"); + return func; +} + +function invokeEntryPoint(ptr, arg) { + var result = getWasmTableEntry(ptr)(arg); + checkStackCookie(); + if (keepRuntimeAlive()) { + PThread.setExitStatus(result); + } else { + __emscripten_thread_exit(result); + } +} + +Module["invokeEntryPoint"] = invokeEntryPoint; + +function jsStackTrace() { + var error = new Error(); + if (!error.stack) { + try { + throw new Error(); + } catch (e) { + error = e; + } + if (!error.stack) { + return "(no stack trace available)"; + } + } + return error.stack.toString(); +} + +function registerTLSInit(tlsInitFunc) { + PThread.tlsInitFunctions.push(tlsInitFunc); +} + +function setValue(ptr, value, type = "i8") { + if (type.endsWith("*")) type = "*"; + switch (type) { + case "i1": + GROWABLE_HEAP_I8()[ptr >> 0] = value; + break; + + case "i8": + GROWABLE_HEAP_I8()[ptr >> 0] = value; + break; + + case "i16": + GROWABLE_HEAP_I16()[ptr >> 1] = value; + break; + + case "i32": + GROWABLE_HEAP_I32()[ptr >> 2] = value; + break; + + case "i64": + tempI64 = [ value >>> 0, (tempDouble = value, +Math.abs(tempDouble) >= 1 ? tempDouble > 0 ? (Math.min(+Math.floor(tempDouble / 4294967296), 4294967295) | 0) >>> 0 : ~~+Math.ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0 : 0) ], + GROWABLE_HEAP_I32()[ptr >> 2] = tempI64[0], GROWABLE_HEAP_I32()[ptr + 4 >> 2] = tempI64[1]; + break; + + case "float": + GROWABLE_HEAP_F32()[ptr >> 2] = value; + break; + + case "double": + GROWABLE_HEAP_F64()[ptr >> 3] = value; + break; + + case "*": + GROWABLE_HEAP_U32()[ptr >> 2] = value; + break; + + default: + abort("invalid type for setValue: " + type); + } +} + +function stackTrace() { + var js = jsStackTrace(); + if (Module["extraStackTrace"]) js += "\n" + Module["extraStackTrace"](); + return demangleAll(js); +} + +function writeArrayToMemory(array, buffer) { + assert(array.length >= 0, "writeArrayToMemory array must have a length (should be an array or typed array)"); + GROWABLE_HEAP_I8().set(array, buffer); +} + +function ___assert_fail(condition, filename, line, func) { + abort("Assertion failed: " + UTF8ToString(condition) + ", at: " + [ filename ? UTF8ToString(filename) : "unknown filename", line, func ? UTF8ToString(func) : "unknown function" ]); +} + +function ___call_sighandler(fp, sig) { + getWasmTableEntry(fp)(sig); +} + +function ___emscripten_init_main_thread_js(tb) { + __emscripten_thread_init(tb, !ENVIRONMENT_IS_WORKER, 1, !ENVIRONMENT_IS_WEB); + PThread.threadInitTLS(); +} + +function ___emscripten_thread_cleanup(thread) { + if (!ENVIRONMENT_IS_PTHREAD) cleanupThread(thread); else postMessage({ + "cmd": "cleanupThread", + "thread": thread + }); +} + +function pthreadCreateProxied(pthread_ptr, attr, start_routine, arg) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(3, 1, pthread_ptr, attr, start_routine, arg); + return ___pthread_create_js(pthread_ptr, attr, start_routine, arg); +} + +function ___pthread_create_js(pthread_ptr, attr, start_routine, arg) { + if (typeof SharedArrayBuffer == "undefined") { + err("Current environment does not support SharedArrayBuffer, pthreads are not available!"); + return 6; + } + var transferList = []; + var error = 0; + if (ENVIRONMENT_IS_PTHREAD && (transferList.length === 0 || error)) { + return pthreadCreateProxied(pthread_ptr, attr, start_routine, arg); + } + if (error) return error; + var threadParams = { + startRoutine: start_routine, + pthread_ptr: pthread_ptr, + arg: arg, + transferList: transferList + }; + if (ENVIRONMENT_IS_PTHREAD) { + threadParams.cmd = "spawnThread"; + postMessage(threadParams, transferList); + return 0; + } + return spawnThread(threadParams); +} + +function ___syscall__newselect(nfds, readfds, writefds, exceptfds, timeout) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(4, 1, nfds, readfds, writefds, exceptfds, timeout); + try { + assert(nfds <= 64, "nfds must be less than or equal to 64"); + assert(!exceptfds, "exceptfds not supported"); + var total = 0; + var srcReadLow = readfds ? GROWABLE_HEAP_I32()[readfds >> 2] : 0, srcReadHigh = readfds ? GROWABLE_HEAP_I32()[readfds + 4 >> 2] : 0; + var srcWriteLow = writefds ? GROWABLE_HEAP_I32()[writefds >> 2] : 0, srcWriteHigh = writefds ? GROWABLE_HEAP_I32()[writefds + 4 >> 2] : 0; + var srcExceptLow = exceptfds ? GROWABLE_HEAP_I32()[exceptfds >> 2] : 0, srcExceptHigh = exceptfds ? GROWABLE_HEAP_I32()[exceptfds + 4 >> 2] : 0; + var dstReadLow = 0, dstReadHigh = 0; + var dstWriteLow = 0, dstWriteHigh = 0; + var dstExceptLow = 0, dstExceptHigh = 0; + var allLow = (readfds ? GROWABLE_HEAP_I32()[readfds >> 2] : 0) | (writefds ? GROWABLE_HEAP_I32()[writefds >> 2] : 0) | (exceptfds ? GROWABLE_HEAP_I32()[exceptfds >> 2] : 0); + var allHigh = (readfds ? GROWABLE_HEAP_I32()[readfds + 4 >> 2] : 0) | (writefds ? GROWABLE_HEAP_I32()[writefds + 4 >> 2] : 0) | (exceptfds ? GROWABLE_HEAP_I32()[exceptfds + 4 >> 2] : 0); + var check = function(fd, low, high, val) { + return fd < 32 ? low & val : high & val; + }; + for (var fd = 0; fd < nfds; fd++) { + var mask = 1 << fd % 32; + if (!check(fd, allLow, allHigh, mask)) { + continue; + } + var stream = FS.getStream(fd); + if (!stream) throw new FS.ErrnoError(8); + var flags = SYSCALLS.DEFAULT_POLLMASK; + if (stream.stream_ops.poll) { + flags = stream.stream_ops.poll(stream); + } + if (flags & 1 && check(fd, srcReadLow, srcReadHigh, mask)) { + fd < 32 ? dstReadLow = dstReadLow | mask : dstReadHigh = dstReadHigh | mask; + total++; + } + if (flags & 4 && check(fd, srcWriteLow, srcWriteHigh, mask)) { + fd < 32 ? dstWriteLow = dstWriteLow | mask : dstWriteHigh = dstWriteHigh | mask; + total++; + } + if (flags & 2 && check(fd, srcExceptLow, srcExceptHigh, mask)) { + fd < 32 ? dstExceptLow = dstExceptLow | mask : dstExceptHigh = dstExceptHigh | mask; + total++; + } + } + if (readfds) { + GROWABLE_HEAP_I32()[readfds >> 2] = dstReadLow; + GROWABLE_HEAP_I32()[readfds + 4 >> 2] = dstReadHigh; + } + if (writefds) { + GROWABLE_HEAP_I32()[writefds >> 2] = dstWriteLow; + GROWABLE_HEAP_I32()[writefds + 4 >> 2] = dstWriteHigh; + } + if (exceptfds) { + GROWABLE_HEAP_I32()[exceptfds >> 2] = dstExceptLow; + GROWABLE_HEAP_I32()[exceptfds + 4 >> 2] = dstExceptHigh; + } + return total; + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +var SOCKFS = { + mount: function(mount) { + Module["websocket"] = Module["websocket"] && "object" === typeof Module["websocket"] ? Module["websocket"] : {}; + Module["websocket"]._callbacks = {}; + Module["websocket"]["on"] = function(event, callback) { + if ("function" === typeof callback) { + this._callbacks[event] = callback; + } + return this; + }; + Module["websocket"].emit = function(event, param) { + if ("function" === typeof this._callbacks[event]) { + this._callbacks[event].call(this, param); + } + }; + return FS.createNode(null, "/", 16384 | 511, 0); + }, + createSocket: function(family, type, protocol) { + type &= ~526336; + var streaming = type == 1; + if (streaming && protocol && protocol != 6) { + throw new FS.ErrnoError(66); + } + var sock = { + family: family, + type: type, + protocol: protocol, + server: null, + error: null, + peers: {}, + pending: [], + recv_queue: [], + sock_ops: SOCKFS.websocket_sock_ops + }; + var name = SOCKFS.nextname(); + var node = FS.createNode(SOCKFS.root, name, 49152, 0); + node.sock = sock; + var stream = FS.createStream({ + path: name, + node: node, + flags: 2, + seekable: false, + stream_ops: SOCKFS.stream_ops + }); + sock.stream = stream; + return sock; + }, + getSocket: function(fd) { + var stream = FS.getStream(fd); + if (!stream || !FS.isSocket(stream.node.mode)) { + return null; + } + return stream.node.sock; + }, + stream_ops: { + poll: function(stream) { + var sock = stream.node.sock; + return sock.sock_ops.poll(sock); + }, + ioctl: function(stream, request, varargs) { + var sock = stream.node.sock; + return sock.sock_ops.ioctl(sock, request, varargs); + }, + read: function(stream, buffer, offset, length, position) { + var sock = stream.node.sock; + var msg = sock.sock_ops.recvmsg(sock, length); + if (!msg) { + return 0; + } + buffer.set(msg.buffer, offset); + return msg.buffer.length; + }, + write: function(stream, buffer, offset, length, position) { + var sock = stream.node.sock; + return sock.sock_ops.sendmsg(sock, buffer, offset, length); + }, + close: function(stream) { + var sock = stream.node.sock; + sock.sock_ops.close(sock); + } + }, + nextname: function() { + if (!SOCKFS.nextname.current) { + SOCKFS.nextname.current = 0; + } + return "socket[" + SOCKFS.nextname.current++ + "]"; + }, + websocket_sock_ops: { + createPeer: function(sock, addr, port) { + var ws; + if (typeof addr == "object") { + ws = addr; + addr = null; + port = null; + } + if (ws) { + if (ws._socket) { + addr = ws._socket.remoteAddress; + port = ws._socket.remotePort; + } else { + var result = /ws[s]?:\/\/([^:]+):(\d+)/.exec(ws.url); + if (!result) { + throw new Error("WebSocket URL must be in the format ws(s)://address:port"); + } + addr = result[1]; + port = parseInt(result[2], 10); + } + } else { + try { + var runtimeConfig = Module["websocket"] && "object" === typeof Module["websocket"]; + var url = "ws:#".replace("#", "//"); + if (runtimeConfig) { + if ("string" === typeof Module["websocket"]["url"]) { + url = Module["websocket"]["url"]; + } + } + if (url === "ws://" || url === "wss://") { + var parts = addr.split("/"); + url = url + parts[0] + ":" + port + "/" + parts.slice(1).join("/"); + } + var subProtocols = "binary"; + if (runtimeConfig) { + if ("string" === typeof Module["websocket"]["subprotocol"]) { + subProtocols = Module["websocket"]["subprotocol"]; + } + } + var opts = undefined; + if (subProtocols !== "null") { + subProtocols = subProtocols.replace(/^ +| +$/g, "").split(/ *, */); + opts = subProtocols; + } + if (runtimeConfig && null === Module["websocket"]["subprotocol"]) { + subProtocols = "null"; + opts = undefined; + } + var WebSocketConstructor; + { + WebSocketConstructor = WebSocket; + } + ws = new WebSocketConstructor(url, opts); + ws.binaryType = "arraybuffer"; + } catch (e) { + throw new FS.ErrnoError(23); + } + } + var peer = { + addr: addr, + port: port, + socket: ws, + dgram_send_queue: [] + }; + SOCKFS.websocket_sock_ops.addPeer(sock, peer); + SOCKFS.websocket_sock_ops.handlePeerEvents(sock, peer); + if (sock.type === 2 && typeof sock.sport != "undefined") { + peer.dgram_send_queue.push(new Uint8Array([ 255, 255, 255, 255, "p".charCodeAt(0), "o".charCodeAt(0), "r".charCodeAt(0), "t".charCodeAt(0), (sock.sport & 65280) >> 8, sock.sport & 255 ])); + } + return peer; + }, + getPeer: function(sock, addr, port) { + return sock.peers[addr + ":" + port]; + }, + addPeer: function(sock, peer) { + sock.peers[peer.addr + ":" + peer.port] = peer; + }, + removePeer: function(sock, peer) { + delete sock.peers[peer.addr + ":" + peer.port]; + }, + handlePeerEvents: function(sock, peer) { + var first = true; + var handleOpen = function() { + Module["websocket"].emit("open", sock.stream.fd); + try { + var queued = peer.dgram_send_queue.shift(); + while (queued) { + peer.socket.send(queued); + queued = peer.dgram_send_queue.shift(); + } + } catch (e) { + peer.socket.close(); + } + }; + function handleMessage(data) { + if (typeof data == "string") { + var encoder = new TextEncoder(); + data = encoder.encode(data); + } else { + assert(data.byteLength !== undefined); + if (data.byteLength == 0) { + return; + } + data = new Uint8Array(data); + } + var wasfirst = first; + first = false; + if (wasfirst && data.length === 10 && data[0] === 255 && data[1] === 255 && data[2] === 255 && data[3] === 255 && data[4] === "p".charCodeAt(0) && data[5] === "o".charCodeAt(0) && data[6] === "r".charCodeAt(0) && data[7] === "t".charCodeAt(0)) { + var newport = data[8] << 8 | data[9]; + SOCKFS.websocket_sock_ops.removePeer(sock, peer); + peer.port = newport; + SOCKFS.websocket_sock_ops.addPeer(sock, peer); + return; + } + sock.recv_queue.push({ + addr: peer.addr, + port: peer.port, + data: data + }); + Module["websocket"].emit("message", sock.stream.fd); + } + if (ENVIRONMENT_IS_NODE) { + peer.socket.on("open", handleOpen); + peer.socket.on("message", function(data, isBinary) { + if (!isBinary) { + return; + } + handleMessage(new Uint8Array(data).buffer); + }); + peer.socket.on("close", function() { + Module["websocket"].emit("close", sock.stream.fd); + }); + peer.socket.on("error", function(error) { + sock.error = 14; + Module["websocket"].emit("error", [ sock.stream.fd, sock.error, "ECONNREFUSED: Connection refused" ]); + }); + } else { + peer.socket.onopen = handleOpen; + peer.socket.onclose = function() { + Module["websocket"].emit("close", sock.stream.fd); + }; + peer.socket.onmessage = function peer_socket_onmessage(event) { + handleMessage(event.data); + }; + peer.socket.onerror = function(error) { + sock.error = 14; + Module["websocket"].emit("error", [ sock.stream.fd, sock.error, "ECONNREFUSED: Connection refused" ]); + }; + } + }, + poll: function(sock) { + if (sock.type === 1 && sock.server) { + return sock.pending.length ? 64 | 1 : 0; + } + var mask = 0; + var dest = sock.type === 1 ? SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport) : null; + if (sock.recv_queue.length || !dest || dest && dest.socket.readyState === dest.socket.CLOSING || dest && dest.socket.readyState === dest.socket.CLOSED) { + mask |= 64 | 1; + } + if (!dest || dest && dest.socket.readyState === dest.socket.OPEN) { + mask |= 4; + } + if (dest && dest.socket.readyState === dest.socket.CLOSING || dest && dest.socket.readyState === dest.socket.CLOSED) { + mask |= 16; + } + return mask; + }, + ioctl: function(sock, request, arg) { + switch (request) { + case 21531: + var bytes = 0; + if (sock.recv_queue.length) { + bytes = sock.recv_queue[0].data.length; + } + GROWABLE_HEAP_I32()[arg >> 2] = bytes; + return 0; + + default: + return 28; + } + }, + close: function(sock) { + if (sock.server) { + try { + sock.server.close(); + } catch (e) {} + sock.server = null; + } + var peers = Object.keys(sock.peers); + for (var i = 0; i < peers.length; i++) { + var peer = sock.peers[peers[i]]; + try { + peer.socket.close(); + } catch (e) {} + SOCKFS.websocket_sock_ops.removePeer(sock, peer); + } + return 0; + }, + bind: function(sock, addr, port) { + if (typeof sock.saddr != "undefined" || typeof sock.sport != "undefined") { + throw new FS.ErrnoError(28); + } + sock.saddr = addr; + sock.sport = port; + if (sock.type === 2) { + if (sock.server) { + sock.server.close(); + sock.server = null; + } + try { + sock.sock_ops.listen(sock, 0); + } catch (e) { + if (!(e instanceof FS.ErrnoError)) throw e; + if (e.errno !== 138) throw e; + } + } + }, + connect: function(sock, addr, port) { + if (sock.server) { + throw new FS.ErrnoError(138); + } + if (typeof sock.daddr != "undefined" && typeof sock.dport != "undefined") { + var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport); + if (dest) { + if (dest.socket.readyState === dest.socket.CONNECTING) { + throw new FS.ErrnoError(7); + } else { + throw new FS.ErrnoError(30); + } + } + } + var peer = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port); + sock.daddr = peer.addr; + sock.dport = peer.port; + throw new FS.ErrnoError(26); + }, + listen: function(sock, backlog) { + if (!ENVIRONMENT_IS_NODE) { + throw new FS.ErrnoError(138); + } + }, + accept: function(listensock) { + if (!listensock.server || !listensock.pending.length) { + throw new FS.ErrnoError(28); + } + var newsock = listensock.pending.shift(); + newsock.stream.flags = listensock.stream.flags; + return newsock; + }, + getname: function(sock, peer) { + var addr, port; + if (peer) { + if (sock.daddr === undefined || sock.dport === undefined) { + throw new FS.ErrnoError(53); + } + addr = sock.daddr; + port = sock.dport; + } else { + addr = sock.saddr || 0; + port = sock.sport || 0; + } + return { + addr: addr, + port: port + }; + }, + sendmsg: function(sock, buffer, offset, length, addr, port) { + if (sock.type === 2) { + if (addr === undefined || port === undefined) { + addr = sock.daddr; + port = sock.dport; + } + if (addr === undefined || port === undefined) { + throw new FS.ErrnoError(17); + } + } else { + addr = sock.daddr; + port = sock.dport; + } + var dest = SOCKFS.websocket_sock_ops.getPeer(sock, addr, port); + if (sock.type === 1) { + if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) { + throw new FS.ErrnoError(53); + } else if (dest.socket.readyState === dest.socket.CONNECTING) { + throw new FS.ErrnoError(6); + } + } + if (ArrayBuffer.isView(buffer)) { + offset += buffer.byteOffset; + buffer = buffer.buffer; + } + var data; + if (buffer instanceof SharedArrayBuffer) { + data = new Uint8Array(new Uint8Array(buffer.slice(offset, offset + length))).buffer; + } else { + data = buffer.slice(offset, offset + length); + } + if (sock.type === 2) { + if (!dest || dest.socket.readyState !== dest.socket.OPEN) { + if (!dest || dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) { + dest = SOCKFS.websocket_sock_ops.createPeer(sock, addr, port); + } + dest.dgram_send_queue.push(data); + return length; + } + } + try { + dest.socket.send(data); + return length; + } catch (e) { + throw new FS.ErrnoError(28); + } + }, + recvmsg: function(sock, length) { + if (sock.type === 1 && sock.server) { + throw new FS.ErrnoError(53); + } + var queued = sock.recv_queue.shift(); + if (!queued) { + if (sock.type === 1) { + var dest = SOCKFS.websocket_sock_ops.getPeer(sock, sock.daddr, sock.dport); + if (!dest) { + throw new FS.ErrnoError(53); + } + if (dest.socket.readyState === dest.socket.CLOSING || dest.socket.readyState === dest.socket.CLOSED) { + return null; + } + throw new FS.ErrnoError(6); + } + throw new FS.ErrnoError(6); + } + var queuedLength = queued.data.byteLength || queued.data.length; + var queuedOffset = queued.data.byteOffset || 0; + var queuedBuffer = queued.data.buffer || queued.data; + var bytesRead = Math.min(length, queuedLength); + var res = { + buffer: new Uint8Array(queuedBuffer, queuedOffset, bytesRead), + addr: queued.addr, + port: queued.port + }; + if (sock.type === 1 && bytesRead < queuedLength) { + var bytesRemaining = queuedLength - bytesRead; + queued.data = new Uint8Array(queuedBuffer, queuedOffset + bytesRead, bytesRemaining); + sock.recv_queue.unshift(queued); + } + return res; + } + } +}; + +function getSocketFromFD(fd) { + var socket = SOCKFS.getSocket(fd); + if (!socket) throw new FS.ErrnoError(8); + return socket; +} + +function setErrNo(value) { + GROWABLE_HEAP_I32()[___errno_location() >> 2] = value; + return value; +} + +var Sockets = { + BUFFER_SIZE: 10240, + MAX_BUFFER_SIZE: 10485760, + nextFd: 1, + fds: {}, + nextport: 1, + maxport: 65535, + peer: null, + connections: {}, + portmap: {}, + localAddr: 4261412874, + addrPool: [ 33554442, 50331658, 67108874, 83886090, 100663306, 117440522, 134217738, 150994954, 167772170, 184549386, 201326602, 218103818, 234881034 ] +}; + +function inetPton4(str) { + var b = str.split("."); + for (var i = 0; i < 4; i++) { + var tmp = Number(b[i]); + if (isNaN(tmp)) return null; + b[i] = tmp; + } + return (b[0] | b[1] << 8 | b[2] << 16 | b[3] << 24) >>> 0; +} + +function jstoi_q(str) { + return parseInt(str); +} + +function inetPton6(str) { + var words; + var w, offset, z, i; + var valid6regx = /^((?=.*::)(?!.*::.+::)(::)?([\dA-F]{1,4}:(:|\b)|){5}|([\dA-F]{1,4}:){6})((([\dA-F]{1,4}((?!\3)::|:\b|$))|(?!\2\3)){2}|(((2[0-4]|1\d|[1-9])?\d|25[0-5])\.?\b){4})$/i; + var parts = []; + if (!valid6regx.test(str)) { + return null; + } + if (str === "::") { + return [ 0, 0, 0, 0, 0, 0, 0, 0 ]; + } + if (str.startsWith("::")) { + str = str.replace("::", "Z:"); + } else { + str = str.replace("::", ":Z:"); + } + if (str.indexOf(".") > 0) { + str = str.replace(new RegExp("[.]", "g"), ":"); + words = str.split(":"); + words[words.length - 4] = jstoi_q(words[words.length - 4]) + jstoi_q(words[words.length - 3]) * 256; + words[words.length - 3] = jstoi_q(words[words.length - 2]) + jstoi_q(words[words.length - 1]) * 256; + words = words.slice(0, words.length - 2); + } else { + words = str.split(":"); + } + offset = 0; + z = 0; + for (w = 0; w < words.length; w++) { + if (typeof words[w] == "string") { + if (words[w] === "Z") { + for (z = 0; z < 8 - words.length + 1; z++) { + parts[w + z] = 0; + } + offset = z - 1; + } else { + parts[w + offset] = _htons(parseInt(words[w], 16)); + } + } else { + parts[w + offset] = words[w]; + } + } + return [ parts[1] << 16 | parts[0], parts[3] << 16 | parts[2], parts[5] << 16 | parts[4], parts[7] << 16 | parts[6] ]; +} + +function writeSockaddr(sa, family, addr, port, addrlen) { + switch (family) { + case 2: + addr = inetPton4(addr); + zeroMemory(sa, 16); + if (addrlen) { + GROWABLE_HEAP_I32()[addrlen >> 2] = 16; + } + GROWABLE_HEAP_I16()[sa >> 1] = family; + GROWABLE_HEAP_I32()[sa + 4 >> 2] = addr; + GROWABLE_HEAP_I16()[sa + 2 >> 1] = _htons(port); + break; + + case 10: + addr = inetPton6(addr); + zeroMemory(sa, 28); + if (addrlen) { + GROWABLE_HEAP_I32()[addrlen >> 2] = 28; + } + GROWABLE_HEAP_I32()[sa >> 2] = family; + GROWABLE_HEAP_I32()[sa + 8 >> 2] = addr[0]; + GROWABLE_HEAP_I32()[sa + 12 >> 2] = addr[1]; + GROWABLE_HEAP_I32()[sa + 16 >> 2] = addr[2]; + GROWABLE_HEAP_I32()[sa + 20 >> 2] = addr[3]; + GROWABLE_HEAP_I16()[sa + 2 >> 1] = _htons(port); + break; + + default: + return 5; + } + return 0; +} + +var DNS = { + address_map: { + id: 1, + addrs: {}, + names: {} + }, + lookup_name: function(name) { + var res = inetPton4(name); + if (res !== null) { + return name; + } + res = inetPton6(name); + if (res !== null) { + return name; + } + var addr; + if (DNS.address_map.addrs[name]) { + addr = DNS.address_map.addrs[name]; + } else { + var id = DNS.address_map.id++; + assert(id < 65535, "exceeded max address mappings of 65535"); + addr = "172.29." + (id & 255) + "." + (id & 65280); + DNS.address_map.names[addr] = name; + DNS.address_map.addrs[name] = addr; + } + return addr; + }, + lookup_addr: function(addr) { + if (DNS.address_map.names[addr]) { + return DNS.address_map.names[addr]; + } + return null; + } +}; + +function ___syscall_accept4(fd, addr, addrlen, flags) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(5, 1, fd, addr, addrlen, flags); + try { + var sock = getSocketFromFD(fd); + var newsock = sock.sock_ops.accept(sock); + if (addr) { + var errno = writeSockaddr(addr, newsock.family, DNS.lookup_name(newsock.daddr), newsock.dport, addrlen); + assert(!errno); + } + return newsock.stream.fd; + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +function inetNtop4(addr) { + return (addr & 255) + "." + (addr >> 8 & 255) + "." + (addr >> 16 & 255) + "." + (addr >> 24 & 255); +} + +function inetNtop6(ints) { + var str = ""; + var word = 0; + var longest = 0; + var lastzero = 0; + var zstart = 0; + var len = 0; + var i = 0; + var parts = [ ints[0] & 65535, ints[0] >> 16, ints[1] & 65535, ints[1] >> 16, ints[2] & 65535, ints[2] >> 16, ints[3] & 65535, ints[3] >> 16 ]; + var hasipv4 = true; + var v4part = ""; + for (i = 0; i < 5; i++) { + if (parts[i] !== 0) { + hasipv4 = false; + break; + } + } + if (hasipv4) { + v4part = inetNtop4(parts[6] | parts[7] << 16); + if (parts[5] === -1) { + str = "::ffff:"; + str += v4part; + return str; + } + if (parts[5] === 0) { + str = "::"; + if (v4part === "0.0.0.0") v4part = ""; + if (v4part === "0.0.0.1") v4part = "1"; + str += v4part; + return str; + } + } + for (word = 0; word < 8; word++) { + if (parts[word] === 0) { + if (word - lastzero > 1) { + len = 0; + } + lastzero = word; + len++; + } + if (len > longest) { + longest = len; + zstart = word - longest + 1; + } + } + for (word = 0; word < 8; word++) { + if (longest > 1) { + if (parts[word] === 0 && word >= zstart && word < zstart + longest) { + if (word === zstart) { + str += ":"; + if (zstart === 0) str += ":"; + } + continue; + } + } + str += Number(_ntohs(parts[word] & 65535)).toString(16); + str += word < 7 ? ":" : ""; + } + return str; +} + +function readSockaddr(sa, salen) { + var family = GROWABLE_HEAP_I16()[sa >> 1]; + var port = _ntohs(GROWABLE_HEAP_U16()[sa + 2 >> 1]); + var addr; + switch (family) { + case 2: + if (salen !== 16) { + return { + errno: 28 + }; + } + addr = GROWABLE_HEAP_I32()[sa + 4 >> 2]; + addr = inetNtop4(addr); + break; + + case 10: + if (salen !== 28) { + return { + errno: 28 + }; + } + addr = [ GROWABLE_HEAP_I32()[sa + 8 >> 2], GROWABLE_HEAP_I32()[sa + 12 >> 2], GROWABLE_HEAP_I32()[sa + 16 >> 2], GROWABLE_HEAP_I32()[sa + 20 >> 2] ]; + addr = inetNtop6(addr); + break; + + default: + return { + errno: 5 + }; + } + return { + family: family, + addr: addr, + port: port + }; +} + +function getSocketAddress(addrp, addrlen, allowNull) { + if (allowNull && addrp === 0) return null; + var info = readSockaddr(addrp, addrlen); + if (info.errno) throw new FS.ErrnoError(info.errno); + info.addr = DNS.lookup_addr(info.addr) || info.addr; + return info; +} + +function ___syscall_bind(fd, addr, addrlen) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(6, 1, fd, addr, addrlen); + try { + var sock = getSocketFromFD(fd); + var info = getSocketAddress(addr, addrlen); + sock.sock_ops.bind(sock, info.addr, info.port); + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +function ___syscall_chdir(path) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(7, 1, path); + try { + path = SYSCALLS.getStr(path); + FS.chdir(path); + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +function ___syscall_chmod(path, mode) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(8, 1, path, mode); + try { + path = SYSCALLS.getStr(path); + FS.chmod(path, mode); + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +function ___syscall_connect(fd, addr, addrlen) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(9, 1, fd, addr, addrlen); + try { + var sock = getSocketFromFD(fd); + var info = getSocketAddress(addr, addrlen); + sock.sock_ops.connect(sock, info.addr, info.port); + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +function ___syscall_faccessat(dirfd, path, amode, flags) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(10, 1, dirfd, path, amode, flags); + try { + path = SYSCALLS.getStr(path); + assert(flags === 0); + path = SYSCALLS.calculateAt(dirfd, path); + if (amode & ~7) { + return -28; + } + var lookup = FS.lookupPath(path, { + follow: true + }); + var node = lookup.node; + if (!node) { + return -44; + } + var perms = ""; + if (amode & 4) perms += "r"; + if (amode & 2) perms += "w"; + if (amode & 1) perms += "x"; + if (perms && FS.nodePermissions(node, perms)) { + return -2; + } + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +function ___syscall_fchmod(fd, mode) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(11, 1, fd, mode); + try { + FS.fchmod(fd, mode); + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +function ___syscall_fcntl64(fd, cmd, varargs) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(12, 1, fd, cmd, varargs); + SYSCALLS.varargs = varargs; + try { + var stream = SYSCALLS.getStreamFromFD(fd); + switch (cmd) { + case 0: + { + var arg = SYSCALLS.get(); + if (arg < 0) { + return -28; + } + var newStream; + newStream = FS.createStream(stream, arg); + return newStream.fd; + } + + case 1: + case 2: + return 0; + + case 3: + return stream.flags; + + case 4: + { + var arg = SYSCALLS.get(); + stream.flags |= arg; + return 0; + } + + case 5: + { + var arg = SYSCALLS.get(); + var offset = 0; + GROWABLE_HEAP_I16()[arg + offset >> 1] = 2; + return 0; + } + + case 6: + case 7: + return 0; + + case 16: + case 8: + return -28; + + case 9: + setErrNo(28); + return -1; + + default: + { + return -28; + } + } + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +function ___syscall_getcwd(buf, size) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(13, 1, buf, size); + try { + if (size === 0) return -28; + var cwd = FS.cwd(); + var cwdLengthInBytes = lengthBytesUTF8(cwd) + 1; + if (size < cwdLengthInBytes) return -68; + stringToUTF8(cwd, buf, size); + return cwdLengthInBytes; + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +function ___syscall_getdents64(fd, dirp, count) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(14, 1, fd, dirp, count); + try { + var stream = SYSCALLS.getStreamFromFD(fd); + if (!stream.getdents) { + stream.getdents = FS.readdir(stream.path); + } + var struct_size = 280; + var pos = 0; + var off = FS.llseek(stream, 0, 1); + var idx = Math.floor(off / struct_size); + while (idx < stream.getdents.length && pos + struct_size <= count) { + var id; + var type; + var name = stream.getdents[idx]; + if (name === ".") { + id = stream.node.id; + type = 4; + } else if (name === "..") { + var lookup = FS.lookupPath(stream.path, { + parent: true + }); + id = lookup.node.id; + type = 4; + } else { + var child = FS.lookupNode(stream.node, name); + id = child.id; + type = FS.isChrdev(child.mode) ? 2 : FS.isDir(child.mode) ? 4 : FS.isLink(child.mode) ? 10 : 8; + } + assert(id); + tempI64 = [ id >>> 0, (tempDouble = id, +Math.abs(tempDouble) >= 1 ? tempDouble > 0 ? (Math.min(+Math.floor(tempDouble / 4294967296), 4294967295) | 0) >>> 0 : ~~+Math.ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0 : 0) ], + GROWABLE_HEAP_I32()[dirp + pos >> 2] = tempI64[0], GROWABLE_HEAP_I32()[dirp + pos + 4 >> 2] = tempI64[1]; + tempI64 = [ (idx + 1) * struct_size >>> 0, (tempDouble = (idx + 1) * struct_size, + +Math.abs(tempDouble) >= 1 ? tempDouble > 0 ? (Math.min(+Math.floor(tempDouble / 4294967296), 4294967295) | 0) >>> 0 : ~~+Math.ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0 : 0) ], + GROWABLE_HEAP_I32()[dirp + pos + 8 >> 2] = tempI64[0], GROWABLE_HEAP_I32()[dirp + pos + 12 >> 2] = tempI64[1]; + GROWABLE_HEAP_I16()[dirp + pos + 16 >> 1] = 280; + GROWABLE_HEAP_I8()[dirp + pos + 18 >> 0] = type; + stringToUTF8(name, dirp + pos + 19, 256); + pos += struct_size; + idx += 1; + } + FS.llseek(stream, idx * struct_size, 0); + return pos; + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +function ___syscall_getsockname(fd, addr, addrlen) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(15, 1, fd, addr, addrlen); + try { + err("__syscall_getsockname " + fd); + var sock = getSocketFromFD(fd); + var errno = writeSockaddr(addr, sock.family, DNS.lookup_name(sock.saddr || "0.0.0.0"), sock.sport, addrlen); + assert(!errno); + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +function ___syscall_getsockopt(fd, level, optname, optval, optlen) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(16, 1, fd, level, optname, optval, optlen); + try { + var sock = getSocketFromFD(fd); + if (level === 1) { + if (optname === 4) { + GROWABLE_HEAP_I32()[optval >> 2] = sock.error; + GROWABLE_HEAP_I32()[optlen >> 2] = 4; + sock.error = null; + return 0; + } + } + return -50; + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +function ___syscall_ioctl(fd, op, varargs) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(17, 1, fd, op, varargs); + SYSCALLS.varargs = varargs; + try { + var stream = SYSCALLS.getStreamFromFD(fd); + switch (op) { + case 21509: + case 21505: + { + if (!stream.tty) return -59; + return 0; + } + + case 21510: + case 21511: + case 21512: + case 21506: + case 21507: + case 21508: + { + if (!stream.tty) return -59; + return 0; + } + + case 21519: + { + if (!stream.tty) return -59; + var argp = SYSCALLS.get(); + GROWABLE_HEAP_I32()[argp >> 2] = 0; + return 0; + } + + case 21520: + { + if (!stream.tty) return -59; + return -28; + } + + case 21531: + { + var argp = SYSCALLS.get(); + return FS.ioctl(stream, op, argp); + } + + case 21523: + { + if (!stream.tty) return -59; + return 0; + } + + case 21524: + { + if (!stream.tty) return -59; + return 0; + } + + default: + return -28; + } + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +function ___syscall_listen(fd, backlog) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(18, 1, fd, backlog); + try { + var sock = getSocketFromFD(fd); + sock.sock_ops.listen(sock, backlog); + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +function ___syscall_lstat64(path, buf) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(19, 1, path, buf); + try { + path = SYSCALLS.getStr(path); + return SYSCALLS.doStat(FS.lstat, path, buf); + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +function ___syscall_mkdirat(dirfd, path, mode) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(20, 1, dirfd, path, mode); + try { + path = SYSCALLS.getStr(path); + path = SYSCALLS.calculateAt(dirfd, path); + path = PATH.normalize(path); + if (path[path.length - 1] === "/") path = path.substr(0, path.length - 1); + FS.mkdir(path, mode, 0); + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +function ___syscall_newfstatat(dirfd, path, buf, flags) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(21, 1, dirfd, path, buf, flags); + try { + path = SYSCALLS.getStr(path); + var nofollow = flags & 256; + var allowEmpty = flags & 4096; + flags = flags & ~4352; + assert(!flags, flags); + path = SYSCALLS.calculateAt(dirfd, path, allowEmpty); + return SYSCALLS.doStat(nofollow ? FS.lstat : FS.stat, path, buf); + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +function ___syscall_openat(dirfd, path, flags, varargs) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(22, 1, dirfd, path, flags, varargs); + SYSCALLS.varargs = varargs; + try { + path = SYSCALLS.getStr(path); + path = SYSCALLS.calculateAt(dirfd, path); + var mode = varargs ? SYSCALLS.get() : 0; + return FS.open(path, flags, mode).fd; + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +function ___syscall_poll(fds, nfds, timeout) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(23, 1, fds, nfds, timeout); + try { + var nonzero = 0; + for (var i = 0; i < nfds; i++) { + var pollfd = fds + 8 * i; + var fd = GROWABLE_HEAP_I32()[pollfd >> 2]; + var events = GROWABLE_HEAP_I16()[pollfd + 4 >> 1]; + var mask = 32; + var stream = FS.getStream(fd); + if (stream) { + mask = SYSCALLS.DEFAULT_POLLMASK; + if (stream.stream_ops.poll) { + mask = stream.stream_ops.poll(stream); + } + } + mask &= events | 8 | 16; + if (mask) nonzero++; + GROWABLE_HEAP_I16()[pollfd + 6 >> 1] = mask; + } + return nonzero; + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +function ___syscall_readlinkat(dirfd, path, buf, bufsize) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(24, 1, dirfd, path, buf, bufsize); + try { + path = SYSCALLS.getStr(path); + path = SYSCALLS.calculateAt(dirfd, path); + if (bufsize <= 0) return -28; + var ret = FS.readlink(path); + var len = Math.min(bufsize, lengthBytesUTF8(ret)); + var endChar = GROWABLE_HEAP_I8()[buf + len]; + stringToUTF8(ret, buf, bufsize + 1); + GROWABLE_HEAP_I8()[buf + len] = endChar; + return len; + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +function ___syscall_recvfrom(fd, buf, len, flags, addr, addrlen) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(25, 1, fd, buf, len, flags, addr, addrlen); + try { + var sock = getSocketFromFD(fd); + var msg = sock.sock_ops.recvmsg(sock, len); + if (!msg) return 0; + if (addr) { + var errno = writeSockaddr(addr, sock.family, DNS.lookup_name(msg.addr), msg.port, addrlen); + assert(!errno); + } + GROWABLE_HEAP_U8().set(msg.buffer, buf); + return msg.buffer.byteLength; + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +function ___syscall_renameat(olddirfd, oldpath, newdirfd, newpath) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(26, 1, olddirfd, oldpath, newdirfd, newpath); + try { + oldpath = SYSCALLS.getStr(oldpath); + newpath = SYSCALLS.getStr(newpath); + oldpath = SYSCALLS.calculateAt(olddirfd, oldpath); + newpath = SYSCALLS.calculateAt(newdirfd, newpath); + FS.rename(oldpath, newpath); + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +function ___syscall_rmdir(path) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(27, 1, path); + try { + path = SYSCALLS.getStr(path); + FS.rmdir(path); + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +function ___syscall_sendto(fd, message, length, flags, addr, addr_len) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(28, 1, fd, message, length, flags, addr, addr_len); + try { + var sock = getSocketFromFD(fd); + var dest = getSocketAddress(addr, addr_len, true); + if (!dest) { + return FS.write(sock.stream, GROWABLE_HEAP_I8(), message, length); + } + return sock.sock_ops.sendmsg(sock, GROWABLE_HEAP_I8(), message, length, dest.addr, dest.port); + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +function ___syscall_socket(domain, type, protocol) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(29, 1, domain, type, protocol); + try { + var sock = SOCKFS.createSocket(domain, type, protocol); + assert(sock.stream.fd < 64); + return sock.stream.fd; + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +function ___syscall_stat64(path, buf) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(30, 1, path, buf); + try { + path = SYSCALLS.getStr(path); + return SYSCALLS.doStat(FS.stat, path, buf); + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +function ___syscall_statfs64(path, size, buf) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(31, 1, path, size, buf); + try { + path = SYSCALLS.getStr(path); + assert(size === 64); + GROWABLE_HEAP_I32()[buf + 4 >> 2] = 4096; + GROWABLE_HEAP_I32()[buf + 40 >> 2] = 4096; + GROWABLE_HEAP_I32()[buf + 8 >> 2] = 1e6; + GROWABLE_HEAP_I32()[buf + 12 >> 2] = 5e5; + GROWABLE_HEAP_I32()[buf + 16 >> 2] = 5e5; + GROWABLE_HEAP_I32()[buf + 20 >> 2] = FS.nextInode; + GROWABLE_HEAP_I32()[buf + 24 >> 2] = 1e6; + GROWABLE_HEAP_I32()[buf + 28 >> 2] = 42; + GROWABLE_HEAP_I32()[buf + 44 >> 2] = 2; + GROWABLE_HEAP_I32()[buf + 36 >> 2] = 255; + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +function ___syscall_symlink(target, linkpath) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(32, 1, target, linkpath); + try { + target = SYSCALLS.getStr(target); + linkpath = SYSCALLS.getStr(linkpath); + FS.symlink(target, linkpath); + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +function ___syscall_unlinkat(dirfd, path, flags) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(33, 1, dirfd, path, flags); + try { + path = SYSCALLS.getStr(path); + path = SYSCALLS.calculateAt(dirfd, path); + if (flags === 0) { + FS.unlink(path); + } else if (flags === 512) { + FS.rmdir(path); + } else { + abort("Invalid flags passed to unlinkat"); + } + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +function __dlinit(main_dso_handle) {} + +var dlopenMissingError = "To use dlopen, you need enable dynamic linking, see https://github.com/emscripten-core/emscripten/wiki/Linking"; + +function __dlopen_js(filename, flag) { + abort(dlopenMissingError); +} + +function __dlsym_js(handle, symbol) { + abort(dlopenMissingError); +} + +function __emscripten_date_now() { + return Date.now(); +} + +function __emscripten_default_pthread_stack_size() { + return 2097152; +} + +var nowIsMonotonic = true; + +function __emscripten_get_now_is_monotonic() { + return nowIsMonotonic; +} + +function executeNotifiedProxyingQueue(queue) { + Atomics.store(GROWABLE_HEAP_I32(), queue >> 2, 1); + if (_pthread_self()) { + __emscripten_proxy_execute_task_queue(queue); + } + Atomics.compareExchange(GROWABLE_HEAP_I32(), queue >> 2, 1, 0); +} + +Module["executeNotifiedProxyingQueue"] = executeNotifiedProxyingQueue; + +function __emscripten_notify_task_queue(targetThreadId, currThreadId, mainThreadId, queue) { + if (targetThreadId == currThreadId) { + setTimeout(() => executeNotifiedProxyingQueue(queue)); + } else if (ENVIRONMENT_IS_PTHREAD) { + postMessage({ + "targetThread": targetThreadId, + "cmd": "processProxyingQueue", + "queue": queue + }); + } else { + var worker = PThread.pthreads[targetThreadId]; + if (!worker) { + err("Cannot send message to thread with ID " + targetThreadId + ", unknown thread ID!"); + return; + } + worker.postMessage({ + "cmd": "processProxyingQueue", + "queue": queue + }); + } + return 1; +} + +function __emscripten_proxied_gl_context_activated_from_main_browser_thread(contextHandle) { + GLctx = Module.ctx = GL.currentContext = contextHandle; + GL.currentContextIsProxied = true; +} + +function __emscripten_set_offscreencanvas_size(target, width, height) { + err("emscripten_set_offscreencanvas_size: Build with -sOFFSCREENCANVAS_SUPPORT=1 to enable transferring canvases to pthreads."); + return -1; +} + +function __emscripten_throw_longjmp() { + throw Infinity; +} + +function readI53FromI64(ptr) { + return GROWABLE_HEAP_U32()[ptr >> 2] + GROWABLE_HEAP_I32()[ptr + 4 >> 2] * 4294967296; +} + +function __gmtime_js(time, tmPtr) { + var date = new Date(readI53FromI64(time) * 1e3); + GROWABLE_HEAP_I32()[tmPtr >> 2] = date.getUTCSeconds(); + GROWABLE_HEAP_I32()[tmPtr + 4 >> 2] = date.getUTCMinutes(); + GROWABLE_HEAP_I32()[tmPtr + 8 >> 2] = date.getUTCHours(); + GROWABLE_HEAP_I32()[tmPtr + 12 >> 2] = date.getUTCDate(); + GROWABLE_HEAP_I32()[tmPtr + 16 >> 2] = date.getUTCMonth(); + GROWABLE_HEAP_I32()[tmPtr + 20 >> 2] = date.getUTCFullYear() - 1900; + GROWABLE_HEAP_I32()[tmPtr + 24 >> 2] = date.getUTCDay(); + var start = Date.UTC(date.getUTCFullYear(), 0, 1, 0, 0, 0, 0); + var yday = (date.getTime() - start) / (1e3 * 60 * 60 * 24) | 0; + GROWABLE_HEAP_I32()[tmPtr + 28 >> 2] = yday; +} + +function __localtime_js(time, tmPtr) { + var date = new Date(readI53FromI64(time) * 1e3); + GROWABLE_HEAP_I32()[tmPtr >> 2] = date.getSeconds(); + GROWABLE_HEAP_I32()[tmPtr + 4 >> 2] = date.getMinutes(); + GROWABLE_HEAP_I32()[tmPtr + 8 >> 2] = date.getHours(); + GROWABLE_HEAP_I32()[tmPtr + 12 >> 2] = date.getDate(); + GROWABLE_HEAP_I32()[tmPtr + 16 >> 2] = date.getMonth(); + GROWABLE_HEAP_I32()[tmPtr + 20 >> 2] = date.getFullYear() - 1900; + GROWABLE_HEAP_I32()[tmPtr + 24 >> 2] = date.getDay(); + var start = new Date(date.getFullYear(), 0, 1); + var yday = (date.getTime() - start.getTime()) / (1e3 * 60 * 60 * 24) | 0; + GROWABLE_HEAP_I32()[tmPtr + 28 >> 2] = yday; + GROWABLE_HEAP_I32()[tmPtr + 36 >> 2] = -(date.getTimezoneOffset() * 60); + var summerOffset = new Date(date.getFullYear(), 6, 1).getTimezoneOffset(); + var winterOffset = start.getTimezoneOffset(); + var dst = (summerOffset != winterOffset && date.getTimezoneOffset() == Math.min(winterOffset, summerOffset)) | 0; + GROWABLE_HEAP_I32()[tmPtr + 32 >> 2] = dst; +} + +function __mmap_js(len, prot, flags, fd, off, allocated) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(34, 1, len, prot, flags, fd, off, allocated); + try { + var stream = FS.getStream(fd); + if (!stream) return -8; + var res = FS.mmap(stream, len, off, prot, flags); + var ptr = res.ptr; + GROWABLE_HEAP_I32()[allocated >> 2] = res.allocated; + return ptr; + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +function __munmap_js(addr, len, prot, flags, fd, offset) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(35, 1, addr, len, prot, flags, fd, offset); + try { + var stream = FS.getStream(fd); + if (stream) { + if (prot & 2) { + SYSCALLS.doMsync(addr, stream, len, flags, offset); + } + FS.munmap(stream); + } + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return -e.errno; + } +} + +function allocateUTF8(str) { + var size = lengthBytesUTF8(str) + 1; + var ret = _malloc(size); + if (ret) stringToUTF8Array(str, GROWABLE_HEAP_I8(), ret, size); + return ret; +} + +function _tzset_impl(timezone, daylight, tzname) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(36, 1, timezone, daylight, tzname); + var currentYear = new Date().getFullYear(); + var winter = new Date(currentYear, 0, 1); + var summer = new Date(currentYear, 6, 1); + var winterOffset = winter.getTimezoneOffset(); + var summerOffset = summer.getTimezoneOffset(); + var stdTimezoneOffset = Math.max(winterOffset, summerOffset); + GROWABLE_HEAP_I32()[timezone >> 2] = stdTimezoneOffset * 60; + GROWABLE_HEAP_I32()[daylight >> 2] = Number(winterOffset != summerOffset); + function extractZone(date) { + var match = date.toTimeString().match(/\(([A-Za-z ]+)\)$/); + return match ? match[1] : "GMT"; + } + var winterName = extractZone(winter); + var summerName = extractZone(summer); + var winterNamePtr = allocateUTF8(winterName); + var summerNamePtr = allocateUTF8(summerName); + if (summerOffset < winterOffset) { + GROWABLE_HEAP_U32()[tzname >> 2] = winterNamePtr; + GROWABLE_HEAP_U32()[tzname + 4 >> 2] = summerNamePtr; + } else { + GROWABLE_HEAP_U32()[tzname >> 2] = summerNamePtr; + GROWABLE_HEAP_U32()[tzname + 4 >> 2] = winterNamePtr; + } +} + +function __tzset_js(timezone, daylight, tzname) { + if (__tzset_js.called) return; + __tzset_js.called = true; + _tzset_impl(timezone, daylight, tzname); +} + +function _abort() { + abort("native code called abort()"); +} + +function runtimeKeepalivePush() { + runtimeKeepaliveCounter += 1; +} + +function _emscripten_set_main_loop_timing(mode, value) { + Browser.mainLoop.timingMode = mode; + Browser.mainLoop.timingValue = value; + if (!Browser.mainLoop.func) { + err("emscripten_set_main_loop_timing: Cannot set timing mode for main loop since a main loop does not exist! Call emscripten_set_main_loop first to set one up."); + return 1; + } + if (!Browser.mainLoop.running) { + runtimeKeepalivePush(); + Browser.mainLoop.running = true; + } + if (mode == 0) { + Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setTimeout() { + var timeUntilNextTick = Math.max(0, Browser.mainLoop.tickStartTime + value - _emscripten_get_now()) | 0; + setTimeout(Browser.mainLoop.runner, timeUntilNextTick); + }; + Browser.mainLoop.method = "timeout"; + } else if (mode == 1) { + Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_rAF() { + Browser.requestAnimationFrame(Browser.mainLoop.runner); + }; + Browser.mainLoop.method = "rAF"; + } else if (mode == 2) { + if (typeof setImmediate == "undefined") { + var setImmediates = []; + var emscriptenMainLoopMessageId = "setimmediate"; + var Browser_setImmediate_messageHandler = event => { + if (event.data === emscriptenMainLoopMessageId || event.data.target === emscriptenMainLoopMessageId) { + event.stopPropagation(); + setImmediates.shift()(); + } + }; + addEventListener("message", Browser_setImmediate_messageHandler, true); + setImmediate = function Browser_emulated_setImmediate(func) { + setImmediates.push(func); + if (ENVIRONMENT_IS_WORKER) { + if (Module["setImmediates"] === undefined) Module["setImmediates"] = []; + Module["setImmediates"].push(func); + postMessage({ + target: emscriptenMainLoopMessageId + }); + } else postMessage(emscriptenMainLoopMessageId, "*"); + }; + } + Browser.mainLoop.scheduler = function Browser_mainLoop_scheduler_setImmediate() { + setImmediate(Browser.mainLoop.runner); + }; + Browser.mainLoop.method = "immediate"; + } + return 0; +} + +var _emscripten_get_now; + +if (ENVIRONMENT_IS_PTHREAD) { + _emscripten_get_now = () => performance.now() - Module["__performance_now_clock_drift"]; +} else _emscripten_get_now = () => performance.now(); + +function maybeExit() { + if (!keepRuntimeAlive()) { + try { + if (ENVIRONMENT_IS_PTHREAD) __emscripten_thread_exit(EXITSTATUS); else _exit(EXITSTATUS); + } catch (e) { + handleException(e); + } + } +} + +function runtimeKeepalivePop() { + assert(runtimeKeepaliveCounter > 0); + runtimeKeepaliveCounter -= 1; +} + +function setMainLoop(browserIterationFunc, fps, simulateInfiniteLoop, arg, noSetTiming) { + assert(!Browser.mainLoop.func, "emscripten_set_main_loop: there can only be one main loop function at once: call emscripten_cancel_main_loop to cancel the previous one before setting a new one with different parameters."); + Browser.mainLoop.func = browserIterationFunc; + Browser.mainLoop.arg = arg; + var thisMainLoopId = Browser.mainLoop.currentlyRunningMainloop; + function checkIsRunning() { + if (thisMainLoopId < Browser.mainLoop.currentlyRunningMainloop) { + runtimeKeepalivePop(); + maybeExit(); + return false; + } + return true; + } + Browser.mainLoop.running = false; + Browser.mainLoop.runner = function Browser_mainLoop_runner() { + if (ABORT) return; + if (Browser.mainLoop.queue.length > 0) { + var start = Date.now(); + var blocker = Browser.mainLoop.queue.shift(); + blocker.func(blocker.arg); + if (Browser.mainLoop.remainingBlockers) { + var remaining = Browser.mainLoop.remainingBlockers; + var next = remaining % 1 == 0 ? remaining - 1 : Math.floor(remaining); + if (blocker.counted) { + Browser.mainLoop.remainingBlockers = next; + } else { + next = next + .5; + Browser.mainLoop.remainingBlockers = (8 * remaining + next) / 9; + } + } + out('main loop blocker "' + blocker.name + '" took ' + (Date.now() - start) + " ms"); + Browser.mainLoop.updateStatus(); + if (!checkIsRunning()) return; + setTimeout(Browser.mainLoop.runner, 0); + return; + } + if (!checkIsRunning()) return; + Browser.mainLoop.currentFrameNumber = Browser.mainLoop.currentFrameNumber + 1 | 0; + if (Browser.mainLoop.timingMode == 1 && Browser.mainLoop.timingValue > 1 && Browser.mainLoop.currentFrameNumber % Browser.mainLoop.timingValue != 0) { + Browser.mainLoop.scheduler(); + return; + } else if (Browser.mainLoop.timingMode == 0) { + Browser.mainLoop.tickStartTime = _emscripten_get_now(); + } + if (Browser.mainLoop.method === "timeout" && Module.ctx) { + warnOnce("Looks like you are rendering without using requestAnimationFrame for the main loop. You should use 0 for the frame rate in emscripten_set_main_loop in order to use requestAnimationFrame, as that can greatly improve your frame rates!"); + Browser.mainLoop.method = ""; + } + Browser.mainLoop.runIter(browserIterationFunc); + checkStackCookie(); + if (!checkIsRunning()) return; + if (typeof SDL == "object" && SDL.audio && SDL.audio.queueNewAudioData) SDL.audio.queueNewAudioData(); + Browser.mainLoop.scheduler(); + }; + if (!noSetTiming) { + if (fps && fps > 0) _emscripten_set_main_loop_timing(0, 1e3 / fps); else _emscripten_set_main_loop_timing(1, 1); + Browser.mainLoop.scheduler(); + } + if (simulateInfiniteLoop) { + throw "unwind"; + } +} + +function callUserCallback(func) { + if (runtimeExited || ABORT) { + err("user callback triggered after runtime exited or application aborted. Ignoring."); + return; + } + try { + func(); + maybeExit(); + } catch (e) { + handleException(e); + } +} + +function safeSetTimeout(func, timeout) { + runtimeKeepalivePush(); + return setTimeout(function() { + runtimeKeepalivePop(); + callUserCallback(func); + }, timeout); +} + +function warnOnce(text) { + if (!warnOnce.shown) warnOnce.shown = {}; + if (!warnOnce.shown[text]) { + warnOnce.shown[text] = 1; + err(text); + } +} + +var Browser = { + mainLoop: { + running: false, + scheduler: null, + method: "", + currentlyRunningMainloop: 0, + func: null, + arg: 0, + timingMode: 0, + timingValue: 0, + currentFrameNumber: 0, + queue: [], + pause: function() { + Browser.mainLoop.scheduler = null; + Browser.mainLoop.currentlyRunningMainloop++; + }, + resume: function() { + Browser.mainLoop.currentlyRunningMainloop++; + var timingMode = Browser.mainLoop.timingMode; + var timingValue = Browser.mainLoop.timingValue; + var func = Browser.mainLoop.func; + Browser.mainLoop.func = null; + setMainLoop(func, 0, false, Browser.mainLoop.arg, true); + _emscripten_set_main_loop_timing(timingMode, timingValue); + Browser.mainLoop.scheduler(); + }, + updateStatus: function() { + if (Module["setStatus"]) { + var message = Module["statusMessage"] || "Please wait..."; + var remaining = Browser.mainLoop.remainingBlockers; + var expected = Browser.mainLoop.expectedBlockers; + if (remaining) { + if (remaining < expected) { + Module["setStatus"](message + " (" + (expected - remaining) + "/" + expected + ")"); + } else { + Module["setStatus"](message); + } + } else { + Module["setStatus"](""); + } + } + }, + runIter: function(func) { + if (ABORT) return; + if (Module["preMainLoop"]) { + var preRet = Module["preMainLoop"](); + if (preRet === false) { + return; + } + } + callUserCallback(func); + if (Module["postMainLoop"]) Module["postMainLoop"](); + } + }, + isFullscreen: false, + pointerLock: false, + moduleContextCreatedCallbacks: [], + workers: [], + init: function() { + if (!Module["preloadPlugins"]) Module["preloadPlugins"] = []; + if (Browser.initted) return; + Browser.initted = true; + try { + new Blob(); + Browser.hasBlobConstructor = true; + } catch (e) { + Browser.hasBlobConstructor = false; + err("warning: no blob constructor, cannot create blobs with mimetypes"); + } + Browser.BlobBuilder = typeof MozBlobBuilder != "undefined" ? MozBlobBuilder : typeof WebKitBlobBuilder != "undefined" ? WebKitBlobBuilder : !Browser.hasBlobConstructor ? err("warning: no BlobBuilder") : null; + Browser.URLObject = typeof window != "undefined" ? window.URL ? window.URL : window.webkitURL : undefined; + if (!Module.noImageDecoding && typeof Browser.URLObject == "undefined") { + err("warning: Browser does not support creating object URLs. Built-in browser image decoding will not be available."); + Module.noImageDecoding = true; + } + var imagePlugin = {}; + imagePlugin["canHandle"] = function imagePlugin_canHandle(name) { + return !Module.noImageDecoding && /\.(jpg|jpeg|png|bmp)$/i.test(name); + }; + imagePlugin["handle"] = function imagePlugin_handle(byteArray, name, onload, onerror) { + var b = null; + if (Browser.hasBlobConstructor) { + try { + b = new Blob([ byteArray ], { + type: Browser.getMimetype(name) + }); + if (b.size !== byteArray.length) { + b = new Blob([ new Uint8Array(byteArray).buffer ], { + type: Browser.getMimetype(name) + }); + } + } catch (e) { + warnOnce("Blob constructor present but fails: " + e + "; falling back to blob builder"); + } + } + if (!b) { + var bb = new Browser.BlobBuilder(); + bb.append(new Uint8Array(byteArray).buffer); + b = bb.getBlob(); + } + var url = Browser.URLObject.createObjectURL(b); + assert(typeof url == "string", "createObjectURL must return a url as a string"); + var img = new Image(); + img.onload = () => { + assert(img.complete, "Image " + name + " could not be decoded"); + var canvas = document.createElement("canvas"); + canvas.width = img.width; + canvas.height = img.height; + var ctx = canvas.getContext("2d"); + ctx.drawImage(img, 0, 0); + preloadedImages[name] = canvas; + Browser.URLObject.revokeObjectURL(url); + if (onload) onload(byteArray); + }; + img.onerror = event => { + out("Image " + url + " could not be decoded"); + if (onerror) onerror(); + }; + img.src = url; + }; + Module["preloadPlugins"].push(imagePlugin); + var audioPlugin = {}; + audioPlugin["canHandle"] = function audioPlugin_canHandle(name) { + return !Module.noAudioDecoding && name.substr(-4) in { + ".ogg": 1, + ".wav": 1, + ".mp3": 1 + }; + }; + audioPlugin["handle"] = function audioPlugin_handle(byteArray, name, onload, onerror) { + var done = false; + function finish(audio) { + if (done) return; + done = true; + preloadedAudios[name] = audio; + if (onload) onload(byteArray); + } + function fail() { + if (done) return; + done = true; + preloadedAudios[name] = new Audio(); + if (onerror) onerror(); + } + if (Browser.hasBlobConstructor) { + try { + var b = new Blob([ byteArray ], { + type: Browser.getMimetype(name) + }); + } catch (e) { + return fail(); + } + var url = Browser.URLObject.createObjectURL(b); + assert(typeof url == "string", "createObjectURL must return a url as a string"); + var audio = new Audio(); + audio.addEventListener("canplaythrough", () => finish(audio), false); + audio.onerror = function audio_onerror(event) { + if (done) return; + err("warning: browser could not fully decode audio " + name + ", trying slower base64 approach"); + function encode64(data) { + var BASE = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"; + var PAD = "="; + var ret = ""; + var leftchar = 0; + var leftbits = 0; + for (var i = 0; i < data.length; i++) { + leftchar = leftchar << 8 | data[i]; + leftbits += 8; + while (leftbits >= 6) { + var curr = leftchar >> leftbits - 6 & 63; + leftbits -= 6; + ret += BASE[curr]; + } + } + if (leftbits == 2) { + ret += BASE[(leftchar & 3) << 4]; + ret += PAD + PAD; + } else if (leftbits == 4) { + ret += BASE[(leftchar & 15) << 2]; + ret += PAD; + } + return ret; + } + audio.src = "data:audio/x-" + name.substr(-3) + ";base64," + encode64(byteArray); + finish(audio); + }; + audio.src = url; + safeSetTimeout(function() { + finish(audio); + }, 1e4); + } else { + return fail(); + } + }; + Module["preloadPlugins"].push(audioPlugin); + function pointerLockChange() { + Browser.pointerLock = document["pointerLockElement"] === Module["canvas"] || document["mozPointerLockElement"] === Module["canvas"] || document["webkitPointerLockElement"] === Module["canvas"] || document["msPointerLockElement"] === Module["canvas"]; + } + var canvas = Module["canvas"]; + if (canvas) { + canvas.requestPointerLock = canvas["requestPointerLock"] || canvas["mozRequestPointerLock"] || canvas["webkitRequestPointerLock"] || canvas["msRequestPointerLock"] || (() => {}); + canvas.exitPointerLock = document["exitPointerLock"] || document["mozExitPointerLock"] || document["webkitExitPointerLock"] || document["msExitPointerLock"] || (() => {}); + canvas.exitPointerLock = canvas.exitPointerLock.bind(document); + document.addEventListener("pointerlockchange", pointerLockChange, false); + document.addEventListener("mozpointerlockchange", pointerLockChange, false); + document.addEventListener("webkitpointerlockchange", pointerLockChange, false); + document.addEventListener("mspointerlockchange", pointerLockChange, false); + if (Module["elementPointerLock"]) { + canvas.addEventListener("click", ev => { + if (!Browser.pointerLock && Module["canvas"].requestPointerLock) { + Module["canvas"].requestPointerLock(); + ev.preventDefault(); + } + }, false); + } + } + }, + handledByPreloadPlugin: function(byteArray, fullname, finish, onerror) { + Browser.init(); + var handled = false; + Module["preloadPlugins"].forEach(function(plugin) { + if (handled) return; + if (plugin["canHandle"](fullname)) { + plugin["handle"](byteArray, fullname, finish, onerror); + handled = true; + } + }); + return handled; + }, + createContext: function(canvas, useWebGL, setInModule, webGLContextAttributes) { + if (useWebGL && Module.ctx && canvas == Module.canvas) return Module.ctx; + var ctx; + var contextHandle; + if (useWebGL) { + var contextAttributes = { + antialias: false, + alpha: false, + majorVersion: typeof WebGL2RenderingContext != "undefined" ? 2 : 1 + }; + if (webGLContextAttributes) { + for (var attribute in webGLContextAttributes) { + contextAttributes[attribute] = webGLContextAttributes[attribute]; + } + } + if (typeof GL != "undefined") { + contextHandle = GL.createContext(canvas, contextAttributes); + if (contextHandle) { + ctx = GL.getContext(contextHandle).GLctx; + } + } + } else { + ctx = canvas.getContext("2d"); + } + if (!ctx) return null; + if (setInModule) { + if (!useWebGL) assert(typeof GLctx == "undefined", "cannot set in module if GLctx is used, but we are a non-GL context that would replace it"); + Module.ctx = ctx; + if (useWebGL) GL.makeContextCurrent(contextHandle); + Module.useWebGL = useWebGL; + Browser.moduleContextCreatedCallbacks.forEach(function(callback) { + callback(); + }); + Browser.init(); + } + return ctx; + }, + destroyContext: function(canvas, useWebGL, setInModule) {}, + fullscreenHandlersInstalled: false, + lockPointer: undefined, + resizeCanvas: undefined, + requestFullscreen: function(lockPointer, resizeCanvas) { + Browser.lockPointer = lockPointer; + Browser.resizeCanvas = resizeCanvas; + if (typeof Browser.lockPointer == "undefined") Browser.lockPointer = true; + if (typeof Browser.resizeCanvas == "undefined") Browser.resizeCanvas = false; + var canvas = Module["canvas"]; + function fullscreenChange() { + Browser.isFullscreen = false; + var canvasContainer = canvas.parentNode; + if ((document["fullscreenElement"] || document["mozFullScreenElement"] || document["msFullscreenElement"] || document["webkitFullscreenElement"] || document["webkitCurrentFullScreenElement"]) === canvasContainer) { + canvas.exitFullscreen = Browser.exitFullscreen; + if (Browser.lockPointer) canvas.requestPointerLock(); + Browser.isFullscreen = true; + if (Browser.resizeCanvas) { + Browser.setFullscreenCanvasSize(); + } else { + Browser.updateCanvasDimensions(canvas); + } + } else { + canvasContainer.parentNode.insertBefore(canvas, canvasContainer); + canvasContainer.parentNode.removeChild(canvasContainer); + if (Browser.resizeCanvas) { + Browser.setWindowedCanvasSize(); + } else { + Browser.updateCanvasDimensions(canvas); + } + } + if (Module["onFullScreen"]) Module["onFullScreen"](Browser.isFullscreen); + if (Module["onFullscreen"]) Module["onFullscreen"](Browser.isFullscreen); + } + if (!Browser.fullscreenHandlersInstalled) { + Browser.fullscreenHandlersInstalled = true; + document.addEventListener("fullscreenchange", fullscreenChange, false); + document.addEventListener("mozfullscreenchange", fullscreenChange, false); + document.addEventListener("webkitfullscreenchange", fullscreenChange, false); + document.addEventListener("MSFullscreenChange", fullscreenChange, false); + } + var canvasContainer = document.createElement("div"); + canvas.parentNode.insertBefore(canvasContainer, canvas); + canvasContainer.appendChild(canvas); + canvasContainer.requestFullscreen = canvasContainer["requestFullscreen"] || canvasContainer["mozRequestFullScreen"] || canvasContainer["msRequestFullscreen"] || (canvasContainer["webkitRequestFullscreen"] ? () => canvasContainer["webkitRequestFullscreen"](Element["ALLOW_KEYBOARD_INPUT"]) : null) || (canvasContainer["webkitRequestFullScreen"] ? () => canvasContainer["webkitRequestFullScreen"](Element["ALLOW_KEYBOARD_INPUT"]) : null); + canvasContainer.requestFullscreen(); + }, + requestFullScreen: function() { + abort("Module.requestFullScreen has been replaced by Module.requestFullscreen (without a capital S)"); + }, + exitFullscreen: function() { + if (!Browser.isFullscreen) { + return false; + } + var CFS = document["exitFullscreen"] || document["cancelFullScreen"] || document["mozCancelFullScreen"] || document["msExitFullscreen"] || document["webkitCancelFullScreen"] || function() {}; + CFS.apply(document, []); + return true; + }, + nextRAF: 0, + fakeRequestAnimationFrame: function(func) { + var now = Date.now(); + if (Browser.nextRAF === 0) { + Browser.nextRAF = now + 1e3 / 60; + } else { + while (now + 2 >= Browser.nextRAF) { + Browser.nextRAF += 1e3 / 60; + } + } + var delay = Math.max(Browser.nextRAF - now, 0); + setTimeout(func, delay); + }, + requestAnimationFrame: function(func) { + if (typeof requestAnimationFrame == "function") { + requestAnimationFrame(func); + return; + } + var RAF = Browser.fakeRequestAnimationFrame; + RAF(func); + }, + safeSetTimeout: function(func) { + return safeSetTimeout(func); + }, + safeRequestAnimationFrame: function(func) { + runtimeKeepalivePush(); + return Browser.requestAnimationFrame(function() { + runtimeKeepalivePop(); + callUserCallback(func); + }); + }, + getMimetype: function(name) { + return { + "jpg": "image/jpeg", + "jpeg": "image/jpeg", + "png": "image/png", + "bmp": "image/bmp", + "ogg": "audio/ogg", + "wav": "audio/wav", + "mp3": "audio/mpeg" + }[name.substr(name.lastIndexOf(".") + 1)]; + }, + getUserMedia: function(func) { + if (!window.getUserMedia) { + window.getUserMedia = navigator["getUserMedia"] || navigator["mozGetUserMedia"]; + } + window.getUserMedia(func); + }, + getMovementX: function(event) { + return event["movementX"] || event["mozMovementX"] || event["webkitMovementX"] || 0; + }, + getMovementY: function(event) { + return event["movementY"] || event["mozMovementY"] || event["webkitMovementY"] || 0; + }, + getMouseWheelDelta: function(event) { + var delta = 0; + switch (event.type) { + case "DOMMouseScroll": + delta = event.detail / 3; + break; + + case "mousewheel": + delta = event.wheelDelta / 120; + break; + + case "wheel": + delta = event.deltaY; + switch (event.deltaMode) { + case 0: + delta /= 100; + break; + + case 1: + delta /= 3; + break; + + case 2: + delta *= 80; + break; + + default: + throw "unrecognized mouse wheel delta mode: " + event.deltaMode; + } + break; + + default: + throw "unrecognized mouse wheel event: " + event.type; + } + return delta; + }, + mouseX: 0, + mouseY: 0, + mouseMovementX: 0, + mouseMovementY: 0, + touches: {}, + lastTouches: {}, + calculateMouseEvent: function(event) { + if (Browser.pointerLock) { + if (event.type != "mousemove" && "mozMovementX" in event) { + Browser.mouseMovementX = Browser.mouseMovementY = 0; + } else { + Browser.mouseMovementX = Browser.getMovementX(event); + Browser.mouseMovementY = Browser.getMovementY(event); + } + if (typeof SDL != "undefined") { + Browser.mouseX = SDL.mouseX + Browser.mouseMovementX; + Browser.mouseY = SDL.mouseY + Browser.mouseMovementY; + } else { + Browser.mouseX += Browser.mouseMovementX; + Browser.mouseY += Browser.mouseMovementY; + } + } else { + var rect = Module["canvas"].getBoundingClientRect(); + var cw = Module["canvas"].width; + var ch = Module["canvas"].height; + var scrollX = typeof window.scrollX != "undefined" ? window.scrollX : window.pageXOffset; + var scrollY = typeof window.scrollY != "undefined" ? window.scrollY : window.pageYOffset; + assert(typeof scrollX != "undefined" && typeof scrollY != "undefined", "Unable to retrieve scroll position, mouse positions likely broken."); + if (event.type === "touchstart" || event.type === "touchend" || event.type === "touchmove") { + var touch = event.touch; + if (touch === undefined) { + return; + } + var adjustedX = touch.pageX - (scrollX + rect.left); + var adjustedY = touch.pageY - (scrollY + rect.top); + adjustedX = adjustedX * (cw / rect.width); + adjustedY = adjustedY * (ch / rect.height); + var coords = { + x: adjustedX, + y: adjustedY + }; + if (event.type === "touchstart") { + Browser.lastTouches[touch.identifier] = coords; + Browser.touches[touch.identifier] = coords; + } else if (event.type === "touchend" || event.type === "touchmove") { + var last = Browser.touches[touch.identifier]; + if (!last) last = coords; + Browser.lastTouches[touch.identifier] = last; + Browser.touches[touch.identifier] = coords; + } + return; + } + var x = event.pageX - (scrollX + rect.left); + var y = event.pageY - (scrollY + rect.top); + x = x * (cw / rect.width); + y = y * (ch / rect.height); + Browser.mouseMovementX = x - Browser.mouseX; + Browser.mouseMovementY = y - Browser.mouseY; + Browser.mouseX = x; + Browser.mouseY = y; + } + }, + resizeListeners: [], + updateResizeListeners: function() { + var canvas = Module["canvas"]; + Browser.resizeListeners.forEach(function(listener) { + listener(canvas.width, canvas.height); + }); + }, + setCanvasSize: function(width, height, noUpdates) { + var canvas = Module["canvas"]; + Browser.updateCanvasDimensions(canvas, width, height); + if (!noUpdates) Browser.updateResizeListeners(); + }, + windowedWidth: 0, + windowedHeight: 0, + setFullscreenCanvasSize: function() { + if (typeof SDL != "undefined") { + var flags = GROWABLE_HEAP_U32()[SDL.screen >> 2]; + flags = flags | 8388608; + GROWABLE_HEAP_I32()[SDL.screen >> 2] = flags; + } + Browser.updateCanvasDimensions(Module["canvas"]); + Browser.updateResizeListeners(); + }, + setWindowedCanvasSize: function() { + if (typeof SDL != "undefined") { + var flags = GROWABLE_HEAP_U32()[SDL.screen >> 2]; + flags = flags & ~8388608; + GROWABLE_HEAP_I32()[SDL.screen >> 2] = flags; + } + Browser.updateCanvasDimensions(Module["canvas"]); + Browser.updateResizeListeners(); + }, + updateCanvasDimensions: function(canvas, wNative, hNative) { + if (wNative && hNative) { + canvas.widthNative = wNative; + canvas.heightNative = hNative; + } else { + wNative = canvas.widthNative; + hNative = canvas.heightNative; + } + var w = wNative; + var h = hNative; + if (Module["forcedAspectRatio"] && Module["forcedAspectRatio"] > 0) { + if (w / h < Module["forcedAspectRatio"]) { + w = Math.round(h * Module["forcedAspectRatio"]); + } else { + h = Math.round(w / Module["forcedAspectRatio"]); + } + } + if ((document["fullscreenElement"] || document["mozFullScreenElement"] || document["msFullscreenElement"] || document["webkitFullscreenElement"] || document["webkitCurrentFullScreenElement"]) === canvas.parentNode && typeof screen != "undefined") { + var factor = Math.min(screen.width / w, screen.height / h); + w = Math.round(w * factor); + h = Math.round(h * factor); + } + if (Browser.resizeCanvas) { + if (canvas.width != w) canvas.width = w; + if (canvas.height != h) canvas.height = h; + if (typeof canvas.style != "undefined") { + canvas.style.removeProperty("width"); + canvas.style.removeProperty("height"); + } + } else { + if (canvas.width != wNative) canvas.width = wNative; + if (canvas.height != hNative) canvas.height = hNative; + if (typeof canvas.style != "undefined") { + if (w != wNative || h != hNative) { + canvas.style.setProperty("width", w + "px", "important"); + canvas.style.setProperty("height", h + "px", "important"); + } else { + canvas.style.removeProperty("width"); + canvas.style.removeProperty("height"); + } + } + } + } +}; + +function _emscripten_cancel_main_loop() { + Browser.mainLoop.pause(); + Browser.mainLoop.func = null; +} + +function _emscripten_check_blocking_allowed() { + if (ENVIRONMENT_IS_WORKER) return; + warnOnce("Blocking on the main thread is very dangerous, see https://emscripten.org/docs/porting/pthreads.html#blocking-on-the-main-browser-thread"); +} + +function _emscripten_console_error(str) { + assert(typeof str == "number"); + console.error(UTF8ToString(str)); +} + +function _emscripten_force_exit(status) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(37, 1, status); + noExitRuntime = false; + runtimeKeepaliveCounter = 0; + _exit(status); +} + +function __webgl_enable_ANGLE_instanced_arrays(ctx) { + var ext = ctx.getExtension("ANGLE_instanced_arrays"); + if (ext) { + ctx["vertexAttribDivisor"] = function(index, divisor) { + ext["vertexAttribDivisorANGLE"](index, divisor); + }; + ctx["drawArraysInstanced"] = function(mode, first, count, primcount) { + ext["drawArraysInstancedANGLE"](mode, first, count, primcount); + }; + ctx["drawElementsInstanced"] = function(mode, count, type, indices, primcount) { + ext["drawElementsInstancedANGLE"](mode, count, type, indices, primcount); + }; + return 1; + } +} + +function __webgl_enable_OES_vertex_array_object(ctx) { + var ext = ctx.getExtension("OES_vertex_array_object"); + if (ext) { + ctx["createVertexArray"] = function() { + return ext["createVertexArrayOES"](); + }; + ctx["deleteVertexArray"] = function(vao) { + ext["deleteVertexArrayOES"](vao); + }; + ctx["bindVertexArray"] = function(vao) { + ext["bindVertexArrayOES"](vao); + }; + ctx["isVertexArray"] = function(vao) { + return ext["isVertexArrayOES"](vao); + }; + return 1; + } +} + +function __webgl_enable_WEBGL_draw_buffers(ctx) { + var ext = ctx.getExtension("WEBGL_draw_buffers"); + if (ext) { + ctx["drawBuffers"] = function(n, bufs) { + ext["drawBuffersWEBGL"](n, bufs); + }; + return 1; + } +} + +function __webgl_enable_WEBGL_draw_instanced_base_vertex_base_instance(ctx) { + return !!(ctx.dibvbi = ctx.getExtension("WEBGL_draw_instanced_base_vertex_base_instance")); +} + +function __webgl_enable_WEBGL_multi_draw_instanced_base_vertex_base_instance(ctx) { + return !!(ctx.mdibvbi = ctx.getExtension("WEBGL_multi_draw_instanced_base_vertex_base_instance")); +} + +function __webgl_enable_WEBGL_multi_draw(ctx) { + return !!(ctx.multiDrawWebgl = ctx.getExtension("WEBGL_multi_draw")); +} + +var GL = { + counter: 1, + buffers: [], + programs: [], + framebuffers: [], + renderbuffers: [], + textures: [], + shaders: [], + vaos: [], + contexts: {}, + offscreenCanvases: {}, + queries: [], + samplers: [], + transformFeedbacks: [], + syncs: [], + stringCache: {}, + stringiCache: {}, + unpackAlignment: 4, + recordError: function recordError(errorCode) { + if (!GL.lastError) { + GL.lastError = errorCode; + } + }, + getNewId: function(table) { + var ret = GL.counter++; + for (var i = table.length; i < ret; i++) { + table[i] = null; + } + return ret; + }, + getSource: function(shader, count, string, length) { + var source = ""; + for (var i = 0; i < count; ++i) { + var len = length ? GROWABLE_HEAP_I32()[length + i * 4 >> 2] : -1; + source += UTF8ToString(GROWABLE_HEAP_I32()[string + i * 4 >> 2], len < 0 ? undefined : len); + } + return source; + }, + createContext: function(canvas, webGLContextAttributes) { + if (webGLContextAttributes.renderViaOffscreenBackBuffer) webGLContextAttributes["preserveDrawingBuffer"] = true; + var ctx = webGLContextAttributes.majorVersion > 1 ? canvas.getContext("webgl2", webGLContextAttributes) : canvas.getContext("webgl", webGLContextAttributes); + if (!ctx) return 0; + var handle = GL.registerContext(ctx, webGLContextAttributes); + return handle; + }, + enableOffscreenFramebufferAttributes: function(webGLContextAttributes) { + webGLContextAttributes.renderViaOffscreenBackBuffer = true; + webGLContextAttributes.preserveDrawingBuffer = true; + }, + createOffscreenFramebuffer: function(context) { + var gl = context.GLctx; + var fbo = gl.createFramebuffer(); + gl.bindFramebuffer(36160, fbo); + context.defaultFbo = fbo; + context.defaultFboForbidBlitFramebuffer = false; + if (gl.getContextAttributes().antialias) { + context.defaultFboForbidBlitFramebuffer = true; + } else { + var firefoxMatch = navigator.userAgent.toLowerCase().match(/firefox\/(\d\d)/); + if (firefoxMatch != null) { + var firefoxVersion = firefoxMatch[1]; + context.defaultFboForbidBlitFramebuffer = firefoxVersion < 67; + } + } + context.defaultColorTarget = gl.createTexture(); + context.defaultDepthTarget = gl.createRenderbuffer(); + GL.resizeOffscreenFramebuffer(context); + gl.bindTexture(3553, context.defaultColorTarget); + gl.texParameteri(3553, 10241, 9728); + gl.texParameteri(3553, 10240, 9728); + gl.texParameteri(3553, 10242, 33071); + gl.texParameteri(3553, 10243, 33071); + gl.texImage2D(3553, 0, 6408, gl.canvas.width, gl.canvas.height, 0, 6408, 5121, null); + gl.framebufferTexture2D(36160, 36064, 3553, context.defaultColorTarget, 0); + gl.bindTexture(3553, null); + var depthTarget = gl.createRenderbuffer(); + gl.bindRenderbuffer(36161, context.defaultDepthTarget); + gl.renderbufferStorage(36161, 33189, gl.canvas.width, gl.canvas.height); + gl.framebufferRenderbuffer(36160, 36096, 36161, context.defaultDepthTarget); + gl.bindRenderbuffer(36161, null); + var vertices = [ -1, -1, -1, 1, 1, -1, 1, 1 ]; + var vb = gl.createBuffer(); + gl.bindBuffer(34962, vb); + gl.bufferData(34962, new Float32Array(vertices), 35044); + gl.bindBuffer(34962, null); + context.blitVB = vb; + var vsCode = "attribute vec2 pos;" + "varying lowp vec2 tex;" + "void main() { tex = pos * 0.5 + vec2(0.5,0.5); gl_Position = vec4(pos, 0.0, 1.0); }"; + var vs = gl.createShader(35633); + gl.shaderSource(vs, vsCode); + gl.compileShader(vs); + var fsCode = "varying lowp vec2 tex;" + "uniform sampler2D sampler;" + "void main() { gl_FragColor = texture2D(sampler, tex); }"; + var fs = gl.createShader(35632); + gl.shaderSource(fs, fsCode); + gl.compileShader(fs); + var blitProgram = gl.createProgram(); + gl.attachShader(blitProgram, vs); + gl.attachShader(blitProgram, fs); + gl.linkProgram(blitProgram); + context.blitProgram = blitProgram; + context.blitPosLoc = gl.getAttribLocation(blitProgram, "pos"); + gl.useProgram(blitProgram); + gl.uniform1i(gl.getUniformLocation(blitProgram, "sampler"), 0); + gl.useProgram(null); + context.defaultVao = undefined; + if (gl.createVertexArray) { + context.defaultVao = gl.createVertexArray(); + gl.bindVertexArray(context.defaultVao); + gl.enableVertexAttribArray(context.blitPosLoc); + gl.bindVertexArray(null); + } + }, + resizeOffscreenFramebuffer: function(context) { + var gl = context.GLctx; + if (context.defaultColorTarget) { + var prevTextureBinding = gl.getParameter(32873); + gl.bindTexture(3553, context.defaultColorTarget); + gl.texImage2D(3553, 0, 6408, gl.drawingBufferWidth, gl.drawingBufferHeight, 0, 6408, 5121, null); + gl.bindTexture(3553, prevTextureBinding); + } + if (context.defaultDepthTarget) { + var prevRenderBufferBinding = gl.getParameter(36007); + gl.bindRenderbuffer(36161, context.defaultDepthTarget); + gl.renderbufferStorage(36161, 33189, gl.drawingBufferWidth, gl.drawingBufferHeight); + gl.bindRenderbuffer(36161, prevRenderBufferBinding); + } + }, + blitOffscreenFramebuffer: function(context) { + var gl = context.GLctx; + var prevScissorTest = gl.getParameter(3089); + if (prevScissorTest) gl.disable(3089); + var prevFbo = gl.getParameter(36006); + if (gl.blitFramebuffer && !context.defaultFboForbidBlitFramebuffer) { + gl.bindFramebuffer(36008, context.defaultFbo); + gl.bindFramebuffer(36009, null); + gl.blitFramebuffer(0, 0, gl.canvas.width, gl.canvas.height, 0, 0, gl.canvas.width, gl.canvas.height, 16384, 9728); + } else { + gl.bindFramebuffer(36160, null); + var prevProgram = gl.getParameter(35725); + gl.useProgram(context.blitProgram); + var prevVB = gl.getParameter(34964); + gl.bindBuffer(34962, context.blitVB); + var prevActiveTexture = gl.getParameter(34016); + gl.activeTexture(33984); + var prevTextureBinding = gl.getParameter(32873); + gl.bindTexture(3553, context.defaultColorTarget); + var prevBlend = gl.getParameter(3042); + if (prevBlend) gl.disable(3042); + var prevCullFace = gl.getParameter(2884); + if (prevCullFace) gl.disable(2884); + var prevDepthTest = gl.getParameter(2929); + if (prevDepthTest) gl.disable(2929); + var prevStencilTest = gl.getParameter(2960); + if (prevStencilTest) gl.disable(2960); + function draw() { + gl.vertexAttribPointer(context.blitPosLoc, 2, 5126, false, 0, 0); + gl.drawArrays(5, 0, 4); + } + if (context.defaultVao) { + var prevVAO = gl.getParameter(34229); + gl.bindVertexArray(context.defaultVao); + draw(); + gl.bindVertexArray(prevVAO); + } else { + var prevVertexAttribPointer = { + buffer: gl.getVertexAttrib(context.blitPosLoc, 34975), + size: gl.getVertexAttrib(context.blitPosLoc, 34339), + stride: gl.getVertexAttrib(context.blitPosLoc, 34340), + type: gl.getVertexAttrib(context.blitPosLoc, 34341), + normalized: gl.getVertexAttrib(context.blitPosLoc, 34922), + pointer: gl.getVertexAttribOffset(context.blitPosLoc, 34373) + }; + var maxVertexAttribs = gl.getParameter(34921); + var prevVertexAttribEnables = []; + for (var i = 0; i < maxVertexAttribs; ++i) { + var prevEnabled = gl.getVertexAttrib(i, 34338); + var wantEnabled = i == context.blitPosLoc; + if (prevEnabled && !wantEnabled) { + gl.disableVertexAttribArray(i); + } + if (!prevEnabled && wantEnabled) { + gl.enableVertexAttribArray(i); + } + prevVertexAttribEnables[i] = prevEnabled; + } + draw(); + for (var i = 0; i < maxVertexAttribs; ++i) { + var prevEnabled = prevVertexAttribEnables[i]; + var nowEnabled = i == context.blitPosLoc; + if (prevEnabled && !nowEnabled) { + gl.enableVertexAttribArray(i); + } + if (!prevEnabled && nowEnabled) { + gl.disableVertexAttribArray(i); + } + } + gl.bindBuffer(34962, prevVertexAttribPointer.buffer); + gl.vertexAttribPointer(context.blitPosLoc, prevVertexAttribPointer.size, prevVertexAttribPointer.type, prevVertexAttribPointer.normalized, prevVertexAttribPointer.stride, prevVertexAttribPointer.offset); + } + if (prevStencilTest) gl.enable(2960); + if (prevDepthTest) gl.enable(2929); + if (prevCullFace) gl.enable(2884); + if (prevBlend) gl.enable(3042); + gl.bindTexture(3553, prevTextureBinding); + gl.activeTexture(prevActiveTexture); + gl.bindBuffer(34962, prevVB); + gl.useProgram(prevProgram); + } + gl.bindFramebuffer(36160, prevFbo); + if (prevScissorTest) gl.enable(3089); + }, + registerContext: function(ctx, webGLContextAttributes) { + var handle = _malloc(8); + GROWABLE_HEAP_I32()[handle + 4 >> 2] = _pthread_self(); + var context = { + handle: handle, + attributes: webGLContextAttributes, + version: webGLContextAttributes.majorVersion, + GLctx: ctx + }; + if (ctx.canvas) ctx.canvas.GLctxObject = context; + GL.contexts[handle] = context; + if (typeof webGLContextAttributes.enableExtensionsByDefault == "undefined" || webGLContextAttributes.enableExtensionsByDefault) { + GL.initExtensions(context); + } + if (webGLContextAttributes.renderViaOffscreenBackBuffer) GL.createOffscreenFramebuffer(context); + return handle; + }, + makeContextCurrent: function(contextHandle) { + GL.currentContext = GL.contexts[contextHandle]; + Module.ctx = GLctx = GL.currentContext && GL.currentContext.GLctx; + return !(contextHandle && !GLctx); + }, + getContext: function(contextHandle) { + return GL.contexts[contextHandle]; + }, + deleteContext: function(contextHandle) { + if (GL.currentContext === GL.contexts[contextHandle]) GL.currentContext = null; + if (typeof JSEvents == "object") JSEvents.removeAllHandlersOnTarget(GL.contexts[contextHandle].GLctx.canvas); + if (GL.contexts[contextHandle] && GL.contexts[contextHandle].GLctx.canvas) GL.contexts[contextHandle].GLctx.canvas.GLctxObject = undefined; + _free(GL.contexts[contextHandle].handle); + GL.contexts[contextHandle] = null; + }, + initExtensions: function(context) { + if (!context) context = GL.currentContext; + if (context.initExtensionsDone) return; + context.initExtensionsDone = true; + var GLctx = context.GLctx; + __webgl_enable_ANGLE_instanced_arrays(GLctx); + __webgl_enable_OES_vertex_array_object(GLctx); + __webgl_enable_WEBGL_draw_buffers(GLctx); + __webgl_enable_WEBGL_draw_instanced_base_vertex_base_instance(GLctx); + __webgl_enable_WEBGL_multi_draw_instanced_base_vertex_base_instance(GLctx); + if (context.version >= 2) { + GLctx.disjointTimerQueryExt = GLctx.getExtension("EXT_disjoint_timer_query_webgl2"); + } + if (context.version < 2 || !GLctx.disjointTimerQueryExt) { + GLctx.disjointTimerQueryExt = GLctx.getExtension("EXT_disjoint_timer_query"); + } + __webgl_enable_WEBGL_multi_draw(GLctx); + var exts = GLctx.getSupportedExtensions() || []; + exts.forEach(function(ext) { + if (!ext.includes("lose_context") && !ext.includes("debug")) { + GLctx.getExtension(ext); + } + }); + } +}; + +function _emscripten_glActiveTexture(x0) { + GLctx["activeTexture"](x0); +} + +function _emscripten_glAttachShader(program, shader) { + GLctx.attachShader(GL.programs[program], GL.shaders[shader]); +} + +function _emscripten_glBeginTransformFeedback(x0) { + GLctx["beginTransformFeedback"](x0); +} + +function _emscripten_glBindBuffer(target, buffer) { + if (target == 35051) { + GLctx.currentPixelPackBufferBinding = buffer; + } else if (target == 35052) { + GLctx.currentPixelUnpackBufferBinding = buffer; + } + GLctx.bindBuffer(target, GL.buffers[buffer]); +} + +function _emscripten_glBindBufferBase(target, index, buffer) { + GLctx["bindBufferBase"](target, index, GL.buffers[buffer]); +} + +function _emscripten_glBindBufferRange(target, index, buffer, offset, ptrsize) { + GLctx["bindBufferRange"](target, index, GL.buffers[buffer], offset, ptrsize); +} + +function _emscripten_glBindFramebuffer(target, framebuffer) { + GLctx.bindFramebuffer(target, framebuffer ? GL.framebuffers[framebuffer] : GL.currentContext.defaultFbo); +} + +function _emscripten_glBindRenderbuffer(target, renderbuffer) { + GLctx.bindRenderbuffer(target, GL.renderbuffers[renderbuffer]); +} + +function _emscripten_glBindTexture(target, texture) { + GLctx.bindTexture(target, GL.textures[texture]); +} + +function _emscripten_glBindVertexArray(vao) { + GLctx["bindVertexArray"](GL.vaos[vao]); +} + +function _emscripten_glBlendColor(x0, x1, x2, x3) { + GLctx["blendColor"](x0, x1, x2, x3); +} + +function _emscripten_glBlendEquation(x0) { + GLctx["blendEquation"](x0); +} + +function _emscripten_glBlendFunc(x0, x1) { + GLctx["blendFunc"](x0, x1); +} + +function _emscripten_glBlendFuncSeparate(x0, x1, x2, x3) { + GLctx["blendFuncSeparate"](x0, x1, x2, x3); +} + +function _emscripten_glBlitFramebuffer(x0, x1, x2, x3, x4, x5, x6, x7, x8, x9) { + GLctx["blitFramebuffer"](x0, x1, x2, x3, x4, x5, x6, x7, x8, x9); +} + +function _emscripten_glBufferData(target, size, data, usage) { + if (GL.currentContext.version >= 2) { + if (data && size) { + GLctx.bufferData(target, GROWABLE_HEAP_U8(), usage, data, size); + } else { + GLctx.bufferData(target, size, usage); + } + } else { + GLctx.bufferData(target, data ? GROWABLE_HEAP_U8().subarray(data, data + size) : size, usage); + } +} + +function _emscripten_glBufferSubData(target, offset, size, data) { + if (GL.currentContext.version >= 2) { + size && GLctx.bufferSubData(target, offset, GROWABLE_HEAP_U8(), data, size); + return; + } + GLctx.bufferSubData(target, offset, GROWABLE_HEAP_U8().subarray(data, data + size)); +} + +function _emscripten_glCheckFramebufferStatus(x0) { + return GLctx["checkFramebufferStatus"](x0); +} + +function _emscripten_glClear(x0) { + GLctx["clear"](x0); +} + +function _emscripten_glClearBufferfv(buffer, drawbuffer, value) { + GLctx["clearBufferfv"](buffer, drawbuffer, GROWABLE_HEAP_F32(), value >> 2); +} + +function _emscripten_glClearColor(x0, x1, x2, x3) { + GLctx["clearColor"](x0, x1, x2, x3); +} + +function _emscripten_glClearDepthf(x0) { + GLctx["clearDepth"](x0); +} + +function _emscripten_glColorMask(red, green, blue, alpha) { + GLctx.colorMask(!!red, !!green, !!blue, !!alpha); +} + +function _emscripten_glCompileShader(shader) { + GLctx.compileShader(GL.shaders[shader]); +} + +function _emscripten_glCompressedTexImage2D(target, level, internalFormat, width, height, border, imageSize, data) { + if (GL.currentContext.version >= 2) { + if (GLctx.currentPixelUnpackBufferBinding || !imageSize) { + GLctx["compressedTexImage2D"](target, level, internalFormat, width, height, border, imageSize, data); + } else { + GLctx["compressedTexImage2D"](target, level, internalFormat, width, height, border, GROWABLE_HEAP_U8(), data, imageSize); + } + return; + } + GLctx["compressedTexImage2D"](target, level, internalFormat, width, height, border, data ? GROWABLE_HEAP_U8().subarray(data, data + imageSize) : null); +} + +function _emscripten_glCopyBufferSubData(x0, x1, x2, x3, x4) { + GLctx["copyBufferSubData"](x0, x1, x2, x3, x4); +} + +function _emscripten_glCreateProgram() { + var id = GL.getNewId(GL.programs); + var program = GLctx.createProgram(); + program.name = id; + program.maxUniformLength = program.maxAttributeLength = program.maxUniformBlockNameLength = 0; + program.uniformIdCounter = 1; + GL.programs[id] = program; + return id; +} + +function _emscripten_glCreateShader(shaderType) { + var id = GL.getNewId(GL.shaders); + GL.shaders[id] = GLctx.createShader(shaderType); + return id; +} + +function _emscripten_glCullFace(x0) { + GLctx["cullFace"](x0); +} + +function _emscripten_glDeleteBuffers(n, buffers) { + for (var i = 0; i < n; i++) { + var id = GROWABLE_HEAP_I32()[buffers + i * 4 >> 2]; + var buffer = GL.buffers[id]; + if (!buffer) continue; + GLctx.deleteBuffer(buffer); + buffer.name = 0; + GL.buffers[id] = null; + if (id == GLctx.currentPixelPackBufferBinding) GLctx.currentPixelPackBufferBinding = 0; + if (id == GLctx.currentPixelUnpackBufferBinding) GLctx.currentPixelUnpackBufferBinding = 0; + } +} + +function _emscripten_glDeleteFramebuffers(n, framebuffers) { + for (var i = 0; i < n; ++i) { + var id = GROWABLE_HEAP_I32()[framebuffers + i * 4 >> 2]; + var framebuffer = GL.framebuffers[id]; + if (!framebuffer) continue; + GLctx.deleteFramebuffer(framebuffer); + framebuffer.name = 0; + GL.framebuffers[id] = null; + } +} + +function _emscripten_glDeleteProgram(id) { + if (!id) return; + var program = GL.programs[id]; + if (!program) { + GL.recordError(1281); + return; + } + GLctx.deleteProgram(program); + program.name = 0; + GL.programs[id] = null; +} + +function _emscripten_glDeleteQueries(n, ids) { + for (var i = 0; i < n; i++) { + var id = GROWABLE_HEAP_I32()[ids + i * 4 >> 2]; + var query = GL.queries[id]; + if (!query) continue; + GLctx["deleteQuery"](query); + GL.queries[id] = null; + } +} + +function _emscripten_glDeleteRenderbuffers(n, renderbuffers) { + for (var i = 0; i < n; i++) { + var id = GROWABLE_HEAP_I32()[renderbuffers + i * 4 >> 2]; + var renderbuffer = GL.renderbuffers[id]; + if (!renderbuffer) continue; + GLctx.deleteRenderbuffer(renderbuffer); + renderbuffer.name = 0; + GL.renderbuffers[id] = null; + } +} + +function _emscripten_glDeleteShader(id) { + if (!id) return; + var shader = GL.shaders[id]; + if (!shader) { + GL.recordError(1281); + return; + } + GLctx.deleteShader(shader); + GL.shaders[id] = null; +} + +function _emscripten_glDeleteSync(id) { + if (!id) return; + var sync = GL.syncs[id]; + if (!sync) { + GL.recordError(1281); + return; + } + GLctx.deleteSync(sync); + sync.name = 0; + GL.syncs[id] = null; +} + +function _emscripten_glDeleteTextures(n, textures) { + for (var i = 0; i < n; i++) { + var id = GROWABLE_HEAP_I32()[textures + i * 4 >> 2]; + var texture = GL.textures[id]; + if (!texture) continue; + GLctx.deleteTexture(texture); + texture.name = 0; + GL.textures[id] = null; + } +} + +function _emscripten_glDeleteVertexArrays(n, vaos) { + for (var i = 0; i < n; i++) { + var id = GROWABLE_HEAP_I32()[vaos + i * 4 >> 2]; + GLctx["deleteVertexArray"](GL.vaos[id]); + GL.vaos[id] = null; + } +} + +function _emscripten_glDepthFunc(x0) { + GLctx["depthFunc"](x0); +} + +function _emscripten_glDepthMask(flag) { + GLctx.depthMask(!!flag); +} + +function _emscripten_glDisable(x0) { + GLctx["disable"](x0); +} + +function _emscripten_glDisableVertexAttribArray(index) { + GLctx.disableVertexAttribArray(index); +} + +function _emscripten_glDrawArrays(mode, first, count) { + GLctx.drawArrays(mode, first, count); +} + +function _emscripten_glDrawArraysInstanced(mode, first, count, primcount) { + GLctx["drawArraysInstanced"](mode, first, count, primcount); +} + +function _emscripten_glDrawElements(mode, count, type, indices) { + GLctx.drawElements(mode, count, type, indices); +} + +function _emscripten_glDrawElementsInstanced(mode, count, type, indices, primcount) { + GLctx["drawElementsInstanced"](mode, count, type, indices, primcount); +} + +function _emscripten_glEnable(x0) { + GLctx["enable"](x0); +} + +function _emscripten_glEnableVertexAttribArray(index) { + GLctx.enableVertexAttribArray(index); +} + +function _emscripten_glEndTransformFeedback() { + GLctx["endTransformFeedback"](); +} + +function _emscripten_glFenceSync(condition, flags) { + var sync = GLctx.fenceSync(condition, flags); + if (sync) { + var id = GL.getNewId(GL.syncs); + sync.name = id; + GL.syncs[id] = sync; + return id; + } + return 0; +} + +function _emscripten_glFinish() { + GLctx["finish"](); +} + +function _emscripten_glFramebufferRenderbuffer(target, attachment, renderbuffertarget, renderbuffer) { + GLctx.framebufferRenderbuffer(target, attachment, renderbuffertarget, GL.renderbuffers[renderbuffer]); +} + +function _emscripten_glFramebufferTexture2D(target, attachment, textarget, texture, level) { + GLctx.framebufferTexture2D(target, attachment, textarget, GL.textures[texture], level); +} + +function _emscripten_glFramebufferTextureLayer(target, attachment, texture, level, layer) { + GLctx.framebufferTextureLayer(target, attachment, GL.textures[texture], level, layer); +} + +function _emscripten_glFrontFace(x0) { + GLctx["frontFace"](x0); +} + +function __glGenObject(n, buffers, createFunction, objectTable) { + for (var i = 0; i < n; i++) { + var buffer = GLctx[createFunction](); + var id = buffer && GL.getNewId(objectTable); + if (buffer) { + buffer.name = id; + objectTable[id] = buffer; + } else { + GL.recordError(1282); + } + GROWABLE_HEAP_I32()[buffers + i * 4 >> 2] = id; + } +} + +function _emscripten_glGenBuffers(n, buffers) { + __glGenObject(n, buffers, "createBuffer", GL.buffers); +} + +function _emscripten_glGenFramebuffers(n, ids) { + __glGenObject(n, ids, "createFramebuffer", GL.framebuffers); +} + +function _emscripten_glGenQueries(n, ids) { + __glGenObject(n, ids, "createQuery", GL.queries); +} + +function _emscripten_glGenRenderbuffers(n, renderbuffers) { + __glGenObject(n, renderbuffers, "createRenderbuffer", GL.renderbuffers); +} + +function _emscripten_glGenTextures(n, textures) { + __glGenObject(n, textures, "createTexture", GL.textures); +} + +function _emscripten_glGenVertexArrays(n, arrays) { + __glGenObject(n, arrays, "createVertexArray", GL.vaos); +} + +function _emscripten_glGenerateMipmap(x0) { + GLctx["generateMipmap"](x0); +} + +function readI53FromU64(ptr) { + return GROWABLE_HEAP_U32()[ptr >> 2] + GROWABLE_HEAP_U32()[ptr + 4 >> 2] * 4294967296; +} + +function writeI53ToI64(ptr, num) { + GROWABLE_HEAP_U32()[ptr >> 2] = num; + GROWABLE_HEAP_U32()[ptr + 4 >> 2] = (num - GROWABLE_HEAP_U32()[ptr >> 2]) / 4294967296; + var deserialized = num >= 0 ? readI53FromU64(ptr) : readI53FromI64(ptr); + if (deserialized != num) warnOnce("writeI53ToI64() out of range: serialized JS Number " + num + " to Wasm heap as bytes lo=0x" + GROWABLE_HEAP_U32()[ptr >> 2].toString(16) + ", hi=0x" + GROWABLE_HEAP_U32()[ptr + 4 >> 2].toString(16) + ", which deserializes back to " + deserialized + " instead!"); +} + +function emscriptenWebGLGet(name_, p, type) { + if (!p) { + GL.recordError(1281); + return; + } + var ret = undefined; + switch (name_) { + case 36346: + ret = 1; + break; + + case 36344: + if (type != 0 && type != 1) { + GL.recordError(1280); + } + return; + + case 34814: + case 36345: + ret = 0; + break; + + case 34466: + var formats = GLctx.getParameter(34467); + ret = formats ? formats.length : 0; + break; + + case 33309: + if (GL.currentContext.version < 2) { + GL.recordError(1282); + return; + } + var exts = GLctx.getSupportedExtensions() || []; + ret = 2 * exts.length; + break; + + case 33307: + case 33308: + if (GL.currentContext.version < 2) { + GL.recordError(1280); + return; + } + ret = name_ == 33307 ? 3 : 0; + break; + } + if (ret === undefined) { + var result = GLctx.getParameter(name_); + switch (typeof result) { + case "number": + ret = result; + break; + + case "boolean": + ret = result ? 1 : 0; + break; + + case "string": + GL.recordError(1280); + return; + + case "object": + if (result === null) { + switch (name_) { + case 34964: + case 35725: + case 34965: + case 36006: + case 36007: + case 32873: + case 34229: + case 36662: + case 36663: + case 35053: + case 35055: + case 36010: + case 35097: + case 35869: + case 32874: + case 36389: + case 35983: + case 35368: + case 34068: + { + ret = 0; + break; + } + + default: + { + GL.recordError(1280); + return; + } + } + } else if (result instanceof Float32Array || result instanceof Uint32Array || result instanceof Int32Array || result instanceof Array) { + for (var i = 0; i < result.length; ++i) { + switch (type) { + case 0: + GROWABLE_HEAP_I32()[p + i * 4 >> 2] = result[i]; + break; + + case 2: + GROWABLE_HEAP_F32()[p + i * 4 >> 2] = result[i]; + break; + + case 4: + GROWABLE_HEAP_I8()[p + i >> 0] = result[i] ? 1 : 0; + break; + } + } + return; + } else { + try { + ret = result.name | 0; + } catch (e) { + GL.recordError(1280); + err("GL_INVALID_ENUM in glGet" + type + "v: Unknown object returned from WebGL getParameter(" + name_ + ")! (error: " + e + ")"); + return; + } + } + break; + + default: + GL.recordError(1280); + err("GL_INVALID_ENUM in glGet" + type + "v: Native code calling glGet" + type + "v(" + name_ + ") and it returns " + result + " of type " + typeof result + "!"); + return; + } + } + switch (type) { + case 1: + writeI53ToI64(p, ret); + break; + + case 0: + GROWABLE_HEAP_I32()[p >> 2] = ret; + break; + + case 2: + GROWABLE_HEAP_F32()[p >> 2] = ret; + break; + + case 4: + GROWABLE_HEAP_I8()[p >> 0] = ret ? 1 : 0; + break; + } +} + +function _emscripten_glGetFloatv(name_, p) { + emscriptenWebGLGet(name_, p, 2); +} + +function _emscripten_glGetIntegerv(name_, p) { + emscriptenWebGLGet(name_, p, 0); +} + +function _emscripten_glGetProgramInfoLog(program, maxLength, length, infoLog) { + var log = GLctx.getProgramInfoLog(GL.programs[program]); + if (log === null) log = "(unknown error)"; + var numBytesWrittenExclNull = maxLength > 0 && infoLog ? stringToUTF8(log, infoLog, maxLength) : 0; + if (length) GROWABLE_HEAP_I32()[length >> 2] = numBytesWrittenExclNull; +} + +function _emscripten_glGetProgramiv(program, pname, p) { + if (!p) { + GL.recordError(1281); + return; + } + if (program >= GL.counter) { + GL.recordError(1281); + return; + } + program = GL.programs[program]; + if (pname == 35716) { + var log = GLctx.getProgramInfoLog(program); + if (log === null) log = "(unknown error)"; + GROWABLE_HEAP_I32()[p >> 2] = log.length + 1; + } else if (pname == 35719) { + if (!program.maxUniformLength) { + for (var i = 0; i < GLctx.getProgramParameter(program, 35718); ++i) { + program.maxUniformLength = Math.max(program.maxUniformLength, GLctx.getActiveUniform(program, i).name.length + 1); + } + } + GROWABLE_HEAP_I32()[p >> 2] = program.maxUniformLength; + } else if (pname == 35722) { + if (!program.maxAttributeLength) { + for (var i = 0; i < GLctx.getProgramParameter(program, 35721); ++i) { + program.maxAttributeLength = Math.max(program.maxAttributeLength, GLctx.getActiveAttrib(program, i).name.length + 1); + } + } + GROWABLE_HEAP_I32()[p >> 2] = program.maxAttributeLength; + } else if (pname == 35381) { + if (!program.maxUniformBlockNameLength) { + for (var i = 0; i < GLctx.getProgramParameter(program, 35382); ++i) { + program.maxUniformBlockNameLength = Math.max(program.maxUniformBlockNameLength, GLctx.getActiveUniformBlockName(program, i).length + 1); + } + } + GROWABLE_HEAP_I32()[p >> 2] = program.maxUniformBlockNameLength; + } else { + GROWABLE_HEAP_I32()[p >> 2] = GLctx.getProgramParameter(program, pname); + } +} + +function _emscripten_glGetShaderInfoLog(shader, maxLength, length, infoLog) { + var log = GLctx.getShaderInfoLog(GL.shaders[shader]); + if (log === null) log = "(unknown error)"; + var numBytesWrittenExclNull = maxLength > 0 && infoLog ? stringToUTF8(log, infoLog, maxLength) : 0; + if (length) GROWABLE_HEAP_I32()[length >> 2] = numBytesWrittenExclNull; +} + +function _emscripten_glGetShaderiv(shader, pname, p) { + if (!p) { + GL.recordError(1281); + return; + } + if (pname == 35716) { + var log = GLctx.getShaderInfoLog(GL.shaders[shader]); + if (log === null) log = "(unknown error)"; + var logLength = log ? log.length + 1 : 0; + GROWABLE_HEAP_I32()[p >> 2] = logLength; + } else if (pname == 35720) { + var source = GLctx.getShaderSource(GL.shaders[shader]); + var sourceLength = source ? source.length + 1 : 0; + GROWABLE_HEAP_I32()[p >> 2] = sourceLength; + } else { + GROWABLE_HEAP_I32()[p >> 2] = GLctx.getShaderParameter(GL.shaders[shader], pname); + } +} + +function stringToNewUTF8(jsString) { + var length = lengthBytesUTF8(jsString) + 1; + var cString = _malloc(length); + stringToUTF8(jsString, cString, length); + return cString; +} + +function _emscripten_glGetString(name_) { + var ret = GL.stringCache[name_]; + if (!ret) { + switch (name_) { + case 7939: + var exts = GLctx.getSupportedExtensions() || []; + exts = exts.concat(exts.map(function(e) { + return "GL_" + e; + })); + ret = stringToNewUTF8(exts.join(" ")); + break; + + case 7936: + case 7937: + case 37445: + case 37446: + var s = GLctx.getParameter(name_); + if (!s) { + GL.recordError(1280); + } + ret = s && stringToNewUTF8(s); + break; + + case 7938: + var glVersion = GLctx.getParameter(7938); + if (GL.currentContext.version >= 2) glVersion = "OpenGL ES 3.0 (" + glVersion + ")"; else { + glVersion = "OpenGL ES 2.0 (" + glVersion + ")"; + } + ret = stringToNewUTF8(glVersion); + break; + + case 35724: + var glslVersion = GLctx.getParameter(35724); + var ver_re = /^WebGL GLSL ES ([0-9]\.[0-9][0-9]?)(?:$| .*)/; + var ver_num = glslVersion.match(ver_re); + if (ver_num !== null) { + if (ver_num[1].length == 3) ver_num[1] = ver_num[1] + "0"; + glslVersion = "OpenGL ES GLSL ES " + ver_num[1] + " (" + glslVersion + ")"; + } + ret = stringToNewUTF8(glslVersion); + break; + + default: + GL.recordError(1280); + } + GL.stringCache[name_] = ret; + } + return ret; +} + +function _emscripten_glGetStringi(name, index) { + if (GL.currentContext.version < 2) { + GL.recordError(1282); + return 0; + } + var stringiCache = GL.stringiCache[name]; + if (stringiCache) { + if (index < 0 || index >= stringiCache.length) { + GL.recordError(1281); + return 0; + } + return stringiCache[index]; + } + switch (name) { + case 7939: + var exts = GLctx.getSupportedExtensions() || []; + exts = exts.concat(exts.map(function(e) { + return "GL_" + e; + })); + exts = exts.map(function(e) { + return stringToNewUTF8(e); + }); + stringiCache = GL.stringiCache[name] = exts; + if (index < 0 || index >= stringiCache.length) { + GL.recordError(1281); + return 0; + } + return stringiCache[index]; + + default: + GL.recordError(1280); + return 0; + } +} + +function _emscripten_glGetSynciv(sync, pname, bufSize, length, values) { + if (bufSize < 0) { + GL.recordError(1281); + return; + } + if (!values) { + GL.recordError(1281); + return; + } + var ret = GLctx.getSyncParameter(GL.syncs[sync], pname); + if (ret !== null) { + GROWABLE_HEAP_I32()[values >> 2] = ret; + if (length) GROWABLE_HEAP_I32()[length >> 2] = 1; + } +} + +function _emscripten_glGetUniformBlockIndex(program, uniformBlockName) { + return GLctx["getUniformBlockIndex"](GL.programs[program], UTF8ToString(uniformBlockName)); +} + +function webglGetLeftBracePos(name) { + return name.slice(-1) == "]" && name.lastIndexOf("["); +} + +function webglPrepareUniformLocationsBeforeFirstUse(program) { + var uniformLocsById = program.uniformLocsById, uniformSizeAndIdsByName = program.uniformSizeAndIdsByName, i, j; + if (!uniformLocsById) { + program.uniformLocsById = uniformLocsById = {}; + program.uniformArrayNamesById = {}; + for (i = 0; i < GLctx.getProgramParameter(program, 35718); ++i) { + var u = GLctx.getActiveUniform(program, i); + var nm = u.name; + var sz = u.size; + var lb = webglGetLeftBracePos(nm); + var arrayName = lb > 0 ? nm.slice(0, lb) : nm; + var id = program.uniformIdCounter; + program.uniformIdCounter += sz; + uniformSizeAndIdsByName[arrayName] = [ sz, id ]; + for (j = 0; j < sz; ++j) { + uniformLocsById[id] = j; + program.uniformArrayNamesById[id++] = arrayName; + } + } + } +} + +function _emscripten_glGetUniformLocation(program, name) { + name = UTF8ToString(name); + if (program = GL.programs[program]) { + webglPrepareUniformLocationsBeforeFirstUse(program); + var uniformLocsById = program.uniformLocsById; + var arrayIndex = 0; + var uniformBaseName = name; + var leftBrace = webglGetLeftBracePos(name); + if (leftBrace > 0) { + arrayIndex = jstoi_q(name.slice(leftBrace + 1)) >>> 0; + uniformBaseName = name.slice(0, leftBrace); + } + var sizeAndId = program.uniformSizeAndIdsByName[uniformBaseName]; + if (sizeAndId && arrayIndex < sizeAndId[0]) { + arrayIndex += sizeAndId[1]; + if (uniformLocsById[arrayIndex] = uniformLocsById[arrayIndex] || GLctx.getUniformLocation(program, name)) { + return arrayIndex; + } + } + } else { + GL.recordError(1281); + } + return -1; +} + +function _emscripten_glLinkProgram(program) { + program = GL.programs[program]; + GLctx.linkProgram(program); + program.uniformLocsById = 0; + program.uniformSizeAndIdsByName = {}; +} + +function _emscripten_glPixelStorei(pname, param) { + if (pname == 3317) { + GL.unpackAlignment = param; + } + GLctx.pixelStorei(pname, param); +} + +function _emscripten_glReadBuffer(x0) { + GLctx["readBuffer"](x0); +} + +function computeUnpackAlignedImageSize(width, height, sizePerPixel, alignment) { + function roundedToNextMultipleOf(x, y) { + return x + y - 1 & -y; + } + var plainRowSize = width * sizePerPixel; + var alignedRowSize = roundedToNextMultipleOf(plainRowSize, alignment); + return height * alignedRowSize; +} + +function __colorChannelsInGlTextureFormat(format) { + var colorChannels = { + 5: 3, + 6: 4, + 8: 2, + 29502: 3, + 29504: 4, + 26917: 2, + 26918: 2, + 29846: 3, + 29847: 4 + }; + return colorChannels[format - 6402] || 1; +} + +function heapObjectForWebGLType(type) { + type -= 5120; + if (type == 0) return GROWABLE_HEAP_I8(); + if (type == 1) return GROWABLE_HEAP_U8(); + if (type == 2) return GROWABLE_HEAP_I16(); + if (type == 4) return GROWABLE_HEAP_I32(); + if (type == 6) return GROWABLE_HEAP_F32(); + if (type == 5 || type == 28922 || type == 28520 || type == 30779 || type == 30782) return GROWABLE_HEAP_U32(); + return GROWABLE_HEAP_U16(); +} + +function heapAccessShiftForWebGLHeap(heap) { + return 31 - Math.clz32(heap.BYTES_PER_ELEMENT); +} + +function emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) { + var heap = heapObjectForWebGLType(type); + var shift = heapAccessShiftForWebGLHeap(heap); + var byteSize = 1 << shift; + var sizePerPixel = __colorChannelsInGlTextureFormat(format) * byteSize; + var bytes = computeUnpackAlignedImageSize(width, height, sizePerPixel, GL.unpackAlignment); + return heap.subarray(pixels >> shift, pixels + bytes >> shift); +} + +function _emscripten_glReadPixels(x, y, width, height, format, type, pixels) { + if (GL.currentContext.version >= 2) { + if (GLctx.currentPixelPackBufferBinding) { + GLctx.readPixels(x, y, width, height, format, type, pixels); + } else { + var heap = heapObjectForWebGLType(type); + GLctx.readPixels(x, y, width, height, format, type, heap, pixels >> heapAccessShiftForWebGLHeap(heap)); + } + return; + } + var pixelData = emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, format); + if (!pixelData) { + GL.recordError(1280); + return; + } + GLctx.readPixels(x, y, width, height, format, type, pixelData); +} + +function _emscripten_glRenderbufferStorage(x0, x1, x2, x3) { + GLctx["renderbufferStorage"](x0, x1, x2, x3); +} + +function _emscripten_glScissor(x0, x1, x2, x3) { + GLctx["scissor"](x0, x1, x2, x3); +} + +function _emscripten_glShaderSource(shader, count, string, length) { + var source = GL.getSource(shader, count, string, length); + GLctx.shaderSource(GL.shaders[shader], source); +} + +function _emscripten_glTexImage2D(target, level, internalFormat, width, height, border, format, type, pixels) { + if (GL.currentContext.version >= 2) { + if (GLctx.currentPixelUnpackBufferBinding) { + GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixels); + } else if (pixels) { + var heap = heapObjectForWebGLType(type); + GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, heap, pixels >> heapAccessShiftForWebGLHeap(heap)); + } else { + GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, null); + } + return; + } + GLctx.texImage2D(target, level, internalFormat, width, height, border, format, type, pixels ? emscriptenWebGLGetTexPixelData(type, format, width, height, pixels, internalFormat) : null); +} + +function _emscripten_glTexImage3D(target, level, internalFormat, width, height, depth, border, format, type, pixels) { + if (GLctx.currentPixelUnpackBufferBinding) { + GLctx["texImage3D"](target, level, internalFormat, width, height, depth, border, format, type, pixels); + } else if (pixels) { + var heap = heapObjectForWebGLType(type); + GLctx["texImage3D"](target, level, internalFormat, width, height, depth, border, format, type, heap, pixels >> heapAccessShiftForWebGLHeap(heap)); + } else { + GLctx["texImage3D"](target, level, internalFormat, width, height, depth, border, format, type, null); + } +} + +function _emscripten_glTexParameterf(x0, x1, x2) { + GLctx["texParameterf"](x0, x1, x2); +} + +function _emscripten_glTexParameteri(x0, x1, x2) { + GLctx["texParameteri"](x0, x1, x2); +} + +function _emscripten_glTexStorage2D(x0, x1, x2, x3, x4) { + GLctx["texStorage2D"](x0, x1, x2, x3, x4); +} + +function _emscripten_glTexSubImage3D(target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, pixels) { + if (GLctx.currentPixelUnpackBufferBinding) { + GLctx["texSubImage3D"](target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, pixels); + } else if (pixels) { + var heap = heapObjectForWebGLType(type); + GLctx["texSubImage3D"](target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, heap, pixels >> heapAccessShiftForWebGLHeap(heap)); + } else { + GLctx["texSubImage3D"](target, level, xoffset, yoffset, zoffset, width, height, depth, format, type, null); + } +} + +function _emscripten_glTransformFeedbackVaryings(program, count, varyings, bufferMode) { + program = GL.programs[program]; + var vars = []; + for (var i = 0; i < count; i++) vars.push(UTF8ToString(GROWABLE_HEAP_I32()[varyings + i * 4 >> 2])); + GLctx["transformFeedbackVaryings"](program, vars, bufferMode); +} + +function webglGetUniformLocation(location) { + var p = GLctx.currentProgram; + if (p) { + var webglLoc = p.uniformLocsById[location]; + if (typeof webglLoc == "number") { + p.uniformLocsById[location] = webglLoc = GLctx.getUniformLocation(p, p.uniformArrayNamesById[location] + (webglLoc > 0 ? "[" + webglLoc + "]" : "")); + } + return webglLoc; + } else { + GL.recordError(1282); + } +} + +function _emscripten_glUniform1f(location, v0) { + GLctx.uniform1f(webglGetUniformLocation(location), v0); +} + +function _emscripten_glUniform1i(location, v0) { + GLctx.uniform1i(webglGetUniformLocation(location), v0); +} + +var __miniTempWebGLIntBuffers = []; + +function _emscripten_glUniform1iv(location, count, value) { + if (GL.currentContext.version >= 2) { + count && GLctx.uniform1iv(webglGetUniformLocation(location), GROWABLE_HEAP_I32(), value >> 2, count); + return; + } + if (count <= 288) { + var view = __miniTempWebGLIntBuffers[count - 1]; + for (var i = 0; i < count; ++i) { + view[i] = GROWABLE_HEAP_I32()[value + 4 * i >> 2]; + } + } else { + var view = GROWABLE_HEAP_I32().subarray(value >> 2, value + count * 4 >> 2); + } + GLctx.uniform1iv(webglGetUniformLocation(location), view); +} + +function _emscripten_glUniform1ui(location, v0) { + GLctx.uniform1ui(webglGetUniformLocation(location), v0); +} + +function _emscripten_glUniform1uiv(location, count, value) { + count && GLctx.uniform1uiv(webglGetUniformLocation(location), GROWABLE_HEAP_U32(), value >> 2, count); +} + +function _emscripten_glUniform2f(location, v0, v1) { + GLctx.uniform2f(webglGetUniformLocation(location), v0, v1); +} + +var miniTempWebGLFloatBuffers = []; + +function _emscripten_glUniform2fv(location, count, value) { + if (GL.currentContext.version >= 2) { + count && GLctx.uniform2fv(webglGetUniformLocation(location), GROWABLE_HEAP_F32(), value >> 2, count * 2); + return; + } + if (count <= 144) { + var view = miniTempWebGLFloatBuffers[2 * count - 1]; + for (var i = 0; i < 2 * count; i += 2) { + view[i] = GROWABLE_HEAP_F32()[value + 4 * i >> 2]; + view[i + 1] = GROWABLE_HEAP_F32()[value + (4 * i + 4) >> 2]; + } + } else { + var view = GROWABLE_HEAP_F32().subarray(value >> 2, value + count * 8 >> 2); + } + GLctx.uniform2fv(webglGetUniformLocation(location), view); +} + +function _emscripten_glUniform2iv(location, count, value) { + if (GL.currentContext.version >= 2) { + count && GLctx.uniform2iv(webglGetUniformLocation(location), GROWABLE_HEAP_I32(), value >> 2, count * 2); + return; + } + if (count <= 144) { + var view = __miniTempWebGLIntBuffers[2 * count - 1]; + for (var i = 0; i < 2 * count; i += 2) { + view[i] = GROWABLE_HEAP_I32()[value + 4 * i >> 2]; + view[i + 1] = GROWABLE_HEAP_I32()[value + (4 * i + 4) >> 2]; + } + } else { + var view = GROWABLE_HEAP_I32().subarray(value >> 2, value + count * 8 >> 2); + } + GLctx.uniform2iv(webglGetUniformLocation(location), view); +} + +function _emscripten_glUniform3fv(location, count, value) { + if (GL.currentContext.version >= 2) { + count && GLctx.uniform3fv(webglGetUniformLocation(location), GROWABLE_HEAP_F32(), value >> 2, count * 3); + return; + } + if (count <= 96) { + var view = miniTempWebGLFloatBuffers[3 * count - 1]; + for (var i = 0; i < 3 * count; i += 3) { + view[i] = GROWABLE_HEAP_F32()[value + 4 * i >> 2]; + view[i + 1] = GROWABLE_HEAP_F32()[value + (4 * i + 4) >> 2]; + view[i + 2] = GROWABLE_HEAP_F32()[value + (4 * i + 8) >> 2]; + } + } else { + var view = GROWABLE_HEAP_F32().subarray(value >> 2, value + count * 12 >> 2); + } + GLctx.uniform3fv(webglGetUniformLocation(location), view); +} + +function _emscripten_glUniform4f(location, v0, v1, v2, v3) { + GLctx.uniform4f(webglGetUniformLocation(location), v0, v1, v2, v3); +} + +function _emscripten_glUniform4fv(location, count, value) { + if (GL.currentContext.version >= 2) { + count && GLctx.uniform4fv(webglGetUniformLocation(location), GROWABLE_HEAP_F32(), value >> 2, count * 4); + return; + } + if (count <= 72) { + var view = miniTempWebGLFloatBuffers[4 * count - 1]; + var heap = GROWABLE_HEAP_F32(); + value >>= 2; + for (var i = 0; i < 4 * count; i += 4) { + var dst = value + i; + view[i] = heap[dst]; + view[i + 1] = heap[dst + 1]; + view[i + 2] = heap[dst + 2]; + view[i + 3] = heap[dst + 3]; + } + } else { + var view = GROWABLE_HEAP_F32().subarray(value >> 2, value + count * 16 >> 2); + } + GLctx.uniform4fv(webglGetUniformLocation(location), view); +} + +function _emscripten_glUniformBlockBinding(program, uniformBlockIndex, uniformBlockBinding) { + program = GL.programs[program]; + GLctx["uniformBlockBinding"](program, uniformBlockIndex, uniformBlockBinding); +} + +function _emscripten_glUniformMatrix4fv(location, count, transpose, value) { + if (GL.currentContext.version >= 2) { + count && GLctx.uniformMatrix4fv(webglGetUniformLocation(location), !!transpose, GROWABLE_HEAP_F32(), value >> 2, count * 16); + return; + } + if (count <= 18) { + var view = miniTempWebGLFloatBuffers[16 * count - 1]; + var heap = GROWABLE_HEAP_F32(); + value >>= 2; + for (var i = 0; i < 16 * count; i += 16) { + var dst = value + i; + view[i] = heap[dst]; + view[i + 1] = heap[dst + 1]; + view[i + 2] = heap[dst + 2]; + view[i + 3] = heap[dst + 3]; + view[i + 4] = heap[dst + 4]; + view[i + 5] = heap[dst + 5]; + view[i + 6] = heap[dst + 6]; + view[i + 7] = heap[dst + 7]; + view[i + 8] = heap[dst + 8]; + view[i + 9] = heap[dst + 9]; + view[i + 10] = heap[dst + 10]; + view[i + 11] = heap[dst + 11]; + view[i + 12] = heap[dst + 12]; + view[i + 13] = heap[dst + 13]; + view[i + 14] = heap[dst + 14]; + view[i + 15] = heap[dst + 15]; + } + } else { + var view = GROWABLE_HEAP_F32().subarray(value >> 2, value + count * 64 >> 2); + } + GLctx.uniformMatrix4fv(webglGetUniformLocation(location), !!transpose, view); +} + +function _emscripten_glUseProgram(program) { + program = GL.programs[program]; + GLctx.useProgram(program); + GLctx.currentProgram = program; +} + +function _emscripten_glVertexAttrib4f(x0, x1, x2, x3, x4) { + GLctx["vertexAttrib4f"](x0, x1, x2, x3, x4); +} + +function _emscripten_glVertexAttribDivisor(index, divisor) { + GLctx["vertexAttribDivisor"](index, divisor); +} + +function _emscripten_glVertexAttribIPointer(index, size, type, stride, ptr) { + GLctx["vertexAttribIPointer"](index, size, type, stride, ptr); +} + +function _emscripten_glVertexAttribPointer(index, size, type, normalized, stride, ptr) { + GLctx.vertexAttribPointer(index, size, type, !!normalized, stride, ptr); +} + +function _emscripten_glViewport(x0, x1, x2, x3) { + GLctx["viewport"](x0, x1, x2, x3); +} + +function _emscripten_memcpy_big(dest, src, num) { + GROWABLE_HEAP_U8().copyWithin(dest, src, src + num); +} + +function _emscripten_num_logical_cores() { + return navigator["hardwareConcurrency"]; +} + +function _emscripten_proxy_to_main_thread_js(index, sync) { + var numCallArgs = arguments.length - 2; + var outerArgs = arguments; + if (numCallArgs > 20 - 1) throw "emscripten_proxy_to_main_thread_js: Too many arguments " + numCallArgs + " to proxied function idx=" + index + ", maximum supported is " + (20 - 1) + "!"; + return withStackSave(function() { + var serializedNumCallArgs = numCallArgs; + var args = stackAlloc(serializedNumCallArgs * 8); + var b = args >> 3; + for (var i = 0; i < numCallArgs; i++) { + var arg = outerArgs[2 + i]; + GROWABLE_HEAP_F64()[b + i] = arg; + } + return _emscripten_run_in_main_runtime_thread_js(index, serializedNumCallArgs, args, sync); + }); +} + +var _emscripten_receive_on_main_thread_js_callArgs = []; + +function _emscripten_receive_on_main_thread_js(index, numCallArgs, args) { + _emscripten_receive_on_main_thread_js_callArgs.length = numCallArgs; + var b = args >> 3; + for (var i = 0; i < numCallArgs; i++) { + _emscripten_receive_on_main_thread_js_callArgs[i] = GROWABLE_HEAP_F64()[b + i]; + } + var isEmAsmConst = index < 0; + var func = !isEmAsmConst ? proxiedFunctionTable[index] : ASM_CONSTS[-index - 1]; + assert(func.length == numCallArgs, "Call args mismatch in emscripten_receive_on_main_thread_js"); + return func.apply(null, _emscripten_receive_on_main_thread_js_callArgs); +} + +function getHeapMax() { + return 2147483648; +} + +function emscripten_realloc_buffer(size) { + try { + wasmMemory.grow(size - buffer.byteLength + 65535 >>> 16); + updateGlobalBufferAndViews(wasmMemory.buffer); + return 1; + } catch (e) { + err("emscripten_realloc_buffer: Attempted to grow heap from " + buffer.byteLength + " bytes to " + size + " bytes, but got error: " + e); + } +} + +function _emscripten_resize_heap(requestedSize) { + var oldSize = GROWABLE_HEAP_U8().length; + requestedSize = requestedSize >>> 0; + if (requestedSize <= oldSize) { + return false; + } + var maxHeapSize = getHeapMax(); + if (requestedSize > maxHeapSize) { + err("Cannot enlarge memory, asked to go up to " + requestedSize + " bytes, but the limit is " + maxHeapSize + " bytes!"); + return false; + } + let alignUp = (x, multiple) => x + (multiple - x % multiple) % multiple; + for (var cutDown = 1; cutDown <= 4; cutDown *= 2) { + var overGrownHeapSize = oldSize * (1 + .2 / cutDown); + overGrownHeapSize = Math.min(overGrownHeapSize, requestedSize + 100663296); + var newSize = Math.min(maxHeapSize, alignUp(Math.max(requestedSize, overGrownHeapSize), 65536)); + var replacement = emscripten_realloc_buffer(newSize); + if (replacement) { + return true; + } + } + err("Failed to grow the heap from " + oldSize + " bytes to " + newSize + " bytes, not enough memory!"); + return false; +} + +function _emscripten_set_main_loop(func, fps, simulateInfiniteLoop) { + var browserIterationFunc = getWasmTableEntry(func); + setMainLoop(browserIterationFunc, fps, simulateInfiniteLoop); +} + +function _emscripten_supports_offscreencanvas() { + return 0; +} + +function _emscripten_unwind_to_js_event_loop() { + throw "unwind"; +} + +function _emscripten_webgl_destroy_context(contextHandle) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(38, 1, contextHandle); + if (GL.currentContext == contextHandle) GL.currentContext = 0; + GL.deleteContext(contextHandle); +} + +function _emscripten_webgl_do_commit_frame() { + if (!GL.currentContext || !GL.currentContext.GLctx) { + return -3; + } + if (GL.currentContext.defaultFbo) { + GL.blitOffscreenFramebuffer(GL.currentContext); + return 0; + } + if (!GL.currentContext.attributes.explicitSwapControl) { + return -3; + } + return 0; +} + +function _emscripten_webgl_create_context_proxied(target, attributes) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(39, 1, target, attributes); + return _emscripten_webgl_do_create_context(target, attributes); +} + +var JSEvents = { + inEventHandler: 0, + removeAllEventListeners: function() { + for (var i = JSEvents.eventHandlers.length - 1; i >= 0; --i) { + JSEvents._removeHandler(i); + } + JSEvents.eventHandlers = []; + JSEvents.deferredCalls = []; + }, + registerRemoveEventListeners: function() { + if (!JSEvents.removeEventListenersRegistered) { + __ATEXIT__.push(JSEvents.removeAllEventListeners); + JSEvents.removeEventListenersRegistered = true; + } + }, + deferredCalls: [], + deferCall: function(targetFunction, precedence, argsList) { + function arraysHaveEqualContent(arrA, arrB) { + if (arrA.length != arrB.length) return false; + for (var i in arrA) { + if (arrA[i] != arrB[i]) return false; + } + return true; + } + for (var i in JSEvents.deferredCalls) { + var call = JSEvents.deferredCalls[i]; + if (call.targetFunction == targetFunction && arraysHaveEqualContent(call.argsList, argsList)) { + return; + } + } + JSEvents.deferredCalls.push({ + targetFunction: targetFunction, + precedence: precedence, + argsList: argsList + }); + JSEvents.deferredCalls.sort(function(x, y) { + return x.precedence < y.precedence; + }); + }, + removeDeferredCalls: function(targetFunction) { + for (var i = 0; i < JSEvents.deferredCalls.length; ++i) { + if (JSEvents.deferredCalls[i].targetFunction == targetFunction) { + JSEvents.deferredCalls.splice(i, 1); + --i; + } + } + }, + canPerformEventHandlerRequests: function() { + return JSEvents.inEventHandler && JSEvents.currentEventHandler.allowsDeferredCalls; + }, + runDeferredCalls: function() { + if (!JSEvents.canPerformEventHandlerRequests()) { + return; + } + for (var i = 0; i < JSEvents.deferredCalls.length; ++i) { + var call = JSEvents.deferredCalls[i]; + JSEvents.deferredCalls.splice(i, 1); + --i; + call.targetFunction.apply(null, call.argsList); + } + }, + eventHandlers: [], + removeAllHandlersOnTarget: function(target, eventTypeString) { + for (var i = 0; i < JSEvents.eventHandlers.length; ++i) { + if (JSEvents.eventHandlers[i].target == target && (!eventTypeString || eventTypeString == JSEvents.eventHandlers[i].eventTypeString)) { + JSEvents._removeHandler(i--); + } + } + }, + _removeHandler: function(i) { + var h = JSEvents.eventHandlers[i]; + h.target.removeEventListener(h.eventTypeString, h.eventListenerFunc, h.useCapture); + JSEvents.eventHandlers.splice(i, 1); + }, + registerOrRemoveHandler: function(eventHandler) { + var jsEventHandler = function jsEventHandler(event) { + ++JSEvents.inEventHandler; + JSEvents.currentEventHandler = eventHandler; + JSEvents.runDeferredCalls(); + eventHandler.handlerFunc(event); + JSEvents.runDeferredCalls(); + --JSEvents.inEventHandler; + }; + if (eventHandler.callbackfunc) { + eventHandler.eventListenerFunc = jsEventHandler; + eventHandler.target.addEventListener(eventHandler.eventTypeString, jsEventHandler, eventHandler.useCapture); + JSEvents.eventHandlers.push(eventHandler); + JSEvents.registerRemoveEventListeners(); + } else { + for (var i = 0; i < JSEvents.eventHandlers.length; ++i) { + if (JSEvents.eventHandlers[i].target == eventHandler.target && JSEvents.eventHandlers[i].eventTypeString == eventHandler.eventTypeString) { + JSEvents._removeHandler(i--); + } + } + } + }, + queueEventHandlerOnThread_iiii: function(targetThread, eventHandlerFunc, eventTypeId, eventData, userData) { + withStackSave(function() { + var varargs = stackAlloc(12); + GROWABLE_HEAP_I32()[varargs >> 2] = eventTypeId; + GROWABLE_HEAP_I32()[varargs + 4 >> 2] = eventData; + GROWABLE_HEAP_I32()[varargs + 8 >> 2] = userData; + _emscripten_dispatch_to_thread_(targetThread, 637534208, eventHandlerFunc, eventData, varargs); + }); + }, + getTargetThreadForEventCallback: function(targetThread) { + switch (targetThread) { + case 1: + return 0; + + case 2: + return PThread.currentProxiedOperationCallerThread; + + default: + return targetThread; + } + }, + getNodeNameForTarget: function(target) { + if (!target) return ""; + if (target == window) return "#window"; + if (target == screen) return "#screen"; + return target && target.nodeName ? target.nodeName : ""; + }, + fullscreenEnabled: function() { + return document.fullscreenEnabled || document.webkitFullscreenEnabled; + } +}; + +var __emscripten_webgl_power_preferences = [ "default", "low-power", "high-performance" ]; + +function maybeCStringToJsString(cString) { + return cString > 2 ? UTF8ToString(cString) : cString; +} + +var specialHTMLTargets = [ 0, typeof document != "undefined" ? document : 0, typeof window != "undefined" ? window : 0 ]; + +function findEventTarget(target) { + target = maybeCStringToJsString(target); + var domElement = specialHTMLTargets[target] || (typeof document != "undefined" ? document.querySelector(target) : undefined); + return domElement; +} + +function findCanvasEventTarget(target) { + return findEventTarget(target); +} + +function _emscripten_webgl_do_create_context(target, attributes) { + assert(attributes); + var a = attributes >> 2; + var powerPreference = GROWABLE_HEAP_I32()[a + (24 >> 2)]; + var contextAttributes = { + "alpha": !!GROWABLE_HEAP_I32()[a + (0 >> 2)], + "depth": !!GROWABLE_HEAP_I32()[a + (4 >> 2)], + "stencil": !!GROWABLE_HEAP_I32()[a + (8 >> 2)], + "antialias": !!GROWABLE_HEAP_I32()[a + (12 >> 2)], + "premultipliedAlpha": !!GROWABLE_HEAP_I32()[a + (16 >> 2)], + "preserveDrawingBuffer": !!GROWABLE_HEAP_I32()[a + (20 >> 2)], + "powerPreference": __emscripten_webgl_power_preferences[powerPreference], + "failIfMajorPerformanceCaveat": !!GROWABLE_HEAP_I32()[a + (28 >> 2)], + majorVersion: GROWABLE_HEAP_I32()[a + (32 >> 2)], + minorVersion: GROWABLE_HEAP_I32()[a + (36 >> 2)], + enableExtensionsByDefault: GROWABLE_HEAP_I32()[a + (40 >> 2)], + explicitSwapControl: GROWABLE_HEAP_I32()[a + (44 >> 2)], + proxyContextToMainThread: GROWABLE_HEAP_I32()[a + (48 >> 2)], + renderViaOffscreenBackBuffer: GROWABLE_HEAP_I32()[a + (52 >> 2)] + }; + var canvas = findCanvasEventTarget(target); + if (ENVIRONMENT_IS_PTHREAD) { + if (contextAttributes.proxyContextToMainThread === 2 || !canvas && contextAttributes.proxyContextToMainThread === 1) { + if (typeof OffscreenCanvas == "undefined") { + GROWABLE_HEAP_I32()[attributes + 52 >> 2] = 1; + GROWABLE_HEAP_I32()[attributes + 20 >> 2] = 1; + } + return _emscripten_webgl_create_context_proxied(target, attributes); + } + } + if (!canvas) { + return 0; + } + if (contextAttributes.explicitSwapControl && !contextAttributes.renderViaOffscreenBackBuffer) { + contextAttributes.renderViaOffscreenBackBuffer = true; + } + var contextHandle = GL.createContext(canvas, contextAttributes); + return contextHandle; +} + +function _emscripten_webgl_enable_extension(contextHandle, extension) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(40, 1, contextHandle, extension); + var context = GL.getContext(contextHandle); + var extString = UTF8ToString(extension); + if (extString.startsWith("GL_")) extString = extString.substr(3); + if (extString == "ANGLE_instanced_arrays") __webgl_enable_ANGLE_instanced_arrays(GLctx); + if (extString == "OES_vertex_array_object") __webgl_enable_OES_vertex_array_object(GLctx); + if (extString == "WEBGL_draw_buffers") __webgl_enable_WEBGL_draw_buffers(GLctx); + if (extString == "WEBGL_draw_instanced_base_vertex_base_instance") __webgl_enable_WEBGL_draw_instanced_base_vertex_base_instance(GLctx); + if (extString == "WEBGL_multi_draw_instanced_base_vertex_base_instance") __webgl_enable_WEBGL_multi_draw_instanced_base_vertex_base_instance(GLctx); + if (extString == "WEBGL_multi_draw") __webgl_enable_WEBGL_multi_draw(GLctx); + var ext = context.GLctx.getExtension(extString); + return !!ext; +} + +function _emscripten_webgl_init_context_attributes(attributes) { + assert(attributes); + var a = attributes >> 2; + for (var i = 0; i < 56 >> 2; ++i) { + GROWABLE_HEAP_I32()[a + i] = 0; + } + GROWABLE_HEAP_I32()[a + (0 >> 2)] = GROWABLE_HEAP_I32()[a + (4 >> 2)] = GROWABLE_HEAP_I32()[a + (12 >> 2)] = GROWABLE_HEAP_I32()[a + (16 >> 2)] = GROWABLE_HEAP_I32()[a + (32 >> 2)] = GROWABLE_HEAP_I32()[a + (40 >> 2)] = 1; + if (ENVIRONMENT_IS_WORKER) GROWABLE_HEAP_I32()[attributes + 48 >> 2] = 1; +} + +function _emscripten_webgl_make_context_current_calling_thread(contextHandle) { + var success = GL.makeContextCurrent(contextHandle); + if (success) GL.currentContextIsProxied = false; + return success ? 0 : -5; +} + +var ENV = {}; + +function getExecutableName() { + return thisProgram || "./this.program"; +} + +function getEnvStrings() { + if (!getEnvStrings.strings) { + var lang = (typeof navigator == "object" && navigator.languages && navigator.languages[0] || "C").replace("-", "_") + ".UTF-8"; + var env = { + "USER": "web_user", + "LOGNAME": "web_user", + "PATH": "/", + "PWD": "/", + "HOME": "/home/web_user", + "LANG": lang, + "_": getExecutableName() + }; + for (var x in ENV) { + if (ENV[x] === undefined) delete env[x]; else env[x] = ENV[x]; + } + var strings = []; + for (var x in env) { + strings.push(x + "=" + env[x]); + } + getEnvStrings.strings = strings; + } + return getEnvStrings.strings; +} + +function writeAsciiToMemory(str, buffer, dontAddNull) { + for (var i = 0; i < str.length; ++i) { + assert(str.charCodeAt(i) === (str.charCodeAt(i) & 255)); + GROWABLE_HEAP_I8()[buffer++ >> 0] = str.charCodeAt(i); + } + if (!dontAddNull) GROWABLE_HEAP_I8()[buffer >> 0] = 0; +} + +function _environ_get(__environ, environ_buf) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(41, 1, __environ, environ_buf); + var bufSize = 0; + getEnvStrings().forEach(function(string, i) { + var ptr = environ_buf + bufSize; + GROWABLE_HEAP_U32()[__environ + i * 4 >> 2] = ptr; + writeAsciiToMemory(string, ptr); + bufSize += string.length + 1; + }); + return 0; +} + +function _environ_sizes_get(penviron_count, penviron_buf_size) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(42, 1, penviron_count, penviron_buf_size); + var strings = getEnvStrings(); + GROWABLE_HEAP_U32()[penviron_count >> 2] = strings.length; + var bufSize = 0; + strings.forEach(function(string) { + bufSize += string.length + 1; + }); + GROWABLE_HEAP_U32()[penviron_buf_size >> 2] = bufSize; + return 0; +} + +function _fd_close(fd) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(43, 1, fd); + try { + var stream = SYSCALLS.getStreamFromFD(fd); + FS.close(stream); + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return e.errno; + } +} + +function _fd_fdstat_get(fd, pbuf) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(44, 1, fd, pbuf); + try { + var stream = SYSCALLS.getStreamFromFD(fd); + var type = stream.tty ? 2 : FS.isDir(stream.mode) ? 3 : FS.isLink(stream.mode) ? 7 : 4; + GROWABLE_HEAP_I8()[pbuf >> 0] = type; + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return e.errno; + } +} + +function doReadv(stream, iov, iovcnt, offset) { + var ret = 0; + for (var i = 0; i < iovcnt; i++) { + var ptr = GROWABLE_HEAP_U32()[iov >> 2]; + var len = GROWABLE_HEAP_U32()[iov + 4 >> 2]; + iov += 8; + var curr = FS.read(stream, GROWABLE_HEAP_I8(), ptr, len, offset); + if (curr < 0) return -1; + ret += curr; + if (curr < len) break; + } + return ret; +} + +function _fd_read(fd, iov, iovcnt, pnum) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(45, 1, fd, iov, iovcnt, pnum); + try { + var stream = SYSCALLS.getStreamFromFD(fd); + var num = doReadv(stream, iov, iovcnt); + GROWABLE_HEAP_I32()[pnum >> 2] = num; + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return e.errno; + } +} + +function convertI32PairToI53Checked(lo, hi) { + assert(lo == lo >>> 0 || lo == (lo | 0)); + assert(hi === (hi | 0)); + return hi + 2097152 >>> 0 < 4194305 - !!lo ? (lo >>> 0) + hi * 4294967296 : NaN; +} + +function _fd_seek(fd, offset_low, offset_high, whence, newOffset) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(46, 1, fd, offset_low, offset_high, whence, newOffset); + try { + var offset = convertI32PairToI53Checked(offset_low, offset_high); + if (isNaN(offset)) return 61; + var stream = SYSCALLS.getStreamFromFD(fd); + FS.llseek(stream, offset, whence); + tempI64 = [ stream.position >>> 0, (tempDouble = stream.position, +Math.abs(tempDouble) >= 1 ? tempDouble > 0 ? (Math.min(+Math.floor(tempDouble / 4294967296), 4294967295) | 0) >>> 0 : ~~+Math.ceil((tempDouble - +(~~tempDouble >>> 0)) / 4294967296) >>> 0 : 0) ], + GROWABLE_HEAP_I32()[newOffset >> 2] = tempI64[0], GROWABLE_HEAP_I32()[newOffset + 4 >> 2] = tempI64[1]; + if (stream.getdents && offset === 0 && whence === 0) stream.getdents = null; + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return e.errno; + } +} + +function doWritev(stream, iov, iovcnt, offset) { + var ret = 0; + for (var i = 0; i < iovcnt; i++) { + var ptr = GROWABLE_HEAP_U32()[iov >> 2]; + var len = GROWABLE_HEAP_U32()[iov + 4 >> 2]; + iov += 8; + var curr = FS.write(stream, GROWABLE_HEAP_I8(), ptr, len, offset); + if (curr < 0) return -1; + ret += curr; + } + return ret; +} + +function _fd_write(fd, iov, iovcnt, pnum) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(47, 1, fd, iov, iovcnt, pnum); + try { + var stream = SYSCALLS.getStreamFromFD(fd); + var num = doWritev(stream, iov, iovcnt); + GROWABLE_HEAP_U32()[pnum >> 2] = num; + return 0; + } catch (e) { + if (typeof FS == "undefined" || !(e instanceof FS.ErrnoError)) throw e; + return e.errno; + } +} + +function _getTempRet0() { + return getTempRet0(); +} + +function _getaddrinfo(node, service, hint, out) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(48, 1, node, service, hint, out); + var addrs = []; + var canon = null; + var addr = 0; + var port = 0; + var flags = 0; + var family = 0; + var type = 0; + var proto = 0; + var ai, last; + function allocaddrinfo(family, type, proto, canon, addr, port) { + var sa, salen, ai; + var errno; + salen = family === 10 ? 28 : 16; + addr = family === 10 ? inetNtop6(addr) : inetNtop4(addr); + sa = _malloc(salen); + errno = writeSockaddr(sa, family, addr, port); + assert(!errno); + ai = _malloc(32); + GROWABLE_HEAP_I32()[ai + 4 >> 2] = family; + GROWABLE_HEAP_I32()[ai + 8 >> 2] = type; + GROWABLE_HEAP_I32()[ai + 12 >> 2] = proto; + GROWABLE_HEAP_I32()[ai + 24 >> 2] = canon; + GROWABLE_HEAP_U32()[ai + 20 >> 2] = sa; + if (family === 10) { + GROWABLE_HEAP_I32()[ai + 16 >> 2] = 28; + } else { + GROWABLE_HEAP_I32()[ai + 16 >> 2] = 16; + } + GROWABLE_HEAP_I32()[ai + 28 >> 2] = 0; + return ai; + } + if (hint) { + flags = GROWABLE_HEAP_I32()[hint >> 2]; + family = GROWABLE_HEAP_I32()[hint + 4 >> 2]; + type = GROWABLE_HEAP_I32()[hint + 8 >> 2]; + proto = GROWABLE_HEAP_I32()[hint + 12 >> 2]; + } + if (type && !proto) { + proto = type === 2 ? 17 : 6; + } + if (!type && proto) { + type = proto === 17 ? 2 : 1; + } + if (proto === 0) { + proto = 6; + } + if (type === 0) { + type = 1; + } + if (!node && !service) { + return -2; + } + if (flags & ~(1 | 2 | 4 | 1024 | 8 | 16 | 32)) { + return -1; + } + if (hint !== 0 && GROWABLE_HEAP_I32()[hint >> 2] & 2 && !node) { + return -1; + } + if (flags & 32) { + return -2; + } + if (type !== 0 && type !== 1 && type !== 2) { + return -7; + } + if (family !== 0 && family !== 2 && family !== 10) { + return -6; + } + if (service) { + service = UTF8ToString(service); + port = parseInt(service, 10); + if (isNaN(port)) { + if (flags & 1024) { + return -2; + } + return -8; + } + } + if (!node) { + if (family === 0) { + family = 2; + } + if ((flags & 1) === 0) { + if (family === 2) { + addr = _htonl(2130706433); + } else { + addr = [ 0, 0, 0, 1 ]; + } + } + ai = allocaddrinfo(family, type, proto, null, addr, port); + GROWABLE_HEAP_U32()[out >> 2] = ai; + return 0; + } + node = UTF8ToString(node); + addr = inetPton4(node); + if (addr !== null) { + if (family === 0 || family === 2) { + family = 2; + } else if (family === 10 && flags & 8) { + addr = [ 0, 0, _htonl(65535), addr ]; + family = 10; + } else { + return -2; + } + } else { + addr = inetPton6(node); + if (addr !== null) { + if (family === 0 || family === 10) { + family = 10; + } else { + return -2; + } + } + } + if (addr != null) { + ai = allocaddrinfo(family, type, proto, node, addr, port); + GROWABLE_HEAP_U32()[out >> 2] = ai; + return 0; + } + if (flags & 4) { + return -2; + } + node = DNS.lookup_name(node); + addr = inetPton4(node); + if (family === 0) { + family = 2; + } else if (family === 10) { + addr = [ 0, 0, _htonl(65535), addr ]; + } + ai = allocaddrinfo(family, type, proto, null, addr, port); + GROWABLE_HEAP_U32()[out >> 2] = ai; + return 0; +} + +function _getnameinfo(sa, salen, node, nodelen, serv, servlen, flags) { + var info = readSockaddr(sa, salen); + if (info.errno) { + return -6; + } + var port = info.port; + var addr = info.addr; + var overflowed = false; + if (node && nodelen) { + var lookup; + if (flags & 1 || !(lookup = DNS.lookup_addr(addr))) { + if (flags & 8) { + return -2; + } + } else { + addr = lookup; + } + var numBytesWrittenExclNull = stringToUTF8(addr, node, nodelen); + if (numBytesWrittenExclNull + 1 >= nodelen) { + overflowed = true; + } + } + if (serv && servlen) { + port = "" + port; + var numBytesWrittenExclNull = stringToUTF8(port, serv, servlen); + if (numBytesWrittenExclNull + 1 >= servlen) { + overflowed = true; + } + } + if (overflowed) { + return -12; + } + return 0; +} + +function _glGetBufferSubData(target, offset, size, data) { + if (!data) { + GL.recordError(1281); + return; + } + size && GLctx["getBufferSubData"](target, offset, GROWABLE_HEAP_U8(), data, size); +} + +var GodotRuntime = { + get_func: function(ptr) { + return wasmTable.get(ptr); + }, + error: function() { + err.apply(null, Array.from(arguments)); + }, + print: function() { + out.apply(null, Array.from(arguments)); + }, + malloc: function(p_size) { + return _malloc(p_size); + }, + free: function(p_ptr) { + _free(p_ptr); + }, + getHeapValue: function(p_ptr, p_type) { + return getValue(p_ptr, p_type); + }, + setHeapValue: function(p_ptr, p_value, p_type) { + setValue(p_ptr, p_value, p_type); + }, + heapSub: function(p_heap, p_ptr, p_len) { + const bytes = p_heap.BYTES_PER_ELEMENT; + return p_heap.subarray(p_ptr / bytes, p_ptr / bytes + p_len); + }, + heapSlice: function(p_heap, p_ptr, p_len) { + const bytes = p_heap.BYTES_PER_ELEMENT; + return p_heap.slice(p_ptr / bytes, p_ptr / bytes + p_len); + }, + heapCopy: function(p_dst, p_src, p_ptr) { + const bytes = p_src.BYTES_PER_ELEMENT; + return p_dst.set(p_src, p_ptr / bytes); + }, + parseString: function(p_ptr) { + return UTF8ToString(p_ptr); + }, + parseStringArray: function(p_ptr, p_size) { + const strings = []; + const ptrs = GodotRuntime.heapSub(GROWABLE_HEAP_I32(), p_ptr, p_size); + ptrs.forEach(function(ptr) { + strings.push(GodotRuntime.parseString(ptr)); + }); + return strings; + }, + strlen: function(p_str) { + return lengthBytesUTF8(p_str); + }, + allocString: function(p_str) { + const length = GodotRuntime.strlen(p_str) + 1; + const c_str = GodotRuntime.malloc(length); + stringToUTF8(p_str, c_str, length); + return c_str; + }, + allocStringArray: function(p_strings) { + const size = p_strings.length; + const c_ptr = GodotRuntime.malloc(size * 4); + for (let i = 0; i < size; i++) { + GROWABLE_HEAP_I32()[(c_ptr >> 2) + i] = GodotRuntime.allocString(p_strings[i]); + } + return c_ptr; + }, + freeStringArray: function(p_ptr, p_len) { + for (let i = 0; i < p_len; i++) { + GodotRuntime.free(GROWABLE_HEAP_I32()[(p_ptr >> 2) + i]); + } + GodotRuntime.free(p_ptr); + }, + stringToHeap: function(p_str, p_ptr, p_len) { + return stringToUTF8Array(p_str, GROWABLE_HEAP_I8(), p_ptr, p_len); + } +}; + +var GodotConfig = { + canvas: null, + locale: "en", + canvas_resize_policy: 2, + virtual_keyboard: false, + persistent_drops: false, + on_execute: null, + on_exit: null, + init_config: function(p_opts) { + GodotConfig.canvas_resize_policy = p_opts["canvasResizePolicy"]; + GodotConfig.canvas = p_opts["canvas"]; + GodotConfig.locale = p_opts["locale"] || GodotConfig.locale; + GodotConfig.virtual_keyboard = p_opts["virtualKeyboard"]; + GodotConfig.persistent_drops = !!p_opts["persistentDrops"]; + GodotConfig.on_execute = p_opts["onExecute"]; + GodotConfig.on_exit = p_opts["onExit"]; + if (p_opts["focusCanvas"]) { + GodotConfig.canvas.focus(); + } + }, + locate_file: function(file) { + return Module["locateFile"](file); + }, + clear: function() { + GodotConfig.canvas = null; + GodotConfig.locale = "en"; + GodotConfig.canvas_resize_policy = 2; + GodotConfig.virtual_keyboard = false; + GodotConfig.persistent_drops = false; + GodotConfig.on_execute = null; + GodotConfig.on_exit = null; + } +}; + +var GodotFS = { + ENOENT: 44, + _idbfs: false, + _syncing: false, + _mount_points: [], + is_persistent: function() { + return GodotFS._idbfs ? 1 : 0; + }, + init: function(persistentPaths) { + GodotFS._idbfs = false; + if (!Array.isArray(persistentPaths)) { + return Promise.reject(new Error("Persistent paths must be an array")); + } + if (!persistentPaths.length) { + return Promise.resolve(); + } + GodotFS._mount_points = persistentPaths.slice(); + function createRecursive(dir) { + try { + FS.stat(dir); + } catch (e) { + if (e.errno !== GodotFS.ENOENT) { + GodotRuntime.error(e); + } + FS.mkdirTree(dir); + } + } + GodotFS._mount_points.forEach(function(path) { + createRecursive(path); + FS.mount(IDBFS, {}, path); + }); + return new Promise(function(resolve, reject) { + FS.syncfs(true, function(err) { + if (err) { + GodotFS._mount_points = []; + GodotFS._idbfs = false; + GodotRuntime.print(`IndexedDB not available: ${err.message}`); + } else { + GodotFS._idbfs = true; + } + resolve(err); + }); + }); + }, + deinit: function() { + GodotFS._mount_points.forEach(function(path) { + try { + FS.unmount(path); + } catch (e) { + GodotRuntime.print("Already unmounted", e); + } + if (GodotFS._idbfs && IDBFS.dbs[path]) { + IDBFS.dbs[path].close(); + delete IDBFS.dbs[path]; + } + }); + GodotFS._mount_points = []; + GodotFS._idbfs = false; + GodotFS._syncing = false; + }, + sync: function() { + if (GodotFS._syncing) { + GodotRuntime.error("Already syncing!"); + return Promise.resolve(); + } + GodotFS._syncing = true; + return new Promise(function(resolve, reject) { + FS.syncfs(false, function(error) { + if (error) { + GodotRuntime.error(`Failed to save IDB file system: ${error.message}`); + } + GodotFS._syncing = false; + resolve(error); + }); + }); + }, + copy_to_fs: function(path, buffer) { + const idx = path.lastIndexOf("/"); + let dir = "/"; + if (idx > 0) { + dir = path.slice(0, idx); + } + try { + FS.stat(dir); + } catch (e) { + if (e.errno !== GodotFS.ENOENT) { + GodotRuntime.error(e); + } + FS.mkdirTree(dir); + } + FS.writeFile(path, new Uint8Array(buffer)); + } +}; + +var GodotOS = { + request_quit: function() {}, + _async_cbs: [], + _fs_sync_promise: null, + atexit: function(p_promise_cb) { + GodotOS._async_cbs.push(p_promise_cb); + }, + cleanup: function(exit_code) { + const cb = GodotConfig.on_exit; + GodotFS.deinit(); + GodotConfig.clear(); + if (cb) { + cb(exit_code); + } + }, + finish_async: function(callback) { + GodotOS._fs_sync_promise.then(function(err) { + const promises = []; + GodotOS._async_cbs.forEach(function(cb) { + promises.push(new Promise(cb)); + }); + return Promise.all(promises); + }).then(function() { + return GodotFS.sync(); + }).then(function(err) { + setTimeout(function() { + callback(); + }, 0); + }); + } +}; + +var GodotAudio = { + ctx: null, + input: null, + driver: null, + interval: 0, + init: function(mix_rate, latency, onstatechange, onlatencyupdate) { + const opts = {}; + if (mix_rate) { + opts["sampleRate"] = mix_rate; + } + const ctx = new (window.AudioContext || window.webkitAudioContext)(opts); + GodotAudio.ctx = ctx; + ctx.onstatechange = function() { + let state = 0; + switch (ctx.state) { + case "suspended": + state = 0; + break; + + case "running": + state = 1; + break; + + case "closed": + state = 2; + break; + } + onstatechange(state); + }; + ctx.onstatechange(); + GodotAudio.interval = setInterval(function() { + let computed_latency = 0; + if (ctx.baseLatency) { + computed_latency += GodotAudio.ctx.baseLatency; + } + if (ctx.outputLatency) { + computed_latency += GodotAudio.ctx.outputLatency; + } + onlatencyupdate(computed_latency); + }, 1e3); + GodotOS.atexit(GodotAudio.close_async); + return ctx.destination.channelCount; + }, + create_input: function(callback) { + if (GodotAudio.input) { + return 0; + } + function gotMediaInput(stream) { + try { + GodotAudio.input = GodotAudio.ctx.createMediaStreamSource(stream); + callback(GodotAudio.input); + } catch (e) { + GodotRuntime.error("Failed creaating input.", e); + } + } + if (navigator.mediaDevices && navigator.mediaDevices.getUserMedia) { + navigator.mediaDevices.getUserMedia({ + "audio": true + }).then(gotMediaInput, function(e) { + GodotRuntime.error("Error getting user media.", e); + }); + } else { + if (!navigator.getUserMedia) { + navigator.getUserMedia = navigator.webkitGetUserMedia || navigator.mozGetUserMedia; + } + if (!navigator.getUserMedia) { + GodotRuntime.error("getUserMedia not available."); + return 1; + } + navigator.getUserMedia({ + "audio": true + }, gotMediaInput, function(e) { + GodotRuntime.print(e); + }); + } + return 0; + }, + close_async: function(resolve, reject) { + const ctx = GodotAudio.ctx; + GodotAudio.ctx = null; + if (!ctx) { + resolve(); + return; + } + if (GodotAudio.interval) { + clearInterval(GodotAudio.interval); + GodotAudio.interval = 0; + } + if (GodotAudio.input) { + GodotAudio.input.disconnect(); + GodotAudio.input = null; + } + let closed = Promise.resolve(); + if (GodotAudio.driver) { + closed = GodotAudio.driver.close(); + } + closed.then(function() { + return ctx.close(); + }).then(function() { + ctx.onstatechange = null; + resolve(); + }).catch(function(e) { + ctx.onstatechange = null; + GodotRuntime.error("Error closing AudioContext", e); + resolve(); + }); + } +}; + +function _godot_audio_has_worklet() { + return GodotAudio.ctx && GodotAudio.ctx.audioWorklet ? 1 : 0; +} + +function _godot_audio_init(p_mix_rate, p_latency, p_state_change, p_latency_update) { + const statechange = GodotRuntime.get_func(p_state_change); + const latencyupdate = GodotRuntime.get_func(p_latency_update); + const mix_rate = GodotRuntime.getHeapValue(p_mix_rate, "i32"); + const channels = GodotAudio.init(mix_rate, p_latency, statechange, latencyupdate); + GodotRuntime.setHeapValue(p_mix_rate, GodotAudio.ctx.sampleRate, "i32"); + return channels; +} + +function _godot_audio_input_start() { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(49, 1); + return GodotAudio.create_input(function(input) { + input.connect(GodotAudio.driver.get_node()); + }); +} + +function _godot_audio_input_stop() { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(50, 1); + if (GodotAudio.input) { + const tracks = GodotAudio.input["mediaStream"]["getTracks"](); + for (let i = 0; i < tracks.length; i++) { + tracks[i]["stop"](); + } + GodotAudio.input.disconnect(); + GodotAudio.input = null; + } +} + +function _godot_audio_is_available() { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(51, 1); + if (!(window.AudioContext || window.webkitAudioContext)) { + return 0; + } + return 1; +} + +function _godot_audio_resume() { + if (GodotAudio.ctx && GodotAudio.ctx.state !== "running") { + GodotAudio.ctx.resume(); + } +} + +var GodotAudioWorklet = { + promise: null, + worklet: null, + ring_buffer: null, + create: function(channels) { + const path = GodotConfig.locate_file("godot.audio.worklet.js"); + GodotAudioWorklet.promise = GodotAudio.ctx.audioWorklet.addModule(path).then(function() { + GodotAudioWorklet.worklet = new AudioWorkletNode(GodotAudio.ctx, "godot-processor", { + "outputChannelCount": [ channels ] + }); + return Promise.resolve(); + }); + GodotAudio.driver = GodotAudioWorklet; + }, + start: function(in_buf, out_buf, state) { + GodotAudioWorklet.promise.then(function() { + const node = GodotAudioWorklet.worklet; + node.connect(GodotAudio.ctx.destination); + node.port.postMessage({ + "cmd": "start", + "data": [ state, in_buf, out_buf ] + }); + node.port.onmessage = function(event) { + GodotRuntime.error(event.data); + }; + }); + }, + start_no_threads: function(p_out_buf, p_out_size, out_callback, p_in_buf, p_in_size, in_callback) { + function RingBuffer() { + let wpos = 0; + let rpos = 0; + let pending_samples = 0; + const wbuf = new Float32Array(p_out_size); + function send(port) { + if (pending_samples === 0) { + return; + } + const buffer = GodotRuntime.heapSub(GROWABLE_HEAP_F32(), p_out_buf, p_out_size); + const size = buffer.length; + const tot_sent = pending_samples; + out_callback(wpos, pending_samples); + if (wpos + pending_samples >= size) { + const high = size - wpos; + wbuf.set(buffer.subarray(wpos, size)); + pending_samples -= high; + wpos = 0; + } + if (pending_samples > 0) { + wbuf.set(buffer.subarray(wpos, wpos + pending_samples), tot_sent - pending_samples); + } + port.postMessage({ + "cmd": "chunk", + "data": wbuf.subarray(0, tot_sent) + }); + wpos += pending_samples; + pending_samples = 0; + } + this.receive = function(recv_buf) { + const buffer = GodotRuntime.heapSub(GROWABLE_HEAP_F32(), p_in_buf, p_in_size); + const from = rpos; + let to_write = recv_buf.length; + let high = 0; + if (rpos + to_write >= p_in_size) { + high = p_in_size - rpos; + buffer.set(recv_buf.subarray(0, high), rpos); + to_write -= high; + rpos = 0; + } + if (to_write) { + buffer.set(recv_buf.subarray(high, to_write), rpos); + } + in_callback(from, recv_buf.length); + rpos += to_write; + }; + this.consumed = function(size, port) { + pending_samples += size; + send(port); + }; + } + GodotAudioWorklet.ring_buffer = new RingBuffer(); + GodotAudioWorklet.promise.then(function() { + const node = GodotAudioWorklet.worklet; + const buffer = GodotRuntime.heapSlice(GROWABLE_HEAP_F32(), p_out_buf, p_out_size); + node.connect(GodotAudio.ctx.destination); + node.port.postMessage({ + "cmd": "start_nothreads", + "data": [ buffer, p_in_size ] + }); + node.port.onmessage = function(event) { + if (!GodotAudioWorklet.worklet) { + return; + } + if (event.data["cmd"] === "read") { + const read = event.data["data"]; + GodotAudioWorklet.ring_buffer.consumed(read, GodotAudioWorklet.worklet.port); + } else if (event.data["cmd"] === "input") { + const buf = event.data["data"]; + if (buf.length > p_in_size) { + GodotRuntime.error("Input chunk is too big"); + return; + } + GodotAudioWorklet.ring_buffer.receive(buf); + } else { + GodotRuntime.error(event.data); + } + }; + }); + }, + get_node: function() { + return GodotAudioWorklet.worklet; + }, + close: function() { + return new Promise(function(resolve, reject) { + if (GodotAudioWorklet.promise === null) { + return; + } + const p = GodotAudioWorklet.promise; + p.then(function() { + GodotAudioWorklet.worklet.port.postMessage({ + "cmd": "stop", + "data": null + }); + GodotAudioWorklet.worklet.disconnect(); + GodotAudioWorklet.worklet.port.onmessage = null; + GodotAudioWorklet.worklet = null; + GodotAudioWorklet.promise = null; + resolve(); + }).catch(function(err) { + GodotRuntime.error(err); + }); + }); + } +}; + +function _godot_audio_worklet_create(channels) { + try { + GodotAudioWorklet.create(channels); + } catch (e) { + GodotRuntime.error("Error starting AudioDriverWorklet", e); + return 1; + } + return 0; +} + +function _godot_audio_worklet_start(p_in_buf, p_in_size, p_out_buf, p_out_size, p_state) { + const out_buffer = GodotRuntime.heapSub(GROWABLE_HEAP_F32(), p_out_buf, p_out_size); + const in_buffer = GodotRuntime.heapSub(GROWABLE_HEAP_F32(), p_in_buf, p_in_size); + const state = GodotRuntime.heapSub(GROWABLE_HEAP_I32(), p_state, 4); + GodotAudioWorklet.start(in_buffer, out_buffer, state); +} + +function _godot_audio_worklet_state_add(p_state, p_idx, p_value) { + return Atomics.add(GROWABLE_HEAP_I32(), (p_state >> 2) + p_idx, p_value); +} + +function _godot_audio_worklet_state_get(p_state, p_idx) { + return Atomics.load(GROWABLE_HEAP_I32(), (p_state >> 2) + p_idx); +} + +function _godot_audio_worklet_state_wait(p_state, p_idx, p_expected, p_timeout) { + Atomics.wait(GROWABLE_HEAP_I32(), (p_state >> 2) + p_idx, p_expected, p_timeout); + return Atomics.load(GROWABLE_HEAP_I32(), (p_state >> 2) + p_idx); +} + +function _godot_js_config_canvas_id_get(p_ptr, p_ptr_max) { + GodotRuntime.stringToHeap(`#${GodotConfig.canvas.id}`, p_ptr, p_ptr_max); +} + +function _godot_js_config_locale_get(p_ptr, p_ptr_max) { + GodotRuntime.stringToHeap(GodotConfig.locale, p_ptr, p_ptr_max); +} + +var GodotDisplayCursor = { + shape: "default", + visible: true, + cursors: {}, + set_style: function(style) { + GodotConfig.canvas.style.cursor = style; + }, + set_shape: function(shape) { + GodotDisplayCursor.shape = shape; + let css = shape; + if (shape in GodotDisplayCursor.cursors) { + const c = GodotDisplayCursor.cursors[shape]; + css = `url("${c.url}") ${c.x} ${c.y}, default`; + } + if (GodotDisplayCursor.visible) { + GodotDisplayCursor.set_style(css); + } + }, + clear: function() { + GodotDisplayCursor.set_style(""); + GodotDisplayCursor.shape = "default"; + GodotDisplayCursor.visible = true; + Object.keys(GodotDisplayCursor.cursors).forEach(function(key) { + URL.revokeObjectURL(GodotDisplayCursor.cursors[key]); + delete GodotDisplayCursor.cursors[key]; + }); + }, + lockPointer: function() { + const canvas = GodotConfig.canvas; + if (canvas.requestPointerLock) { + canvas.requestPointerLock(); + } + }, + releasePointer: function() { + if (document.exitPointerLock) { + document.exitPointerLock(); + } + }, + isPointerLocked: function() { + return document.pointerLockElement === GodotConfig.canvas; + } +}; + +var GodotEventListeners = { + handlers: [], + has: function(target, event, method, capture) { + return GodotEventListeners.handlers.findIndex(function(e) { + return e.target === target && e.event === event && e.method === method && e.capture === capture; + }) !== -1; + }, + add: function(target, event, method, capture) { + if (GodotEventListeners.has(target, event, method, capture)) { + return; + } + function Handler(p_target, p_event, p_method, p_capture) { + this.target = p_target; + this.event = p_event; + this.method = p_method; + this.capture = p_capture; + } + GodotEventListeners.handlers.push(new Handler(target, event, method, capture)); + target.addEventListener(event, method, capture); + }, + clear: function() { + GodotEventListeners.handlers.forEach(function(h) { + h.target.removeEventListener(h.event, h.method, h.capture); + }); + GodotEventListeners.handlers.length = 0; + } +}; + +var GodotDisplayScreen = { + desired_size: [ 0, 0 ], + hidpi: true, + getPixelRatio: function() { + return GodotDisplayScreen.hidpi ? window.devicePixelRatio || 1 : 1; + }, + isFullscreen: function() { + const elem = document.fullscreenElement || document.mozFullscreenElement || document.webkitFullscreenElement || document.msFullscreenElement; + if (elem) { + return elem === GodotConfig.canvas; + } + return document.fullscreen || document.mozFullScreen || document.webkitIsFullscreen; + }, + hasFullscreen: function() { + return document.fullscreenEnabled || document.mozFullScreenEnabled || document.webkitFullscreenEnabled; + }, + requestFullscreen: function() { + if (!GodotDisplayScreen.hasFullscreen()) { + return 1; + } + const canvas = GodotConfig.canvas; + try { + const promise = (canvas.requestFullscreen || canvas.msRequestFullscreen || canvas.mozRequestFullScreen || canvas.mozRequestFullscreen || canvas.webkitRequestFullscreen).call(canvas); + if (promise) { + promise.catch(function() {}); + } + } catch (e) { + return 1; + } + return 0; + }, + exitFullscreen: function() { + if (!GodotDisplayScreen.isFullscreen()) { + return 0; + } + try { + const promise = document.exitFullscreen(); + if (promise) { + promise.catch(function() {}); + } + } catch (e) { + return 1; + } + return 0; + }, + _updateGL: function() { + const gl_context_handle = _emscripten_webgl_get_current_context(); + const gl = GL.getContext(gl_context_handle); + if (gl) { + GL.resizeOffscreenFramebuffer(gl); + } + }, + updateSize: function() { + const isFullscreen = GodotDisplayScreen.isFullscreen(); + const wantsFullWindow = GodotConfig.canvas_resize_policy === 2; + const noResize = GodotConfig.canvas_resize_policy === 0; + const wwidth = GodotDisplayScreen.desired_size[0]; + const wheight = GodotDisplayScreen.desired_size[1]; + const canvas = GodotConfig.canvas; + let width = wwidth; + let height = wheight; + if (noResize) { + if (canvas.width !== width || canvas.height !== height) { + GodotDisplayScreen.desired_size = [ canvas.width, canvas.height ]; + GodotDisplayScreen._updateGL(); + return 1; + } + return 0; + } + const scale = GodotDisplayScreen.getPixelRatio(); + if (isFullscreen || wantsFullWindow) { + width = window.innerWidth * scale; + height = window.innerHeight * scale; + } + const csw = `${width / scale}px`; + const csh = `${height / scale}px`; + if (canvas.style.width !== csw || canvas.style.height !== csh || canvas.width !== width || canvas.height !== height) { + canvas.width = width; + canvas.height = height; + canvas.style.width = csw; + canvas.style.height = csh; + GodotDisplayScreen._updateGL(); + return 1; + } + return 0; + } +}; + +var GodotDisplayVK = { + textinput: null, + textarea: null, + available: function() { + return GodotConfig.virtual_keyboard && "ontouchstart" in window; + }, + init: function(input_cb) { + function create(what) { + const elem = document.createElement(what); + elem.style.display = "none"; + elem.style.position = "absolute"; + elem.style.zIndex = "-1"; + elem.style.background = "transparent"; + elem.style.padding = "0px"; + elem.style.margin = "0px"; + elem.style.overflow = "hidden"; + elem.style.width = "0px"; + elem.style.height = "0px"; + elem.style.border = "0px"; + elem.style.outline = "none"; + elem.readonly = true; + elem.disabled = true; + GodotEventListeners.add(elem, "input", function(evt) { + const c_str = GodotRuntime.allocString(elem.value); + input_cb(c_str, elem.selectionEnd); + GodotRuntime.free(c_str); + }, false); + GodotEventListeners.add(elem, "blur", function(evt) { + elem.style.display = "none"; + elem.readonly = true; + elem.disabled = true; + }, false); + GodotConfig.canvas.insertAdjacentElement("beforebegin", elem); + return elem; + } + GodotDisplayVK.textinput = create("input"); + GodotDisplayVK.textarea = create("textarea"); + GodotDisplayVK.updateSize(); + }, + show: function(text, type, start, end) { + if (!GodotDisplayVK.textinput || !GodotDisplayVK.textarea) { + return; + } + if (GodotDisplayVK.textinput.style.display !== "" || GodotDisplayVK.textarea.style.display !== "") { + GodotDisplayVK.hide(); + } + GodotDisplayVK.updateSize(); + let elem = GodotDisplayVK.textinput; + switch (type) { + case 0: + elem.type = "text"; + elem.inputmode = ""; + break; + + case 1: + elem = GodotDisplayVK.textarea; + break; + + case 2: + elem.type = "text"; + elem.inputmode = "numeric"; + break; + + case 3: + elem.type = "text"; + elem.inputmode = "decimal"; + break; + + case 4: + elem.type = "tel"; + elem.inputmode = ""; + break; + + case 5: + elem.type = "email"; + elem.inputmode = ""; + break; + + case 6: + elem.type = "password"; + elem.inputmode = ""; + break; + + case 7: + elem.type = "url"; + elem.inputmode = ""; + break; + + default: + elem.type = "text"; + elem.inputmode = ""; + break; + } + elem.readonly = false; + elem.disabled = false; + elem.value = text; + elem.style.display = "block"; + elem.focus(); + elem.setSelectionRange(start, end); + }, + hide: function() { + if (!GodotDisplayVK.textinput || !GodotDisplayVK.textarea) { + return; + } + [ GodotDisplayVK.textinput, GodotDisplayVK.textarea ].forEach(function(elem) { + elem.blur(); + elem.style.display = "none"; + elem.value = ""; + }); + }, + updateSize: function() { + if (!GodotDisplayVK.textinput || !GodotDisplayVK.textarea) { + return; + } + const rect = GodotConfig.canvas.getBoundingClientRect(); + function update(elem) { + elem.style.left = `${rect.left}px`; + elem.style.top = `${rect.top}px`; + elem.style.width = `${rect.width}px`; + elem.style.height = `${rect.height}px`; + } + update(GodotDisplayVK.textinput); + update(GodotDisplayVK.textarea); + }, + clear: function() { + if (GodotDisplayVK.textinput) { + GodotDisplayVK.textinput.remove(); + GodotDisplayVK.textinput = null; + } + if (GodotDisplayVK.textarea) { + GodotDisplayVK.textarea.remove(); + GodotDisplayVK.textarea = null; + } + } +}; + +var GodotDisplay = { + window_icon: "", + getDPI: function() { + const dpi = Math.round(window.devicePixelRatio * 96); + return dpi >= 96 ? dpi : 96; + } +}; + +function _godot_js_display_alert(p_text) { + window.alert(GodotRuntime.parseString(p_text)); +} + +function _godot_js_display_canvas_focus() { + GodotConfig.canvas.focus(); +} + +function _godot_js_display_canvas_is_focused() { + return document.activeElement === GodotConfig.canvas; +} + +function _godot_js_display_clipboard_get(callback) { + const func = GodotRuntime.get_func(callback); + try { + navigator.clipboard.readText().then(function(result) { + const ptr = GodotRuntime.allocString(result); + func(ptr); + GodotRuntime.free(ptr); + }).catch(function(e) {}); + } catch (e) {} +} + +function _godot_js_display_clipboard_set(p_text) { + const text = GodotRuntime.parseString(p_text); + if (!navigator.clipboard || !navigator.clipboard.writeText) { + return 1; + } + navigator.clipboard.writeText(text).catch(function(e) { + GodotRuntime.error("Setting OS clipboard is only possible from an input callback for the Web platform. Exception:", e); + }); + return 0; +} + +function _godot_js_display_cursor_is_hidden() { + return !GodotDisplayCursor.visible; +} + +function _godot_js_display_cursor_is_locked() { + return GodotDisplayCursor.isPointerLocked() ? 1 : 0; +} + +function _godot_js_display_cursor_lock_set(p_lock) { + if (p_lock) { + GodotDisplayCursor.lockPointer(); + } else { + GodotDisplayCursor.releasePointer(); + } +} + +function _godot_js_display_cursor_set_custom_shape(p_shape, p_ptr, p_len, p_hotspot_x, p_hotspot_y) { + const shape = GodotRuntime.parseString(p_shape); + const old_shape = GodotDisplayCursor.cursors[shape]; + if (p_len > 0) { + const png = new Blob([ GodotRuntime.heapSlice(GROWABLE_HEAP_U8(), p_ptr, p_len) ], { + type: "image/png" + }); + const url = URL.createObjectURL(png); + GodotDisplayCursor.cursors[shape] = { + url: url, + x: p_hotspot_x, + y: p_hotspot_y + }; + } else { + delete GodotDisplayCursor.cursors[shape]; + } + if (shape === GodotDisplayCursor.shape) { + GodotDisplayCursor.set_shape(GodotDisplayCursor.shape); + } + if (old_shape) { + URL.revokeObjectURL(old_shape.url); + } +} + +function _godot_js_display_cursor_set_shape(p_string) { + GodotDisplayCursor.set_shape(GodotRuntime.parseString(p_string)); +} + +function _godot_js_display_cursor_set_visible(p_visible) { + const visible = p_visible !== 0; + if (visible === GodotDisplayCursor.visible) { + return; + } + GodotDisplayCursor.visible = visible; + if (visible) { + GodotDisplayCursor.set_shape(GodotDisplayCursor.shape); + } else { + GodotDisplayCursor.set_style("none"); + } +} + +function _godot_js_display_desired_size_set(width, height) { + GodotDisplayScreen.desired_size = [ width, height ]; + GodotDisplayScreen.updateSize(); +} + +function _godot_js_display_fullscreen_cb(callback) { + const canvas = GodotConfig.canvas; + const func = GodotRuntime.get_func(callback); + function change_cb(evt) { + if (evt.target === canvas) { + func(GodotDisplayScreen.isFullscreen()); + } + } + GodotEventListeners.add(document, "fullscreenchange", change_cb, false); + GodotEventListeners.add(document, "mozfullscreenchange", change_cb, false); + GodotEventListeners.add(document, "webkitfullscreenchange", change_cb, false); +} + +function _godot_js_display_fullscreen_exit() { + return GodotDisplayScreen.exitFullscreen(); +} + +function _godot_js_display_fullscreen_request() { + return GodotDisplayScreen.requestFullscreen(); +} + +function _godot_js_display_has_webgl(p_version) { + if (p_version !== 1 && p_version !== 2) { + return false; + } + try { + return !!document.createElement("canvas").getContext(p_version === 2 ? "webgl2" : "webgl"); + } catch (e) {} + return false; +} + +function _godot_js_display_is_swap_ok_cancel() { + const win = [ "Windows", "Win64", "Win32", "WinCE" ]; + const plat = navigator.platform || ""; + if (win.indexOf(plat) !== -1) { + return 1; + } + return 0; +} + +function _godot_js_display_notification_cb(callback, p_enter, p_exit, p_in, p_out) { + const canvas = GodotConfig.canvas; + const func = GodotRuntime.get_func(callback); + const notif = [ p_enter, p_exit, p_in, p_out ]; + [ "mouseover", "mouseleave", "focus", "blur" ].forEach(function(evt_name, idx) { + GodotEventListeners.add(canvas, evt_name, function() { + func(notif[idx]); + }, true); + }); +} + +function _godot_js_display_pixel_ratio_get() { + return GodotDisplayScreen.getPixelRatio(); +} + +function _godot_js_display_screen_dpi_get() { + return GodotDisplay.getDPI(); +} + +function _godot_js_display_screen_size_get(width, height) { + const scale = GodotDisplayScreen.getPixelRatio(); + GodotRuntime.setHeapValue(width, window.screen.width * scale, "i32"); + GodotRuntime.setHeapValue(height, window.screen.height * scale, "i32"); +} + +function _godot_js_display_setup_canvas(p_width, p_height, p_fullscreen, p_hidpi) { + const canvas = GodotConfig.canvas; + GodotEventListeners.add(canvas, "contextmenu", function(ev) { + ev.preventDefault(); + }, false); + GodotEventListeners.add(canvas, "webglcontextlost", function(ev) { + alert("WebGL context lost, please reload the page"); + ev.preventDefault(); + }, false); + GodotDisplayScreen.hidpi = !!p_hidpi; + switch (GodotConfig.canvas_resize_policy) { + case 0: + GodotDisplayScreen.desired_size = [ canvas.width, canvas.height ]; + break; + + case 1: + GodotDisplayScreen.desired_size = [ p_width, p_height ]; + break; + + default: + canvas.style.position = "absolute"; + canvas.style.top = 0; + canvas.style.left = 0; + break; + } + GodotDisplayScreen.updateSize(); + if (p_fullscreen) { + GodotDisplayScreen.requestFullscreen(); + } +} + +function _godot_js_display_size_update() { + const updated = GodotDisplayScreen.updateSize(); + if (updated) { + GodotDisplayVK.updateSize(); + } + return updated; +} + +function _godot_js_display_touchscreen_is_available() { + return "ontouchstart" in window; +} + +function _godot_js_display_tts_available() { + return "speechSynthesis" in window; +} + +function _godot_js_display_vk_available() { + return GodotDisplayVK.available(); +} + +function _godot_js_display_vk_cb(p_input_cb) { + const input_cb = GodotRuntime.get_func(p_input_cb); + if (GodotDisplayVK.available()) { + GodotDisplayVK.init(input_cb); + } +} + +function _godot_js_display_vk_hide() { + GodotDisplayVK.hide(); +} + +function _godot_js_display_vk_show(p_text, p_type, p_start, p_end) { + const text = GodotRuntime.parseString(p_text); + const start = p_start > 0 ? p_start : 0; + const end = p_end > 0 ? p_end : start; + GodotDisplayVK.show(text, p_type, start, end); +} + +function _godot_js_display_window_blur_cb(callback) { + const func = GodotRuntime.get_func(callback); + GodotEventListeners.add(window, "blur", function() { + func(); + }, false); +} + +function _godot_js_display_window_icon_set(p_ptr, p_len) { + let link = document.getElementById("-gd-engine-icon"); + if (link === null) { + link = document.createElement("link"); + link.rel = "icon"; + link.id = "-gd-engine-icon"; + document.head.appendChild(link); + } + const old_icon = GodotDisplay.window_icon; + const png = new Blob([ GodotRuntime.heapSlice(GROWABLE_HEAP_U8(), p_ptr, p_len) ], { + type: "image/png" + }); + GodotDisplay.window_icon = URL.createObjectURL(png); + link.href = GodotDisplay.window_icon; + if (old_icon) { + URL.revokeObjectURL(old_icon); + } +} + +function _godot_js_display_window_size_get(p_width, p_height) { + GodotRuntime.setHeapValue(p_width, GodotConfig.canvas.width, "i32"); + GodotRuntime.setHeapValue(p_height, GodotConfig.canvas.height, "i32"); +} + +function _godot_js_display_window_title_set(p_data) { + document.title = GodotRuntime.parseString(p_data); +} + +function _godot_js_eval(p_js, p_use_global_ctx, p_union_ptr, p_byte_arr, p_byte_arr_write, p_callback) { + const js_code = GodotRuntime.parseString(p_js); + let eval_ret = null; + try { + if (p_use_global_ctx) { + const global_eval = eval; + eval_ret = global_eval(js_code); + } else { + eval_ret = eval(js_code); + } + } catch (e) { + GodotRuntime.error(e); + } + switch (typeof eval_ret) { + case "boolean": + GodotRuntime.setHeapValue(p_union_ptr, eval_ret, "i32"); + return 1; + + case "number": + GodotRuntime.setHeapValue(p_union_ptr, eval_ret, "double"); + return 3; + + case "string": + GodotRuntime.setHeapValue(p_union_ptr, GodotRuntime.allocString(eval_ret), "*"); + return 4; + + case "object": + if (eval_ret === null) { + break; + } + if (ArrayBuffer.isView(eval_ret) && !(eval_ret instanceof Uint8Array)) { + eval_ret = new Uint8Array(eval_ret.buffer); + } else if (eval_ret instanceof ArrayBuffer) { + eval_ret = new Uint8Array(eval_ret); + } + if (eval_ret instanceof Uint8Array) { + const func = GodotRuntime.get_func(p_callback); + const bytes_ptr = func(p_byte_arr, p_byte_arr_write, eval_ret.length); + GROWABLE_HEAP_U8().set(eval_ret, bytes_ptr); + return 20; + } + break; + } + return 0; +} + +var IDHandler = { + _last_id: 0, + _references: {}, + get: function(p_id) { + return IDHandler._references[p_id]; + }, + add: function(p_data) { + const id = ++IDHandler._last_id; + IDHandler._references[id] = p_data; + return id; + }, + remove: function(p_id) { + delete IDHandler._references[p_id]; + } +}; + +var GodotFetch = { + onread: function(id, result) { + const obj = IDHandler.get(id); + if (!obj) { + return; + } + if (result.value) { + obj.chunks.push(result.value); + } + obj.reading = false; + obj.done = result.done; + }, + onresponse: function(id, response) { + const obj = IDHandler.get(id); + if (!obj) { + return; + } + let chunked = false; + let bodySize = -1; + response.headers.forEach(function(value, header) { + const v = value.toLowerCase().trim(); + const h = header.toLowerCase().trim(); + if (h === "transfer-encoding" && v === "chunked") { + chunked = true; + } + if (h === "content-length") { + bodySize = parseInt(v, 10); + } + }); + obj.status = response.status; + obj.response = response; + obj.reader = response.body.getReader(); + obj.chunked = chunked; + obj.bodySize = bodySize; + }, + onerror: function(id, err) { + GodotRuntime.error(err); + const obj = IDHandler.get(id); + if (!obj) { + return; + } + obj.error = err; + }, + create: function(method, url, headers, body) { + const obj = { + request: null, + response: null, + reader: null, + error: null, + done: false, + reading: false, + status: 0, + chunks: [], + bodySize: -1 + }; + const id = IDHandler.add(obj); + const init = { + method: method, + headers: headers, + body: body + }; + obj.request = fetch(url, init); + obj.request.then(GodotFetch.onresponse.bind(null, id)).catch(GodotFetch.onerror.bind(null, id)); + return id; + }, + free: function(id) { + const obj = IDHandler.get(id); + if (!obj) { + return; + } + IDHandler.remove(id); + if (!obj.request) { + return; + } + obj.request.then(function(response) { + response.abort(); + }).catch(function(e) {}); + }, + read: function(id) { + const obj = IDHandler.get(id); + if (!obj) { + return; + } + if (obj.reader && !obj.reading) { + if (obj.done) { + obj.reader = null; + return; + } + obj.reading = true; + obj.reader.read().then(GodotFetch.onread.bind(null, id)).catch(GodotFetch.onerror.bind(null, id)); + } + } +}; + +function _godot_js_fetch_body_length_get(p_id) { + const obj = IDHandler.get(p_id); + if (!obj || !obj.response) { + return -1; + } + return obj.bodySize; +} + +function _godot_js_fetch_create(p_method, p_url, p_headers, p_headers_size, p_body, p_body_size) { + const method = GodotRuntime.parseString(p_method); + const url = GodotRuntime.parseString(p_url); + const headers = GodotRuntime.parseStringArray(p_headers, p_headers_size); + const body = p_body_size ? GodotRuntime.heapSlice(GROWABLE_HEAP_I8(), p_body, p_body_size) : null; + return GodotFetch.create(method, url, headers.map(function(hv) { + const idx = hv.indexOf(":"); + if (idx <= 0) { + return []; + } + return [ hv.slice(0, idx).trim(), hv.slice(idx + 1).trim() ]; + }).filter(function(v) { + return v.length === 2; + }), body); +} + +function _godot_js_fetch_free(id) { + GodotFetch.free(id); +} + +function _godot_js_fetch_http_status_get(p_id) { + const obj = IDHandler.get(p_id); + if (!obj || !obj.response) { + return 0; + } + return obj.status; +} + +function _godot_js_fetch_is_chunked(p_id) { + const obj = IDHandler.get(p_id); + if (!obj || !obj.response) { + return -1; + } + return obj.chunked ? 1 : 0; +} + +function _godot_js_fetch_read_chunk(p_id, p_buf, p_buf_size) { + const obj = IDHandler.get(p_id); + if (!obj || !obj.response) { + return 0; + } + let to_read = p_buf_size; + const chunks = obj.chunks; + while (to_read && chunks.length) { + const chunk = obj.chunks[0]; + if (chunk.length > to_read) { + GodotRuntime.heapCopy(GROWABLE_HEAP_I8(), chunk.slice(0, to_read), p_buf); + chunks[0] = chunk.slice(to_read); + to_read = 0; + } else { + GodotRuntime.heapCopy(GROWABLE_HEAP_I8(), chunk, p_buf); + to_read -= chunk.length; + chunks.pop(); + } + } + if (!chunks.length) { + GodotFetch.read(p_id); + } + return p_buf_size - to_read; +} + +function _godot_js_fetch_read_headers(p_id, p_parse_cb, p_ref) { + const obj = IDHandler.get(p_id); + if (!obj || !obj.response) { + return 1; + } + const cb = GodotRuntime.get_func(p_parse_cb); + const arr = []; + obj.response.headers.forEach(function(v, h) { + arr.push(`${h}:${v}`); + }); + const c_ptr = GodotRuntime.allocStringArray(arr); + cb(arr.length, c_ptr, p_ref); + GodotRuntime.freeStringArray(c_ptr, arr.length); + return 0; +} + +function _godot_js_fetch_state_get(p_id) { + const obj = IDHandler.get(p_id); + if (!obj) { + return -1; + } + if (obj.error) { + return -1; + } + if (!obj.response) { + return 0; + } + if (obj.reader) { + return 1; + } + if (obj.done) { + return 2; + } + return -1; +} + +var GodotInputGamepads = { + samples: [], + get_pads: function() { + try { + const pads = navigator.getGamepads(); + if (pads) { + return pads; + } + return []; + } catch (e) { + return []; + } + }, + get_samples: function() { + return GodotInputGamepads.samples; + }, + get_sample: function(index) { + const samples = GodotInputGamepads.samples; + return index < samples.length ? samples[index] : null; + }, + sample: function() { + const pads = GodotInputGamepads.get_pads(); + const samples = []; + for (let i = 0; i < pads.length; i++) { + const pad = pads[i]; + if (!pad) { + samples.push(null); + continue; + } + const s = { + standard: pad.mapping === "standard", + buttons: [], + axes: [], + connected: pad.connected + }; + for (let b = 0; b < pad.buttons.length; b++) { + s.buttons.push(pad.buttons[b].value); + } + for (let a = 0; a < pad.axes.length; a++) { + s.axes.push(pad.axes[a]); + } + samples.push(s); + } + GodotInputGamepads.samples = samples; + }, + init: function(onchange) { + GodotInputGamepads.samples = []; + function add(pad) { + const guid = GodotInputGamepads.get_guid(pad); + const c_id = GodotRuntime.allocString(pad.id); + const c_guid = GodotRuntime.allocString(guid); + onchange(pad.index, 1, c_id, c_guid); + GodotRuntime.free(c_id); + GodotRuntime.free(c_guid); + } + const pads = GodotInputGamepads.get_pads(); + for (let i = 0; i < pads.length; i++) { + if (pads[i]) { + add(pads[i]); + } + } + GodotEventListeners.add(window, "gamepadconnected", function(evt) { + if (evt.gamepad) { + add(evt.gamepad); + } + }, false); + GodotEventListeners.add(window, "gamepaddisconnected", function(evt) { + if (evt.gamepad) { + onchange(evt.gamepad.index, 0); + } + }, false); + }, + get_guid: function(pad) { + if (pad.mapping) { + return pad.mapping; + } + const ua = navigator.userAgent; + let os = "Unknown"; + if (ua.indexOf("Android") >= 0) { + os = "Android"; + } else if (ua.indexOf("Linux") >= 0) { + os = "Linux"; + } else if (ua.indexOf("iPhone") >= 0) { + os = "iOS"; + } else if (ua.indexOf("Macintosh") >= 0) { + os = "MacOSX"; + } else if (ua.indexOf("Windows") >= 0) { + os = "Windows"; + } + const id = pad.id; + const exp1 = /vendor: ([0-9a-f]{4}) product: ([0-9a-f]{4})/i; + const exp2 = /^([0-9a-f]+)-([0-9a-f]+)-/i; + let vendor = ""; + let product = ""; + if (exp1.test(id)) { + const match = exp1.exec(id); + vendor = match[1].padStart(4, "0"); + product = match[2].padStart(4, "0"); + } else if (exp2.test(id)) { + const match = exp2.exec(id); + vendor = match[1].padStart(4, "0"); + product = match[2].padStart(4, "0"); + } + if (!vendor || !product) { + return `${os}Unknown`; + } + return os + vendor + product; + } +}; + +var GodotInputDragDrop = { + promises: [], + pending_files: [], + add_entry: function(entry) { + if (entry.isDirectory) { + GodotInputDragDrop.add_dir(entry); + } else if (entry.isFile) { + GodotInputDragDrop.add_file(entry); + } else { + GodotRuntime.error("Unrecognized entry...", entry); + } + }, + add_dir: function(entry) { + GodotInputDragDrop.promises.push(new Promise(function(resolve, reject) { + const reader = entry.createReader(); + reader.readEntries(function(entries) { + for (let i = 0; i < entries.length; i++) { + GodotInputDragDrop.add_entry(entries[i]); + } + resolve(); + }); + })); + }, + add_file: function(entry) { + GodotInputDragDrop.promises.push(new Promise(function(resolve, reject) { + entry.file(function(file) { + const reader = new FileReader(); + reader.onload = function() { + const f = { + "path": file.relativePath || file.webkitRelativePath, + "name": file.name, + "type": file.type, + "size": file.size, + "data": reader.result + }; + if (!f["path"]) { + f["path"] = f["name"]; + } + GodotInputDragDrop.pending_files.push(f); + resolve(); + }; + reader.onerror = function() { + GodotRuntime.print("Error reading file"); + reject(); + }; + reader.readAsArrayBuffer(file); + }, function(err) { + GodotRuntime.print("Error!"); + reject(); + }); + })); + }, + process: function(resolve, reject) { + if (GodotInputDragDrop.promises.length === 0) { + resolve(); + return; + } + GodotInputDragDrop.promises.pop().then(function() { + setTimeout(function() { + GodotInputDragDrop.process(resolve, reject); + }, 0); + }); + }, + _process_event: function(ev, callback) { + ev.preventDefault(); + if (ev.dataTransfer.items) { + for (let i = 0; i < ev.dataTransfer.items.length; i++) { + const item = ev.dataTransfer.items[i]; + let entry = null; + if ("getAsEntry" in item) { + entry = item.getAsEntry(); + } else if ("webkitGetAsEntry" in item) { + entry = item.webkitGetAsEntry(); + } + if (entry) { + GodotInputDragDrop.add_entry(entry); + } + } + } else { + GodotRuntime.error("File upload not supported"); + } + new Promise(GodotInputDragDrop.process).then(function() { + const DROP = `/tmp/drop-${parseInt(Math.random() * (1 << 30), 10)}/`; + const drops = []; + const files = []; + FS.mkdir(DROP.slice(0, -1)); + GodotInputDragDrop.pending_files.forEach(elem => { + const path = elem["path"]; + GodotFS.copy_to_fs(DROP + path, elem["data"]); + let idx = path.indexOf("/"); + if (idx === -1) { + drops.push(DROP + path); + } else { + const sub = path.substr(0, idx); + idx = sub.indexOf("/"); + if (idx < 0 && drops.indexOf(DROP + sub) === -1) { + drops.push(DROP + sub); + } + } + files.push(DROP + path); + }); + GodotInputDragDrop.promises = []; + GodotInputDragDrop.pending_files = []; + callback(drops); + if (GodotConfig.persistent_drops) { + GodotOS.atexit(function(resolve, reject) { + GodotInputDragDrop.remove_drop(files, DROP); + resolve(); + }); + } else { + GodotInputDragDrop.remove_drop(files, DROP); + } + }); + }, + remove_drop: function(files, drop_path) { + const dirs = [ drop_path.substr(0, drop_path.length - 1) ]; + files.forEach(function(file) { + FS.unlink(file); + let dir = file.replace(drop_path, ""); + let idx = dir.lastIndexOf("/"); + while (idx > 0) { + dir = dir.substr(0, idx); + if (dirs.indexOf(drop_path + dir) === -1) { + dirs.push(drop_path + dir); + } + idx = dir.lastIndexOf("/"); + } + }); + dirs.sort(function(a, b) { + const al = (a.match(/\//g) || []).length; + const bl = (b.match(/\//g) || []).length; + if (al > bl) { + return -1; + } else if (al < bl) { + return 1; + } + return 0; + }).forEach(function(dir) { + FS.rmdir(dir); + }); + }, + handler: function(callback) { + return function(ev) { + GodotInputDragDrop._process_event(ev, callback); + }; + } +}; + +var GodotInput = { + getModifiers: function(evt) { + return evt.shiftKey + 0 + (evt.altKey + 0 << 1) + (evt.ctrlKey + 0 << 2) + (evt.metaKey + 0 << 3); + }, + computePosition: function(evt, rect) { + const canvas = GodotConfig.canvas; + const rw = canvas.width / rect.width; + const rh = canvas.height / rect.height; + const x = (evt.clientX - rect.x) * rw; + const y = (evt.clientY - rect.y) * rh; + return [ x, y ]; + } +}; + +function _godot_js_input_drop_files_cb(callback) { + const func = GodotRuntime.get_func(callback); + const dropFiles = function(files) { + const args = files || []; + if (!args.length) { + return; + } + const argc = args.length; + const argv = GodotRuntime.allocStringArray(args); + func(argv, argc); + GodotRuntime.freeStringArray(argv, argc); + }; + const canvas = GodotConfig.canvas; + GodotEventListeners.add(canvas, "dragover", function(ev) { + ev.preventDefault(); + }, false); + GodotEventListeners.add(canvas, "drop", GodotInputDragDrop.handler(dropFiles)); +} + +function _godot_js_input_gamepad_cb(change_cb) { + const onchange = GodotRuntime.get_func(change_cb); + GodotInputGamepads.init(onchange); +} + +function _godot_js_input_gamepad_sample() { + GodotInputGamepads.sample(); + return 0; +} + +function _godot_js_input_gamepad_sample_count() { + return GodotInputGamepads.get_samples().length; +} + +function _godot_js_input_gamepad_sample_get(p_index, r_btns, r_btns_num, r_axes, r_axes_num, r_standard) { + const sample = GodotInputGamepads.get_sample(p_index); + if (!sample || !sample.connected) { + return 1; + } + const btns = sample.buttons; + const btns_len = btns.length < 16 ? btns.length : 16; + for (let i = 0; i < btns_len; i++) { + GodotRuntime.setHeapValue(r_btns + (i << 2), btns[i], "float"); + } + GodotRuntime.setHeapValue(r_btns_num, btns_len, "i32"); + const axes = sample.axes; + const axes_len = axes.length < 10 ? axes.length : 10; + for (let i = 0; i < axes_len; i++) { + GodotRuntime.setHeapValue(r_axes + (i << 2), axes[i], "float"); + } + GodotRuntime.setHeapValue(r_axes_num, axes_len, "i32"); + const is_standard = sample.standard ? 1 : 0; + GodotRuntime.setHeapValue(r_standard, is_standard, "i32"); + return 0; +} + +function _godot_js_input_key_cb(callback, code, key) { + const func = GodotRuntime.get_func(callback); + function key_cb(pressed, evt) { + const modifiers = GodotInput.getModifiers(evt); + GodotRuntime.stringToHeap(evt.code, code, 32); + GodotRuntime.stringToHeap(evt.key, key, 32); + func(pressed, evt.repeat, modifiers); + evt.preventDefault(); + } + GodotEventListeners.add(GodotConfig.canvas, "keydown", key_cb.bind(null, 1), false); + GodotEventListeners.add(GodotConfig.canvas, "keyup", key_cb.bind(null, 0), false); +} + +function _godot_js_input_mouse_button_cb(callback) { + const func = GodotRuntime.get_func(callback); + const canvas = GodotConfig.canvas; + function button_cb(p_pressed, evt) { + const rect = canvas.getBoundingClientRect(); + const pos = GodotInput.computePosition(evt, rect); + const modifiers = GodotInput.getModifiers(evt); + if (p_pressed) { + GodotConfig.canvas.focus(); + } + if (func(p_pressed, evt.button, pos[0], pos[1], modifiers)) { + evt.preventDefault(); + } + } + GodotEventListeners.add(canvas, "mousedown", button_cb.bind(null, 1), false); + GodotEventListeners.add(window, "mouseup", button_cb.bind(null, 0), false); +} + +function _godot_js_input_mouse_move_cb(callback) { + const func = GodotRuntime.get_func(callback); + const canvas = GodotConfig.canvas; + function move_cb(evt) { + const rect = canvas.getBoundingClientRect(); + const pos = GodotInput.computePosition(evt, rect); + const rw = canvas.width / rect.width; + const rh = canvas.height / rect.height; + const rel_pos_x = evt.movementX * rw; + const rel_pos_y = evt.movementY * rh; + const modifiers = GodotInput.getModifiers(evt); + func(pos[0], pos[1], rel_pos_x, rel_pos_y, modifiers); + } + GodotEventListeners.add(window, "mousemove", move_cb, false); +} + +function _godot_js_input_mouse_wheel_cb(callback) { + const func = GodotRuntime.get_func(callback); + function wheel_cb(evt) { + if (func(evt["deltaX"] || 0, evt["deltaY"] || 0)) { + evt.preventDefault(); + } + } + GodotEventListeners.add(GodotConfig.canvas, "wheel", wheel_cb, false); +} + +function _godot_js_input_paste_cb(callback) { + const func = GodotRuntime.get_func(callback); + GodotEventListeners.add(window, "paste", function(evt) { + const text = evt.clipboardData.getData("text"); + const ptr = GodotRuntime.allocString(text); + func(ptr); + GodotRuntime.free(ptr); + }, false); +} + +function _godot_js_input_touch_cb(callback, ids, coords) { + const func = GodotRuntime.get_func(callback); + const canvas = GodotConfig.canvas; + function touch_cb(type, evt) { + if (type === 0) { + GodotConfig.canvas.focus(); + } + const rect = canvas.getBoundingClientRect(); + const touches = evt.changedTouches; + for (let i = 0; i < touches.length; i++) { + const touch = touches[i]; + const pos = GodotInput.computePosition(touch, rect); + GodotRuntime.setHeapValue(coords + i * 2 * 8, pos[0], "double"); + GodotRuntime.setHeapValue(coords + (i * 2 + 1) * 8, pos[1], "double"); + GodotRuntime.setHeapValue(ids + i * 4, touch.identifier, "i32"); + } + func(type, touches.length); + if (evt.cancelable) { + evt.preventDefault(); + } + } + GodotEventListeners.add(canvas, "touchstart", touch_cb.bind(null, 0), false); + GodotEventListeners.add(canvas, "touchend", touch_cb.bind(null, 1), false); + GodotEventListeners.add(canvas, "touchcancel", touch_cb.bind(null, 1), false); + GodotEventListeners.add(canvas, "touchmove", touch_cb.bind(null, 2), false); +} + +function _godot_js_input_vibrate_handheld(p_duration_ms) { + if (typeof navigator.vibrate !== "function") { + GodotRuntime.print("This browser does not support vibration."); + } else { + navigator.vibrate(p_duration_ms); + } +} + +function _godot_js_os_download_buffer(p_ptr, p_size, p_name, p_mime) { + const buf = GodotRuntime.heapSlice(GROWABLE_HEAP_I8(), p_ptr, p_size); + const name = GodotRuntime.parseString(p_name); + const mime = GodotRuntime.parseString(p_mime); + const blob = new Blob([ buf ], { + type: mime + }); + const url = window.URL.createObjectURL(blob); + const a = document.createElement("a"); + a.href = url; + a.download = name; + a.style.display = "none"; + document.body.appendChild(a); + a.click(); + a.remove(); + window.URL.revokeObjectURL(url); +} + +function _godot_js_os_execute(p_json) { + const json_args = GodotRuntime.parseString(p_json); + const args = JSON.parse(json_args); + if (GodotConfig.on_execute) { + GodotConfig.on_execute(args); + return 0; + } + return 1; +} + +function _godot_js_os_finish_async(p_callback) { + const func = GodotRuntime.get_func(p_callback); + GodotOS.finish_async(func); +} + +function _godot_js_os_fs_is_persistent() { + return GodotFS.is_persistent(); +} + +function _godot_js_os_fs_sync(callback) { + const func = GodotRuntime.get_func(callback); + GodotOS._fs_sync_promise = GodotFS.sync(); + GodotOS._fs_sync_promise.then(function(err) { + func(); + }); +} + +function _godot_js_os_has_feature(p_ftr) { + const ftr = GodotRuntime.parseString(p_ftr); + const ua = navigator.userAgent; + if (ftr === "web_macos") { + return ua.indexOf("Mac") !== -1 ? 1 : 0; + } + if (ftr === "web_windows") { + return ua.indexOf("Windows") !== -1 ? 1 : 0; + } + if (ftr === "web_android") { + return ua.indexOf("Android") !== -1 ? 1 : 0; + } + if (ftr === "web_ios") { + return ua.indexOf("iPhone") !== -1 || ua.indexOf("iPad") !== -1 || ua.indexOf("iPod") !== -1 ? 1 : 0; + } + if (ftr === "web_linuxbsd") { + return ua.indexOf("CrOS") !== -1 || ua.indexOf("BSD") !== -1 || ua.indexOf("Linux") !== -1 || ua.indexOf("X11") !== -1 ? 1 : 0; + } + return 0; +} + +function _godot_js_os_hw_concurrency_get() { + const concurrency = navigator.hardwareConcurrency || 1; + return concurrency < 2 ? concurrency : 2; +} + +function _godot_js_os_request_quit_cb(p_callback) { + GodotOS.request_quit = GodotRuntime.get_func(p_callback); +} + +function _godot_js_os_shell_open(p_uri) { + window.open(GodotRuntime.parseString(p_uri), "_blank"); +} + +var GodotPWA = { + hasUpdate: false, + updateState: function(cb, reg) { + if (!reg) { + return; + } + if (!reg.active) { + return; + } + if (reg.waiting) { + GodotPWA.hasUpdate = true; + cb(); + } + GodotEventListeners.add(reg, "updatefound", function() { + const installing = reg.installing; + GodotEventListeners.add(installing, "statechange", function() { + if (installing.state === "installed") { + GodotPWA.hasUpdate = true; + cb(); + } + }); + }); + } +}; + +function _godot_js_pwa_cb(p_update_cb) { + if ("serviceWorker" in navigator) { + const cb = GodotRuntime.get_func(p_update_cb); + navigator.serviceWorker.getRegistration().then(GodotPWA.updateState.bind(null, cb)); + } +} + +function _godot_js_pwa_update() { + if ("serviceWorker" in navigator && GodotPWA.hasUpdate) { + navigator.serviceWorker.getRegistration().then(function(reg) { + if (!reg || !reg.waiting) { + return; + } + reg.waiting.postMessage("update"); + }); + return 0; + } + return 1; +} + +var GodotRTCDataChannel = { + connect: function(p_id, p_on_open, p_on_message, p_on_error, p_on_close) { + const ref = IDHandler.get(p_id); + if (!ref) { + return; + } + ref.binaryType = "arraybuffer"; + ref.onopen = function(event) { + p_on_open(); + }; + ref.onclose = function(event) { + p_on_close(); + }; + ref.onerror = function(event) { + p_on_error(); + }; + ref.onmessage = function(event) { + let buffer; + let is_string = 0; + if (event.data instanceof ArrayBuffer) { + buffer = new Uint8Array(event.data); + } else if (event.data instanceof Blob) { + GodotRuntime.error("Blob type not supported"); + return; + } else if (typeof event.data === "string") { + is_string = 1; + const enc = new TextEncoder("utf-8"); + buffer = new Uint8Array(enc.encode(event.data)); + } else { + GodotRuntime.error("Unknown message type"); + return; + } + const len = buffer.length * buffer.BYTES_PER_ELEMENT; + const out = GodotRuntime.malloc(len); + GROWABLE_HEAP_U8().set(buffer, out); + p_on_message(out, len, is_string); + GodotRuntime.free(out); + }; + }, + close: function(p_id) { + const ref = IDHandler.get(p_id); + if (!ref) { + return; + } + ref.onopen = null; + ref.onmessage = null; + ref.onerror = null; + ref.onclose = null; + ref.close(); + }, + get_prop: function(p_id, p_prop, p_def) { + const ref = IDHandler.get(p_id); + return ref && ref[p_prop] !== undefined ? ref[p_prop] : p_def; + } +}; + +function _godot_js_rtc_datachannel_close(p_id) { + const ref = IDHandler.get(p_id); + if (!ref) { + return; + } + GodotRTCDataChannel.close(p_id); +} + +function _godot_js_rtc_datachannel_connect(p_id, p_ref, p_on_open, p_on_message, p_on_error, p_on_close) { + const onopen = GodotRuntime.get_func(p_on_open).bind(null, p_ref); + const onmessage = GodotRuntime.get_func(p_on_message).bind(null, p_ref); + const onerror = GodotRuntime.get_func(p_on_error).bind(null, p_ref); + const onclose = GodotRuntime.get_func(p_on_close).bind(null, p_ref); + GodotRTCDataChannel.connect(p_id, onopen, onmessage, onerror, onclose); +} + +function _godot_js_rtc_datachannel_destroy(p_id) { + GodotRTCDataChannel.close(p_id); + IDHandler.remove(p_id); +} + +function _godot_js_rtc_datachannel_get_buffered_amount(p_id) { + return GodotRTCDataChannel.get_prop(p_id, "bufferedAmount", 0); +} + +function _godot_js_rtc_datachannel_id_get(p_id) { + return GodotRTCDataChannel.get_prop(p_id, "id", 65535); +} + +function _godot_js_rtc_datachannel_is_negotiated(p_id) { + return GodotRTCDataChannel.get_prop(p_id, "negotiated", 65535); +} + +function _godot_js_rtc_datachannel_is_ordered(p_id) { + return GodotRTCDataChannel.get_prop(p_id, "ordered", true); +} + +function _godot_js_rtc_datachannel_label_get(p_id) { + const ref = IDHandler.get(p_id); + if (!ref || !ref.label) { + return 0; + } + return GodotRuntime.allocString(ref.label); +} + +function _godot_js_rtc_datachannel_max_packet_lifetime_get(p_id) { + const ref = IDHandler.get(p_id); + if (!ref) { + return 65535; + } + if (ref["maxPacketLifeTime"] !== undefined) { + return ref["maxPacketLifeTime"]; + } else if (ref["maxRetransmitTime"] !== undefined) { + return ref["maxRetransmitTime"]; + } + return 65535; +} + +function _godot_js_rtc_datachannel_max_retransmits_get(p_id) { + return GodotRTCDataChannel.get_prop(p_id, "maxRetransmits", 65535); +} + +function _godot_js_rtc_datachannel_protocol_get(p_id) { + const ref = IDHandler.get(p_id); + if (!ref || !ref.protocol) { + return 0; + } + return GodotRuntime.allocString(ref.protocol); +} + +function _godot_js_rtc_datachannel_ready_state_get(p_id) { + const ref = IDHandler.get(p_id); + if (!ref) { + return 3; + } + switch (ref.readyState) { + case "connecting": + return 0; + + case "open": + return 1; + + case "closing": + return 2; + + case "closed": + default: + return 3; + } +} + +function _godot_js_rtc_datachannel_send(p_id, p_buffer, p_length, p_raw) { + const ref = IDHandler.get(p_id); + if (!ref) { + return 1; + } + const bytes_array = new Uint8Array(p_length); + for (let i = 0; i < p_length; i++) { + bytes_array[i] = GodotRuntime.getHeapValue(p_buffer + i, "i8"); + } + if (p_raw) { + ref.send(bytes_array.buffer); + } else { + const string = new TextDecoder("utf-8").decode(bytes_array); + ref.send(string); + } + return 0; +} + +var GodotRTCPeerConnection = { + ConnectionState: { + new: 0, + connecting: 1, + connected: 2, + disconnected: 3, + failed: 4, + closed: 5 + }, + ConnectionStateCompat: { + new: 0, + checking: 1, + connected: 2, + completed: 2, + disconnected: 3, + failed: 4, + closed: 5 + }, + IceGatheringState: { + new: 0, + gathering: 1, + complete: 2 + }, + SignalingState: { + stable: 0, + "have-local-offer": 1, + "have-remote-offer": 2, + "have-local-pranswer": 3, + "have-remote-pranswer": 4, + closed: 5 + }, + create: function(config, onConnectionChange, onSignalingChange, onIceGatheringChange, onIceCandidate, onDataChannel) { + let conn = null; + try { + conn = new RTCPeerConnection(config); + } catch (e) { + GodotRuntime.error(e); + return 0; + } + const id = IDHandler.add(conn); + if ("connectionState" in conn && conn["connectionState"] !== undefined) { + conn.onconnectionstatechange = function(event) { + if (!IDHandler.get(id)) { + return; + } + onConnectionChange(GodotRTCPeerConnection.ConnectionState[conn.connectionState] || 0); + }; + } else { + conn.oniceconnectionstatechange = function(event) { + if (!IDHandler.get(id)) { + return; + } + onConnectionChange(GodotRTCPeerConnection.ConnectionStateCompat[conn.iceConnectionState] || 0); + }; + } + conn.onicegatheringstatechange = function(event) { + if (!IDHandler.get(id)) { + return; + } + onIceGatheringChange(GodotRTCPeerConnection.IceGatheringState[conn.iceGatheringState] || 0); + }; + conn.onsignalingstatechange = function(event) { + if (!IDHandler.get(id)) { + return; + } + onSignalingChange(GodotRTCPeerConnection.SignalingState[conn.signalingState] || 0); + }; + conn.onicecandidate = function(event) { + if (!IDHandler.get(id)) { + return; + } + const c = event.candidate; + if (!c || !c.candidate) { + return; + } + const candidate_str = GodotRuntime.allocString(c.candidate); + const mid_str = GodotRuntime.allocString(c.sdpMid); + onIceCandidate(mid_str, c.sdpMLineIndex, candidate_str); + GodotRuntime.free(candidate_str); + GodotRuntime.free(mid_str); + }; + conn.ondatachannel = function(event) { + if (!IDHandler.get(id)) { + return; + } + const cid = IDHandler.add(event.channel); + onDataChannel(cid); + }; + return id; + }, + destroy: function(p_id) { + const conn = IDHandler.get(p_id); + if (!conn) { + return; + } + conn.onconnectionstatechange = null; + conn.oniceconnectionstatechange = null; + conn.onicegatheringstatechange = null; + conn.onsignalingstatechange = null; + conn.onicecandidate = null; + conn.ondatachannel = null; + IDHandler.remove(p_id); + }, + onsession: function(p_id, callback, session) { + if (!IDHandler.get(p_id)) { + return; + } + const type_str = GodotRuntime.allocString(session.type); + const sdp_str = GodotRuntime.allocString(session.sdp); + callback(type_str, sdp_str); + GodotRuntime.free(type_str); + GodotRuntime.free(sdp_str); + }, + onerror: function(p_id, callback, error) { + const ref = IDHandler.get(p_id); + if (!ref) { + return; + } + GodotRuntime.error(error); + callback(); + } +}; + +function _godot_js_rtc_pc_close(p_id) { + const ref = IDHandler.get(p_id); + if (!ref) { + return; + } + ref.close(); +} + +function _godot_js_rtc_pc_create(p_config, p_ref, p_on_connection_state_change, p_on_ice_gathering_state_change, p_on_signaling_state_change, p_on_ice_candidate, p_on_datachannel) { + const wrap = function(p_func) { + return GodotRuntime.get_func(p_func).bind(null, p_ref); + }; + return GodotRTCPeerConnection.create(JSON.parse(GodotRuntime.parseString(p_config)), wrap(p_on_connection_state_change), wrap(p_on_signaling_state_change), wrap(p_on_ice_gathering_state_change), wrap(p_on_ice_candidate), wrap(p_on_datachannel)); +} + +function _godot_js_rtc_pc_datachannel_create(p_id, p_label, p_config) { + try { + const ref = IDHandler.get(p_id); + if (!ref) { + return 0; + } + const label = GodotRuntime.parseString(p_label); + const config = JSON.parse(GodotRuntime.parseString(p_config)); + const channel = ref.createDataChannel(label, config); + return IDHandler.add(channel); + } catch (e) { + GodotRuntime.error(e); + return 0; + } +} + +function _godot_js_rtc_pc_destroy(p_id) { + GodotRTCPeerConnection.destroy(p_id); +} + +function _godot_js_rtc_pc_ice_candidate_add(p_id, p_mid_name, p_mline_idx, p_sdp) { + const ref = IDHandler.get(p_id); + if (!ref) { + return; + } + const sdpMidName = GodotRuntime.parseString(p_mid_name); + const sdpName = GodotRuntime.parseString(p_sdp); + ref.addIceCandidate(new RTCIceCandidate({ + "candidate": sdpName, + "sdpMid": sdpMidName, + "sdpMlineIndex": p_mline_idx + })); +} + +function _godot_js_rtc_pc_local_description_set(p_id, p_type, p_sdp, p_obj, p_on_error) { + const ref = IDHandler.get(p_id); + if (!ref) { + return; + } + const type = GodotRuntime.parseString(p_type); + const sdp = GodotRuntime.parseString(p_sdp); + const onerror = GodotRuntime.get_func(p_on_error).bind(null, p_obj); + ref.setLocalDescription({ + "sdp": sdp, + "type": type + }).catch(function(error) { + GodotRTCPeerConnection.onerror(p_id, onerror, error); + }); +} + +function _godot_js_rtc_pc_offer_create(p_id, p_obj, p_on_session, p_on_error) { + const ref = IDHandler.get(p_id); + if (!ref) { + return; + } + const onsession = GodotRuntime.get_func(p_on_session).bind(null, p_obj); + const onerror = GodotRuntime.get_func(p_on_error).bind(null, p_obj); + ref.createOffer().then(function(session) { + GodotRTCPeerConnection.onsession(p_id, onsession, session); + }).catch(function(error) { + GodotRTCPeerConnection.onerror(p_id, onerror, error); + }); +} + +function _godot_js_rtc_pc_remote_description_set(p_id, p_type, p_sdp, p_obj, p_session_created, p_on_error) { + const ref = IDHandler.get(p_id); + if (!ref) { + return; + } + const type = GodotRuntime.parseString(p_type); + const sdp = GodotRuntime.parseString(p_sdp); + const onerror = GodotRuntime.get_func(p_on_error).bind(null, p_obj); + const onsession = GodotRuntime.get_func(p_session_created).bind(null, p_obj); + ref.setRemoteDescription({ + "sdp": sdp, + "type": type + }).then(function() { + if (type !== "offer") { + return Promise.resolve(); + } + return ref.createAnswer().then(function(session) { + GodotRTCPeerConnection.onsession(p_id, onsession, session); + }); + }).catch(function(error) { + GodotRTCPeerConnection.onerror(p_id, onerror, error); + }); +} + +function _godot_js_tts_get_voices(p_callback) { + const func = GodotRuntime.get_func(p_callback); + try { + const arr = []; + const voices = window.speechSynthesis.getVoices(); + for (let i = 0; i < voices.length; i++) { + arr.push(`${voices[i].lang};${voices[i].name}`); + } + const c_ptr = GodotRuntime.allocStringArray(arr); + func(arr.length, c_ptr); + GodotRuntime.freeStringArray(c_ptr, arr.length); + } catch (e) {} +} + +function _godot_js_tts_is_paused() { + return window.speechSynthesis.paused; +} + +function _godot_js_tts_is_speaking() { + return window.speechSynthesis.speaking; +} + +function _godot_js_tts_pause() { + window.speechSynthesis.pause(); +} + +function _godot_js_tts_resume() { + window.speechSynthesis.resume(); +} + +function _godot_js_tts_speak(p_text, p_voice, p_volume, p_pitch, p_rate, p_utterance_id, p_callback) { + const func = GodotRuntime.get_func(p_callback); + function listener_end(evt) { + evt.currentTarget.cb(1, evt.currentTarget.id, 0); + } + function listener_start(evt) { + evt.currentTarget.cb(0, evt.currentTarget.id, 0); + } + function listener_error(evt) { + evt.currentTarget.cb(2, evt.currentTarget.id, 0); + } + function listener_bound(evt) { + evt.currentTarget.cb(3, evt.currentTarget.id, evt.charIndex); + } + const utterance = new SpeechSynthesisUtterance(GodotRuntime.parseString(p_text)); + utterance.rate = p_rate; + utterance.pitch = p_pitch; + utterance.volume = p_volume / 100; + utterance.addEventListener("end", listener_end); + utterance.addEventListener("start", listener_start); + utterance.addEventListener("error", listener_error); + utterance.addEventListener("boundary", listener_bound); + utterance.id = p_utterance_id; + utterance.cb = func; + const voice = GodotRuntime.parseString(p_voice); + const voices = window.speechSynthesis.getVoices(); + for (let i = 0; i < voices.length; i++) { + if (voices[i].name === voice) { + utterance.voice = voices[i]; + break; + } + } + window.speechSynthesis.resume(); + window.speechSynthesis.speak(utterance); +} + +function _godot_js_tts_stop() { + window.speechSynthesis.cancel(); + window.speechSynthesis.resume(); +} + +var GodotWebSocket = { + _onopen: function(p_id, callback, event) { + const ref = IDHandler.get(p_id); + if (!ref) { + return; + } + const c_str = GodotRuntime.allocString(ref.protocol); + callback(c_str); + GodotRuntime.free(c_str); + }, + _onmessage: function(p_id, callback, event) { + const ref = IDHandler.get(p_id); + if (!ref) { + return; + } + let buffer; + let is_string = 0; + if (event.data instanceof ArrayBuffer) { + buffer = new Uint8Array(event.data); + } else if (event.data instanceof Blob) { + GodotRuntime.error("Blob type not supported"); + return; + } else if (typeof event.data === "string") { + is_string = 1; + const enc = new TextEncoder("utf-8"); + buffer = new Uint8Array(enc.encode(event.data)); + } else { + GodotRuntime.error("Unknown message type"); + return; + } + const len = buffer.length * buffer.BYTES_PER_ELEMENT; + const out = GodotRuntime.malloc(len); + GROWABLE_HEAP_U8().set(buffer, out); + callback(out, len, is_string); + GodotRuntime.free(out); + }, + _onerror: function(p_id, callback, event) { + const ref = IDHandler.get(p_id); + if (!ref) { + return; + } + callback(); + }, + _onclose: function(p_id, callback, event) { + const ref = IDHandler.get(p_id); + if (!ref) { + return; + } + const c_str = GodotRuntime.allocString(event.reason); + callback(event.code, c_str, event.wasClean ? 1 : 0); + GodotRuntime.free(c_str); + }, + send: function(p_id, p_data) { + const ref = IDHandler.get(p_id); + if (!ref || ref.readyState !== ref.OPEN) { + return 1; + } + ref.send(p_data); + return 0; + }, + bufferedAmount: function(p_id) { + const ref = IDHandler.get(p_id); + if (!ref) { + return 0; + } + return ref.bufferedAmount; + }, + create: function(socket, p_on_open, p_on_message, p_on_error, p_on_close) { + const id = IDHandler.add(socket); + socket.onopen = GodotWebSocket._onopen.bind(null, id, p_on_open); + socket.onmessage = GodotWebSocket._onmessage.bind(null, id, p_on_message); + socket.onerror = GodotWebSocket._onerror.bind(null, id, p_on_error); + socket.onclose = GodotWebSocket._onclose.bind(null, id, p_on_close); + return id; + }, + close: function(p_id, p_code, p_reason) { + const ref = IDHandler.get(p_id); + if (ref && ref.readyState < ref.CLOSING) { + const code = p_code; + const reason = GodotRuntime.parseString(p_reason); + ref.close(code, reason); + } + }, + destroy: function(p_id) { + const ref = IDHandler.get(p_id); + if (!ref) { + return; + } + GodotWebSocket.close(p_id, 3001, "destroyed"); + IDHandler.remove(p_id); + ref.onopen = null; + ref.onmessage = null; + ref.onerror = null; + ref.onclose = null; + } +}; + +function _godot_js_websocket_buffered_amount(p_id) { + return GodotWebSocket.bufferedAmount(p_id); +} + +function _godot_js_websocket_close(p_id, p_code, p_reason) { + const code = p_code; + const reason = GodotRuntime.parseString(p_reason); + GodotWebSocket.close(p_id, code, reason); +} + +function _godot_js_websocket_create(p_ref, p_url, p_proto, p_on_open, p_on_message, p_on_error, p_on_close) { + const on_open = GodotRuntime.get_func(p_on_open).bind(null, p_ref); + const on_message = GodotRuntime.get_func(p_on_message).bind(null, p_ref); + const on_error = GodotRuntime.get_func(p_on_error).bind(null, p_ref); + const on_close = GodotRuntime.get_func(p_on_close).bind(null, p_ref); + const url = GodotRuntime.parseString(p_url); + const protos = GodotRuntime.parseString(p_proto); + let socket = null; + try { + if (protos) { + socket = new WebSocket(url, protos.split(",")); + } else { + socket = new WebSocket(url); + } + } catch (e) { + return 0; + } + socket.binaryType = "arraybuffer"; + return GodotWebSocket.create(socket, on_open, on_message, on_error, on_close); +} + +function _godot_js_websocket_destroy(p_id) { + GodotWebSocket.destroy(p_id); +} + +function _godot_js_websocket_send(p_id, p_buf, p_buf_len, p_raw) { + const bytes_array = new Uint8Array(p_buf_len); + let i = 0; + for (i = 0; i < p_buf_len; i++) { + bytes_array[i] = GodotRuntime.getHeapValue(p_buf + i, "i8"); + } + let out = bytes_array.buffer; + if (!p_raw) { + out = new TextDecoder("utf-8").decode(bytes_array); + } + return GodotWebSocket.send(p_id, out); +} + +var GodotJSWrapper = { + proxies: null, + cb_ret: null, + MyProxy: function(val) { + const id = IDHandler.add(this); + GodotJSWrapper.proxies.set(val, id); + let refs = 1; + this.ref = function() { + refs++; + }; + this.unref = function() { + refs--; + if (refs === 0) { + IDHandler.remove(id); + GodotJSWrapper.proxies.delete(val); + } + }; + this.get_val = function() { + return val; + }; + this.get_id = function() { + return id; + }; + }, + get_proxied: function(val) { + const id = GodotJSWrapper.proxies.get(val); + if (id === undefined) { + const proxy = new GodotJSWrapper.MyProxy(val); + return proxy.get_id(); + } + IDHandler.get(id).ref(); + return id; + }, + get_proxied_value: function(id) { + const proxy = IDHandler.get(id); + if (proxy === undefined) { + return undefined; + } + return proxy.get_val(); + }, + variant2js: function(type, val) { + switch (type) { + case 0: + return null; + + case 1: + return !!GodotRuntime.getHeapValue(val, "i64"); + + case 2: + return GodotRuntime.getHeapValue(val, "i64"); + + case 3: + return GodotRuntime.getHeapValue(val, "double"); + + case 4: + return GodotRuntime.parseString(GodotRuntime.getHeapValue(val, "*")); + + case 24: + return GodotJSWrapper.get_proxied_value(GodotRuntime.getHeapValue(val, "i64")); + + default: + return undefined; + } + }, + js2variant: function(p_val, p_exchange) { + if (p_val === undefined || p_val === null) { + return 0; + } + const type = typeof p_val; + if (type === "boolean") { + GodotRuntime.setHeapValue(p_exchange, p_val, "i64"); + return 1; + } else if (type === "number") { + if (Number.isInteger(p_val)) { + GodotRuntime.setHeapValue(p_exchange, p_val, "i64"); + return 2; + } + GodotRuntime.setHeapValue(p_exchange, p_val, "double"); + return 3; + } else if (type === "string") { + const c_str = GodotRuntime.allocString(p_val); + GodotRuntime.setHeapValue(p_exchange, c_str, "*"); + return 4; + } + const id = GodotJSWrapper.get_proxied(p_val); + GodotRuntime.setHeapValue(p_exchange, id, "i64"); + return 24; + } +}; + +function _godot_js_wrapper_create_cb(p_ref, p_func) { + const func = GodotRuntime.get_func(p_func); + let id = 0; + const cb = function() { + if (!GodotJSWrapper.get_proxied_value(id)) { + return undefined; + } + GodotJSWrapper.cb_ret = null; + const args = Array.from(arguments); + func(p_ref, GodotJSWrapper.get_proxied(args), args.length); + const ret = GodotJSWrapper.cb_ret; + GodotJSWrapper.cb_ret = null; + return ret; + }; + id = GodotJSWrapper.get_proxied(cb); + return id; +} + +function _godot_js_wrapper_create_object(p_object, p_args, p_argc, p_convert_callback, p_exchange, p_lock, p_free_lock_callback) { + const name = GodotRuntime.parseString(p_object); + if (typeof window[name] === "undefined") { + return -1; + } + const convert = GodotRuntime.get_func(p_convert_callback); + const freeLock = GodotRuntime.get_func(p_free_lock_callback); + const args = new Array(p_argc); + for (let i = 0; i < p_argc; i++) { + const type = convert(p_args, i, p_exchange, p_lock); + const lock = GodotRuntime.getHeapValue(p_lock, "*"); + args[i] = GodotJSWrapper.variant2js(type, p_exchange); + if (lock) { + freeLock(p_lock, type); + } + } + try { + const res = new window[name](...args); + return GodotJSWrapper.js2variant(res, p_exchange); + } catch (e) { + GodotRuntime.error(`Error calling constructor ${name} with args:`, args, "error:", e); + return -1; + } +} + +function _godot_js_wrapper_interface_get(p_name) { + const name = GodotRuntime.parseString(p_name); + if (typeof window[name] !== "undefined") { + return GodotJSWrapper.get_proxied(window[name]); + } + return 0; +} + +function _godot_js_wrapper_object_call(p_id, p_method, p_args, p_argc, p_convert_callback, p_exchange, p_lock, p_free_lock_callback) { + const obj = GodotJSWrapper.get_proxied_value(p_id); + if (obj === undefined) { + return -1; + } + const method = GodotRuntime.parseString(p_method); + const convert = GodotRuntime.get_func(p_convert_callback); + const freeLock = GodotRuntime.get_func(p_free_lock_callback); + const args = new Array(p_argc); + for (let i = 0; i < p_argc; i++) { + const type = convert(p_args, i, p_exchange, p_lock); + const lock = GodotRuntime.getHeapValue(p_lock, "*"); + args[i] = GodotJSWrapper.variant2js(type, p_exchange); + if (lock) { + freeLock(p_lock, type); + } + } + try { + const res = obj[method](...args); + return GodotJSWrapper.js2variant(res, p_exchange); + } catch (e) { + GodotRuntime.error(`Error calling method ${method} on:`, obj, "error:", e); + return -1; + } +} + +function _godot_js_wrapper_object_get(p_id, p_exchange, p_prop) { + const obj = GodotJSWrapper.get_proxied_value(p_id); + if (obj === undefined) { + return 0; + } + if (p_prop) { + const prop = GodotRuntime.parseString(p_prop); + try { + return GodotJSWrapper.js2variant(obj[prop], p_exchange); + } catch (e) { + GodotRuntime.error(`Error getting variable ${prop} on object`, obj); + return 0; + } + } + return GodotJSWrapper.js2variant(obj, p_exchange); +} + +function _godot_js_wrapper_object_getvar(p_id, p_type, p_exchange) { + const obj = GodotJSWrapper.get_proxied_value(p_id); + if (obj === undefined) { + return -1; + } + const prop = GodotJSWrapper.variant2js(p_type, p_exchange); + if (prop === undefined || prop === null) { + return -1; + } + try { + return GodotJSWrapper.js2variant(obj[prop], p_exchange); + } catch (e) { + GodotRuntime.error(`Error getting variable ${prop} on object`, obj, e); + return -1; + } +} + +function _godot_js_wrapper_object_set(p_id, p_name, p_type, p_exchange) { + const obj = GodotJSWrapper.get_proxied_value(p_id); + if (obj === undefined) { + return; + } + const name = GodotRuntime.parseString(p_name); + try { + obj[name] = GodotJSWrapper.variant2js(p_type, p_exchange); + } catch (e) { + GodotRuntime.error(`Error setting variable ${name} on object`, obj); + } +} + +function _godot_js_wrapper_object_set_cb_ret(p_val_type, p_val_ex) { + GodotJSWrapper.cb_ret = GodotJSWrapper.variant2js(p_val_type, p_val_ex); +} + +function _godot_js_wrapper_object_setvar(p_id, p_key_type, p_key_ex, p_val_type, p_val_ex) { + const obj = GodotJSWrapper.get_proxied_value(p_id); + if (obj === undefined) { + return -1; + } + const key = GodotJSWrapper.variant2js(p_key_type, p_key_ex); + try { + obj[key] = GodotJSWrapper.variant2js(p_val_type, p_val_ex); + return 0; + } catch (e) { + GodotRuntime.error(`Error setting variable ${key} on object`, obj); + return -1; + } +} + +function _godot_js_wrapper_object_unref(p_id) { + const proxy = IDHandler.get(p_id); + if (proxy !== undefined) { + proxy.unref(); + } +} + +var GodotWebGL2 = {}; + +function _godot_webgl2_glFramebufferTextureMultiviewOVR(target, attachment, texture, level, base_view_index, num_views) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(52, 1, target, attachment, texture, level, base_view_index, num_views); + const context = GL.currentContext; + if (typeof context.multiviewExt === "undefined") { + const ext = context.GLctx.getExtension("OVR_multiview2"); + if (!ext) { + console.error("Trying to call glFramebufferTextureMultiviewOVR() without the OVR_multiview2 extension"); + return; + } + context.multiviewExt = ext; + } + const ext = context.multiviewExt; + ext.framebufferTextureMultiviewOVR(target, attachment, GL.textures[texture], level, base_view_index, num_views); +} + +var GodotWebXR = { + gl: null, + session: null, + gl_binding: null, + layer: null, + space: null, + frame: null, + pose: null, + view_count: 1, + input_sources: [ , , , , , , , , , , , , , , , ], + touches: [ , , , , ], + onsimpleevent: null, + orig_requestAnimationFrame: null, + requestAnimationFrame: callback => { + if (GodotWebXR.session && GodotWebXR.space) { + const onFrame = function(time, frame) { + GodotWebXR.frame = frame; + GodotWebXR.pose = frame.getViewerPose(GodotWebXR.space); + callback(time); + GodotWebXR.frame = null; + GodotWebXR.pose = null; + }; + GodotWebXR.session.requestAnimationFrame(onFrame); + } else { + GodotWebXR.orig_requestAnimationFrame(callback); + } + }, + monkeyPatchRequestAnimationFrame: enable => { + if (GodotWebXR.orig_requestAnimationFrame === null) { + GodotWebXR.orig_requestAnimationFrame = Browser.requestAnimationFrame; + } + Browser.requestAnimationFrame = enable ? GodotWebXR.requestAnimationFrame : GodotWebXR.orig_requestAnimationFrame; + }, + pauseResumeMainLoop: () => { + Browser.mainLoop.pause(); + runtimeKeepalivePush(); + window.setTimeout(function() { + runtimeKeepalivePop(); + Browser.mainLoop.resume(); + }, 0); + }, + getLayer: () => { + const new_view_count = GodotWebXR.pose ? GodotWebXR.pose.views.length : 1; + let layer = GodotWebXR.layer; + if (layer && GodotWebXR.view_count === new_view_count) { + return layer; + } + if (!GodotWebXR.session || !GodotWebXR.gl_binding) { + return null; + } + const gl = GodotWebXR.gl; + layer = GodotWebXR.gl_binding.createProjectionLayer({ + textureType: new_view_count > 1 ? "texture-array" : "texture", + colorFormat: gl.RGBA8, + depthFormat: gl.DEPTH_COMPONENT24 + }); + GodotWebXR.session.updateRenderState({ + layers: [ layer ] + }); + GodotWebXR.layer = layer; + GodotWebXR.view_count = new_view_count; + return layer; + }, + getSubImage: () => { + if (!GodotWebXR.pose) { + return null; + } + const layer = GodotWebXR.getLayer(); + if (layer === null) { + return null; + } + return GodotWebXR.gl_binding.getViewSubImage(layer, GodotWebXR.pose.views[0]); + }, + getTextureId: texture => { + if (texture.name !== undefined) { + return texture.name; + } + const id = GL.getNewId(GL.textures); + texture.name = id; + GL.textures[id] = texture; + return id; + }, + addInputSource: input_source => { + let name = -1; + if (input_source.targetRayMode === "tracked-pointer" && input_source.handedness === "left") { + name = 0; + } else if (input_source.targetRayMode === "tracked-pointer" && input_source.handedness === "right") { + name = 1; + } else { + for (let i = 2; i < 16; i++) { + if (!GodotWebXR.input_sources[i]) { + name = i; + break; + } + } + } + if (name >= 0) { + GodotWebXR.input_sources[name] = input_source; + input_source.name = name; + if (input_source.targetRayMode === "screen") { + let touch_index = -1; + for (let i = 0; i < 5; i++) { + if (!GodotWebXR.touches[i]) { + touch_index = i; + break; + } + } + if (touch_index >= 0) { + GodotWebXR.touches[touch_index] = input_source; + input_source.touch_index = touch_index; + } + } + } + return name; + }, + removeInputSource: input_source => { + if (input_source.name !== undefined) { + const name = input_source.name; + if (name >= 0 && name < 16) { + GodotWebXR.input_sources[name] = null; + } + if (input_source.touch_index !== undefined) { + const touch_index = input_source.touch_index; + if (touch_index >= 0 && touch_index < 5) { + GodotWebXR.touches[touch_index] = null; + } + } + return name; + } + return -1; + }, + getInputSourceId: input_source => { + if (input_source !== undefined) { + return input_source.name; + } + return -1; + }, + getTouchIndex: input_source => { + if (input_source.touch_index !== undefined) { + return input_source.touch_index; + } + return -1; + } +}; + +function _godot_webxr_get_bounds_geometry(r_points) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(53, 1, r_points); + if (!GodotWebXR.space || !GodotWebXR.space.boundsGeometry) { + return 0; + } + const point_count = GodotWebXR.space.boundsGeometry.length; + if (point_count === 0) { + return 0; + } + const buf = GodotRuntime.malloc(point_count * 3 * 4); + for (let i = 0; i < point_count; i++) { + const point = GodotWebXR.space.boundsGeometry[i]; + GodotRuntime.setHeapValue(buf + (i * 3 + 0) * 4, point.x, "float"); + GodotRuntime.setHeapValue(buf + (i * 3 + 1) * 4, point.y, "float"); + GodotRuntime.setHeapValue(buf + (i * 3 + 2) * 4, point.z, "float"); + } + GodotRuntime.setHeapValue(r_points, buf, "i32"); + return point_count; +} + +function _godot_webxr_get_color_texture() { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(54, 1); + const subimage = GodotWebXR.getSubImage(); + if (subimage === null) { + return 0; + } + return GodotWebXR.getTextureId(subimage.colorTexture); +} + +function _godot_webxr_get_depth_texture() { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(55, 1); + const subimage = GodotWebXR.getSubImage(); + if (subimage === null) { + return 0; + } + if (!subimage.depthStencilTexture) { + return 0; + } + return GodotWebXR.getTextureId(subimage.depthStencilTexture); +} + +function _godot_webxr_get_frame_rate() { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(56, 1); + if (!GodotWebXR.session || GodotWebXR.session.frameRate === undefined) { + return 0; + } + return GodotWebXR.session.frameRate; +} + +function _godot_webxr_get_projection_for_view(p_view, r_transform) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(57, 1, p_view, r_transform); + if (!GodotWebXR.session || !GodotWebXR.pose) { + return false; + } + const matrix = GodotWebXR.pose.views[p_view].projectionMatrix; + for (let i = 0; i < 16; i++) { + GodotRuntime.setHeapValue(r_transform + i * 4, matrix[i], "float"); + } + return true; +} + +function _godot_webxr_get_render_target_size(r_size) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(58, 1, r_size); + const subimage = GodotWebXR.getSubImage(); + if (subimage === null) { + return false; + } + GodotRuntime.setHeapValue(r_size + 0, subimage.viewport.width, "i32"); + GodotRuntime.setHeapValue(r_size + 4, subimage.viewport.height, "i32"); + return true; +} + +function _godot_webxr_get_supported_frame_rates(r_frame_rates) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(59, 1, r_frame_rates); + if (!GodotWebXR.session || GodotWebXR.session.supportedFrameRates === undefined) { + return 0; + } + const frame_rate_count = GodotWebXR.session.supportedFrameRates.length; + if (frame_rate_count === 0) { + return 0; + } + const buf = GodotRuntime.malloc(frame_rate_count * 4); + for (let i = 0; i < frame_rate_count; i++) { + GodotRuntime.setHeapValue(buf + i * 4, GodotWebXR.session.supportedFrameRates[i], "float"); + } + GodotRuntime.setHeapValue(r_frame_rates, buf, "i32"); + return frame_rate_count; +} + +function _godot_webxr_get_transform_for_view(p_view, r_transform) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(60, 1, p_view, r_transform); + if (!GodotWebXR.session || !GodotWebXR.pose) { + return false; + } + const views = GodotWebXR.pose.views; + let matrix; + if (p_view >= 0) { + matrix = views[p_view].transform.matrix; + } else { + matrix = GodotWebXR.pose.transform.matrix; + } + for (let i = 0; i < 16; i++) { + GodotRuntime.setHeapValue(r_transform + i * 4, matrix[i], "float"); + } + return true; +} + +function _godot_webxr_get_velocity_texture() { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(61, 1); + const subimage = GodotWebXR.getSubImage(); + if (subimage === null) { + return 0; + } + if (!subimage.motionVectorTexture) { + return 0; + } + return GodotWebXR.getTextureId(subimage.motionVectorTexture); +} + +function _godot_webxr_get_view_count() { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(62, 1); + if (!GodotWebXR.session || !GodotWebXR.pose) { + return 1; + } + const view_count = GodotWebXR.pose.views.length; + return view_count > 0 ? view_count : 1; +} + +function _godot_webxr_get_visibility_state() { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(63, 1); + if (!GodotWebXR.session || !GodotWebXR.session.visibilityState) { + return 0; + } + return GodotRuntime.allocString(GodotWebXR.session.visibilityState); +} + +function _godot_webxr_initialize(p_session_mode, p_required_features, p_optional_features, p_requested_reference_spaces, p_on_session_started, p_on_session_ended, p_on_session_failed, p_on_input_event, p_on_simple_event) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(64, 1, p_session_mode, p_required_features, p_optional_features, p_requested_reference_spaces, p_on_session_started, p_on_session_ended, p_on_session_failed, p_on_input_event, p_on_simple_event); + GodotWebXR.monkeyPatchRequestAnimationFrame(true); + const session_mode = GodotRuntime.parseString(p_session_mode); + const required_features = GodotRuntime.parseString(p_required_features).split(",").map(s => s.trim()).filter(s => s !== ""); + const optional_features = GodotRuntime.parseString(p_optional_features).split(",").map(s => s.trim()).filter(s => s !== ""); + const requested_reference_space_types = GodotRuntime.parseString(p_requested_reference_spaces).split(",").map(s => s.trim()); + const onstarted = GodotRuntime.get_func(p_on_session_started); + const onended = GodotRuntime.get_func(p_on_session_ended); + const onfailed = GodotRuntime.get_func(p_on_session_failed); + const oninputevent = GodotRuntime.get_func(p_on_input_event); + const onsimpleevent = GodotRuntime.get_func(p_on_simple_event); + const session_init = {}; + if (required_features.length > 0) { + session_init["requiredFeatures"] = required_features; + } + if (optional_features.length > 0) { + session_init["optionalFeatures"] = optional_features; + } + navigator.xr.requestSession(session_mode, session_init).then(function(session) { + GodotWebXR.session = session; + session.addEventListener("end", function(evt) { + onended(); + }); + session.addEventListener("inputsourceschange", function(evt) { + evt.added.forEach(GodotWebXR.addInputSource); + evt.removed.forEach(GodotWebXR.removeInputSource); + }); + [ "selectstart", "selectend", "squeezestart", "squeezeend" ].forEach((input_event, index) => { + session.addEventListener(input_event, function(evt) { + GodotWebXR.frame = evt.frame; + oninputevent(index, GodotWebXR.getInputSourceId(evt.inputSource)); + GodotWebXR.frame = null; + }); + }); + session.addEventListener("visibilitychange", function(evt) { + const c_str = GodotRuntime.allocString("visibility_state_changed"); + onsimpleevent(c_str); + GodotRuntime.free(c_str); + }); + GodotWebXR.onsimpleevent = onsimpleevent; + const gl_context_handle = _emscripten_webgl_get_current_context(); + const gl = GL.getContext(gl_context_handle).GLctx; + GodotWebXR.gl = gl; + gl.makeXRCompatible().then(function() { + GodotWebXR.gl_binding = new XRWebGLBinding(session, gl); + GodotWebXR.getLayer(); + function onReferenceSpaceSuccess(reference_space, reference_space_type) { + GodotWebXR.space = reference_space; + reference_space.onreset = function(evt) { + const c_str = GodotRuntime.allocString("reference_space_reset"); + onsimpleevent(c_str); + GodotRuntime.free(c_str); + }; + GodotWebXR.pauseResumeMainLoop(); + window.setTimeout(function() { + const c_str = GodotRuntime.allocString(reference_space_type); + onstarted(c_str); + GodotRuntime.free(c_str); + }, 0); + } + function requestReferenceSpace() { + const reference_space_type = requested_reference_space_types.shift(); + session.requestReferenceSpace(reference_space_type).then(refSpace => { + onReferenceSpaceSuccess(refSpace, reference_space_type); + }).catch(() => { + if (requested_reference_space_types.length === 0) { + const c_str = GodotRuntime.allocString("Unable to get any of the requested reference space types"); + onfailed(c_str); + GodotRuntime.free(c_str); + } else { + requestReferenceSpace(); + } + }); + } + requestReferenceSpace(); + }).catch(function(error) { + const c_str = GodotRuntime.allocString(`Unable to make WebGL context compatible with WebXR: ${error}`); + onfailed(c_str); + GodotRuntime.free(c_str); + }); + }).catch(function(error) { + const c_str = GodotRuntime.allocString(`Unable to start session: ${error}`); + onfailed(c_str); + GodotRuntime.free(c_str); + }); +} + +function _godot_webxr_is_session_supported(p_session_mode, p_callback) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(65, 1, p_session_mode, p_callback); + const session_mode = GodotRuntime.parseString(p_session_mode); + const cb = GodotRuntime.get_func(p_callback); + if (navigator.xr) { + navigator.xr.isSessionSupported(session_mode).then(function(supported) { + const c_str = GodotRuntime.allocString(session_mode); + cb(c_str, supported ? 1 : 0); + GodotRuntime.free(c_str); + }); + } else { + const c_str = GodotRuntime.allocString(session_mode); + cb(c_str, 0); + GodotRuntime.free(c_str); + } +} + +function _godot_webxr_is_supported() { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(66, 1); + return !!navigator.xr; +} + +function _godot_webxr_uninitialize() { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(67, 1); + if (GodotWebXR.session) { + GodotWebXR.session.end().catch(e => {}); + } + GodotWebXR.session = null; + GodotWebXR.gl_binding = null; + GodotWebXR.layer = null; + GodotWebXR.space = null; + GodotWebXR.frame = null; + GodotWebXR.pose = null; + GodotWebXR.view_count = 1; + GodotWebXR.input_sources = new Array(16); + GodotWebXR.touches = new Array(5); + GodotWebXR.onsimpleevent = null; + GodotWebXR.monkeyPatchRequestAnimationFrame(false); + GodotWebXR.pauseResumeMainLoop(); +} + +function _godot_webxr_update_input_source(p_input_source_id, r_target_pose, r_target_ray_mode, r_touch_index, r_has_grip_pose, r_grip_pose, r_has_standard_mapping, r_button_count, r_buttons, r_axes_count, r_axes) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(68, 1, p_input_source_id, r_target_pose, r_target_ray_mode, r_touch_index, r_has_grip_pose, r_grip_pose, r_has_standard_mapping, r_button_count, r_buttons, r_axes_count, r_axes); + if (!GodotWebXR.session || !GodotWebXR.frame) { + return 0; + } + if (p_input_source_id < 0 || p_input_source_id >= GodotWebXR.input_sources.length || !GodotWebXR.input_sources[p_input_source_id]) { + return false; + } + const input_source = GodotWebXR.input_sources[p_input_source_id]; + const frame = GodotWebXR.frame; + const space = GodotWebXR.space; + const target_pose = frame.getPose(input_source.targetRaySpace, space); + if (!target_pose) { + return false; + } + const target_pose_matrix = target_pose.transform.matrix; + for (let i = 0; i < 16; i++) { + GodotRuntime.setHeapValue(r_target_pose + i * 4, target_pose_matrix[i], "float"); + } + let target_ray_mode = 0; + switch (input_source.targetRayMode) { + case "gaze": + target_ray_mode = 1; + break; + + case "tracked-pointer": + target_ray_mode = 2; + break; + + case "screen": + target_ray_mode = 3; + break; + + default: + } + GodotRuntime.setHeapValue(r_target_ray_mode, target_ray_mode, "i32"); + GodotRuntime.setHeapValue(r_touch_index, GodotWebXR.getTouchIndex(input_source), "i32"); + let has_grip_pose = false; + if (input_source.gripSpace) { + const grip_pose = frame.getPose(input_source.gripSpace, space); + if (grip_pose) { + const grip_pose_matrix = grip_pose.transform.matrix; + for (let i = 0; i < 16; i++) { + GodotRuntime.setHeapValue(r_grip_pose + i * 4, grip_pose_matrix[i], "float"); + } + has_grip_pose = true; + } + } + GodotRuntime.setHeapValue(r_has_grip_pose, has_grip_pose ? 1 : 0, "i32"); + let has_standard_mapping = false; + let button_count = 0; + let axes_count = 0; + if (input_source.gamepad) { + if (input_source.gamepad.mapping === "xr-standard") { + has_standard_mapping = true; + } + button_count = Math.min(input_source.gamepad.buttons.length, 10); + for (let i = 0; i < button_count; i++) { + GodotRuntime.setHeapValue(r_buttons + i * 4, input_source.gamepad.buttons[i].value, "float"); + } + axes_count = Math.min(input_source.gamepad.axes.length, 10); + for (let i = 0; i < axes_count; i++) { + GodotRuntime.setHeapValue(r_axes + i * 4, input_source.gamepad.axes[i], "float"); + } + } + GodotRuntime.setHeapValue(r_has_standard_mapping, has_standard_mapping ? 1 : 0, "i32"); + GodotRuntime.setHeapValue(r_button_count, button_count, "i32"); + GodotRuntime.setHeapValue(r_axes_count, axes_count, "i32"); + return true; +} + +function _godot_webxr_update_target_frame_rate(p_frame_rate) { + if (ENVIRONMENT_IS_PTHREAD) return _emscripten_proxy_to_main_thread_js(69, 1, p_frame_rate); + if (!GodotWebXR.session || GodotWebXR.session.updateTargetFrameRate === undefined) { + return; + } + GodotWebXR.session.updateTargetFrameRate(p_frame_rate).then(() => { + const c_str = GodotRuntime.allocString("display_refresh_rate_changed"); + GodotWebXR.onsimpleevent(c_str); + GodotRuntime.free(c_str); + }); +} + +function _setTempRet0(val) { + setTempRet0(val); +} + +function __isLeapYear(year) { + return year % 4 === 0 && (year % 100 !== 0 || year % 400 === 0); +} + +function __arraySum(array, index) { + var sum = 0; + for (var i = 0; i <= index; sum += array[i++]) {} + return sum; +} + +var __MONTH_DAYS_LEAP = [ 31, 29, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31 ]; + +var __MONTH_DAYS_REGULAR = [ 31, 28, 31, 30, 31, 30, 31, 31, 30, 31, 30, 31 ]; + +function __addDays(date, days) { + var newDate = new Date(date.getTime()); + while (days > 0) { + var leap = __isLeapYear(newDate.getFullYear()); + var currentMonth = newDate.getMonth(); + var daysInCurrentMonth = (leap ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR)[currentMonth]; + if (days > daysInCurrentMonth - newDate.getDate()) { + days -= daysInCurrentMonth - newDate.getDate() + 1; + newDate.setDate(1); + if (currentMonth < 11) { + newDate.setMonth(currentMonth + 1); + } else { + newDate.setMonth(0); + newDate.setFullYear(newDate.getFullYear() + 1); + } + } else { + newDate.setDate(newDate.getDate() + days); + return newDate; + } + } + return newDate; +} + +function _strftime(s, maxsize, format, tm) { + var tm_zone = GROWABLE_HEAP_I32()[tm + 40 >> 2]; + var date = { + tm_sec: GROWABLE_HEAP_I32()[tm >> 2], + tm_min: GROWABLE_HEAP_I32()[tm + 4 >> 2], + tm_hour: GROWABLE_HEAP_I32()[tm + 8 >> 2], + tm_mday: GROWABLE_HEAP_I32()[tm + 12 >> 2], + tm_mon: GROWABLE_HEAP_I32()[tm + 16 >> 2], + tm_year: GROWABLE_HEAP_I32()[tm + 20 >> 2], + tm_wday: GROWABLE_HEAP_I32()[tm + 24 >> 2], + tm_yday: GROWABLE_HEAP_I32()[tm + 28 >> 2], + tm_isdst: GROWABLE_HEAP_I32()[tm + 32 >> 2], + tm_gmtoff: GROWABLE_HEAP_I32()[tm + 36 >> 2], + tm_zone: tm_zone ? UTF8ToString(tm_zone) : "" + }; + var pattern = UTF8ToString(format); + var EXPANSION_RULES_1 = { + "%c": "%a %b %d %H:%M:%S %Y", + "%D": "%m/%d/%y", + "%F": "%Y-%m-%d", + "%h": "%b", + "%r": "%I:%M:%S %p", + "%R": "%H:%M", + "%T": "%H:%M:%S", + "%x": "%m/%d/%y", + "%X": "%H:%M:%S", + "%Ec": "%c", + "%EC": "%C", + "%Ex": "%m/%d/%y", + "%EX": "%H:%M:%S", + "%Ey": "%y", + "%EY": "%Y", + "%Od": "%d", + "%Oe": "%e", + "%OH": "%H", + "%OI": "%I", + "%Om": "%m", + "%OM": "%M", + "%OS": "%S", + "%Ou": "%u", + "%OU": "%U", + "%OV": "%V", + "%Ow": "%w", + "%OW": "%W", + "%Oy": "%y" + }; + for (var rule in EXPANSION_RULES_1) { + pattern = pattern.replace(new RegExp(rule, "g"), EXPANSION_RULES_1[rule]); + } + var WEEKDAYS = [ "Sunday", "Monday", "Tuesday", "Wednesday", "Thursday", "Friday", "Saturday" ]; + var MONTHS = [ "January", "February", "March", "April", "May", "June", "July", "August", "September", "October", "November", "December" ]; + function leadingSomething(value, digits, character) { + var str = typeof value == "number" ? value.toString() : value || ""; + while (str.length < digits) { + str = character[0] + str; + } + return str; + } + function leadingNulls(value, digits) { + return leadingSomething(value, digits, "0"); + } + function compareByDay(date1, date2) { + function sgn(value) { + return value < 0 ? -1 : value > 0 ? 1 : 0; + } + var compare; + if ((compare = sgn(date1.getFullYear() - date2.getFullYear())) === 0) { + if ((compare = sgn(date1.getMonth() - date2.getMonth())) === 0) { + compare = sgn(date1.getDate() - date2.getDate()); + } + } + return compare; + } + function getFirstWeekStartDate(janFourth) { + switch (janFourth.getDay()) { + case 0: + return new Date(janFourth.getFullYear() - 1, 11, 29); + + case 1: + return janFourth; + + case 2: + return new Date(janFourth.getFullYear(), 0, 3); + + case 3: + return new Date(janFourth.getFullYear(), 0, 2); + + case 4: + return new Date(janFourth.getFullYear(), 0, 1); + + case 5: + return new Date(janFourth.getFullYear() - 1, 11, 31); + + case 6: + return new Date(janFourth.getFullYear() - 1, 11, 30); + } + } + function getWeekBasedYear(date) { + var thisDate = __addDays(new Date(date.tm_year + 1900, 0, 1), date.tm_yday); + var janFourthThisYear = new Date(thisDate.getFullYear(), 0, 4); + var janFourthNextYear = new Date(thisDate.getFullYear() + 1, 0, 4); + var firstWeekStartThisYear = getFirstWeekStartDate(janFourthThisYear); + var firstWeekStartNextYear = getFirstWeekStartDate(janFourthNextYear); + if (compareByDay(firstWeekStartThisYear, thisDate) <= 0) { + if (compareByDay(firstWeekStartNextYear, thisDate) <= 0) { + return thisDate.getFullYear() + 1; + } + return thisDate.getFullYear(); + } + return thisDate.getFullYear() - 1; + } + var EXPANSION_RULES_2 = { + "%a": function(date) { + return WEEKDAYS[date.tm_wday].substring(0, 3); + }, + "%A": function(date) { + return WEEKDAYS[date.tm_wday]; + }, + "%b": function(date) { + return MONTHS[date.tm_mon].substring(0, 3); + }, + "%B": function(date) { + return MONTHS[date.tm_mon]; + }, + "%C": function(date) { + var year = date.tm_year + 1900; + return leadingNulls(year / 100 | 0, 2); + }, + "%d": function(date) { + return leadingNulls(date.tm_mday, 2); + }, + "%e": function(date) { + return leadingSomething(date.tm_mday, 2, " "); + }, + "%g": function(date) { + return getWeekBasedYear(date).toString().substring(2); + }, + "%G": function(date) { + return getWeekBasedYear(date); + }, + "%H": function(date) { + return leadingNulls(date.tm_hour, 2); + }, + "%I": function(date) { + var twelveHour = date.tm_hour; + if (twelveHour == 0) twelveHour = 12; else if (twelveHour > 12) twelveHour -= 12; + return leadingNulls(twelveHour, 2); + }, + "%j": function(date) { + return leadingNulls(date.tm_mday + __arraySum(__isLeapYear(date.tm_year + 1900) ? __MONTH_DAYS_LEAP : __MONTH_DAYS_REGULAR, date.tm_mon - 1), 3); + }, + "%m": function(date) { + return leadingNulls(date.tm_mon + 1, 2); + }, + "%M": function(date) { + return leadingNulls(date.tm_min, 2); + }, + "%n": function() { + return "\n"; + }, + "%p": function(date) { + if (date.tm_hour >= 0 && date.tm_hour < 12) { + return "AM"; + } + return "PM"; + }, + "%S": function(date) { + return leadingNulls(date.tm_sec, 2); + }, + "%t": function() { + return "\t"; + }, + "%u": function(date) { + return date.tm_wday || 7; + }, + "%U": function(date) { + var days = date.tm_yday + 7 - date.tm_wday; + return leadingNulls(Math.floor(days / 7), 2); + }, + "%V": function(date) { + var val = Math.floor((date.tm_yday + 7 - (date.tm_wday + 6) % 7) / 7); + if ((date.tm_wday + 371 - date.tm_yday - 2) % 7 <= 2) { + val++; + } + if (!val) { + val = 52; + var dec31 = (date.tm_wday + 7 - date.tm_yday - 1) % 7; + if (dec31 == 4 || dec31 == 5 && __isLeapYear(date.tm_year % 400 - 1)) { + val++; + } + } else if (val == 53) { + var jan1 = (date.tm_wday + 371 - date.tm_yday) % 7; + if (jan1 != 4 && (jan1 != 3 || !__isLeapYear(date.tm_year))) val = 1; + } + return leadingNulls(val, 2); + }, + "%w": function(date) { + return date.tm_wday; + }, + "%W": function(date) { + var days = date.tm_yday + 7 - (date.tm_wday + 6) % 7; + return leadingNulls(Math.floor(days / 7), 2); + }, + "%y": function(date) { + return (date.tm_year + 1900).toString().substring(2); + }, + "%Y": function(date) { + return date.tm_year + 1900; + }, + "%z": function(date) { + var off = date.tm_gmtoff; + var ahead = off >= 0; + off = Math.abs(off) / 60; + off = off / 60 * 100 + off % 60; + return (ahead ? "+" : "-") + String("0000" + off).slice(-4); + }, + "%Z": function(date) { + return date.tm_zone; + }, + "%%": function() { + return "%"; + } + }; + pattern = pattern.replace(/%%/g, "\0\0"); + for (var rule in EXPANSION_RULES_2) { + if (pattern.includes(rule)) { + pattern = pattern.replace(new RegExp(rule, "g"), EXPANSION_RULES_2[rule](date)); + } + } + pattern = pattern.replace(/\0\0/g, "%"); + var bytes = intArrayFromString(pattern, false); + if (bytes.length > maxsize) { + return 0; + } + writeArrayToMemory(bytes, s); + return bytes.length - 1; +} + +function _strftime_l(s, maxsize, format, tm) { + return _strftime(s, maxsize, format, tm); +} + +function allocateUTF8OnStack(str) { + var size = lengthBytesUTF8(str) + 1; + var ret = stackAlloc(size); + stringToUTF8Array(str, GROWABLE_HEAP_I8(), ret, size); + return ret; +} + +function uleb128Encode(n, target) { + assert(n < 16384); + if (n < 128) { + target.push(n); + } else { + target.push(n % 128 | 128, n >> 7); + } +} + +function sigToWasmTypes(sig) { + var typeNames = { + "i": "i32", + "j": "i64", + "f": "f32", + "d": "f64", + "p": "i32" + }; + var type = { + parameters: [], + results: sig[0] == "v" ? [] : [ typeNames[sig[0]] ] + }; + for (var i = 1; i < sig.length; ++i) { + assert(sig[i] in typeNames, "invalid signature char: " + sig[i]); + type.parameters.push(typeNames[sig[i]]); + } + return type; +} + +function convertJsFunctionToWasm(func, sig) { + if (typeof WebAssembly.Function == "function") { + return new WebAssembly.Function(sigToWasmTypes(sig), func); + } + var typeSectionBody = [ 1, 96 ]; + var sigRet = sig.slice(0, 1); + var sigParam = sig.slice(1); + var typeCodes = { + "i": 127, + "p": 127, + "j": 126, + "f": 125, + "d": 124 + }; + uleb128Encode(sigParam.length, typeSectionBody); + for (var i = 0; i < sigParam.length; ++i) { + assert(sigParam[i] in typeCodes, "invalid signature char: " + sigParam[i]); + typeSectionBody.push(typeCodes[sigParam[i]]); + } + if (sigRet == "v") { + typeSectionBody.push(0); + } else { + typeSectionBody.push(1, typeCodes[sigRet]); + } + var bytes = [ 0, 97, 115, 109, 1, 0, 0, 0, 1 ]; + uleb128Encode(typeSectionBody.length, bytes); + bytes.push.apply(bytes, typeSectionBody); + bytes.push(2, 7, 1, 1, 101, 1, 102, 0, 0, 7, 5, 1, 1, 102, 0, 0); + var module = new WebAssembly.Module(new Uint8Array(bytes)); + var instance = new WebAssembly.Instance(module, { + "e": { + "f": func + } + }); + var wrappedFunc = instance.exports["f"]; + return wrappedFunc; +} + +function updateTableMap(offset, count) { + if (functionsInTableMap) { + for (var i = offset; i < offset + count; i++) { + var item = getWasmTableEntry(i); + if (item) { + functionsInTableMap.set(item, i); + } + } + } +} + +var functionsInTableMap = undefined; + +var freeTableIndexes = []; + +function getEmptyTableSlot() { + if (freeTableIndexes.length) { + return freeTableIndexes.pop(); + } + try { + wasmTable.grow(1); + } catch (err) { + if (!(err instanceof RangeError)) { + throw err; + } + throw "Unable to grow wasm table. Set ALLOW_TABLE_GROWTH."; + } + return wasmTable.length - 1; +} + +function setWasmTableEntry(idx, func) { + wasmTable.set(idx, func); + wasmTableMirror[idx] = wasmTable.get(idx); +} + +function addFunction(func, sig) { + assert(typeof func != "undefined"); + if (!functionsInTableMap) { + functionsInTableMap = new WeakMap(); + updateTableMap(0, wasmTable.length); + } + if (functionsInTableMap.has(func)) { + return functionsInTableMap.get(func); + } + var ret = getEmptyTableSlot(); + try { + setWasmTableEntry(ret, func); + } catch (err) { + if (!(err instanceof TypeError)) { + throw err; + } + assert(typeof sig != "undefined", "Missing signature argument to addFunction: " + func); + var wrapped = convertJsFunctionToWasm(func, sig); + setWasmTableEntry(ret, wrapped); + } + functionsInTableMap.set(func, ret); + return ret; +} + +function removeFunction(index) { + functionsInTableMap.delete(getWasmTableEntry(index)); + freeTableIndexes.push(index); +} + +var ALLOC_NORMAL = 0; + +var ALLOC_STACK = 1; + +function allocate(slab, allocator) { + var ret; + assert(typeof allocator == "number", "allocate no longer takes a type argument"); + assert(typeof slab != "number", "allocate no longer takes a number as arg0"); + if (allocator == ALLOC_STACK) { + ret = stackAlloc(slab.length); + } else { + ret = _malloc(slab.length); + } + if (!slab.subarray && !slab.slice) { + slab = new Uint8Array(slab); + } + GROWABLE_HEAP_U8().set(slab, ret); + return ret; +} + +function AsciiToString(ptr) { + var str = ""; + while (1) { + var ch = GROWABLE_HEAP_U8()[ptr++ >> 0]; + if (!ch) return str; + str += String.fromCharCode(ch); + } +} + +function stringToAscii(str, outPtr) { + return writeAsciiToMemory(str, outPtr, false); +} + +var UTF16Decoder = typeof TextDecoder != "undefined" ? new TextDecoder("utf-16le") : undefined; + +function UTF16ToString(ptr, maxBytesToRead) { + assert(ptr % 2 == 0, "Pointer passed to UTF16ToString must be aligned to two bytes!"); + var endPtr = ptr; + var idx = endPtr >> 1; + var maxIdx = idx + maxBytesToRead / 2; + while (!(idx >= maxIdx) && GROWABLE_HEAP_U16()[idx]) ++idx; + endPtr = idx << 1; + if (endPtr - ptr > 32 && UTF16Decoder) { + return UTF16Decoder.decode(GROWABLE_HEAP_U8().slice(ptr, endPtr)); + } else { + var str = ""; + for (var i = 0; !(i >= maxBytesToRead / 2); ++i) { + var codeUnit = GROWABLE_HEAP_I16()[ptr + i * 2 >> 1]; + if (codeUnit == 0) break; + str += String.fromCharCode(codeUnit); + } + return str; + } +} + +function stringToUTF16(str, outPtr, maxBytesToWrite) { + assert(outPtr % 2 == 0, "Pointer passed to stringToUTF16 must be aligned to two bytes!"); + assert(typeof maxBytesToWrite == "number", "stringToUTF16(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!"); + if (maxBytesToWrite === undefined) { + maxBytesToWrite = 2147483647; + } + if (maxBytesToWrite < 2) return 0; + maxBytesToWrite -= 2; + var startPtr = outPtr; + var numCharsToWrite = maxBytesToWrite < str.length * 2 ? maxBytesToWrite / 2 : str.length; + for (var i = 0; i < numCharsToWrite; ++i) { + var codeUnit = str.charCodeAt(i); + GROWABLE_HEAP_I16()[outPtr >> 1] = codeUnit; + outPtr += 2; + } + GROWABLE_HEAP_I16()[outPtr >> 1] = 0; + return outPtr - startPtr; +} + +function lengthBytesUTF16(str) { + return str.length * 2; +} + +function UTF32ToString(ptr, maxBytesToRead) { + assert(ptr % 4 == 0, "Pointer passed to UTF32ToString must be aligned to four bytes!"); + var i = 0; + var str = ""; + while (!(i >= maxBytesToRead / 4)) { + var utf32 = GROWABLE_HEAP_I32()[ptr + i * 4 >> 2]; + if (utf32 == 0) break; + ++i; + if (utf32 >= 65536) { + var ch = utf32 - 65536; + str += String.fromCharCode(55296 | ch >> 10, 56320 | ch & 1023); + } else { + str += String.fromCharCode(utf32); + } + } + return str; +} + +function stringToUTF32(str, outPtr, maxBytesToWrite) { + assert(outPtr % 4 == 0, "Pointer passed to stringToUTF32 must be aligned to four bytes!"); + assert(typeof maxBytesToWrite == "number", "stringToUTF32(str, outPtr, maxBytesToWrite) is missing the third parameter that specifies the length of the output buffer!"); + if (maxBytesToWrite === undefined) { + maxBytesToWrite = 2147483647; + } + if (maxBytesToWrite < 4) return 0; + var startPtr = outPtr; + var endPtr = startPtr + maxBytesToWrite - 4; + for (var i = 0; i < str.length; ++i) { + var codeUnit = str.charCodeAt(i); + if (codeUnit >= 55296 && codeUnit <= 57343) { + var trailSurrogate = str.charCodeAt(++i); + codeUnit = 65536 + ((codeUnit & 1023) << 10) | trailSurrogate & 1023; + } + GROWABLE_HEAP_I32()[outPtr >> 2] = codeUnit; + outPtr += 4; + if (outPtr + 4 > endPtr) break; + } + GROWABLE_HEAP_I32()[outPtr >> 2] = 0; + return outPtr - startPtr; +} + +function lengthBytesUTF32(str) { + var len = 0; + for (var i = 0; i < str.length; ++i) { + var codeUnit = str.charCodeAt(i); + if (codeUnit >= 55296 && codeUnit <= 57343) ++i; + len += 4; + } + return len; +} + +function writeStringToMemory(string, buffer, dontAddNull) { + warnOnce("writeStringToMemory is deprecated and should not be called! Use stringToUTF8() instead!"); + var lastChar, end; + if (dontAddNull) { + end = buffer + lengthBytesUTF8(string); + lastChar = GROWABLE_HEAP_I8()[end]; + } + stringToUTF8(string, buffer, Infinity); + if (dontAddNull) GROWABLE_HEAP_I8()[end] = lastChar; +} + +function intArrayToString(array) { + var ret = []; + for (var i = 0; i < array.length; i++) { + var chr = array[i]; + if (chr > 255) { + if (ASSERTIONS) { + assert(false, "Character code " + chr + " (" + String.fromCharCode(chr) + ") at offset " + i + " not in 0x00-0xFF."); + } + chr &= 255; + } + ret.push(String.fromCharCode(chr)); + } + return ret.join(""); +} + +function getCFunc(ident) { + var func = Module["_" + ident]; + assert(func, "Cannot call unknown function " + ident + ", make sure it is exported"); + return func; +} + +function ccall(ident, returnType, argTypes, args, opts) { + var toC = { + "string": str => { + var ret = 0; + if (str !== null && str !== undefined && str !== 0) { + var len = (str.length << 2) + 1; + ret = stackAlloc(len); + stringToUTF8(str, ret, len); + } + return ret; + }, + "array": arr => { + var ret = stackAlloc(arr.length); + writeArrayToMemory(arr, ret); + return ret; + } + }; + function convertReturnValue(ret) { + if (returnType === "string") { + return UTF8ToString(ret); + } + if (returnType === "boolean") return Boolean(ret); + return ret; + } + var func = getCFunc(ident); + var cArgs = []; + var stack = 0; + assert(returnType !== "array", 'Return type should not be "array".'); + if (args) { + for (var i = 0; i < args.length; i++) { + var converter = toC[argTypes[i]]; + if (converter) { + if (stack === 0) stack = stackSave(); + cArgs[i] = converter(args[i]); + } else { + cArgs[i] = args[i]; + } + } + } + var ret = func.apply(null, cArgs); + function onDone(ret) { + if (stack !== 0) stackRestore(stack); + return convertReturnValue(ret); + } + ret = onDone(ret); + return ret; +} + +function cwrap(ident, returnType, argTypes, opts) { + return function() { + return ccall(ident, returnType, argTypes, arguments, opts); + }; +} + +PThread.init(); + +var FSNode = function(parent, name, mode, rdev) { + if (!parent) { + parent = this; + } + this.parent = parent; + this.mount = parent.mount; + this.mounted = null; + this.id = FS.nextInode++; + this.name = name; + this.mode = mode; + this.node_ops = {}; + this.stream_ops = {}; + this.rdev = rdev; +}; + +var readMode = 292 | 73; + +var writeMode = 146; + +Object.defineProperties(FSNode.prototype, { + read: { + get: function() { + return (this.mode & readMode) === readMode; + }, + set: function(val) { + val ? this.mode |= readMode : this.mode &= ~readMode; + } + }, + write: { + get: function() { + return (this.mode & writeMode) === writeMode; + }, + set: function(val) { + val ? this.mode |= writeMode : this.mode &= ~writeMode; + } + }, + isFolder: { + get: function() { + return FS.isDir(this.mode); + } + }, + isDevice: { + get: function() { + return FS.isChrdev(this.mode); + } + } +}); + +FS.FSNode = FSNode; + +FS.staticInit(); + +ERRNO_CODES = { + "EPERM": 63, + "ENOENT": 44, + "ESRCH": 71, + "EINTR": 27, + "EIO": 29, + "ENXIO": 60, + "E2BIG": 1, + "ENOEXEC": 45, + "EBADF": 8, + "ECHILD": 12, + "EAGAIN": 6, + "EWOULDBLOCK": 6, + "ENOMEM": 48, + "EACCES": 2, + "EFAULT": 21, + "ENOTBLK": 105, + "EBUSY": 10, + "EEXIST": 20, + "EXDEV": 75, + "ENODEV": 43, + "ENOTDIR": 54, + "EISDIR": 31, + "EINVAL": 28, + "ENFILE": 41, + "EMFILE": 33, + "ENOTTY": 59, + "ETXTBSY": 74, + "EFBIG": 22, + "ENOSPC": 51, + "ESPIPE": 70, + "EROFS": 69, + "EMLINK": 34, + "EPIPE": 64, + "EDOM": 18, + "ERANGE": 68, + "ENOMSG": 49, + "EIDRM": 24, + "ECHRNG": 106, + "EL2NSYNC": 156, + "EL3HLT": 107, + "EL3RST": 108, + "ELNRNG": 109, + "EUNATCH": 110, + "ENOCSI": 111, + "EL2HLT": 112, + "EDEADLK": 16, + "ENOLCK": 46, + "EBADE": 113, + "EBADR": 114, + "EXFULL": 115, + "ENOANO": 104, + "EBADRQC": 103, + "EBADSLT": 102, + "EDEADLOCK": 16, + "EBFONT": 101, + "ENOSTR": 100, + "ENODATA": 116, + "ETIME": 117, + "ENOSR": 118, + "ENONET": 119, + "ENOPKG": 120, + "EREMOTE": 121, + "ENOLINK": 47, + "EADV": 122, + "ESRMNT": 123, + "ECOMM": 124, + "EPROTO": 65, + "EMULTIHOP": 36, + "EDOTDOT": 125, + "EBADMSG": 9, + "ENOTUNIQ": 126, + "EBADFD": 127, + "EREMCHG": 128, + "ELIBACC": 129, + "ELIBBAD": 130, + "ELIBSCN": 131, + "ELIBMAX": 132, + "ELIBEXEC": 133, + "ENOSYS": 52, + "ENOTEMPTY": 55, + "ENAMETOOLONG": 37, + "ELOOP": 32, + "EOPNOTSUPP": 138, + "EPFNOSUPPORT": 139, + "ECONNRESET": 15, + "ENOBUFS": 42, + "EAFNOSUPPORT": 5, + "EPROTOTYPE": 67, + "ENOTSOCK": 57, + "ENOPROTOOPT": 50, + "ESHUTDOWN": 140, + "ECONNREFUSED": 14, + "EADDRINUSE": 3, + "ECONNABORTED": 13, + "ENETUNREACH": 40, + "ENETDOWN": 38, + "ETIMEDOUT": 73, + "EHOSTDOWN": 142, + "EHOSTUNREACH": 23, + "EINPROGRESS": 26, + "EALREADY": 7, + "EDESTADDRREQ": 17, + "EMSGSIZE": 35, + "EPROTONOSUPPORT": 66, + "ESOCKTNOSUPPORT": 137, + "EADDRNOTAVAIL": 4, + "ENETRESET": 39, + "EISCONN": 30, + "ENOTCONN": 53, + "ETOOMANYREFS": 141, + "EUSERS": 136, + "EDQUOT": 19, + "ESTALE": 72, + "ENOTSUP": 138, + "ENOMEDIUM": 148, + "EILSEQ": 25, + "EOVERFLOW": 61, + "ECANCELED": 11, + "ENOTRECOVERABLE": 56, + "EOWNERDEAD": 62, + "ESTRPIPE": 135 +}; + +Module["requestFullscreen"] = function Module_requestFullscreen(lockPointer, resizeCanvas) { + Browser.requestFullscreen(lockPointer, resizeCanvas); +}; + +Module["requestFullScreen"] = function Module_requestFullScreen() { + Browser.requestFullScreen(); +}; + +Module["requestAnimationFrame"] = function Module_requestAnimationFrame(func) { + Browser.requestAnimationFrame(func); +}; + +Module["setCanvasSize"] = function Module_setCanvasSize(width, height, noUpdates) { + Browser.setCanvasSize(width, height, noUpdates); +}; + +Module["pauseMainLoop"] = function Module_pauseMainLoop() { + Browser.mainLoop.pause(); +}; + +Module["resumeMainLoop"] = function Module_resumeMainLoop() { + Browser.mainLoop.resume(); +}; + +Module["getUserMedia"] = function Module_getUserMedia() { + Browser.getUserMedia(); +}; + +Module["createContext"] = function Module_createContext(canvas, useWebGL, setInModule, webGLContextAttributes) { + return Browser.createContext(canvas, useWebGL, setInModule, webGLContextAttributes); +}; + +var preloadedImages = {}; + +var preloadedAudios = {}; + +var GLctx; + +var __miniTempWebGLIntBuffersStorage = new Int32Array(288); + +for (var i = 0; i < 288; ++i) { + __miniTempWebGLIntBuffers[i] = __miniTempWebGLIntBuffersStorage.subarray(0, i + 1); +} + +var miniTempWebGLFloatBuffersStorage = new Float32Array(288); + +for (var i = 0; i < 288; ++i) { + miniTempWebGLFloatBuffers[i] = miniTempWebGLFloatBuffersStorage.subarray(0, i + 1); +} + +Module["request_quit"] = function() { + GodotOS.request_quit(); +}; + +Module["onExit"] = GodotOS.cleanup; + +GodotOS._fs_sync_promise = Promise.resolve(); + +Module["initConfig"] = GodotConfig.init_config; + +Module["initFS"] = GodotFS.init; + +Module["copyToFS"] = GodotFS.copy_to_fs; + +GodotOS.atexit(function(resolve, reject) { + GodotDisplayCursor.clear(); + resolve(); +}); + +GodotOS.atexit(function(resolve, reject) { + GodotEventListeners.clear(); + resolve(); +}); + +GodotOS.atexit(function(resolve, reject) { + GodotDisplayVK.clear(); + resolve(); +}); + +GodotJSWrapper.proxies = new Map(); + +var proxiedFunctionTable = [ null, _proc_exit, exitOnMainThread, pthreadCreateProxied, ___syscall__newselect, ___syscall_accept4, ___syscall_bind, ___syscall_chdir, ___syscall_chmod, ___syscall_connect, ___syscall_faccessat, ___syscall_fchmod, ___syscall_fcntl64, ___syscall_getcwd, ___syscall_getdents64, ___syscall_getsockname, ___syscall_getsockopt, ___syscall_ioctl, ___syscall_listen, ___syscall_lstat64, ___syscall_mkdirat, ___syscall_newfstatat, ___syscall_openat, ___syscall_poll, ___syscall_readlinkat, ___syscall_recvfrom, ___syscall_renameat, ___syscall_rmdir, ___syscall_sendto, ___syscall_socket, ___syscall_stat64, ___syscall_statfs64, ___syscall_symlink, ___syscall_unlinkat, __mmap_js, __munmap_js, _tzset_impl, _emscripten_force_exit, _emscripten_webgl_destroy_context, _emscripten_webgl_create_context_proxied, _emscripten_webgl_enable_extension, _environ_get, _environ_sizes_get, _fd_close, _fd_fdstat_get, _fd_read, _fd_seek, _fd_write, _getaddrinfo, _godot_audio_input_start, _godot_audio_input_stop, _godot_audio_is_available, _godot_webgl2_glFramebufferTextureMultiviewOVR, _godot_webxr_get_bounds_geometry, _godot_webxr_get_color_texture, _godot_webxr_get_depth_texture, _godot_webxr_get_frame_rate, _godot_webxr_get_projection_for_view, _godot_webxr_get_render_target_size, _godot_webxr_get_supported_frame_rates, _godot_webxr_get_transform_for_view, _godot_webxr_get_velocity_texture, _godot_webxr_get_view_count, _godot_webxr_get_visibility_state, _godot_webxr_initialize, _godot_webxr_is_session_supported, _godot_webxr_is_supported, _godot_webxr_uninitialize, _godot_webxr_update_input_source, _godot_webxr_update_target_frame_rate ]; + +var ASSERTIONS = true; + +function checkIncomingModuleAPI() { + ignoredModuleProp("fetchSettings"); +} + +var asmLibraryArg = { + "__assert_fail": ___assert_fail, + "__call_sighandler": ___call_sighandler, + "__emscripten_init_main_thread_js": ___emscripten_init_main_thread_js, + "__emscripten_thread_cleanup": ___emscripten_thread_cleanup, + "__pthread_create_js": ___pthread_create_js, + "__syscall__newselect": ___syscall__newselect, + "__syscall_accept4": ___syscall_accept4, + "__syscall_bind": ___syscall_bind, + "__syscall_chdir": ___syscall_chdir, + "__syscall_chmod": ___syscall_chmod, + "__syscall_connect": ___syscall_connect, + "__syscall_faccessat": ___syscall_faccessat, + "__syscall_fchmod": ___syscall_fchmod, + "__syscall_fcntl64": ___syscall_fcntl64, + "__syscall_getcwd": ___syscall_getcwd, + "__syscall_getdents64": ___syscall_getdents64, + "__syscall_getsockname": ___syscall_getsockname, + "__syscall_getsockopt": ___syscall_getsockopt, + "__syscall_ioctl": ___syscall_ioctl, + "__syscall_listen": ___syscall_listen, + "__syscall_lstat64": ___syscall_lstat64, + "__syscall_mkdirat": ___syscall_mkdirat, + "__syscall_newfstatat": ___syscall_newfstatat, + "__syscall_openat": ___syscall_openat, + "__syscall_poll": ___syscall_poll, + "__syscall_readlinkat": ___syscall_readlinkat, + "__syscall_recvfrom": ___syscall_recvfrom, + "__syscall_renameat": ___syscall_renameat, + "__syscall_rmdir": ___syscall_rmdir, + "__syscall_sendto": ___syscall_sendto, + "__syscall_socket": ___syscall_socket, + "__syscall_stat64": ___syscall_stat64, + "__syscall_statfs64": ___syscall_statfs64, + "__syscall_symlink": ___syscall_symlink, + "__syscall_unlinkat": ___syscall_unlinkat, + "_dlinit": __dlinit, + "_dlopen_js": __dlopen_js, + "_dlsym_js": __dlsym_js, + "_emscripten_date_now": __emscripten_date_now, + "_emscripten_default_pthread_stack_size": __emscripten_default_pthread_stack_size, + "_emscripten_get_now_is_monotonic": __emscripten_get_now_is_monotonic, + "_emscripten_notify_task_queue": __emscripten_notify_task_queue, + "_emscripten_proxied_gl_context_activated_from_main_browser_thread": __emscripten_proxied_gl_context_activated_from_main_browser_thread, + "_emscripten_set_offscreencanvas_size": __emscripten_set_offscreencanvas_size, + "_emscripten_throw_longjmp": __emscripten_throw_longjmp, + "_gmtime_js": __gmtime_js, + "_localtime_js": __localtime_js, + "_mmap_js": __mmap_js, + "_munmap_js": __munmap_js, + "_tzset_js": __tzset_js, + "abort": _abort, + "emscripten_cancel_main_loop": _emscripten_cancel_main_loop, + "emscripten_check_blocking_allowed": _emscripten_check_blocking_allowed, + "emscripten_console_error": _emscripten_console_error, + "emscripten_force_exit": _emscripten_force_exit, + "emscripten_get_now": _emscripten_get_now, + "emscripten_glActiveTexture": _emscripten_glActiveTexture, + "emscripten_glAttachShader": _emscripten_glAttachShader, + "emscripten_glBeginTransformFeedback": _emscripten_glBeginTransformFeedback, + "emscripten_glBindBuffer": _emscripten_glBindBuffer, + "emscripten_glBindBufferBase": _emscripten_glBindBufferBase, + "emscripten_glBindBufferRange": _emscripten_glBindBufferRange, + "emscripten_glBindFramebuffer": _emscripten_glBindFramebuffer, + "emscripten_glBindRenderbuffer": _emscripten_glBindRenderbuffer, + "emscripten_glBindTexture": _emscripten_glBindTexture, + "emscripten_glBindVertexArray": _emscripten_glBindVertexArray, + "emscripten_glBlendColor": _emscripten_glBlendColor, + "emscripten_glBlendEquation": _emscripten_glBlendEquation, + "emscripten_glBlendFunc": _emscripten_glBlendFunc, + "emscripten_glBlendFuncSeparate": _emscripten_glBlendFuncSeparate, + "emscripten_glBlitFramebuffer": _emscripten_glBlitFramebuffer, + "emscripten_glBufferData": _emscripten_glBufferData, + "emscripten_glBufferSubData": _emscripten_glBufferSubData, + "emscripten_glCheckFramebufferStatus": _emscripten_glCheckFramebufferStatus, + "emscripten_glClear": _emscripten_glClear, + "emscripten_glClearBufferfv": _emscripten_glClearBufferfv, + "emscripten_glClearColor": _emscripten_glClearColor, + "emscripten_glClearDepthf": _emscripten_glClearDepthf, + "emscripten_glColorMask": _emscripten_glColorMask, + "emscripten_glCompileShader": _emscripten_glCompileShader, + "emscripten_glCompressedTexImage2D": _emscripten_glCompressedTexImage2D, + "emscripten_glCopyBufferSubData": _emscripten_glCopyBufferSubData, + "emscripten_glCreateProgram": _emscripten_glCreateProgram, + "emscripten_glCreateShader": _emscripten_glCreateShader, + "emscripten_glCullFace": _emscripten_glCullFace, + "emscripten_glDeleteBuffers": _emscripten_glDeleteBuffers, + "emscripten_glDeleteFramebuffers": _emscripten_glDeleteFramebuffers, + "emscripten_glDeleteProgram": _emscripten_glDeleteProgram, + "emscripten_glDeleteQueries": _emscripten_glDeleteQueries, + "emscripten_glDeleteRenderbuffers": _emscripten_glDeleteRenderbuffers, + "emscripten_glDeleteShader": _emscripten_glDeleteShader, + "emscripten_glDeleteSync": _emscripten_glDeleteSync, + "emscripten_glDeleteTextures": _emscripten_glDeleteTextures, + "emscripten_glDeleteVertexArrays": _emscripten_glDeleteVertexArrays, + "emscripten_glDepthFunc": _emscripten_glDepthFunc, + "emscripten_glDepthMask": _emscripten_glDepthMask, + "emscripten_glDisable": _emscripten_glDisable, + "emscripten_glDisableVertexAttribArray": _emscripten_glDisableVertexAttribArray, + "emscripten_glDrawArrays": _emscripten_glDrawArrays, + "emscripten_glDrawArraysInstanced": _emscripten_glDrawArraysInstanced, + "emscripten_glDrawElements": _emscripten_glDrawElements, + "emscripten_glDrawElementsInstanced": _emscripten_glDrawElementsInstanced, + "emscripten_glEnable": _emscripten_glEnable, + "emscripten_glEnableVertexAttribArray": _emscripten_glEnableVertexAttribArray, + "emscripten_glEndTransformFeedback": _emscripten_glEndTransformFeedback, + "emscripten_glFenceSync": _emscripten_glFenceSync, + "emscripten_glFinish": _emscripten_glFinish, + "emscripten_glFramebufferRenderbuffer": _emscripten_glFramebufferRenderbuffer, + "emscripten_glFramebufferTexture2D": _emscripten_glFramebufferTexture2D, + "emscripten_glFramebufferTextureLayer": _emscripten_glFramebufferTextureLayer, + "emscripten_glFrontFace": _emscripten_glFrontFace, + "emscripten_glGenBuffers": _emscripten_glGenBuffers, + "emscripten_glGenFramebuffers": _emscripten_glGenFramebuffers, + "emscripten_glGenQueries": _emscripten_glGenQueries, + "emscripten_glGenRenderbuffers": _emscripten_glGenRenderbuffers, + "emscripten_glGenTextures": _emscripten_glGenTextures, + "emscripten_glGenVertexArrays": _emscripten_glGenVertexArrays, + "emscripten_glGenerateMipmap": _emscripten_glGenerateMipmap, + "emscripten_glGetFloatv": _emscripten_glGetFloatv, + "emscripten_glGetIntegerv": _emscripten_glGetIntegerv, + "emscripten_glGetProgramInfoLog": _emscripten_glGetProgramInfoLog, + "emscripten_glGetProgramiv": _emscripten_glGetProgramiv, + "emscripten_glGetShaderInfoLog": _emscripten_glGetShaderInfoLog, + "emscripten_glGetShaderiv": _emscripten_glGetShaderiv, + "emscripten_glGetString": _emscripten_glGetString, + "emscripten_glGetStringi": _emscripten_glGetStringi, + "emscripten_glGetSynciv": _emscripten_glGetSynciv, + "emscripten_glGetUniformBlockIndex": _emscripten_glGetUniformBlockIndex, + "emscripten_glGetUniformLocation": _emscripten_glGetUniformLocation, + "emscripten_glLinkProgram": _emscripten_glLinkProgram, + "emscripten_glPixelStorei": _emscripten_glPixelStorei, + "emscripten_glReadBuffer": _emscripten_glReadBuffer, + "emscripten_glReadPixels": _emscripten_glReadPixels, + "emscripten_glRenderbufferStorage": _emscripten_glRenderbufferStorage, + "emscripten_glScissor": _emscripten_glScissor, + "emscripten_glShaderSource": _emscripten_glShaderSource, + "emscripten_glTexImage2D": _emscripten_glTexImage2D, + "emscripten_glTexImage3D": _emscripten_glTexImage3D, + "emscripten_glTexParameterf": _emscripten_glTexParameterf, + "emscripten_glTexParameteri": _emscripten_glTexParameteri, + "emscripten_glTexStorage2D": _emscripten_glTexStorage2D, + "emscripten_glTexSubImage3D": _emscripten_glTexSubImage3D, + "emscripten_glTransformFeedbackVaryings": _emscripten_glTransformFeedbackVaryings, + "emscripten_glUniform1f": _emscripten_glUniform1f, + "emscripten_glUniform1i": _emscripten_glUniform1i, + "emscripten_glUniform1iv": _emscripten_glUniform1iv, + "emscripten_glUniform1ui": _emscripten_glUniform1ui, + "emscripten_glUniform1uiv": _emscripten_glUniform1uiv, + "emscripten_glUniform2f": _emscripten_glUniform2f, + "emscripten_glUniform2fv": _emscripten_glUniform2fv, + "emscripten_glUniform2iv": _emscripten_glUniform2iv, + "emscripten_glUniform3fv": _emscripten_glUniform3fv, + "emscripten_glUniform4f": _emscripten_glUniform4f, + "emscripten_glUniform4fv": _emscripten_glUniform4fv, + "emscripten_glUniformBlockBinding": _emscripten_glUniformBlockBinding, + "emscripten_glUniformMatrix4fv": _emscripten_glUniformMatrix4fv, + "emscripten_glUseProgram": _emscripten_glUseProgram, + "emscripten_glVertexAttrib4f": _emscripten_glVertexAttrib4f, + "emscripten_glVertexAttribDivisor": _emscripten_glVertexAttribDivisor, + "emscripten_glVertexAttribIPointer": _emscripten_glVertexAttribIPointer, + "emscripten_glVertexAttribPointer": _emscripten_glVertexAttribPointer, + "emscripten_glViewport": _emscripten_glViewport, + "emscripten_memcpy_big": _emscripten_memcpy_big, + "emscripten_num_logical_cores": _emscripten_num_logical_cores, + "emscripten_receive_on_main_thread_js": _emscripten_receive_on_main_thread_js, + "emscripten_resize_heap": _emscripten_resize_heap, + "emscripten_set_main_loop": _emscripten_set_main_loop, + "emscripten_supports_offscreencanvas": _emscripten_supports_offscreencanvas, + "emscripten_unwind_to_js_event_loop": _emscripten_unwind_to_js_event_loop, + "emscripten_webgl_destroy_context": _emscripten_webgl_destroy_context, + "emscripten_webgl_do_commit_frame": _emscripten_webgl_do_commit_frame, + "emscripten_webgl_do_create_context": _emscripten_webgl_do_create_context, + "emscripten_webgl_enable_extension": _emscripten_webgl_enable_extension, + "emscripten_webgl_init_context_attributes": _emscripten_webgl_init_context_attributes, + "emscripten_webgl_make_context_current_calling_thread": _emscripten_webgl_make_context_current_calling_thread, + "environ_get": _environ_get, + "environ_sizes_get": _environ_sizes_get, + "exit": _exit, + "fd_close": _fd_close, + "fd_fdstat_get": _fd_fdstat_get, + "fd_read": _fd_read, + "fd_seek": _fd_seek, + "fd_write": _fd_write, + "getTempRet0": _getTempRet0, + "getaddrinfo": _getaddrinfo, + "getnameinfo": _getnameinfo, + "glGetBufferSubData": _glGetBufferSubData, + "godot_audio_has_worklet": _godot_audio_has_worklet, + "godot_audio_init": _godot_audio_init, + "godot_audio_input_start": _godot_audio_input_start, + "godot_audio_input_stop": _godot_audio_input_stop, + "godot_audio_is_available": _godot_audio_is_available, + "godot_audio_resume": _godot_audio_resume, + "godot_audio_worklet_create": _godot_audio_worklet_create, + "godot_audio_worklet_start": _godot_audio_worklet_start, + "godot_audio_worklet_state_add": _godot_audio_worklet_state_add, + "godot_audio_worklet_state_get": _godot_audio_worklet_state_get, + "godot_audio_worklet_state_wait": _godot_audio_worklet_state_wait, + "godot_js_config_canvas_id_get": _godot_js_config_canvas_id_get, + "godot_js_config_locale_get": _godot_js_config_locale_get, + "godot_js_display_alert": _godot_js_display_alert, + "godot_js_display_canvas_focus": _godot_js_display_canvas_focus, + "godot_js_display_canvas_is_focused": _godot_js_display_canvas_is_focused, + "godot_js_display_clipboard_get": _godot_js_display_clipboard_get, + "godot_js_display_clipboard_set": _godot_js_display_clipboard_set, + "godot_js_display_cursor_is_hidden": _godot_js_display_cursor_is_hidden, + "godot_js_display_cursor_is_locked": _godot_js_display_cursor_is_locked, + "godot_js_display_cursor_lock_set": _godot_js_display_cursor_lock_set, + "godot_js_display_cursor_set_custom_shape": _godot_js_display_cursor_set_custom_shape, + "godot_js_display_cursor_set_shape": _godot_js_display_cursor_set_shape, + "godot_js_display_cursor_set_visible": _godot_js_display_cursor_set_visible, + "godot_js_display_desired_size_set": _godot_js_display_desired_size_set, + "godot_js_display_fullscreen_cb": _godot_js_display_fullscreen_cb, + "godot_js_display_fullscreen_exit": _godot_js_display_fullscreen_exit, + "godot_js_display_fullscreen_request": _godot_js_display_fullscreen_request, + "godot_js_display_has_webgl": _godot_js_display_has_webgl, + "godot_js_display_is_swap_ok_cancel": _godot_js_display_is_swap_ok_cancel, + "godot_js_display_notification_cb": _godot_js_display_notification_cb, + "godot_js_display_pixel_ratio_get": _godot_js_display_pixel_ratio_get, + "godot_js_display_screen_dpi_get": _godot_js_display_screen_dpi_get, + "godot_js_display_screen_size_get": _godot_js_display_screen_size_get, + "godot_js_display_setup_canvas": _godot_js_display_setup_canvas, + "godot_js_display_size_update": _godot_js_display_size_update, + "godot_js_display_touchscreen_is_available": _godot_js_display_touchscreen_is_available, + "godot_js_display_tts_available": _godot_js_display_tts_available, + "godot_js_display_vk_available": _godot_js_display_vk_available, + "godot_js_display_vk_cb": _godot_js_display_vk_cb, + "godot_js_display_vk_hide": _godot_js_display_vk_hide, + "godot_js_display_vk_show": _godot_js_display_vk_show, + "godot_js_display_window_blur_cb": _godot_js_display_window_blur_cb, + "godot_js_display_window_icon_set": _godot_js_display_window_icon_set, + "godot_js_display_window_size_get": _godot_js_display_window_size_get, + "godot_js_display_window_title_set": _godot_js_display_window_title_set, + "godot_js_eval": _godot_js_eval, + "godot_js_fetch_body_length_get": _godot_js_fetch_body_length_get, + "godot_js_fetch_create": _godot_js_fetch_create, + "godot_js_fetch_free": _godot_js_fetch_free, + "godot_js_fetch_http_status_get": _godot_js_fetch_http_status_get, + "godot_js_fetch_is_chunked": _godot_js_fetch_is_chunked, + "godot_js_fetch_read_chunk": _godot_js_fetch_read_chunk, + "godot_js_fetch_read_headers": _godot_js_fetch_read_headers, + "godot_js_fetch_state_get": _godot_js_fetch_state_get, + "godot_js_input_drop_files_cb": _godot_js_input_drop_files_cb, + "godot_js_input_gamepad_cb": _godot_js_input_gamepad_cb, + "godot_js_input_gamepad_sample": _godot_js_input_gamepad_sample, + "godot_js_input_gamepad_sample_count": _godot_js_input_gamepad_sample_count, + "godot_js_input_gamepad_sample_get": _godot_js_input_gamepad_sample_get, + "godot_js_input_key_cb": _godot_js_input_key_cb, + "godot_js_input_mouse_button_cb": _godot_js_input_mouse_button_cb, + "godot_js_input_mouse_move_cb": _godot_js_input_mouse_move_cb, + "godot_js_input_mouse_wheel_cb": _godot_js_input_mouse_wheel_cb, + "godot_js_input_paste_cb": _godot_js_input_paste_cb, + "godot_js_input_touch_cb": _godot_js_input_touch_cb, + "godot_js_input_vibrate_handheld": _godot_js_input_vibrate_handheld, + "godot_js_os_download_buffer": _godot_js_os_download_buffer, + "godot_js_os_execute": _godot_js_os_execute, + "godot_js_os_finish_async": _godot_js_os_finish_async, + "godot_js_os_fs_is_persistent": _godot_js_os_fs_is_persistent, + "godot_js_os_fs_sync": _godot_js_os_fs_sync, + "godot_js_os_has_feature": _godot_js_os_has_feature, + "godot_js_os_hw_concurrency_get": _godot_js_os_hw_concurrency_get, + "godot_js_os_request_quit_cb": _godot_js_os_request_quit_cb, + "godot_js_os_shell_open": _godot_js_os_shell_open, + "godot_js_pwa_cb": _godot_js_pwa_cb, + "godot_js_pwa_update": _godot_js_pwa_update, + "godot_js_rtc_datachannel_close": _godot_js_rtc_datachannel_close, + "godot_js_rtc_datachannel_connect": _godot_js_rtc_datachannel_connect, + "godot_js_rtc_datachannel_destroy": _godot_js_rtc_datachannel_destroy, + "godot_js_rtc_datachannel_get_buffered_amount": _godot_js_rtc_datachannel_get_buffered_amount, + "godot_js_rtc_datachannel_id_get": _godot_js_rtc_datachannel_id_get, + "godot_js_rtc_datachannel_is_negotiated": _godot_js_rtc_datachannel_is_negotiated, + "godot_js_rtc_datachannel_is_ordered": _godot_js_rtc_datachannel_is_ordered, + "godot_js_rtc_datachannel_label_get": _godot_js_rtc_datachannel_label_get, + "godot_js_rtc_datachannel_max_packet_lifetime_get": _godot_js_rtc_datachannel_max_packet_lifetime_get, + "godot_js_rtc_datachannel_max_retransmits_get": _godot_js_rtc_datachannel_max_retransmits_get, + "godot_js_rtc_datachannel_protocol_get": _godot_js_rtc_datachannel_protocol_get, + "godot_js_rtc_datachannel_ready_state_get": _godot_js_rtc_datachannel_ready_state_get, + "godot_js_rtc_datachannel_send": _godot_js_rtc_datachannel_send, + "godot_js_rtc_pc_close": _godot_js_rtc_pc_close, + "godot_js_rtc_pc_create": _godot_js_rtc_pc_create, + "godot_js_rtc_pc_datachannel_create": _godot_js_rtc_pc_datachannel_create, + "godot_js_rtc_pc_destroy": _godot_js_rtc_pc_destroy, + "godot_js_rtc_pc_ice_candidate_add": _godot_js_rtc_pc_ice_candidate_add, + "godot_js_rtc_pc_local_description_set": _godot_js_rtc_pc_local_description_set, + "godot_js_rtc_pc_offer_create": _godot_js_rtc_pc_offer_create, + "godot_js_rtc_pc_remote_description_set": _godot_js_rtc_pc_remote_description_set, + "godot_js_tts_get_voices": _godot_js_tts_get_voices, + "godot_js_tts_is_paused": _godot_js_tts_is_paused, + "godot_js_tts_is_speaking": _godot_js_tts_is_speaking, + "godot_js_tts_pause": _godot_js_tts_pause, + "godot_js_tts_resume": _godot_js_tts_resume, + "godot_js_tts_speak": _godot_js_tts_speak, + "godot_js_tts_stop": _godot_js_tts_stop, + "godot_js_websocket_buffered_amount": _godot_js_websocket_buffered_amount, + "godot_js_websocket_close": _godot_js_websocket_close, + "godot_js_websocket_create": _godot_js_websocket_create, + "godot_js_websocket_destroy": _godot_js_websocket_destroy, + "godot_js_websocket_send": _godot_js_websocket_send, + "godot_js_wrapper_create_cb": _godot_js_wrapper_create_cb, + "godot_js_wrapper_create_object": _godot_js_wrapper_create_object, + "godot_js_wrapper_interface_get": _godot_js_wrapper_interface_get, + "godot_js_wrapper_object_call": _godot_js_wrapper_object_call, + "godot_js_wrapper_object_get": _godot_js_wrapper_object_get, + "godot_js_wrapper_object_getvar": _godot_js_wrapper_object_getvar, + "godot_js_wrapper_object_set": _godot_js_wrapper_object_set, + "godot_js_wrapper_object_set_cb_ret": _godot_js_wrapper_object_set_cb_ret, + "godot_js_wrapper_object_setvar": _godot_js_wrapper_object_setvar, + "godot_js_wrapper_object_unref": _godot_js_wrapper_object_unref, + "godot_webgl2_glFramebufferTextureMultiviewOVR": _godot_webgl2_glFramebufferTextureMultiviewOVR, + "godot_webxr_get_bounds_geometry": _godot_webxr_get_bounds_geometry, + "godot_webxr_get_color_texture": _godot_webxr_get_color_texture, + "godot_webxr_get_depth_texture": _godot_webxr_get_depth_texture, + "godot_webxr_get_frame_rate": _godot_webxr_get_frame_rate, + "godot_webxr_get_projection_for_view": _godot_webxr_get_projection_for_view, + "godot_webxr_get_render_target_size": _godot_webxr_get_render_target_size, + "godot_webxr_get_supported_frame_rates": _godot_webxr_get_supported_frame_rates, + "godot_webxr_get_transform_for_view": _godot_webxr_get_transform_for_view, + "godot_webxr_get_velocity_texture": _godot_webxr_get_velocity_texture, + "godot_webxr_get_view_count": _godot_webxr_get_view_count, + "godot_webxr_get_visibility_state": _godot_webxr_get_visibility_state, + "godot_webxr_initialize": _godot_webxr_initialize, + "godot_webxr_is_session_supported": _godot_webxr_is_session_supported, + "godot_webxr_is_supported": _godot_webxr_is_supported, + "godot_webxr_uninitialize": _godot_webxr_uninitialize, + "godot_webxr_update_input_source": _godot_webxr_update_input_source, + "godot_webxr_update_target_frame_rate": _godot_webxr_update_target_frame_rate, + "invoke_ii": invoke_ii, + "invoke_iii": invoke_iii, + "invoke_iiii": invoke_iiii, + "invoke_iiiii": invoke_iiiii, + "invoke_iiiiiii": invoke_iiiiiii, + "invoke_vi": invoke_vi, + "invoke_vii": invoke_vii, + "invoke_viii": invoke_viii, + "invoke_viiii": invoke_viiii, + "invoke_viiiiiii": invoke_viiiiiii, + "memory": wasmMemory || Module["wasmMemory"], + "setTempRet0": _setTempRet0, + "strftime": _strftime, + "strftime_l": _strftime_l +}; + +var asm = createWasm(); + +var ___wasm_call_ctors = Module["___wasm_call_ctors"] = createExportWrapper("__wasm_call_ctors"); + +var _emscripten_webgl_make_context_current = Module["_emscripten_webgl_make_context_current"] = createExportWrapper("emscripten_webgl_make_context_current"); + +var _emscripten_webgl_commit_frame = Module["_emscripten_webgl_commit_frame"] = createExportWrapper("emscripten_webgl_commit_frame"); + +var _free = Module["_free"] = createExportWrapper("free"); + +var __Z14godot_web_mainiPPc = Module["__Z14godot_web_mainiPPc"] = createExportWrapper("_Z14godot_web_mainiPPc"); + +var _main = Module["_main"] = createExportWrapper("__main_argc_argv"); + +var _malloc = Module["_malloc"] = createExportWrapper("malloc"); + +var _htonl = Module["_htonl"] = createExportWrapper("htonl"); + +var _htons = Module["_htons"] = createExportWrapper("htons"); + +var _ntohs = Module["_ntohs"] = createExportWrapper("ntohs"); + +var ___errno_location = Module["___errno_location"] = createExportWrapper("__errno_location"); + +var _fflush = Module["_fflush"] = createExportWrapper("fflush"); + +var __emwebxr_on_input_event = Module["__emwebxr_on_input_event"] = createExportWrapper("_emwebxr_on_input_event"); + +var __emwebxr_on_simple_event = Module["__emwebxr_on_simple_event"] = createExportWrapper("_emwebxr_on_simple_event"); + +var __emscripten_tls_init = Module["__emscripten_tls_init"] = createExportWrapper("_emscripten_tls_init"); + +var _pthread_self = Module["_pthread_self"] = createExportWrapper("pthread_self"); + +var _emscripten_builtin_memalign = Module["_emscripten_builtin_memalign"] = createExportWrapper("emscripten_builtin_memalign"); + +var _emscripten_webgl_get_current_context = Module["_emscripten_webgl_get_current_context"] = createExportWrapper("emscripten_webgl_get_current_context"); + +var _emscripten_dispatch_to_thread_ = Module["_emscripten_dispatch_to_thread_"] = createExportWrapper("emscripten_dispatch_to_thread_"); + +var ___funcs_on_exit = Module["___funcs_on_exit"] = createExportWrapper("__funcs_on_exit"); + +var ___dl_seterr = Module["___dl_seterr"] = createExportWrapper("__dl_seterr"); + +var __emscripten_thread_init = Module["__emscripten_thread_init"] = createExportWrapper("_emscripten_thread_init"); + +var __emscripten_thread_crashed = Module["__emscripten_thread_crashed"] = createExportWrapper("_emscripten_thread_crashed"); + +var _emscripten_main_thread_process_queued_calls = Module["_emscripten_main_thread_process_queued_calls"] = createExportWrapper("emscripten_main_thread_process_queued_calls"); + +var _raise = Module["_raise"] = createExportWrapper("raise"); + +var _emscripten_main_browser_thread_id = Module["_emscripten_main_browser_thread_id"] = createExportWrapper("emscripten_main_browser_thread_id"); + +var _emscripten_run_in_main_runtime_thread_js = Module["_emscripten_run_in_main_runtime_thread_js"] = createExportWrapper("emscripten_run_in_main_runtime_thread_js"); + +var _emscripten_stack_get_base = Module["_emscripten_stack_get_base"] = function() { + return (_emscripten_stack_get_base = Module["_emscripten_stack_get_base"] = Module["asm"]["emscripten_stack_get_base"]).apply(null, arguments); +}; + +var _emscripten_stack_get_end = Module["_emscripten_stack_get_end"] = function() { + return (_emscripten_stack_get_end = Module["_emscripten_stack_get_end"] = Module["asm"]["emscripten_stack_get_end"]).apply(null, arguments); +}; + +var __emscripten_proxy_execute_task_queue = Module["__emscripten_proxy_execute_task_queue"] = createExportWrapper("_emscripten_proxy_execute_task_queue"); + +var __emscripten_thread_free_data = Module["__emscripten_thread_free_data"] = createExportWrapper("_emscripten_thread_free_data"); + +var __emscripten_thread_exit = Module["__emscripten_thread_exit"] = createExportWrapper("_emscripten_thread_exit"); + +var _setThrew = Module["_setThrew"] = createExportWrapper("setThrew"); + +var _saveSetjmp = Module["_saveSetjmp"] = createExportWrapper("saveSetjmp"); + +var _emscripten_stack_init = Module["_emscripten_stack_init"] = function() { + return (_emscripten_stack_init = Module["_emscripten_stack_init"] = Module["asm"]["emscripten_stack_init"]).apply(null, arguments); +}; + +var _emscripten_stack_set_limits = Module["_emscripten_stack_set_limits"] = function() { + return (_emscripten_stack_set_limits = Module["_emscripten_stack_set_limits"] = Module["asm"]["emscripten_stack_set_limits"]).apply(null, arguments); +}; + +var _emscripten_stack_get_free = Module["_emscripten_stack_get_free"] = function() { + return (_emscripten_stack_get_free = Module["_emscripten_stack_get_free"] = Module["asm"]["emscripten_stack_get_free"]).apply(null, arguments); +}; + +var stackSave = Module["stackSave"] = createExportWrapper("stackSave"); + +var stackRestore = Module["stackRestore"] = createExportWrapper("stackRestore"); + +var stackAlloc = Module["stackAlloc"] = createExportWrapper("stackAlloc"); + +var dynCall_vjiii = Module["dynCall_vjiii"] = createExportWrapper("dynCall_vjiii"); + +var dynCall_vij = Module["dynCall_vij"] = createExportWrapper("dynCall_vij"); + +var dynCall_ji = Module["dynCall_ji"] = createExportWrapper("dynCall_ji"); + +var dynCall_viiij = Module["dynCall_viiij"] = createExportWrapper("dynCall_viiij"); + +var dynCall_jii = Module["dynCall_jii"] = createExportWrapper("dynCall_jii"); + +var dynCall_viij = Module["dynCall_viij"] = createExportWrapper("dynCall_viij"); + +var dynCall_jiji = Module["dynCall_jiji"] = createExportWrapper("dynCall_jiji"); + +var dynCall_viiiiifiijii = Module["dynCall_viiiiifiijii"] = createExportWrapper("dynCall_viiiiifiijii"); + +var dynCall_viiiiifiiijjii = Module["dynCall_viiiiifiiijjii"] = createExportWrapper("dynCall_viiiiifiiijjii"); + +var dynCall_viiiiifiiijii = Module["dynCall_viiiiifiiijii"] = createExportWrapper("dynCall_viiiiifiiijii"); + +var dynCall_viiiiifiiiijjii = Module["dynCall_viiiiifiiiijjii"] = createExportWrapper("dynCall_viiiiifiiiijjii"); + +var dynCall_jiifff = Module["dynCall_jiifff"] = createExportWrapper("dynCall_jiifff"); + +var dynCall_vijf = Module["dynCall_vijf"] = createExportWrapper("dynCall_vijf"); + +var dynCall_iij = Module["dynCall_iij"] = createExportWrapper("dynCall_iij"); + +var dynCall_vijiii = Module["dynCall_vijiii"] = createExportWrapper("dynCall_vijiii"); + +var dynCall_vijiiii = Module["dynCall_vijiiii"] = createExportWrapper("dynCall_vijiiii"); + +var dynCall_vijii = Module["dynCall_vijii"] = createExportWrapper("dynCall_vijii"); + +var dynCall_viiiiij = Module["dynCall_viiiiij"] = createExportWrapper("dynCall_viiiiij"); + +var dynCall_viiiiiji = Module["dynCall_viiiiiji"] = createExportWrapper("dynCall_viiiiiji"); + +var dynCall_viiijii = Module["dynCall_viiijii"] = createExportWrapper("dynCall_viiijii"); + +var dynCall_vijiiiiiidddd = Module["dynCall_vijiiiiiidddd"] = createExportWrapper("dynCall_vijiiiiiidddd"); + +var dynCall_jij = Module["dynCall_jij"] = createExportWrapper("dynCall_jij"); + +var dynCall_jiiii = Module["dynCall_jiiii"] = createExportWrapper("dynCall_jiiii"); + +var dynCall_jiij = Module["dynCall_jiij"] = createExportWrapper("dynCall_jiij"); + +var dynCall_jiijiiii = Module["dynCall_jiijiiii"] = createExportWrapper("dynCall_jiijiiii"); + +var dynCall_jiii = Module["dynCall_jiii"] = createExportWrapper("dynCall_jiii"); + +var dynCall_jiiji = Module["dynCall_jiiji"] = createExportWrapper("dynCall_jiiji"); + +var dynCall_jiiiji = Module["dynCall_jiiiji"] = createExportWrapper("dynCall_jiiiji"); + +var dynCall_jiijii = Module["dynCall_jiijii"] = createExportWrapper("dynCall_jiijii"); + +var dynCall_iijiiij = Module["dynCall_iijiiij"] = createExportWrapper("dynCall_iijiiij"); + +var dynCall_jijjjiiiiijii = Module["dynCall_jijjjiiiiijii"] = createExportWrapper("dynCall_jijjjiiiiijii"); + +var dynCall_jijiiiiifiii = Module["dynCall_jijiiiiifiii"] = createExportWrapper("dynCall_jijiiiiifiii"); + +var dynCall_viijiiiiiifiii = Module["dynCall_viijiiiiiifiii"] = createExportWrapper("dynCall_viijiiiiiifiii"); + +var dynCall_jiiiiiii = Module["dynCall_jiiiiiii"] = createExportWrapper("dynCall_jiiiiiii"); + +var dynCall_viji = Module["dynCall_viji"] = createExportWrapper("dynCall_viji"); + +var dynCall_viiji = Module["dynCall_viiji"] = createExportWrapper("dynCall_viiji"); + +var dynCall_viiiij = Module["dynCall_viiiij"] = createExportWrapper("dynCall_viiiij"); + +var dynCall_vijj = Module["dynCall_vijj"] = createExportWrapper("dynCall_vijj"); + +var dynCall_vijji = Module["dynCall_vijji"] = createExportWrapper("dynCall_vijji"); + +var dynCall_vijjii = Module["dynCall_vijjii"] = createExportWrapper("dynCall_vijjii"); + +var dynCall_fij = Module["dynCall_fij"] = createExportWrapper("dynCall_fij"); + +var dynCall_vijiffifff = Module["dynCall_vijiffifff"] = createExportWrapper("dynCall_vijiffifff"); + +var dynCall_vijff = Module["dynCall_vijff"] = createExportWrapper("dynCall_vijff"); + +var dynCall_vijiffff = Module["dynCall_vijiffff"] = createExportWrapper("dynCall_vijiffff"); + +var dynCall_vijjf = Module["dynCall_vijjf"] = createExportWrapper("dynCall_vijjf"); + +var dynCall_vijij = Module["dynCall_vijij"] = createExportWrapper("dynCall_vijij"); + +var dynCall_vijif = Module["dynCall_vijif"] = createExportWrapper("dynCall_vijif"); + +var dynCall_vijiiifi = Module["dynCall_vijiiifi"] = createExportWrapper("dynCall_vijiiifi"); + +var dynCall_vijiifi = Module["dynCall_vijiifi"] = createExportWrapper("dynCall_vijiifi"); + +var dynCall_vijiif = Module["dynCall_vijiif"] = createExportWrapper("dynCall_vijiif"); + +var dynCall_vijifi = Module["dynCall_vijifi"] = createExportWrapper("dynCall_vijifi"); + +var dynCall_vijijiii = Module["dynCall_vijijiii"] = createExportWrapper("dynCall_vijijiii"); + +var dynCall_vijijiiii = Module["dynCall_vijijiiii"] = createExportWrapper("dynCall_vijijiiii"); + +var dynCall_vijijiiiff = Module["dynCall_vijijiiiff"] = createExportWrapper("dynCall_vijijiiiff"); + +var dynCall_vijijii = Module["dynCall_vijijii"] = createExportWrapper("dynCall_vijijii"); + +var dynCall_vijiijiiiiii = Module["dynCall_vijiijiiiiii"] = createExportWrapper("dynCall_vijiijiiiiii"); + +var dynCall_vijiiij = Module["dynCall_vijiiij"] = createExportWrapper("dynCall_vijiiij"); + +var dynCall_vijiiiiiiji = Module["dynCall_vijiiiiiiji"] = createExportWrapper("dynCall_vijiiiiiiji"); + +var dynCall_vijjj = Module["dynCall_vijjj"] = createExportWrapper("dynCall_vijjj"); + +var dynCall_vijdddd = Module["dynCall_vijdddd"] = createExportWrapper("dynCall_vijdddd"); + +var dynCall_vijififi = Module["dynCall_vijififi"] = createExportWrapper("dynCall_vijififi"); + +var dynCall_iiiij = Module["dynCall_iiiij"] = createExportWrapper("dynCall_iiiij"); + +var dynCall_iijji = Module["dynCall_iijji"] = createExportWrapper("dynCall_iijji"); + +var dynCall_viijj = Module["dynCall_viijj"] = createExportWrapper("dynCall_viijj"); + +var dynCall_jiiiiii = Module["dynCall_jiiiiii"] = createExportWrapper("dynCall_jiiiiii"); + +var dynCall_viiiiji = Module["dynCall_viiiiji"] = createExportWrapper("dynCall_viiiiji"); + +var dynCall_dij = Module["dynCall_dij"] = createExportWrapper("dynCall_dij"); + +var dynCall_vijd = Module["dynCall_vijd"] = createExportWrapper("dynCall_vijd"); + +var dynCall_iiij = Module["dynCall_iiij"] = createExportWrapper("dynCall_iiij"); + +var dynCall_jiiiii = Module["dynCall_jiiiii"] = createExportWrapper("dynCall_jiiiii"); + +var dynCall_ij = Module["dynCall_ij"] = createExportWrapper("dynCall_ij"); + +var dynCall_viijiiii = Module["dynCall_viijiiii"] = createExportWrapper("dynCall_viijiiii"); + +var dynCall_viijiii = Module["dynCall_viijiii"] = createExportWrapper("dynCall_viijiii"); + +var dynCall_iiji = Module["dynCall_iiji"] = createExportWrapper("dynCall_iiji"); + +var dynCall_iiiijf = Module["dynCall_iiiijf"] = createExportWrapper("dynCall_iiiijf"); + +var dynCall_vijiiiii = Module["dynCall_vijiiiii"] = createExportWrapper("dynCall_vijiiiii"); + +var dynCall_vijjjii = Module["dynCall_vijjjii"] = createExportWrapper("dynCall_vijjjii"); + +var dynCall_viijd = Module["dynCall_viijd"] = createExportWrapper("dynCall_viijd"); + +var dynCall_diij = Module["dynCall_diij"] = createExportWrapper("dynCall_diij"); + +var dynCall_viiiji = Module["dynCall_viiiji"] = createExportWrapper("dynCall_viiiji"); + +var dynCall_viiijj = Module["dynCall_viiijj"] = createExportWrapper("dynCall_viiijj"); + +var dynCall_viijji = Module["dynCall_viijji"] = createExportWrapper("dynCall_viijji"); + +var dynCall_jiiij = Module["dynCall_jiiij"] = createExportWrapper("dynCall_jiiij"); + +var dynCall_viijii = Module["dynCall_viijii"] = createExportWrapper("dynCall_viijii"); + +var dynCall_jiijjj = Module["dynCall_jiijjj"] = createExportWrapper("dynCall_jiijjj"); + +var dynCall_jiijj = Module["dynCall_jiijj"] = createExportWrapper("dynCall_jiijj"); + +var dynCall_viiijiji = Module["dynCall_viiijiji"] = createExportWrapper("dynCall_viiijiji"); + +var dynCall_viiijjiji = Module["dynCall_viiijjiji"] = createExportWrapper("dynCall_viiijjiji"); + +var dynCall_viijiji = Module["dynCall_viijiji"] = createExportWrapper("dynCall_viijiji"); + +var dynCall_iiiiijiii = Module["dynCall_iiiiijiii"] = createExportWrapper("dynCall_iiiiijiii"); + +var dynCall_iiiiiijd = Module["dynCall_iiiiiijd"] = createExportWrapper("dynCall_iiiiiijd"); + +var dynCall_diidj = Module["dynCall_diidj"] = createExportWrapper("dynCall_diidj"); + +var dynCall_viiiijij = Module["dynCall_viiiijij"] = createExportWrapper("dynCall_viiiijij"); + +var dynCall_viiidjj = Module["dynCall_viiidjj"] = createExportWrapper("dynCall_viiidjj"); + +var dynCall_viidj = Module["dynCall_viidj"] = createExportWrapper("dynCall_viidj"); + +var dynCall_iiijj = Module["dynCall_iiijj"] = createExportWrapper("dynCall_iiijj"); + +var dynCall_jiid = Module["dynCall_jiid"] = createExportWrapper("dynCall_jiid"); + +var dynCall_viiiiddji = Module["dynCall_viiiiddji"] = createExportWrapper("dynCall_viiiiddji"); + +var dynCall_vijiiiiiiiii = Module["dynCall_vijiiiiiiiii"] = createExportWrapper("dynCall_vijiiiiiiiii"); + +var dynCall_vijiiiffi = Module["dynCall_vijiiiffi"] = createExportWrapper("dynCall_vijiiiffi"); + +var dynCall_vijiiifii = Module["dynCall_vijiiifii"] = createExportWrapper("dynCall_vijiiifii"); + +var dynCall_viijfii = Module["dynCall_viijfii"] = createExportWrapper("dynCall_viijfii"); + +var dynCall_viiiiiiiiiiijjjjjjifiiiiii = Module["dynCall_viiiiiiiiiiijjjjjjifiiiiii"] = createExportWrapper("dynCall_viiiiiiiiiiijjjjjjifiiiiii"); + +var dynCall_vijifff = Module["dynCall_vijifff"] = createExportWrapper("dynCall_vijifff"); + +var dynCall_fiji = Module["dynCall_fiji"] = createExportWrapper("dynCall_fiji"); + +var dynCall_vijiiffifffi = Module["dynCall_vijiiffifffi"] = createExportWrapper("dynCall_vijiiffifffi"); + +var dynCall_iijj = Module["dynCall_iijj"] = createExportWrapper("dynCall_iijj"); + +var dynCall_iijjfj = Module["dynCall_iijjfj"] = createExportWrapper("dynCall_iijjfj"); + +var dynCall_vijiji = Module["dynCall_vijiji"] = createExportWrapper("dynCall_vijiji"); + +var dynCall_jijii = Module["dynCall_jijii"] = createExportWrapper("dynCall_jijii"); + +var dynCall_vijid = Module["dynCall_vijid"] = createExportWrapper("dynCall_vijid"); + +var dynCall_vijiiiffiiiii = Module["dynCall_vijiiiffiiiii"] = createExportWrapper("dynCall_vijiiiffiiiii"); + +var dynCall_vijiiiiii = Module["dynCall_vijiiiiii"] = createExportWrapper("dynCall_vijiiiiii"); + +var dynCall_vijiff = Module["dynCall_vijiff"] = createExportWrapper("dynCall_vijiff"); + +var dynCall_vijjjj = Module["dynCall_vijjjj"] = createExportWrapper("dynCall_vijjjj"); + +var dynCall_vijiiiiiii = Module["dynCall_vijiiiiiii"] = createExportWrapper("dynCall_vijiiiiiii"); + +var dynCall_jiiifi = Module["dynCall_jiiifi"] = createExportWrapper("dynCall_jiiifi"); + +var dynCall_viiiifijii = Module["dynCall_viiiifijii"] = createExportWrapper("dynCall_viiiifijii"); + +var dynCall_viiiifiijjii = Module["dynCall_viiiifiijjii"] = createExportWrapper("dynCall_viiiifiijjii"); + +var dynCall_vijiiifiijii = Module["dynCall_vijiiifiijii"] = createExportWrapper("dynCall_vijiiifiijii"); + +var dynCall_vijiiifiiijjii = Module["dynCall_vijiiifiiijjii"] = createExportWrapper("dynCall_vijiiifiiijjii"); + +var dynCall_vijiiifiiijii = Module["dynCall_vijiiifiiijii"] = createExportWrapper("dynCall_vijiiifiiijii"); + +var dynCall_vijiiifiiiijjii = Module["dynCall_vijiiifiiiijjii"] = createExportWrapper("dynCall_vijiiifiiiijjii"); + +var dynCall_fijiiii = Module["dynCall_fijiiii"] = createExportWrapper("dynCall_fijiiii"); + +var dynCall_fijiiiii = Module["dynCall_fijiiiii"] = createExportWrapper("dynCall_fijiiiii"); + +var dynCall_iijii = Module["dynCall_iijii"] = createExportWrapper("dynCall_iijii"); + +var dynCall_iijiijiiiii = Module["dynCall_iijiijiiiii"] = createExportWrapper("dynCall_iijiijiiiii"); + +var dynCall_iijijiiiii = Module["dynCall_iijijiiiii"] = createExportWrapper("dynCall_iijijiiiii"); + +var dynCall_vijijj = Module["dynCall_vijijj"] = createExportWrapper("dynCall_vijijj"); + +var dynCall_vijiiijj = Module["dynCall_vijiiijj"] = createExportWrapper("dynCall_vijiiijj"); + +var dynCall_vijiijj = Module["dynCall_vijiijj"] = createExportWrapper("dynCall_vijiijj"); + +var dynCall_vijjiji = Module["dynCall_vijjiji"] = createExportWrapper("dynCall_vijjiji"); + +var dynCall_vijjiijii = Module["dynCall_vijjiijii"] = createExportWrapper("dynCall_vijjiijii"); + +var dynCall_fijii = Module["dynCall_fijii"] = createExportWrapper("dynCall_fijii"); + +var dynCall_vijiiiij = Module["dynCall_vijiiiij"] = createExportWrapper("dynCall_vijiiiij"); + +var dynCall_jijj = Module["dynCall_jijj"] = createExportWrapper("dynCall_jijj"); + +var dynCall_jiiif = Module["dynCall_jiiif"] = createExportWrapper("dynCall_jiiif"); + +var dynCall_vijfff = Module["dynCall_vijfff"] = createExportWrapper("dynCall_vijfff"); + +var dynCall_vijfiff = Module["dynCall_vijfiff"] = createExportWrapper("dynCall_vijfiff"); + +var dynCall_vijfi = Module["dynCall_vijfi"] = createExportWrapper("dynCall_vijfi"); + +var dynCall_vijffffi = Module["dynCall_vijffffi"] = createExportWrapper("dynCall_vijffffi"); + +var dynCall_vijiiffi = Module["dynCall_vijiiffi"] = createExportWrapper("dynCall_vijiiffi"); + +var dynCall_vijiifffffff = Module["dynCall_vijiifffffff"] = createExportWrapper("dynCall_vijiifffffff"); + +var dynCall_vijifiifffffifff = Module["dynCall_vijifiifffffifff"] = createExportWrapper("dynCall_vijifiifffffifff"); + +var dynCall_vijiiffffiffffj = Module["dynCall_vijiiffffiffffj"] = createExportWrapper("dynCall_vijiiffffiffffj"); + +var dynCall_vijiifff = Module["dynCall_vijiifff"] = createExportWrapper("dynCall_vijiifff"); + +var dynCall_vijiffffffff = Module["dynCall_vijiffffffff"] = createExportWrapper("dynCall_vijiffffffff"); + +var dynCall_vijiifiififff = Module["dynCall_vijiifiififff"] = createExportWrapper("dynCall_vijiifiififff"); + +var dynCall_vijifffij = Module["dynCall_vijifffij"] = createExportWrapper("dynCall_vijifffij"); + +var dynCall_viijjjiifjii = Module["dynCall_viijjjiifjii"] = createExportWrapper("dynCall_viijjjiifjii"); + +var dynCall_fijj = Module["dynCall_fijj"] = createExportWrapper("dynCall_fijj"); + +var dynCall_iijjiii = Module["dynCall_iijjiii"] = createExportWrapper("dynCall_iijjiii"); + +var dynCall_iiiiij = Module["dynCall_iiiiij"] = createExportWrapper("dynCall_iiiiij"); + +var dynCall_iiiiijj = Module["dynCall_iiiiijj"] = createExportWrapper("dynCall_iiiiijj"); + +var dynCall_iiiiiijj = Module["dynCall_iiiiiijj"] = createExportWrapper("dynCall_iiiiiijj"); + +function invoke_vii(index, a1, a2) { + var sp = stackSave(); + try { + getWasmTableEntry(index)(a1, a2); + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0); + } +} + +function invoke_vi(index, a1) { + var sp = stackSave(); + try { + getWasmTableEntry(index)(a1); + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viii(index, a1, a2, a3) { + var sp = stackSave(); + try { + getWasmTableEntry(index)(a1, a2, a3); + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0); + } +} + +function invoke_ii(index, a1) { + var sp = stackSave(); + try { + return getWasmTableEntry(index)(a1); + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiii(index, a1, a2, a3, a4) { + var sp = stackSave(); + try { + getWasmTableEntry(index)(a1, a2, a3, a4); + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iii(index, a1, a2) { + var sp = stackSave(); + try { + return getWasmTableEntry(index)(a1, a2); + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiii(index, a1, a2, a3) { + var sp = stackSave(); + try { + return getWasmTableEntry(index)(a1, a2, a3); + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiii(index, a1, a2, a3, a4) { + var sp = stackSave(); + try { + return getWasmTableEntry(index)(a1, a2, a3, a4); + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0); + } +} + +function invoke_viiiiiii(index, a1, a2, a3, a4, a5, a6, a7) { + var sp = stackSave(); + try { + getWasmTableEntry(index)(a1, a2, a3, a4, a5, a6, a7); + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0); + } +} + +function invoke_iiiiiii(index, a1, a2, a3, a4, a5, a6) { + var sp = stackSave(); + try { + return getWasmTableEntry(index)(a1, a2, a3, a4, a5, a6); + } catch (e) { + stackRestore(sp); + if (e !== e + 0) throw e; + _setThrew(1, 0); + } +} + +Module["callMain"] = callMain; + +Module["keepRuntimeAlive"] = keepRuntimeAlive; + +Module["wasmMemory"] = wasmMemory; + +Module["cwrap"] = cwrap; + +Module["ExitStatus"] = ExitStatus; + +Module["PThread"] = PThread; + +var unexportedRuntimeSymbols = [ "run", "UTF8ArrayToString", "UTF8ToString", "stringToUTF8Array", "stringToUTF8", "lengthBytesUTF8", "addOnPreRun", "addOnInit", "addOnPreMain", "addOnExit", "addOnPostRun", "addRunDependency", "removeRunDependency", "FS_createFolder", "FS_createPath", "FS_createDataFile", "FS_createPreloadedFile", "FS_createLazyFile", "FS_createLink", "FS_createDevice", "FS_unlink", "getLEB", "getFunctionTables", "alignFunctionTables", "registerFunctions", "prettyPrint", "getCompilerSetting", "print", "printErr", "getTempRet0", "setTempRet0", "abort", "stackSave", "stackRestore", "stackAlloc", "GROWABLE_HEAP_I8", "GROWABLE_HEAP_U8", "GROWABLE_HEAP_I16", "GROWABLE_HEAP_U16", "GROWABLE_HEAP_I32", "GROWABLE_HEAP_U32", "GROWABLE_HEAP_F32", "GROWABLE_HEAP_F64", "writeStackCookie", "checkStackCookie", "ptrToString", "zeroMemory", "stringToNewUTF8", "exitJS", "getHeapMax", "emscripten_realloc_buffer", "ENV", "ERRNO_CODES", "ERRNO_MESSAGES", "setErrNo", "inetPton4", "inetNtop4", "inetPton6", "inetNtop6", "readSockaddr", "writeSockaddr", "DNS", "getHostByName", "Protocols", "Sockets", "getRandomDevice", "warnOnce", "traverseStack", "UNWIND_CACHE", "convertPCtoSourceLocation", "readAsmConstArgsArray", "readAsmConstArgs", "mainThreadEM_ASM", "jstoi_q", "jstoi_s", "getExecutableName", "listenOnce", "autoResumeAudioContext", "dynCallLegacy", "getDynCaller", "dynCall", "handleException", "runtimeKeepalivePush", "runtimeKeepalivePop", "callUserCallback", "maybeExit", "safeSetTimeout", "asmjsMangle", "asyncLoad", "alignMemory", "mmapAlloc", "writeI53ToI64", "writeI53ToI64Clamped", "writeI53ToI64Signaling", "writeI53ToU64Clamped", "writeI53ToU64Signaling", "readI53FromI64", "readI53FromU64", "convertI32PairToI53", "convertI32PairToI53Checked", "convertU32PairToI53", "getCFunc", "ccall", "uleb128Encode", "sigToWasmTypes", "convertJsFunctionToWasm", "freeTableIndexes", "functionsInTableMap", "getEmptyTableSlot", "updateTableMap", "addFunction", "removeFunction", "reallyNegative", "unSign", "strLen", "reSign", "formatString", "setValue", "getValue", "PATH", "PATH_FS", "intArrayFromString", "intArrayToString", "AsciiToString", "stringToAscii", "UTF16Decoder", "UTF16ToString", "stringToUTF16", "lengthBytesUTF16", "UTF32ToString", "stringToUTF32", "lengthBytesUTF32", "allocateUTF8", "allocateUTF8OnStack", "writeStringToMemory", "writeArrayToMemory", "writeAsciiToMemory", "SYSCALLS", "getSocketFromFD", "getSocketAddress", "JSEvents", "registerKeyEventCallback", "specialHTMLTargets", "maybeCStringToJsString", "findEventTarget", "findCanvasEventTarget", "getBoundingClientRect", "fillMouseEventData", "registerMouseEventCallback", "registerWheelEventCallback", "registerUiEventCallback", "registerFocusEventCallback", "fillDeviceOrientationEventData", "registerDeviceOrientationEventCallback", "fillDeviceMotionEventData", "registerDeviceMotionEventCallback", "screenOrientation", "fillOrientationChangeEventData", "registerOrientationChangeEventCallback", "fillFullscreenChangeEventData", "registerFullscreenChangeEventCallback", "JSEvents_requestFullscreen", "JSEvents_resizeCanvasForFullscreen", "registerRestoreOldStyle", "hideEverythingExceptGivenElement", "restoreHiddenElements", "setLetterbox", "currentFullscreenStrategy", "restoreOldWindowedStyle", "softFullscreenResizeWebGLRenderTarget", "doRequestFullscreen", "fillPointerlockChangeEventData", "registerPointerlockChangeEventCallback", "registerPointerlockErrorEventCallback", "requestPointerLock", "fillVisibilityChangeEventData", "registerVisibilityChangeEventCallback", "registerTouchEventCallback", "fillGamepadEventData", "registerGamepadEventCallback", "registerBeforeUnloadEventCallback", "fillBatteryEventData", "battery", "registerBatteryEventCallback", "setCanvasElementSize", "getCanvasElementSize", "demangle", "demangleAll", "jsStackTrace", "stackTrace", "getEnvStrings", "checkWasiClock", "doReadv", "doWritev", "dlopenMissingError", "setImmediateWrapped", "clearImmediateWrapped", "polyfillSetImmediate", "uncaughtExceptionCount", "exceptionLast", "exceptionCaught", "ExceptionInfo", "exception_addRef", "exception_decRef", "Browser", "setMainLoop", "wget", "FS", "MEMFS", "TTY", "PIPEFS", "SOCKFS", "_setNetworkCallback", "tempFixedLengthArray", "miniTempWebGLFloatBuffers", "heapObjectForWebGLType", "heapAccessShiftForWebGLHeap", "GL", "emscriptenWebGLGet", "computeUnpackAlignedImageSize", "emscriptenWebGLGetTexPixelData", "emscriptenWebGLGetUniform", "webglGetUniformLocation", "webglPrepareUniformLocationsBeforeFirstUse", "webglGetLeftBracePos", "emscriptenWebGLGetVertexAttrib", "writeGLArray", "AL", "SDL_unicode", "SDL_ttfContext", "SDL_audio", "SDL", "SDL_gfx", "GLUT", "EGL", "GLFW_Window", "GLFW", "GLEW", "IDBStore", "runAndAbortIfError", "emscriptenWebGLGetIndexed", "ALLOC_NORMAL", "ALLOC_STACK", "allocate", "killThread", "cleanupThread", "registerTLSInit", "cancelThread", "spawnThread", "exitOnMainThread", "invokeEntryPoint", "executeNotifiedProxyingQueue", "GodotWebXR", "GodotWebSocket", "GodotRTCDataChannel", "GodotRTCPeerConnection", "GodotAudio", "GodotAudioWorklet", "GodotAudioScript", "GodotDisplayVK", "GodotDisplayCursor", "GodotDisplayScreen", "GodotDisplay", "GodotFetch", "IDHandler", "GodotConfig", "GodotFS", "GodotOS", "GodotEventListeners", "GodotPWA", "GodotRuntime", "GodotInputGamepads", "GodotInputDragDrop", "GodotInput", "GodotWebGL2", "GodotJSWrapper", "IDBFS" ]; + +unexportedRuntimeSymbols.forEach(unexportedRuntimeSymbol); + +var missingLibrarySymbols = [ "getHostByName", "traverseStack", "convertPCtoSourceLocation", "readAsmConstArgs", "mainThreadEM_ASM", "jstoi_s", "listenOnce", "autoResumeAudioContext", "dynCallLegacy", "getDynCaller", "dynCall", "asmjsMangle", "writeI53ToI64Clamped", "writeI53ToI64Signaling", "writeI53ToU64Clamped", "writeI53ToU64Signaling", "convertI32PairToI53", "convertU32PairToI53", "reallyNegative", "unSign", "strLen", "reSign", "formatString", "registerKeyEventCallback", "getBoundingClientRect", "fillMouseEventData", "registerMouseEventCallback", "registerWheelEventCallback", "registerUiEventCallback", "registerFocusEventCallback", "fillDeviceOrientationEventData", "registerDeviceOrientationEventCallback", "fillDeviceMotionEventData", "registerDeviceMotionEventCallback", "screenOrientation", "fillOrientationChangeEventData", "registerOrientationChangeEventCallback", "fillFullscreenChangeEventData", "registerFullscreenChangeEventCallback", "JSEvents_requestFullscreen", "JSEvents_resizeCanvasForFullscreen", "registerRestoreOldStyle", "hideEverythingExceptGivenElement", "restoreHiddenElements", "setLetterbox", "softFullscreenResizeWebGLRenderTarget", "doRequestFullscreen", "fillPointerlockChangeEventData", "registerPointerlockChangeEventCallback", "registerPointerlockErrorEventCallback", "requestPointerLock", "fillVisibilityChangeEventData", "registerVisibilityChangeEventCallback", "registerTouchEventCallback", "fillGamepadEventData", "registerGamepadEventCallback", "registerBeforeUnloadEventCallback", "fillBatteryEventData", "battery", "registerBatteryEventCallback", "setCanvasElementSize", "getCanvasElementSize", "checkWasiClock", "setImmediateWrapped", "clearImmediateWrapped", "polyfillSetImmediate", "ExceptionInfo", "exception_addRef", "exception_decRef", "_setNetworkCallback", "emscriptenWebGLGetUniform", "emscriptenWebGLGetVertexAttrib", "writeGLArray", "SDL_unicode", "SDL_ttfContext", "SDL_audio", "GLFW_Window", "runAndAbortIfError", "emscriptenWebGLGetIndexed" ]; + +missingLibrarySymbols.forEach(missingLibrarySymbol); + +var calledRun; + +dependenciesFulfilled = function runCaller() { + if (!calledRun) run(); + if (!calledRun) dependenciesFulfilled = runCaller; +}; + +function callMain(args) { + assert(runDependencies == 0, 'cannot call main when async dependencies remain! (listen on Module["onRuntimeInitialized"])'); + assert(__ATPRERUN__.length == 0, "cannot call main when preRun functions remain to be called"); + var entryFunction = Module["_main"]; + args = args || []; + args.unshift(thisProgram); + var argc = args.length; + var argv = stackAlloc((argc + 1) * 4); + var argv_ptr = argv >> 2; + args.forEach(arg => { + GROWABLE_HEAP_I32()[argv_ptr++] = allocateUTF8OnStack(arg); + }); + GROWABLE_HEAP_I32()[argv_ptr] = 0; + try { + var ret = entryFunction(argc, argv); + exitJS(ret, true); + return ret; + } catch (e) { + return handleException(e); + } +} + +function stackCheckInit() { + assert(!ENVIRONMENT_IS_PTHREAD); + _emscripten_stack_init(); + writeStackCookie(); +} + +function run(args) { + args = args || arguments_; + if (runDependencies > 0) { + return; + } + if (!ENVIRONMENT_IS_PTHREAD) stackCheckInit(); + if (ENVIRONMENT_IS_PTHREAD) { + readyPromiseResolve(Module); + initRuntime(); + postMessage({ + "cmd": "loaded" + }); + return; + } + preRun(); + if (runDependencies > 0) { + return; + } + function doRun() { + if (calledRun) return; + calledRun = true; + Module["calledRun"] = true; + if (ABORT) return; + initRuntime(); + preMain(); + readyPromiseResolve(Module); + if (Module["onRuntimeInitialized"]) Module["onRuntimeInitialized"](); + if (shouldRunNow) callMain(args); + postRun(); + } + if (Module["setStatus"]) { + Module["setStatus"]("Running..."); + setTimeout(function() { + setTimeout(function() { + Module["setStatus"](""); + }, 1); + doRun(); + }, 1); + } else { + doRun(); + } + checkStackCookie(); +} + +if (Module["preInit"]) { + if (typeof Module["preInit"] == "function") Module["preInit"] = [ Module["preInit"] ]; + while (Module["preInit"].length > 0) { + Module["preInit"].pop()(); + } +} + +var shouldRunNow = false; + +if (Module["noInitialRun"]) shouldRunNow = false; + +run(); + + + return Godot.ready +} +); +})(); +if (typeof exports === 'object' && typeof module === 'object') + module.exports = Godot; +else if (typeof define === 'function' && define['amd']) + define([], function() { return Godot; }); +else if (typeof exports === 'object') + exports["Godot"] = Godot; + +const Features = { // eslint-disable-line no-unused-vars + /** + * Check whether WebGL is available. Optionally, specify a particular version of WebGL to check for. + * + * @param {number=} [majorVersion=1] The major WebGL version to check for. + * @returns {boolean} If the given major version of WebGL is available. + * @function Engine.isWebGLAvailable + */ + isWebGLAvailable: function (majorVersion = 1) { + try { + return !!document.createElement('canvas').getContext(['webgl', 'webgl2'][majorVersion - 1]); + } catch (e) { /* Not available */ } + return false; + }, + + /** + * Check whether the Fetch API available and supports streaming responses. + * + * @returns {boolean} If the Fetch API is available and supports streaming responses. + * @function Engine.isFetchAvailable + */ + isFetchAvailable: function () { + return 'fetch' in window && 'Response' in window && 'body' in window.Response.prototype; + }, + + /** + * Check whether the engine is running in a Secure Context. + * + * @returns {boolean} If the engine is running in a Secure Context. + * @function Engine.isSecureContext + */ + isSecureContext: function () { + return window['isSecureContext'] === true; + }, + + /** + * Check whether the engine is cross origin isolated. + * This value is dependent on Cross-Origin-Opener-Policy and Cross-Origin-Embedder-Policy headers sent by the server. + * + * @returns {boolean} If the engine is running in a Secure Context. + * @function Engine.isSecureContext + */ + isCrossOriginIsolated: function () { + return window['crossOriginIsolated'] === true; + }, + + /** + * Check whether SharedBufferArray is available. + * + * Most browsers require the page to be running in a secure context, and the + * the server to provide specific CORS headers for SharedArrayBuffer to be available. + * + * @returns {boolean} If SharedArrayBuffer is available. + * @function Engine.isSharedArrayBufferAvailable + */ + isSharedArrayBufferAvailable: function () { + return 'SharedArrayBuffer' in window; + }, + + /** + * Check whether the AudioContext supports AudioWorkletNodes. + * + * @returns {boolean} If AudioWorkletNode is available. + * @function Engine.isAudioWorkletAvailable + */ + isAudioWorkletAvailable: function () { + return 'AudioContext' in window && 'audioWorklet' in AudioContext.prototype; + }, + + /** + * Return an array of missing required features (as string). + * + * @returns {Array} A list of human-readable missing features. + * @function Engine.getMissingFeatures + */ + getMissingFeatures: function () { + const missing = []; + if (!Features.isWebGLAvailable(2)) { + missing.push('WebGL2 - Check web browser configuration and hardware support'); + } + if (!Features.isFetchAvailable()) { + missing.push('Fetch - Check web browser version'); + } + if (!Features.isSecureContext()) { + missing.push('Secure Context - Check web server configuration (use HTTPS)'); + } + if (!Features.isCrossOriginIsolated()) { + missing.push('Cross Origin Isolation - Check web server configuration (send correct headers)'); + } + if (!Features.isSharedArrayBufferAvailable()) { + missing.push('SharedArrayBuffer - Check web server configuration (send correct headers)'); + } + // Audio is normally optional since we have a dummy fallback. + return missing; + }, +}; + +const Preloader = /** @constructor */ function () { // eslint-disable-line no-unused-vars + function getTrackedResponse(response, load_status) { + function onloadprogress(reader, controller) { + return reader.read().then(function (result) { + if (load_status.done) { + return Promise.resolve(); + } + if (result.value) { + controller.enqueue(result.value); + load_status.loaded += result.value.length; + } + if (!result.done) { + return onloadprogress(reader, controller); + } + load_status.done = true; + return Promise.resolve(); + }); + } + const reader = response.body.getReader(); + return new Response(new ReadableStream({ + start: function (controller) { + onloadprogress(reader, controller).then(function () { + controller.close(); + }); + }, + }), { headers: response.headers }); + } + + function loadFetch(file, tracker, fileSize, raw) { + tracker[file] = { + total: fileSize || 0, + loaded: 0, + done: false, + }; + return fetch(file).then(function (response) { + if (!response.ok) { + return Promise.reject(new Error(`Failed loading file '${file}'`)); + } + const tr = getTrackedResponse(response, tracker[file]); + if (raw) { + return Promise.resolve(tr); + } + return tr.arrayBuffer(); + }); + } + + function retry(func, attempts = 1) { + function onerror(err) { + if (attempts <= 1) { + return Promise.reject(err); + } + return new Promise(function (resolve, reject) { + setTimeout(function () { + retry(func, attempts - 1).then(resolve).catch(reject); + }, 1000); + }); + } + return func().catch(onerror); + } + + const DOWNLOAD_ATTEMPTS_MAX = 4; + const loadingFiles = {}; + const lastProgress = { loaded: 0, total: 0 }; + let progressFunc = null; + + const animateProgress = function () { + let loaded = 0; + let total = 0; + let totalIsValid = true; + let progressIsFinal = true; + + Object.keys(loadingFiles).forEach(function (file) { + const stat = loadingFiles[file]; + if (!stat.done) { + progressIsFinal = false; + } + if (!totalIsValid || stat.total === 0) { + totalIsValid = false; + total = 0; + } else { + total += stat.total; + } + loaded += stat.loaded; + }); + if (loaded !== lastProgress.loaded || total !== lastProgress.total) { + lastProgress.loaded = loaded; + lastProgress.total = total; + if (typeof progressFunc === 'function') { + progressFunc(loaded, total); + } + } + if (!progressIsFinal) { + requestAnimationFrame(animateProgress); + } + }; + + this.animateProgress = animateProgress; + + this.setProgressFunc = function (callback) { + progressFunc = callback; + }; + + this.loadPromise = function (file, fileSize, raw = false) { + return retry(loadFetch.bind(null, file, loadingFiles, fileSize, raw), DOWNLOAD_ATTEMPTS_MAX); + }; + + this.preloadedFiles = []; + this.preload = function (pathOrBuffer, destPath, fileSize) { + let buffer = null; + if (typeof pathOrBuffer === 'string') { + const me = this; + return this.loadPromise(pathOrBuffer, fileSize).then(function (buf) { + me.preloadedFiles.push({ + path: destPath || pathOrBuffer, + buffer: buf, + }); + return Promise.resolve(); + }); + } else if (pathOrBuffer instanceof ArrayBuffer) { + buffer = new Uint8Array(pathOrBuffer); + } else if (ArrayBuffer.isView(pathOrBuffer)) { + buffer = new Uint8Array(pathOrBuffer.buffer); + } + if (buffer) { + this.preloadedFiles.push({ + path: destPath, + buffer: pathOrBuffer, + }); + return Promise.resolve(); + } + return Promise.reject(new Error('Invalid object for preloading')); + }; +}; + +/** + * An object used to configure the Engine instance based on godot export options, and to override those in custom HTML + * templates if needed. + * + * @header Engine configuration + * @summary The Engine configuration object. This is just a typedef, create it like a regular object, e.g.: + * + * ``const MyConfig = { executable: 'godot', unloadAfterInit: false }`` + * + * @typedef {Object} EngineConfig + */ +const EngineConfig = {}; // eslint-disable-line no-unused-vars + +/** + * @struct + * @constructor + * @ignore + */ +const InternalConfig = function (initConfig) { // eslint-disable-line no-unused-vars + const cfg = /** @lends {InternalConfig.prototype} */ { + /** + * Whether the unload the engine automatically after the instance is initialized. + * + * @memberof EngineConfig + * @default + * @type {boolean} + */ + unloadAfterInit: true, + /** + * The HTML DOM Canvas object to use. + * + * By default, the first canvas element in the document will be used is none is specified. + * + * @memberof EngineConfig + * @default + * @type {?HTMLCanvasElement} + */ + canvas: null, + /** + * The name of the WASM file without the extension. (Set by Godot Editor export process). + * + * @memberof EngineConfig + * @default + * @type {string} + */ + executable: '', + /** + * An alternative name for the game pck to load. The executable name is used otherwise. + * + * @memberof EngineConfig + * @default + * @type {?string} + */ + mainPack: null, + /** + * Specify a language code to select the proper localization for the game. + * + * The browser locale will be used if none is specified. See complete list of + * :ref:`supported locales `. + * + * @memberof EngineConfig + * @type {?string} + * @default + */ + locale: null, + /** + * The canvas resize policy determines how the canvas should be resized by Godot. + * + * ``0`` means Godot won't do any resizing. This is useful if you want to control the canvas size from + * javascript code in your template. + * + * ``1`` means Godot will resize the canvas on start, and when changing window size via engine functions. + * + * ``2`` means Godot will adapt the canvas size to match the whole browser window. + * + * @memberof EngineConfig + * @type {number} + * @default + */ + canvasResizePolicy: 2, + /** + * The arguments to be passed as command line arguments on startup. + * + * See :ref:`command line tutorial `. + * + * **Note**: :js:meth:`startGame ` will always add the ``--main-pack`` argument. + * + * @memberof EngineConfig + * @type {Array} + * @default + */ + args: [], + /** + * When enabled, the game canvas will automatically grab the focus when the engine starts. + * + * @memberof EngineConfig + * @type {boolean} + * @default + */ + focusCanvas: true, + /** + * When enabled, this will turn on experimental virtual keyboard support on mobile. + * + * @memberof EngineConfig + * @type {boolean} + * @default + */ + experimentalVK: false, + /** + * The progressive web app service worker to install. + * @memberof EngineConfig + * @default + * @type {string} + */ + serviceWorker: '', + /** + * @ignore + * @type {Array.} + */ + persistentPaths: ['/userfs'], + /** + * @ignore + * @type {boolean} + */ + persistentDrops: false, + /** + * @ignore + * @type {Array.} + */ + gdextensionLibs: [], + /** + * @ignore + * @type {Array.} + */ + fileSizes: [], + /** + * A callback function for handling Godot's ``OS.execute`` calls. + * + * This is for example used in the Web Editor template to switch between project manager and editor, and for running the game. + * + * @callback EngineConfig.onExecute + * @param {string} path The path that Godot's wants executed. + * @param {Array.} args The arguments of the "command" to execute. + */ + /** + * @ignore + * @type {?function(string, Array.)} + */ + onExecute: null, + /** + * A callback function for being notified when the Godot instance quits. + * + * **Note**: This function will not be called if the engine crashes or become unresponsive. + * + * @callback EngineConfig.onExit + * @param {number} status_code The status code returned by Godot on exit. + */ + /** + * @ignore + * @type {?function(number)} + */ + onExit: null, + /** + * A callback function for displaying download progress. + * + * The function is called once per frame while downloading files, so the usage of ``requestAnimationFrame()`` + * is not necessary. + * + * If the callback function receives a total amount of bytes as 0, this means that it is impossible to calculate. + * Possible reasons include: + * + * - Files are delivered with server-side chunked compression + * - Files are delivered with server-side compression on Chromium + * - Not all file downloads have started yet (usually on servers without multi-threading) + * + * @callback EngineConfig.onProgress + * @param {number} current The current amount of downloaded bytes so far. + * @param {number} total The total amount of bytes to be downloaded. + */ + /** + * @ignore + * @type {?function(number, number)} + */ + onProgress: null, + /** + * A callback function for handling the standard output stream. This method should usually only be used in debug pages. + * + * By default, ``console.log()`` is used. + * + * @callback EngineConfig.onPrint + * @param {...*} [var_args] A variadic number of arguments to be printed. + */ + /** + * @ignore + * @type {?function(...*)} + */ + onPrint: function () { + console.log.apply(console, Array.from(arguments)); // eslint-disable-line no-console + }, + /** + * A callback function for handling the standard error stream. This method should usually only be used in debug pages. + * + * By default, ``console.error()`` is used. + * + * @callback EngineConfig.onPrintError + * @param {...*} [var_args] A variadic number of arguments to be printed as errors. + */ + /** + * @ignore + * @type {?function(...*)} + */ + onPrintError: function (var_args) { + console.error.apply(console, Array.from(arguments)); // eslint-disable-line no-console + }, + }; + + /** + * @ignore + * @struct + * @constructor + * @param {EngineConfig} opts + */ + function Config(opts) { + this.update(opts); + } + + Config.prototype = cfg; + + /** + * @ignore + * @param {EngineConfig} opts + */ + Config.prototype.update = function (opts) { + const config = opts || {}; + // NOTE: We must explicitly pass the default, accessing it via + // the key will fail due to closure compiler renames. + function parse(key, def) { + if (typeof (config[key]) === 'undefined') { + return def; + } + return config[key]; + } + // Module config + this.unloadAfterInit = parse('unloadAfterInit', this.unloadAfterInit); + this.onPrintError = parse('onPrintError', this.onPrintError); + this.onPrint = parse('onPrint', this.onPrint); + this.onProgress = parse('onProgress', this.onProgress); + + // Godot config + this.canvas = parse('canvas', this.canvas); + this.executable = parse('executable', this.executable); + this.mainPack = parse('mainPack', this.mainPack); + this.locale = parse('locale', this.locale); + this.canvasResizePolicy = parse('canvasResizePolicy', this.canvasResizePolicy); + this.persistentPaths = parse('persistentPaths', this.persistentPaths); + this.persistentDrops = parse('persistentDrops', this.persistentDrops); + this.experimentalVK = parse('experimentalVK', this.experimentalVK); + this.focusCanvas = parse('focusCanvas', this.focusCanvas); + this.serviceWorker = parse('serviceWorker', this.serviceWorker); + this.gdextensionLibs = parse('gdextensionLibs', this.gdextensionLibs); + this.fileSizes = parse('fileSizes', this.fileSizes); + this.args = parse('args', this.args); + this.onExecute = parse('onExecute', this.onExecute); + this.onExit = parse('onExit', this.onExit); + }; + + /** + * @ignore + * @param {string} loadPath + * @param {Response} response + */ + Config.prototype.getModuleConfig = function (loadPath, response) { + let r = response; + return { + 'print': this.onPrint, + 'printErr': this.onPrintError, + 'thisProgram': this.executable, + 'noExitRuntime': false, + 'dynamicLibraries': [`${loadPath}.side.wasm`], + 'instantiateWasm': function (imports, onSuccess) { + function done(result) { + onSuccess(result['instance'], result['module']); + } + if (typeof (WebAssembly.instantiateStreaming) !== 'undefined') { + WebAssembly.instantiateStreaming(Promise.resolve(r), imports).then(done); + } else { + r.arrayBuffer().then(function (buffer) { + WebAssembly.instantiate(buffer, imports).then(done); + }); + } + r = null; + return {}; + }, + 'locateFile': function (path) { + if (path.endsWith('.worker.js')) { + return `${loadPath}.worker.js`; + } else if (path.endsWith('.audio.worklet.js')) { + return `${loadPath}.audio.worklet.js`; + } else if (path.endsWith('.js')) { + return `${loadPath}.js`; + } else if (path.endsWith('.side.wasm')) { + return `${loadPath}.side.wasm`; + } else if (path.endsWith('.wasm')) { + return `${loadPath}.wasm`; + } + return path; + }, + }; + }; + + /** + * @ignore + * @param {function()} cleanup + */ + Config.prototype.getGodotConfig = function (cleanup) { + // Try to find a canvas + if (!(this.canvas instanceof HTMLCanvasElement)) { + const nodes = document.getElementsByTagName('canvas'); + if (nodes.length && nodes[0] instanceof HTMLCanvasElement) { + const first = nodes[0]; + this.canvas = /** @type {!HTMLCanvasElement} */ (first); + } + if (!this.canvas) { + throw new Error('No canvas found in page'); + } + } + // Canvas can grab focus on click, or key events won't work. + if (this.canvas.tabIndex < 0) { + this.canvas.tabIndex = 0; + } + + // Browser locale, or custom one if defined. + let locale = this.locale; + if (!locale) { + locale = navigator.languages ? navigator.languages[0] : navigator.language; + locale = locale.split('.')[0]; + } + locale = locale.replace('-', '_'); + const onExit = this.onExit; + + // Godot configuration. + return { + 'canvas': this.canvas, + 'canvasResizePolicy': this.canvasResizePolicy, + 'locale': locale, + 'persistentDrops': this.persistentDrops, + 'virtualKeyboard': this.experimentalVK, + 'focusCanvas': this.focusCanvas, + 'onExecute': this.onExecute, + 'onExit': function (p_code) { + cleanup(); // We always need to call the cleanup callback to free memory. + if (typeof (onExit) === 'function') { + onExit(p_code); + } + }, + }; + }; + return new Config(initConfig); +}; + +/** + * Projects exported for the Web expose the :js:class:`Engine` class to the JavaScript environment, that allows + * fine control over the engine's start-up process. + * + * This API is built in an asynchronous manner and requires basic understanding + * of `Promises `__. + * + * @module Engine + * @header Web export JavaScript reference + */ +const Engine = (function () { + const preloader = new Preloader(); + + let loadPromise = null; + let loadPath = ''; + let initPromise = null; + + /** + * @classdesc The ``Engine`` class provides methods for loading and starting exported projects on the Web. For default export + * settings, this is already part of the exported HTML page. To understand practical use of the ``Engine`` class, + * see :ref:`Custom HTML page for Web export `. + * + * @description Create a new Engine instance with the given configuration. + * + * @global + * @constructor + * @param {EngineConfig} initConfig The initial config for this instance. + */ + function Engine(initConfig) { // eslint-disable-line no-shadow + this.config = new InternalConfig(initConfig); + this.rtenv = null; + } + + /** + * Load the engine from the specified base path. + * + * @param {string} basePath Base path of the engine to load. + * @param {number=} [size=0] The file size if known. + * @returns {Promise} A Promise that resolves once the engine is loaded. + * + * @function Engine.load + */ + Engine.load = function (basePath, size) { + if (loadPromise == null) { + loadPath = basePath; + loadPromise = preloader.loadPromise(`${loadPath}.wasm`, size, true); + requestAnimationFrame(preloader.animateProgress); + } + return loadPromise; + }; + + /** + * Unload the engine to free memory. + * + * This method will be called automatically depending on the configuration. See :js:attr:`unloadAfterInit`. + * + * @function Engine.unload + */ + Engine.unload = function () { + loadPromise = null; + }; + + /** + * Safe Engine constructor, creates a new prototype for every new instance to avoid prototype pollution. + * @ignore + * @constructor + */ + function SafeEngine(initConfig) { + const proto = /** @lends Engine.prototype */ { + /** + * Initialize the engine instance. Optionally, pass the base path to the engine to load it, + * if it hasn't been loaded yet. See :js:meth:`Engine.load`. + * + * @param {string=} basePath Base path of the engine to load. + * @return {Promise} A ``Promise`` that resolves once the engine is loaded and initialized. + */ + init: function (basePath) { + if (initPromise) { + return initPromise; + } + if (loadPromise == null) { + if (!basePath) { + initPromise = Promise.reject(new Error('A base path must be provided when calling `init` and the engine is not loaded.')); + return initPromise; + } + Engine.load(basePath, this.config.fileSizes[`${basePath}.wasm`]); + } + const me = this; + function doInit(promise) { + // Care! Promise chaining is bogus with old emscripten versions. + // This caused a regression with the Mono build (which uses an older emscripten version). + // Make sure to test that when refactoring. + return new Promise(function (resolve, reject) { + promise.then(function (response) { + const cloned = new Response(response.clone().body, { 'headers': [['content-type', 'application/wasm']] }); + Godot(me.config.getModuleConfig(loadPath, cloned)).then(function (module) { + const paths = me.config.persistentPaths; + module['initFS'](paths).then(function (err) { + me.rtenv = module; + if (me.config.unloadAfterInit) { + Engine.unload(); + } + resolve(); + }); + }); + }); + }); + } + preloader.setProgressFunc(this.config.onProgress); + initPromise = doInit(loadPromise); + return initPromise; + }, + + /** + * Load a file so it is available in the instance's file system once it runs. Must be called **before** starting the + * instance. + * + * If not provided, the ``path`` is derived from the URL of the loaded file. + * + * @param {string|ArrayBuffer} file The file to preload. + * + * If a ``string`` the file will be loaded from that path. + * + * If an ``ArrayBuffer`` or a view on one, the buffer will used as the content of the file. + * + * @param {string=} path Path by which the file will be accessible. Required, if ``file`` is not a string. + * + * @returns {Promise} A Promise that resolves once the file is loaded. + */ + preloadFile: function (file, path) { + return preloader.preload(file, path, this.config.fileSizes[file]); + }, + + /** + * Start the engine instance using the given override configuration (if any). + * :js:meth:`startGame ` can be used in typical cases instead. + * + * This will initialize the instance if it is not initialized. For manual initialization, see :js:meth:`init `. + * The engine must be loaded beforehand. + * + * Fails if a canvas cannot be found on the page, or not specified in the configuration. + * + * @param {EngineConfig} override An optional configuration override. + * @return {Promise} Promise that resolves once the engine started. + */ + start: function (override) { + this.config.update(override); + const me = this; + return me.init().then(function () { + if (!me.rtenv) { + return Promise.reject(new Error('The engine must be initialized before it can be started')); + } + + let config = {}; + try { + config = me.config.getGodotConfig(function () { + me.rtenv = null; + }); + } catch (e) { + return Promise.reject(e); + } + // Godot configuration. + me.rtenv['initConfig'](config); + + // Preload GDExtension libraries. + const libs = []; + me.config.gdextensionLibs.forEach(function (lib) { + libs.push(me.rtenv['loadDynamicLibrary'](lib, { 'loadAsync': true })); + }); + return Promise.all(libs).then(function () { + return new Promise(function (resolve, reject) { + preloader.preloadedFiles.forEach(function (file) { + me.rtenv['copyToFS'](file.path, file.buffer); + }); + preloader.preloadedFiles.length = 0; // Clear memory + me.rtenv['callMain'](me.config.args); + initPromise = null; + if (me.config.serviceWorker && 'serviceWorker' in navigator) { + navigator.serviceWorker.register(me.config.serviceWorker); + } + resolve(); + }); + }); + }); + }, + + /** + * Start the game instance using the given configuration override (if any). + * + * This will initialize the instance if it is not initialized. For manual initialization, see :js:meth:`init `. + * + * This will load the engine if it is not loaded, and preload the main pck. + * + * This method expects the initial config (or the override) to have both the :js:attr:`executable` and :js:attr:`mainPack` + * properties set (normally done by the editor during export). + * + * @param {EngineConfig} override An optional configuration override. + * @return {Promise} Promise that resolves once the game started. + */ + startGame: function (override) { + this.config.update(override); + // Add main-pack argument. + const exe = this.config.executable; + const pack = this.config.mainPack || `${exe}.pck`; + this.config.args = ['--main-pack', pack].concat(this.config.args); + // Start and init with execName as loadPath if not inited. + const me = this; + return Promise.all([ + this.init(exe), + this.preloadFile(pack, pack), + ]).then(function () { + return me.start.apply(me); + }); + }, + + /** + * Create a file at the specified ``path`` with the passed as ``buffer`` in the instance's file system. + * + * @param {string} path The location where the file will be created. + * @param {ArrayBuffer} buffer The content of the file. + */ + copyToFS: function (path, buffer) { + if (this.rtenv == null) { + throw new Error('Engine must be inited before copying files'); + } + this.rtenv['copyToFS'](path, buffer); + }, + + /** + * Request that the current instance quit. + * + * This is akin the user pressing the close button in the window manager, and will + * have no effect if the engine has crashed, or is stuck in a loop. + * + */ + requestQuit: function () { + if (this.rtenv) { + this.rtenv['request_quit'](); + } + }, + }; + + Engine.prototype = proto; + // Closure compiler exported instance methods. + Engine.prototype['init'] = Engine.prototype.init; + Engine.prototype['preloadFile'] = Engine.prototype.preloadFile; + Engine.prototype['start'] = Engine.prototype.start; + Engine.prototype['startGame'] = Engine.prototype.startGame; + Engine.prototype['copyToFS'] = Engine.prototype.copyToFS; + Engine.prototype['requestQuit'] = Engine.prototype.requestQuit; + // Also expose static methods as instance methods + Engine.prototype['load'] = Engine.load; + Engine.prototype['unload'] = Engine.unload; + return new Engine(initConfig); + } + + // Closure compiler exported static methods. + SafeEngine['load'] = Engine.load; + SafeEngine['unload'] = Engine.unload; + + // Feature-detection utilities. + SafeEngine['isWebGLAvailable'] = Features.isWebGLAvailable; + SafeEngine['isFetchAvailable'] = Features.isFetchAvailable; + SafeEngine['isSecureContext'] = Features.isSecureContext; + SafeEngine['isCrossOriginIsolated'] = Features.isCrossOriginIsolated; + SafeEngine['isSharedArrayBufferAvailable'] = Features.isSharedArrayBufferAvailable; + SafeEngine['isAudioWorkletAvailable'] = Features.isAudioWorkletAvailable; + SafeEngine['getMissingFeatures'] = Features.getMissingFeatures; + + return SafeEngine; +}()); +if (typeof window !== 'undefined') { + window['Engine'] = Engine; +} diff --git a/build/smg/index.pck b/build/smg/index.pck new file mode 100644 index 0000000000000000000000000000000000000000..612a48dd7f6edc59fced07572b1a2d558515046a --- /dev/null +++ b/build/smg/index.pck @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:1d32481932a4d11542b0a462dc130f3eda8b97d087fec1a4a2f7e1b4d618c768 +size 52711824 diff --git a/build/smg/index.png b/build/smg/index.png new file mode 100644 index 0000000000000000000000000000000000000000..eeea696f548066d6278d392439c7bb21e4ba3f9d Binary files /dev/null and b/build/smg/index.png differ diff --git a/build/smg/index.wasm b/build/smg/index.wasm new file mode 100644 index 0000000000000000000000000000000000000000..b9141bc91ae31413a88660b55cb4aa42ed173b09 --- /dev/null +++ b/build/smg/index.wasm @@ -0,0 +1,3 @@ +version https://git-lfs.github.com/spec/v1 +oid sha256:a6316e674cfaa06e2de92ded1d338335e61554c81f485127cd6d86cd90c95a2d +size 52315256 diff --git a/build/smg/index.worker.js b/build/smg/index.worker.js new file mode 100644 index 0000000000000000000000000000000000000000..5a62c09adf44aeab8ef9c10e498b4fe264f5390b --- /dev/null +++ b/build/smg/index.worker.js @@ -0,0 +1,164 @@ +/** + * @license + * Copyright 2015 The Emscripten Authors + * SPDX-License-Identifier: MIT + */ + +// Pthread Web Worker startup routine: +// This is the entry point file that is loaded first by each Web Worker +// that executes pthreads on the Emscripten application. + +'use strict'; + +var Module = {}; + +// Thread-local guard variable for one-time init of the JS state +var initializedJS = false; + +// Proxying queues that were notified before the thread started and need to be +// executed as part of startup. +var pendingNotifiedProxyingQueues = []; + +function assert(condition, text) { + if (!condition) abort('Assertion failed: ' + text); +} + +function threadPrintErr() { + var text = Array.prototype.slice.call(arguments).join(' '); + console.error(text); +} +function threadAlert() { + var text = Array.prototype.slice.call(arguments).join(' '); + postMessage({cmd: 'alert', text: text, threadId: Module['_pthread_self']()}); +} +// We don't need out() for now, but may need to add it if we want to use it +// here. Or, if this code all moves into the main JS, that problem will go +// away. (For now, adding it here increases code size for no benefit.) +var out = () => { throw 'out() is not defined in worker.js.'; } +var err = threadPrintErr; +self.alert = threadAlert; + +Module['instantiateWasm'] = (info, receiveInstance) => { + // Instantiate from the module posted from the main thread. + // We can just use sync instantiation in the worker. + var instance = new WebAssembly.Instance(Module['wasmModule'], info); + // TODO: Due to Closure regression https://github.com/google/closure-compiler/issues/3193, + // the above line no longer optimizes out down to the following line. + // When the regression is fixed, we can remove this if/else. + receiveInstance(instance); + // We don't need the module anymore; new threads will be spawned from the main thread. + Module['wasmModule'] = null; + return instance.exports; +} + +self.onmessage = (e) => { + try { + if (e.data.cmd === 'load') { // Preload command that is called once per worker to parse and load the Emscripten code. + + // Module and memory were sent from main thread + Module['wasmModule'] = e.data.wasmModule; + + Module['wasmMemory'] = e.data.wasmMemory; + + Module['buffer'] = Module['wasmMemory'].buffer; + + Module['ENVIRONMENT_IS_PTHREAD'] = true; + + if (typeof e.data.urlOrBlob == 'string') { + importScripts(e.data.urlOrBlob); + } else { + var objectUrl = URL.createObjectURL(e.data.urlOrBlob); + importScripts(objectUrl); + URL.revokeObjectURL(objectUrl); + } + Godot(Module).then(function (instance) { + Module = instance; + }); + } else if (e.data.cmd === 'run') { + // This worker was idle, and now should start executing its pthread entry + // point. + // performance.now() is specced to return a wallclock time in msecs since + // that Web Worker/main thread launched. However for pthreads this can + // cause subtle problems in emscripten_get_now() as this essentially + // would measure time from pthread_create(), meaning that the clocks + // between each threads would be wildly out of sync. Therefore sync all + // pthreads to the clock on the main browser thread, so that different + // threads see a somewhat coherent clock across each of them + // (+/- 0.1msecs in testing). + Module['__performance_now_clock_drift'] = performance.now() - e.data.time; + + // Pass the thread address to wasm to store it for fast access. + Module['__emscripten_thread_init'](e.data.pthread_ptr, /*isMainBrowserThread=*/0, /*isMainRuntimeThread=*/0, /*canBlock=*/1); + + assert(e.data.pthread_ptr); + // Also call inside JS module to set up the stack frame for this pthread in JS module scope + Module['establishStackSpace'](); + Module['PThread'].receiveObjectTransfer(e.data); + Module['PThread'].threadInitTLS(); + + if (!initializedJS) { + + // Execute any proxied work that came in before the thread was + // initialized. Only do this once because it is only possible for + // proxying notifications to arrive before thread initialization on + // fresh workers. + pendingNotifiedProxyingQueues.forEach(queue => { + Module['executeNotifiedProxyingQueue'](queue); + }); + pendingNotifiedProxyingQueues = []; + initializedJS = true; + } + + try { + Module['invokeEntryPoint'](e.data.start_routine, e.data.arg); + } catch(ex) { + if (ex != 'unwind') { + // ExitStatus not present in MINIMAL_RUNTIME + if (ex instanceof Module['ExitStatus']) { + if (Module['keepRuntimeAlive']()) { + err('Pthread 0x' + Module['_pthread_self']().toString(16) + ' called exit(), staying alive due to noExitRuntime.'); + } else { + err('Pthread 0x' + Module['_pthread_self']().toString(16) + ' called exit(), calling _emscripten_thread_exit.'); + Module['__emscripten_thread_exit'](ex.status); + } + } + else + { + // The pthread "crashed". Do not call `_emscripten_thread_exit` (which + // would make this thread joinable. Instead, re-throw the exception + // and let the top level handler propagate it back to the main thread. + throw ex; + } + } else { + // else e == 'unwind', and we should fall through here and keep the pthread alive for asynchronous events. + err('Pthread 0x' + Module['_pthread_self']().toString(16) + ' completed its main entry point with an `unwind`, keeping the worker alive for asynchronous operation.'); + } + } + } else if (e.data.cmd === 'cancel') { // Main thread is asking for a pthread_cancel() on this thread. + if (Module['_pthread_self']()) { + Module['__emscripten_thread_exit'](-1/*PTHREAD_CANCELED*/); + } + } else if (e.data.target === 'setimmediate') { + // no-op + } else if (e.data.cmd === 'processProxyingQueue') { + if (initializedJS) { + Module['executeNotifiedProxyingQueue'](e.data.queue); + } else { + // Defer executing this queue until the runtime is initialized. + pendingNotifiedProxyingQueues.push(e.data.queue); + } + } else { + err('worker.js received unknown command ' + e.data.cmd); + err(e.data); + } + } catch(ex) { + err('worker.js onmessage() captured an uncaught exception: ' + ex); + if (ex && ex.stack) err(ex.stack); + if (Module['__emscripten_thread_crashed']) { + Module['__emscripten_thread_crashed'](); + } + throw ex; + } +}; + + diff --git a/index.html b/index.html deleted file mode 100644 index 58275de3b1c343a98420342baa076b9baaafa157..0000000000000000000000000000000000000000 --- a/index.html +++ /dev/null @@ -1,19 +0,0 @@ - - - - - - My static Space - - - -
-

Welcome to your static Space!

-

You can modify this app directly by editing index.html in the Files and versions tab.

-

- Also don't forget to check the - Spaces documentation. -

-
- - diff --git a/package-lock.json b/package-lock.json new file mode 100644 index 0000000000000000000000000000000000000000..d30f1973b22244d3fddbbc5b61acfae7ed9dbf84 --- /dev/null +++ b/package-lock.json @@ -0,0 +1,2167 @@ +{ + "name": "my-app", + "version": "0.0.1", + "lockfileVersion": 3, + "requires": true, + "packages": { + "": { + "name": "my-app", + "version": "0.0.1", + "dependencies": { + "@sveltejs/adapter-static": "^2.0.2" + }, + "devDependencies": { + "@sveltejs/adapter-auto": "^2.0.0", + "@sveltejs/kit": "^1.5.0", + "autoprefixer": "^10.4.14", + "postcss": "^8.4.23", + "svelte": "^3.54.0", + "svelte-check": "^3.0.1", + "tailwindcss": "^3.3.2", + "tslib": "^2.4.1", + "typescript": "^5.0.0", + "vite": "^4.3.0" + } + }, + "node_modules/@alloc/quick-lru": { + "version": "5.2.0", + "resolved": "https://registry.npmjs.org/@alloc/quick-lru/-/quick-lru-5.2.0.tgz", + "integrity": "sha512-UrcABB+4bUrFABwbluTIBErXwvbsU/V7TZWfmbgJfbkwiBuziS9gxdODUyuiecfdGQ85jglMW6juS3+z5TsKLw==", + "dev": true, + "engines": { + "node": ">=10" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/@esbuild/android-arm": { + "version": "0.17.18", + "resolved": "https://registry.npmjs.org/@esbuild/android-arm/-/android-arm-0.17.18.tgz", + "integrity": "sha512-EmwL+vUBZJ7mhFCs5lA4ZimpUH3WMAoqvOIYhVQwdIgSpHC8ImHdsRyhHAVxpDYUSm0lWvd63z0XH1IlImS2Qw==", + "cpu": [ + "arm" + ], + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/android-arm64": { + "version": "0.17.18", + "resolved": "https://registry.npmjs.org/@esbuild/android-arm64/-/android-arm64-0.17.18.tgz", + "integrity": "sha512-/iq0aK0eeHgSC3z55ucMAHO05OIqmQehiGay8eP5l/5l+iEr4EIbh4/MI8xD9qRFjqzgkc0JkX0LculNC9mXBw==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/android-x64": { + "version": "0.17.18", + "resolved": "https://registry.npmjs.org/@esbuild/android-x64/-/android-x64-0.17.18.tgz", + "integrity": "sha512-x+0efYNBF3NPW2Xc5bFOSFW7tTXdAcpfEg2nXmxegm4mJuVeS+i109m/7HMiOQ6M12aVGGFlqJX3RhNdYM2lWg==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "android" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/darwin-arm64": { + "version": "0.17.18", + "resolved": "https://registry.npmjs.org/@esbuild/darwin-arm64/-/darwin-arm64-0.17.18.tgz", + "integrity": "sha512-6tY+djEAdF48M1ONWnQb1C+6LiXrKjmqjzPNPWXhu/GzOHTHX2nh8Mo2ZAmBFg0kIodHhciEgUBtcYCAIjGbjQ==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/darwin-x64": { + "version": "0.17.18", + "resolved": "https://registry.npmjs.org/@esbuild/darwin-x64/-/darwin-x64-0.17.18.tgz", + "integrity": "sha512-Qq84ykvLvya3dO49wVC9FFCNUfSrQJLbxhoQk/TE1r6MjHo3sFF2tlJCwMjhkBVq3/ahUisj7+EpRSz0/+8+9A==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/freebsd-arm64": { + "version": "0.17.18", + "resolved": "https://registry.npmjs.org/@esbuild/freebsd-arm64/-/freebsd-arm64-0.17.18.tgz", + "integrity": "sha512-fw/ZfxfAzuHfaQeMDhbzxp9mc+mHn1Y94VDHFHjGvt2Uxl10mT4CDavHm+/L9KG441t1QdABqkVYwakMUeyLRA==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "freebsd" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/freebsd-x64": { + "version": "0.17.18", + "resolved": "https://registry.npmjs.org/@esbuild/freebsd-x64/-/freebsd-x64-0.17.18.tgz", + "integrity": "sha512-FQFbRtTaEi8ZBi/A6kxOC0V0E9B/97vPdYjY9NdawyLd4Qk5VD5g2pbWN2VR1c0xhzcJm74HWpObPszWC+qTew==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "freebsd" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-arm": { + "version": "0.17.18", + "resolved": "https://registry.npmjs.org/@esbuild/linux-arm/-/linux-arm-0.17.18.tgz", + "integrity": "sha512-jW+UCM40LzHcouIaqv3e/oRs0JM76JfhHjCavPxMUti7VAPh8CaGSlS7cmyrdpzSk7A+8f0hiedHqr/LMnfijg==", + "cpu": [ + "arm" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-arm64": { + "version": "0.17.18", + "resolved": "https://registry.npmjs.org/@esbuild/linux-arm64/-/linux-arm64-0.17.18.tgz", + "integrity": "sha512-R7pZvQZFOY2sxUG8P6A21eq6q+eBv7JPQYIybHVf1XkQYC+lT7nDBdC7wWKTrbvMXKRaGudp/dzZCwL/863mZQ==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-ia32": { + "version": "0.17.18", + "resolved": "https://registry.npmjs.org/@esbuild/linux-ia32/-/linux-ia32-0.17.18.tgz", + "integrity": "sha512-ygIMc3I7wxgXIxk6j3V00VlABIjq260i967Cp9BNAk5pOOpIXmd1RFQJQX9Io7KRsthDrQYrtcx7QCof4o3ZoQ==", + "cpu": [ + "ia32" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-loong64": { + "version": "0.17.18", + "resolved": "https://registry.npmjs.org/@esbuild/linux-loong64/-/linux-loong64-0.17.18.tgz", + "integrity": "sha512-bvPG+MyFs5ZlwYclCG1D744oHk1Pv7j8psF5TfYx7otCVmcJsEXgFEhQkbhNW8otDHL1a2KDINW20cfCgnzgMQ==", + "cpu": [ + "loong64" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-mips64el": { + "version": "0.17.18", + "resolved": "https://registry.npmjs.org/@esbuild/linux-mips64el/-/linux-mips64el-0.17.18.tgz", + "integrity": "sha512-oVqckATOAGuiUOa6wr8TXaVPSa+6IwVJrGidmNZS1cZVx0HqkTMkqFGD2HIx9H1RvOwFeWYdaYbdY6B89KUMxA==", + "cpu": [ + "mips64el" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-ppc64": { + "version": "0.17.18", + "resolved": "https://registry.npmjs.org/@esbuild/linux-ppc64/-/linux-ppc64-0.17.18.tgz", + "integrity": "sha512-3dLlQO+b/LnQNxgH4l9rqa2/IwRJVN9u/bK63FhOPB4xqiRqlQAU0qDU3JJuf0BmaH0yytTBdoSBHrb2jqc5qQ==", + "cpu": [ + "ppc64" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-riscv64": { + "version": "0.17.18", + "resolved": "https://registry.npmjs.org/@esbuild/linux-riscv64/-/linux-riscv64-0.17.18.tgz", + "integrity": "sha512-/x7leOyDPjZV3TcsdfrSI107zItVnsX1q2nho7hbbQoKnmoeUWjs+08rKKt4AUXju7+3aRZSsKrJtaRmsdL1xA==", + "cpu": [ + "riscv64" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-s390x": { + "version": "0.17.18", + "resolved": "https://registry.npmjs.org/@esbuild/linux-s390x/-/linux-s390x-0.17.18.tgz", + "integrity": "sha512-cX0I8Q9xQkL/6F5zWdYmVf5JSQt+ZfZD2bJudZrWD+4mnUvoZ3TDDXtDX2mUaq6upMFv9FlfIh4Gfun0tbGzuw==", + "cpu": [ + "s390x" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/linux-x64": { + "version": "0.17.18", + "resolved": "https://registry.npmjs.org/@esbuild/linux-x64/-/linux-x64-0.17.18.tgz", + "integrity": "sha512-66RmRsPlYy4jFl0vG80GcNRdirx4nVWAzJmXkevgphP1qf4dsLQCpSKGM3DUQCojwU1hnepI63gNZdrr02wHUA==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "linux" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/netbsd-x64": { + "version": "0.17.18", + "resolved": "https://registry.npmjs.org/@esbuild/netbsd-x64/-/netbsd-x64-0.17.18.tgz", + "integrity": "sha512-95IRY7mI2yrkLlTLb1gpDxdC5WLC5mZDi+kA9dmM5XAGxCME0F8i4bYH4jZreaJ6lIZ0B8hTrweqG1fUyW7jbg==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "netbsd" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/openbsd-x64": { + "version": "0.17.18", + "resolved": "https://registry.npmjs.org/@esbuild/openbsd-x64/-/openbsd-x64-0.17.18.tgz", + "integrity": "sha512-WevVOgcng+8hSZ4Q3BKL3n1xTv5H6Nb53cBrtzzEjDbbnOmucEVcZeGCsCOi9bAOcDYEeBZbD2SJNBxlfP3qiA==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "openbsd" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/sunos-x64": { + "version": "0.17.18", + "resolved": "https://registry.npmjs.org/@esbuild/sunos-x64/-/sunos-x64-0.17.18.tgz", + "integrity": "sha512-Rzf4QfQagnwhQXVBS3BYUlxmEbcV7MY+BH5vfDZekU5eYpcffHSyjU8T0xucKVuOcdCsMo+Ur5wmgQJH2GfNrg==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "sunos" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/win32-arm64": { + "version": "0.17.18", + "resolved": "https://registry.npmjs.org/@esbuild/win32-arm64/-/win32-arm64-0.17.18.tgz", + "integrity": "sha512-Kb3Ko/KKaWhjeAm2YoT/cNZaHaD1Yk/pa3FTsmqo9uFh1D1Rfco7BBLIPdDOozrObj2sahslFuAQGvWbgWldAg==", + "cpu": [ + "arm64" + ], + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/win32-ia32": { + "version": "0.17.18", + "resolved": "https://registry.npmjs.org/@esbuild/win32-ia32/-/win32-ia32-0.17.18.tgz", + "integrity": "sha512-0/xUMIdkVHwkvxfbd5+lfG7mHOf2FRrxNbPiKWg9C4fFrB8H0guClmaM3BFiRUYrznVoyxTIyC/Ou2B7QQSwmw==", + "cpu": [ + "ia32" + ], + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@esbuild/win32-x64": { + "version": "0.17.18", + "resolved": "https://registry.npmjs.org/@esbuild/win32-x64/-/win32-x64-0.17.18.tgz", + "integrity": "sha512-qU25Ma1I3NqTSHJUOKi9sAH1/Mzuvlke0ioMJRthLXKm7JiSKVwFghlGbDLOO2sARECGhja4xYfRAZNPAkooYg==", + "cpu": [ + "x64" + ], + "optional": true, + "os": [ + "win32" + ], + "engines": { + "node": ">=12" + } + }, + "node_modules/@jridgewell/gen-mapping": { + "version": "0.3.3", + "resolved": "https://registry.npmjs.org/@jridgewell/gen-mapping/-/gen-mapping-0.3.3.tgz", + "integrity": "sha512-HLhSWOLRi875zjjMG/r+Nv0oCW8umGb0BgEhyX3dDX3egwZtB8PqLnjz3yedt8R5StBrzcg4aBpnh8UA9D1BoQ==", + "dev": true, + "dependencies": { + "@jridgewell/set-array": "^1.0.1", + "@jridgewell/sourcemap-codec": "^1.4.10", + "@jridgewell/trace-mapping": "^0.3.9" + }, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/@jridgewell/resolve-uri": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/@jridgewell/resolve-uri/-/resolve-uri-3.1.0.tgz", + "integrity": "sha512-F2msla3tad+Mfht5cJq7LSXcdudKTWCVYUgw6pLFOOHSTtZlj6SWNYAp+AhuqLmWdBO2X5hPrLcu8cVP8fy28w==", + "dev": true, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/@jridgewell/set-array": { + "version": "1.1.2", + "resolved": "https://registry.npmjs.org/@jridgewell/set-array/-/set-array-1.1.2.tgz", + "integrity": "sha512-xnkseuNADM0gt2bs+BvhO0p78Mk762YnZdsuzFV018NoG1Sj1SCQvpSqa7XUaTam5vAGasABV9qXASMKnFMwMw==", + "dev": true, + "engines": { + "node": ">=6.0.0" + } + }, + "node_modules/@jridgewell/sourcemap-codec": { + "version": "1.4.15", + "resolved": "https://registry.npmjs.org/@jridgewell/sourcemap-codec/-/sourcemap-codec-1.4.15.tgz", + "integrity": "sha512-eF2rxCRulEKXHTRiDrDy6erMYWqNw4LPdQ8UQA4huuxaQsVeRPFl2oM8oDGxMFhJUWZf9McpLtJasDDZb/Bpeg==" + }, + "node_modules/@jridgewell/trace-mapping": { + "version": "0.3.18", + "resolved": "https://registry.npmjs.org/@jridgewell/trace-mapping/-/trace-mapping-0.3.18.tgz", + "integrity": "sha512-w+niJYzMHdd7USdiH2U6869nqhD2nbfZXND5Yp93qIbEmnDNk7PD48o+YchRVpzMU7M6jVCbenTR7PA1FLQ9pA==", + "dev": true, + "dependencies": { + "@jridgewell/resolve-uri": "3.1.0", + "@jridgewell/sourcemap-codec": "1.4.14" + } + }, + "node_modules/@jridgewell/trace-mapping/node_modules/@jridgewell/sourcemap-codec": { + "version": "1.4.14", + "resolved": "https://registry.npmjs.org/@jridgewell/sourcemap-codec/-/sourcemap-codec-1.4.14.tgz", + "integrity": "sha512-XPSJHWmi394fuUuzDnGz1wiKqWfo1yXecHQMRf2l6hztTO+nPru658AyDngaBe7isIxEkRsPR3FZh+s7iVa4Uw==", + "dev": true + }, + "node_modules/@nodelib/fs.scandir": { + "version": "2.1.5", + "resolved": "https://registry.npmjs.org/@nodelib/fs.scandir/-/fs.scandir-2.1.5.tgz", + "integrity": "sha512-vq24Bq3ym5HEQm2NKCr3yXDwjc7vTsEThRDnkp2DK9p1uqLR+DHurm/NOTo0KG7HYHU7eppKZj3MyqYuMBf62g==", + "dev": true, + "dependencies": { + "@nodelib/fs.stat": "2.0.5", + "run-parallel": "^1.1.9" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/@nodelib/fs.stat": { + "version": "2.0.5", + "resolved": "https://registry.npmjs.org/@nodelib/fs.stat/-/fs.stat-2.0.5.tgz", + "integrity": "sha512-RkhPPp2zrqDAQA/2jNhnztcPAlv64XdhIp7a7454A5ovI7Bukxgt7MX7udwAu3zg1DcpPU0rz3VV1SeaqvY4+A==", + "dev": true, + "engines": { + "node": ">= 8" + } + }, + "node_modules/@nodelib/fs.walk": { + "version": "1.2.8", + "resolved": "https://registry.npmjs.org/@nodelib/fs.walk/-/fs.walk-1.2.8.tgz", + "integrity": "sha512-oGB+UxlgWcgQkgwo8GcEGwemoTFt3FIO9ababBmaGwXIoBKZ+GTy0pP185beGg7Llih/NSHSV2XAs1lnznocSg==", + "dev": true, + "dependencies": { + "@nodelib/fs.scandir": "2.1.5", + "fastq": "^1.6.0" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/@polka/url": { + "version": "1.0.0-next.21", + "resolved": "https://registry.npmjs.org/@polka/url/-/url-1.0.0-next.21.tgz", + "integrity": "sha512-a5Sab1C4/icpTZVzZc5Ghpz88yQtGOyNqYXcZgOssB2uuAr+wF/MvN6bgtW32q7HHrvBki+BsZ0OuNv6EV3K9g==" + }, + "node_modules/@sveltejs/adapter-auto": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/@sveltejs/adapter-auto/-/adapter-auto-2.0.1.tgz", + "integrity": "sha512-anxxYMcQy7HWSKxN4YNaVcgNzCHtNFwygq72EA1Xv7c+5gSECOJ1ez1PYoLciPiFa7A3XBvMDQXUFJ2eqLDtAA==", + "dev": true, + "dependencies": { + "import-meta-resolve": "^3.0.0" + }, + "peerDependencies": { + "@sveltejs/kit": "^1.0.0" + } + }, + "node_modules/@sveltejs/adapter-static": { + "version": "2.0.2", + "resolved": "https://registry.npmjs.org/@sveltejs/adapter-static/-/adapter-static-2.0.2.tgz", + "integrity": "sha512-9wYtf6s6ew7DHUHMrt55YpD1FgV7oWql2IGsW5BXquLxqcY9vjrqCFo0TzzDpo+ZPZkW/v77k0eOP6tsAb8HmQ==", + "peerDependencies": { + "@sveltejs/kit": "^1.5.0" + } + }, + "node_modules/@sveltejs/kit": { + "version": "1.16.3", + "resolved": "https://registry.npmjs.org/@sveltejs/kit/-/kit-1.16.3.tgz", + "integrity": "sha512-8uv0udYRpVuE1BweFidcWHfL+u2gAANKmvIal1dN/FWPBl7DJYbt9zYEtr3bNTiXystT8Sn0Wp54RfwpbPqHjQ==", + "hasInstallScript": true, + "dependencies": { + "@sveltejs/vite-plugin-svelte": "^2.1.1", + "@types/cookie": "^0.5.1", + "cookie": "^0.5.0", + "devalue": "^4.3.0", + "esm-env": "^1.0.0", + "kleur": "^4.1.5", + "magic-string": "^0.30.0", + "mime": "^3.0.0", + "sade": "^1.8.1", + "set-cookie-parser": "^2.6.0", + "sirv": "^2.0.2", + "tiny-glob": "^0.2.9", + "undici": "~5.22.0" + }, + "bin": { + "svelte-kit": "svelte-kit.js" + }, + "engines": { + "node": "^16.14 || >=18" + }, + "peerDependencies": { + "svelte": "^3.54.0", + "vite": "^4.0.0" + } + }, + "node_modules/@sveltejs/vite-plugin-svelte": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/@sveltejs/vite-plugin-svelte/-/vite-plugin-svelte-2.2.0.tgz", + "integrity": "sha512-KDtdva+FZrZlyug15KlbXuubntAPKcBau0K7QhAIqC5SAy0uDbjZwoexDRx0L0J2T4niEfC6FnA9GuQQJKg+Aw==", + "dependencies": { + "debug": "^4.3.4", + "deepmerge": "^4.3.1", + "kleur": "^4.1.5", + "magic-string": "^0.30.0", + "svelte-hmr": "^0.15.1", + "vitefu": "^0.2.4" + }, + "engines": { + "node": "^14.18.0 || >= 16" + }, + "peerDependencies": { + "svelte": "^3.54.0", + "vite": "^4.0.0" + } + }, + "node_modules/@types/cookie": { + "version": "0.5.1", + "resolved": "https://registry.npmjs.org/@types/cookie/-/cookie-0.5.1.tgz", + "integrity": "sha512-COUnqfB2+ckwXXSFInsFdOAWQzCCx+a5hq2ruyj+Vjund94RJQd4LG2u9hnvJrTgunKAaax7ancBYlDrNYxA0g==" + }, + "node_modules/@types/pug": { + "version": "2.0.6", + "resolved": "https://registry.npmjs.org/@types/pug/-/pug-2.0.6.tgz", + "integrity": "sha512-SnHmG9wN1UVmagJOnyo/qkk0Z7gejYxOYYmaAwr5u2yFYfsupN3sg10kyzN8Hep/2zbHxCnsumxOoRIRMBwKCg==", + "dev": true + }, + "node_modules/any-promise": { + "version": "1.3.0", + "resolved": "https://registry.npmjs.org/any-promise/-/any-promise-1.3.0.tgz", + "integrity": "sha512-7UvmKalWRt1wgjL1RrGxoSJW/0QZFIegpeGvZG9kjp8vrRu55XTHbwnqq2GpXm9uLbcuhxm3IqX9OB4MZR1b2A==", + "dev": true + }, + "node_modules/anymatch": { + "version": "3.1.3", + "resolved": "https://registry.npmjs.org/anymatch/-/anymatch-3.1.3.tgz", + "integrity": "sha512-KMReFUr0B4t+D+OBkjR3KYqvocp2XaSzO55UcB6mgQMd3KbcE+mWTyvVV7D/zsdEbNnV6acZUutkiHQXvTr1Rw==", + "dev": true, + "dependencies": { + "normalize-path": "^3.0.0", + "picomatch": "^2.0.4" + }, + "engines": { + "node": ">= 8" + } + }, + "node_modules/arg": { + "version": "5.0.2", + "resolved": "https://registry.npmjs.org/arg/-/arg-5.0.2.tgz", + "integrity": "sha512-PYjyFOLKQ9y57JvQ6QLo8dAgNqswh8M1RMJYdQduT6xbWSgK36P/Z/v+p888pM69jMMfS8Xd8F6I1kQ/I9HUGg==", + "dev": true + }, + "node_modules/autoprefixer": { + "version": "10.4.14", + "resolved": "https://registry.npmjs.org/autoprefixer/-/autoprefixer-10.4.14.tgz", + "integrity": "sha512-FQzyfOsTlwVzjHxKEqRIAdJx9niO6VCBCoEwax/VLSoQF29ggECcPuBqUMZ+u8jCZOPSy8b8/8KnuFbp0SaFZQ==", + "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/postcss/" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/autoprefixer" + } + ], + "dependencies": { + "browserslist": "^4.21.5", + "caniuse-lite": "^1.0.30001464", + "fraction.js": "^4.2.0", + "normalize-range": "^0.1.2", + "picocolors": "^1.0.0", + "postcss-value-parser": "^4.2.0" + }, + "bin": { + "autoprefixer": "bin/autoprefixer" + }, + "engines": { + "node": "^10 || ^12 || >=14" + }, + "peerDependencies": { + "postcss": "^8.1.0" + } + }, + "node_modules/balanced-match": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/balanced-match/-/balanced-match-1.0.2.tgz", + "integrity": "sha512-3oSeUO0TMV67hN1AmbXsK4yaqU7tjiHlbxRDZOpH0KW9+CeX4bRAaX0Anxt0tx2MrpRpWwQaPwIlISEJhYU5Pw==", + "dev": true + }, + "node_modules/binary-extensions": { + "version": "2.2.0", + "resolved": "https://registry.npmjs.org/binary-extensions/-/binary-extensions-2.2.0.tgz", + "integrity": "sha512-jDctJ/IVQbZoJykoeHbhXpOlNBqGNcwXJKJog42E5HDPUwQTSdjCHdihjj0DlnheQ7blbT6dHOafNAiS8ooQKA==", + "dev": true, + "engines": { + "node": ">=8" + } + }, + "node_modules/brace-expansion": { + "version": "1.1.11", + "resolved": "https://registry.npmjs.org/brace-expansion/-/brace-expansion-1.1.11.tgz", + "integrity": "sha512-iCuPHDFgrHX7H2vEI/5xpz07zSHB00TpugqhmYtVmMO6518mCuRMoOYFldEBl0g187ufozdaHgWKcYFb61qGiA==", + "dev": true, + "dependencies": { + "balanced-match": "^1.0.0", + "concat-map": "0.0.1" + } + }, + "node_modules/braces": { + "version": "3.0.2", + "resolved": "https://registry.npmjs.org/braces/-/braces-3.0.2.tgz", + "integrity": "sha512-b8um+L1RzM3WDSzvhm6gIz1yfTbBt6YTlcEKAvsmqCZZFw46z626lVj9j1yEPW33H5H+lBQpZMP1k8l+78Ha0A==", + "dev": true, + "dependencies": { + "fill-range": "^7.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/browserslist": { + "version": "4.21.5", + "resolved": "https://registry.npmjs.org/browserslist/-/browserslist-4.21.5.tgz", + "integrity": "sha512-tUkiguQGW7S3IhB7N+c2MV/HZPSCPAAiYBZXLsBhFB/PCy6ZKKsZrmBayHV9fdGV/ARIfJ14NkxKzRDjvp7L6w==", + "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/browserslist" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/browserslist" + } + ], + "dependencies": { + "caniuse-lite": "^1.0.30001449", + "electron-to-chromium": "^1.4.284", + "node-releases": "^2.0.8", + "update-browserslist-db": "^1.0.10" + }, + "bin": { + "browserslist": "cli.js" + }, + "engines": { + "node": "^6 || ^7 || ^8 || ^9 || ^10 || ^11 || ^12 || >=13.7" + } + }, + "node_modules/buffer-crc32": { + "version": "0.2.13", + "resolved": "https://registry.npmjs.org/buffer-crc32/-/buffer-crc32-0.2.13.tgz", + "integrity": "sha512-VO9Ht/+p3SN7SKWqcrgEzjGbRSJYTx+Q1pTQC0wrWqHx0vpJraQ6GtHx8tvcg1rlK1byhU5gccxgOgj7B0TDkQ==", + "dev": true, + "engines": { + "node": "*" + } + }, + "node_modules/busboy": { + "version": "1.6.0", + "resolved": "https://registry.npmjs.org/busboy/-/busboy-1.6.0.tgz", + "integrity": "sha512-8SFQbg/0hQ9xy3UNTB0YEnsNBbWfhf7RtnzpL7TkBiTBRfrQ9Fxcnz7VJsleJpyp6rVLvXiuORqjlHi5q+PYuA==", + "dependencies": { + "streamsearch": "^1.1.0" + }, + "engines": { + "node": ">=10.16.0" + } + }, + "node_modules/callsites": { + "version": "3.1.0", + "resolved": "https://registry.npmjs.org/callsites/-/callsites-3.1.0.tgz", + "integrity": "sha512-P8BjAsXvZS+VIDUI11hHCQEv74YT67YUi5JJFNWIqL235sBmjX4+qx9Muvls5ivyNENctx46xQLQ3aTuE7ssaQ==", + "dev": true, + "engines": { + "node": ">=6" + } + }, + "node_modules/camelcase-css": { + "version": "2.0.1", + "resolved": "https://registry.npmjs.org/camelcase-css/-/camelcase-css-2.0.1.tgz", + "integrity": "sha512-QOSvevhslijgYwRx6Rv7zKdMF8lbRmx+uQGx2+vDc+KI/eBnsy9kit5aj23AgGu3pa4t9AgwbnXWqS+iOY+2aA==", + "dev": true, + "engines": { + "node": ">= 6" + } + }, + "node_modules/caniuse-lite": { + "version": "1.0.30001486", + "resolved": "https://registry.npmjs.org/caniuse-lite/-/caniuse-lite-1.0.30001486.tgz", + "integrity": "sha512-uv7/gXuHi10Whlj0pp5q/tsK/32J2QSqVRKQhs2j8VsDCjgyruAh/eEXHF822VqO9yT6iZKw3nRwZRSPBE9OQg==", + "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/browserslist" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/caniuse-lite" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ] + }, + "node_modules/chokidar": { + "version": "3.5.3", + "resolved": "https://registry.npmjs.org/chokidar/-/chokidar-3.5.3.tgz", + "integrity": "sha512-Dr3sfKRP6oTcjf2JmUmFJfeVMvXBdegxB0iVQ5eb2V10uFJUCAS8OByZdVAyVb8xXNz3GjjTgj9kLWsZTqE6kw==", + "dev": true, + "funding": [ + { + "type": "individual", + "url": "https://paulmillr.com/funding/" + } + ], + "dependencies": { + "anymatch": "~3.1.2", + "braces": "~3.0.2", + "glob-parent": "~5.1.2", + "is-binary-path": "~2.1.0", + "is-glob": "~4.0.1", + "normalize-path": "~3.0.0", + "readdirp": "~3.6.0" + }, + "engines": { + "node": ">= 8.10.0" + }, + "optionalDependencies": { + "fsevents": "~2.3.2" + } + }, + "node_modules/commander": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/commander/-/commander-4.1.1.tgz", + "integrity": "sha512-NOKm8xhkzAjzFx8B2v5OAHT+u5pRQc2UCa2Vq9jYL/31o2wi9mxBA7LIFs3sV5VSC49z6pEhfbMULvShKj26WA==", + "dev": true, + "engines": { + "node": ">= 6" + } + }, + "node_modules/concat-map": { + "version": "0.0.1", + "resolved": "https://registry.npmjs.org/concat-map/-/concat-map-0.0.1.tgz", + "integrity": "sha512-/Srv4dswyQNBfohGpz9o6Yb3Gz3SrUDqBH5rTuhGR7ahtlbYKnVxw2bCFMRljaA7EXHaXZ8wsHdodFvbkhKmqg==", + "dev": true + }, + "node_modules/cookie": { + "version": "0.5.0", + "resolved": "https://registry.npmjs.org/cookie/-/cookie-0.5.0.tgz", + "integrity": "sha512-YZ3GUyn/o8gfKJlnlX7g7xq4gyO6OSuhGPKaaGssGB2qgDUS0gPgtTvoyZLTt9Ab6dC4hfc9dV5arkvc/OCmrw==", + "engines": { + "node": ">= 0.6" + } + }, + "node_modules/cssesc": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/cssesc/-/cssesc-3.0.0.tgz", + "integrity": "sha512-/Tb/JcjK111nNScGob5MNtsntNM1aCNUDipB/TkwZFhyDrrE47SOx/18wF2bbjgc3ZzCSKW1T5nt5EbFoAz/Vg==", + "dev": true, + "bin": { + "cssesc": "bin/cssesc" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/debug": { + "version": "4.3.4", + "resolved": "https://registry.npmjs.org/debug/-/debug-4.3.4.tgz", + "integrity": "sha512-PRWFHuSU3eDtQJPvnNY7Jcket1j0t5OuOsFzPPzsekD52Zl8qUfFIPEiswXqIvHWGVHOgX+7G/vCNNhehwxfkQ==", + "dependencies": { + "ms": "2.1.2" + }, + "engines": { + "node": ">=6.0" + }, + "peerDependenciesMeta": { + "supports-color": { + "optional": true + } + } + }, + "node_modules/deepmerge": { + "version": "4.3.1", + "resolved": "https://registry.npmjs.org/deepmerge/-/deepmerge-4.3.1.tgz", + "integrity": "sha512-3sUqbMEc77XqpdNO7FRyRog+eW3ph+GYCbj+rK+uYyRMuwsVy0rMiVtPn+QJlKFvWP/1PYpapqYn0Me2knFn+A==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/detect-indent": { + "version": "6.1.0", + "resolved": "https://registry.npmjs.org/detect-indent/-/detect-indent-6.1.0.tgz", + "integrity": "sha512-reYkTUJAZb9gUuZ2RvVCNhVHdg62RHnJ7WJl8ftMi4diZ6NWlciOzQN88pUhSELEwflJht4oQDv0F0BMlwaYtA==", + "dev": true, + "engines": { + "node": ">=8" + } + }, + "node_modules/devalue": { + "version": "4.3.0", + "resolved": "https://registry.npmjs.org/devalue/-/devalue-4.3.0.tgz", + "integrity": "sha512-n94yQo4LI3w7erwf84mhRUkUJfhLoCZiLyoOZ/QFsDbcWNZePrLwbQpvZBUG2TNxwV3VjCKPxkiiQA6pe3TrTA==" + }, + "node_modules/didyoumean": { + "version": "1.2.2", + "resolved": "https://registry.npmjs.org/didyoumean/-/didyoumean-1.2.2.tgz", + "integrity": "sha512-gxtyfqMg7GKyhQmb056K7M3xszy/myH8w+B4RT+QXBQsvAOdc3XymqDDPHx1BgPgsdAA5SIifona89YtRATDzw==", + "dev": true + }, + "node_modules/dlv": { + "version": "1.1.3", + "resolved": "https://registry.npmjs.org/dlv/-/dlv-1.1.3.tgz", + "integrity": "sha512-+HlytyjlPKnIG8XuRG8WvmBP8xs8P71y+SKKS6ZXWoEgLuePxtDoUEiH7WkdePWrQ5JBpE6aoVqfZfJUQkjXwA==", + "dev": true + }, + "node_modules/electron-to-chromium": { + "version": "1.4.391", + "resolved": "https://registry.npmjs.org/electron-to-chromium/-/electron-to-chromium-1.4.391.tgz", + "integrity": "sha512-GqydVV1+kUWY5qlEzaw34/hyWTApuQrHiGrcGA2Kk/56nEK44i+YUW45VH43JuZT0Oo7uY8aVtpPhBBZXEWtSA==", + "dev": true + }, + "node_modules/es6-promise": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/es6-promise/-/es6-promise-3.3.1.tgz", + "integrity": "sha512-SOp9Phqvqn7jtEUxPWdWfWoLmyt2VaJ6MpvP9Comy1MceMXqE6bxvaTu4iaxpYYPzhny28Lc+M87/c2cPK6lDg==", + "dev": true + }, + "node_modules/esbuild": { + "version": "0.17.18", + "resolved": "https://registry.npmjs.org/esbuild/-/esbuild-0.17.18.tgz", + "integrity": "sha512-z1lix43jBs6UKjcZVKOw2xx69ffE2aG0PygLL5qJ9OS/gy0Ewd1gW/PUQIOIQGXBHWNywSc0floSKoMFF8aK2w==", + "hasInstallScript": true, + "bin": { + "esbuild": "bin/esbuild" + }, + "engines": { + "node": ">=12" + }, + "optionalDependencies": { + "@esbuild/android-arm": "0.17.18", + "@esbuild/android-arm64": "0.17.18", + "@esbuild/android-x64": "0.17.18", + "@esbuild/darwin-arm64": "0.17.18", + "@esbuild/darwin-x64": "0.17.18", + "@esbuild/freebsd-arm64": "0.17.18", + "@esbuild/freebsd-x64": "0.17.18", + "@esbuild/linux-arm": "0.17.18", + "@esbuild/linux-arm64": "0.17.18", + "@esbuild/linux-ia32": "0.17.18", + "@esbuild/linux-loong64": "0.17.18", + "@esbuild/linux-mips64el": "0.17.18", + "@esbuild/linux-ppc64": "0.17.18", + "@esbuild/linux-riscv64": "0.17.18", + "@esbuild/linux-s390x": "0.17.18", + "@esbuild/linux-x64": "0.17.18", + "@esbuild/netbsd-x64": "0.17.18", + "@esbuild/openbsd-x64": "0.17.18", + "@esbuild/sunos-x64": "0.17.18", + "@esbuild/win32-arm64": "0.17.18", + "@esbuild/win32-ia32": "0.17.18", + "@esbuild/win32-x64": "0.17.18" + } + }, + "node_modules/escalade": { + "version": "3.1.1", + "resolved": "https://registry.npmjs.org/escalade/-/escalade-3.1.1.tgz", + "integrity": "sha512-k0er2gUkLf8O0zKJiAhmkTnJlTvINGv7ygDNPbeIsX/TJjGJZHuh9B2UxbsaEkmlEo9MfhrSzmhIlhRlI2GXnw==", + "dev": true, + "engines": { + "node": ">=6" + } + }, + "node_modules/esm-env": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/esm-env/-/esm-env-1.0.0.tgz", + "integrity": "sha512-Cf6VksWPsTuW01vU9Mk/3vRue91Zevka5SjyNf3nEpokFRuqt/KjUQoGAwq9qMmhpLTHmXzSIrFRw8zxWzmFBA==" + }, + "node_modules/fast-glob": { + "version": "3.2.12", + "resolved": "https://registry.npmjs.org/fast-glob/-/fast-glob-3.2.12.tgz", + "integrity": "sha512-DVj4CQIYYow0BlaelwK1pHl5n5cRSJfM60UA0zK891sVInoPri2Ekj7+e1CT3/3qxXenpI+nBBmQAcJPJgaj4w==", + "dev": true, + "dependencies": { + "@nodelib/fs.stat": "^2.0.2", + "@nodelib/fs.walk": "^1.2.3", + "glob-parent": "^5.1.2", + "merge2": "^1.3.0", + "micromatch": "^4.0.4" + }, + "engines": { + "node": ">=8.6.0" + } + }, + "node_modules/fastq": { + "version": "1.15.0", + "resolved": "https://registry.npmjs.org/fastq/-/fastq-1.15.0.tgz", + "integrity": "sha512-wBrocU2LCXXa+lWBt8RoIRD89Fi8OdABODa/kEnyeyjS5aZO5/GNvI5sEINADqP/h8M29UHTHUb53sUu5Ihqdw==", + "dev": true, + "dependencies": { + "reusify": "^1.0.4" + } + }, + "node_modules/fill-range": { + "version": "7.0.1", + "resolved": "https://registry.npmjs.org/fill-range/-/fill-range-7.0.1.tgz", + "integrity": "sha512-qOo9F+dMUmC2Lcb4BbVvnKJxTPjCm+RRpe4gDuGrzkL7mEVl/djYSu2OdQ2Pa302N4oqkSg9ir6jaLWJ2USVpQ==", + "dev": true, + "dependencies": { + "to-regex-range": "^5.0.1" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/fraction.js": { + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/fraction.js/-/fraction.js-4.2.0.tgz", + "integrity": "sha512-MhLuK+2gUcnZe8ZHlaaINnQLl0xRIGRfcGk2yl8xoQAfHrSsL3rYu6FCmBdkdbhc9EPlwyGHewaRsvwRMJtAlA==", + "dev": true, + "engines": { + "node": "*" + }, + "funding": { + "type": "patreon", + "url": "https://www.patreon.com/infusion" + } + }, + "node_modules/fs.realpath": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/fs.realpath/-/fs.realpath-1.0.0.tgz", + "integrity": "sha512-OO0pH2lK6a0hZnAdau5ItzHPI6pUlvI7jMVnxUQRtw4owF2wk8lOSabtGDCTP4Ggrg2MbGnWO9X8K1t4+fGMDw==", + "dev": true + }, + "node_modules/fsevents": { + "version": "2.3.2", + "resolved": "https://registry.npmjs.org/fsevents/-/fsevents-2.3.2.tgz", + "integrity": "sha512-xiqMQR4xAeHTuB9uWm+fFRcIOgKBMiOBP+eXiyT7jsgVCq1bkVygt00oASowB7EdtpOHaaPgKt812P9ab+DDKA==", + "hasInstallScript": true, + "optional": true, + "os": [ + "darwin" + ], + "engines": { + "node": "^8.16.0 || ^10.6.0 || >=11.0.0" + } + }, + "node_modules/function-bind": { + "version": "1.1.1", + "resolved": "https://registry.npmjs.org/function-bind/-/function-bind-1.1.1.tgz", + "integrity": "sha512-yIovAzMX49sF8Yl58fSCWJ5svSLuaibPxXQJFLmBObTuCr0Mf1KiPopGM9NiFjiYBCbfaa2Fh6breQ6ANVTI0A==", + "dev": true + }, + "node_modules/glob": { + "version": "7.2.3", + "resolved": "https://registry.npmjs.org/glob/-/glob-7.2.3.tgz", + "integrity": "sha512-nFR0zLpU2YCaRxwoCJvL6UvCH2JFyFVIvwTLsIf21AuHlMskA1hhTdk+LlYJtOlYt9v6dvszD2BGRqBL+iQK9Q==", + "dev": true, + "dependencies": { + "fs.realpath": "^1.0.0", + "inflight": "^1.0.4", + "inherits": "2", + "minimatch": "^3.1.1", + "once": "^1.3.0", + "path-is-absolute": "^1.0.0" + }, + "engines": { + "node": "*" + }, + "funding": { + "url": "https://github.com/sponsors/isaacs" + } + }, + "node_modules/glob-parent": { + "version": "5.1.2", + "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-5.1.2.tgz", + "integrity": "sha512-AOIgSQCepiJYwP3ARnGx+5VnTu2HBYdzbGP45eLw1vr3zB3vZLeyed1sC9hnbcOc9/SrMyM5RPQrkGz4aS9Zow==", + "dev": true, + "dependencies": { + "is-glob": "^4.0.1" + }, + "engines": { + "node": ">= 6" + } + }, + "node_modules/globalyzer": { + "version": "0.1.0", + "resolved": "https://registry.npmjs.org/globalyzer/-/globalyzer-0.1.0.tgz", + "integrity": "sha512-40oNTM9UfG6aBmuKxk/giHn5nQ8RVz/SS4Ir6zgzOv9/qC3kKZ9v4etGTcJbEl/NyVQH7FGU7d+X1egr57Md2Q==" + }, + "node_modules/globrex": { + "version": "0.1.2", + "resolved": "https://registry.npmjs.org/globrex/-/globrex-0.1.2.tgz", + "integrity": "sha512-uHJgbwAMwNFf5mLst7IWLNg14x1CkeqglJb/K3doi4dw6q2IvAAmM/Y81kevy83wP+Sst+nutFTYOGg3d1lsxg==" + }, + "node_modules/graceful-fs": { + "version": "4.2.11", + "resolved": "https://registry.npmjs.org/graceful-fs/-/graceful-fs-4.2.11.tgz", + "integrity": "sha512-RbJ5/jmFcNNCcDV5o9eTnBLJ/HszWV0P73bc+Ff4nS/rJj+YaS6IGyiOL0VoBYX+l1Wrl3k63h/KrH+nhJ0XvQ==", + "dev": true + }, + "node_modules/has": { + "version": "1.0.3", + "resolved": "https://registry.npmjs.org/has/-/has-1.0.3.tgz", + "integrity": "sha512-f2dvO0VU6Oej7RkWJGrehjbzMAjFp5/VKPp5tTpWIV4JHHZK1/BxbFRtf/siA2SWTe09caDmVtYYzWEIbBS4zw==", + "dev": true, + "dependencies": { + "function-bind": "^1.1.1" + }, + "engines": { + "node": ">= 0.4.0" + } + }, + "node_modules/import-fresh": { + "version": "3.3.0", + "resolved": "https://registry.npmjs.org/import-fresh/-/import-fresh-3.3.0.tgz", + "integrity": "sha512-veYYhQa+D1QBKznvhUHxb8faxlrwUnxseDAbAp457E0wLNio2bOSKnjYDhMj+YiAq61xrMGhQk9iXVk5FzgQMw==", + "dev": true, + "dependencies": { + "parent-module": "^1.0.0", + "resolve-from": "^4.0.0" + }, + "engines": { + "node": ">=6" + }, + "funding": { + "url": "https://github.com/sponsors/sindresorhus" + } + }, + "node_modules/import-meta-resolve": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/import-meta-resolve/-/import-meta-resolve-3.0.0.tgz", + "integrity": "sha512-4IwhLhNNA8yy445rPjD/lWh++7hMDOml2eHtd58eG7h+qK3EryMuuRbsHGPikCoAgIkkDnckKfWSk2iDla/ejg==", + "dev": true, + "funding": { + "type": "github", + "url": "https://github.com/sponsors/wooorm" + } + }, + "node_modules/inflight": { + "version": "1.0.6", + "resolved": "https://registry.npmjs.org/inflight/-/inflight-1.0.6.tgz", + "integrity": "sha512-k92I/b08q4wvFscXCLvqfsHCrjrF7yiXsQuIVvVE7N82W3+aqpzuUdBbfhWcy/FZR3/4IgflMgKLOsvPDrGCJA==", + "dev": true, + "dependencies": { + "once": "^1.3.0", + "wrappy": "1" + } + }, + "node_modules/inherits": { + "version": "2.0.4", + "resolved": "https://registry.npmjs.org/inherits/-/inherits-2.0.4.tgz", + "integrity": "sha512-k/vGaX4/Yla3WzyMCvTQOXYeIHvqOKtnqBduzTHpzpQZzAskKMhZ2K+EnBiSM9zGSoIFeMpXKxa4dYeZIQqewQ==", + "dev": true + }, + "node_modules/is-binary-path": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/is-binary-path/-/is-binary-path-2.1.0.tgz", + "integrity": "sha512-ZMERYes6pDydyuGidse7OsHxtbI7WVeUEozgR/g7rd0xUimYNlvZRE/K2MgZTjWy725IfelLeVcEM97mmtRGXw==", + "dev": true, + "dependencies": { + "binary-extensions": "^2.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/is-core-module": { + "version": "2.12.0", + "resolved": "https://registry.npmjs.org/is-core-module/-/is-core-module-2.12.0.tgz", + "integrity": "sha512-RECHCBCd/viahWmwj6enj19sKbHfJrddi/6cBDsNTKbNq0f7VeaUkBo60BqzvPqo/W54ChS62Z5qyun7cfOMqQ==", + "dev": true, + "dependencies": { + "has": "^1.0.3" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/is-extglob": { + "version": "2.1.1", + "resolved": "https://registry.npmjs.org/is-extglob/-/is-extglob-2.1.1.tgz", + "integrity": "sha512-SbKbANkN603Vi4jEZv49LeVJMn4yGwsbzZworEoyEiutsN3nJYdbO36zfhGJ6QEDpOZIFkDtnq5JRxmvl3jsoQ==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-glob": { + "version": "4.0.3", + "resolved": "https://registry.npmjs.org/is-glob/-/is-glob-4.0.3.tgz", + "integrity": "sha512-xelSayHH36ZgE7ZWhli7pW34hNbNl8Ojv5KVmkJD4hBdD3th8Tfk9vYasLM+mXWOZhFkgZfxhLSnrwRr4elSSg==", + "dev": true, + "dependencies": { + "is-extglob": "^2.1.1" + }, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/is-number": { + "version": "7.0.0", + "resolved": "https://registry.npmjs.org/is-number/-/is-number-7.0.0.tgz", + "integrity": "sha512-41Cifkg6e8TylSpdtTpeLVMqvSBEVzTttHvERD741+pnZ8ANv0004MRL43QKPDlK9cGvNp6NZWZUBlbGXYxxng==", + "dev": true, + "engines": { + "node": ">=0.12.0" + } + }, + "node_modules/jiti": { + "version": "1.18.2", + "resolved": "https://registry.npmjs.org/jiti/-/jiti-1.18.2.tgz", + "integrity": "sha512-QAdOptna2NYiSSpv0O/BwoHBSmz4YhpzJHyi+fnMRTXFjp7B8i/YG5Z8IfusxB1ufjcD2Sre1F3R+nX3fvy7gg==", + "dev": true, + "bin": { + "jiti": "bin/jiti.js" + } + }, + "node_modules/kleur": { + "version": "4.1.5", + "resolved": "https://registry.npmjs.org/kleur/-/kleur-4.1.5.tgz", + "integrity": "sha512-o+NO+8WrRiQEE4/7nwRJhN1HWpVmJm511pBHUxPLtp0BUISzlBplORYSmTclCnJvQq2tKu/sgl3xVpkc7ZWuQQ==", + "engines": { + "node": ">=6" + } + }, + "node_modules/lilconfig": { + "version": "2.1.0", + "resolved": "https://registry.npmjs.org/lilconfig/-/lilconfig-2.1.0.tgz", + "integrity": "sha512-utWOt/GHzuUxnLKxB6dk81RoOeoNeHgbrXiuGk4yyF5qlRz+iIVWu56E2fqGHFrXz0QNUhLB/8nKqvRH66JKGQ==", + "dev": true, + "engines": { + "node": ">=10" + } + }, + "node_modules/lines-and-columns": { + "version": "1.2.4", + "resolved": "https://registry.npmjs.org/lines-and-columns/-/lines-and-columns-1.2.4.tgz", + "integrity": "sha512-7ylylesZQ/PV29jhEDl3Ufjo6ZX7gCqJr5F7PKrqc93v7fzSymt1BpwEU8nAUXs8qzzvqhbjhK5QZg6Mt/HkBg==", + "dev": true + }, + "node_modules/magic-string": { + "version": "0.30.0", + "resolved": "https://registry.npmjs.org/magic-string/-/magic-string-0.30.0.tgz", + "integrity": "sha512-LA+31JYDJLs82r2ScLrlz1GjSgu66ZV518eyWT+S8VhyQn/JL0u9MeBOvQMGYiPk1DBiSN9DDMOcXvigJZaViQ==", + "dependencies": { + "@jridgewell/sourcemap-codec": "^1.4.13" + }, + "engines": { + "node": ">=12" + } + }, + "node_modules/merge2": { + "version": "1.4.1", + "resolved": "https://registry.npmjs.org/merge2/-/merge2-1.4.1.tgz", + "integrity": "sha512-8q7VEgMJW4J8tcfVPy8g09NcQwZdbwFEqhe/WZkoIzjn/3TGDwtOCYtXGxA3O8tPzpczCCDgv+P2P5y00ZJOOg==", + "dev": true, + "engines": { + "node": ">= 8" + } + }, + "node_modules/micromatch": { + "version": "4.0.5", + "resolved": "https://registry.npmjs.org/micromatch/-/micromatch-4.0.5.tgz", + "integrity": "sha512-DMy+ERcEW2q8Z2Po+WNXuw3c5YaUSFjAO5GsJqfEl7UjvtIuFKO6ZrKvcItdy98dwFI2N1tg3zNIdKaQT+aNdA==", + "dev": true, + "dependencies": { + "braces": "^3.0.2", + "picomatch": "^2.3.1" + }, + "engines": { + "node": ">=8.6" + } + }, + "node_modules/mime": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/mime/-/mime-3.0.0.tgz", + "integrity": "sha512-jSCU7/VB1loIWBZe14aEYHU/+1UMEHoaO7qxCOVJOw9GgH72VAWppxNcjU+x9a2k3GSIBXNKxXQFqRvvZ7vr3A==", + "bin": { + "mime": "cli.js" + }, + "engines": { + "node": ">=10.0.0" + } + }, + "node_modules/min-indent": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/min-indent/-/min-indent-1.0.1.tgz", + "integrity": "sha512-I9jwMn07Sy/IwOj3zVkVik2JTvgpaykDZEigL6Rx6N9LbMywwUSMtxET+7lVoDLLd3O3IXwJwvuuns8UB/HeAg==", + "dev": true, + "engines": { + "node": ">=4" + } + }, + "node_modules/minimatch": { + "version": "3.1.2", + "resolved": "https://registry.npmjs.org/minimatch/-/minimatch-3.1.2.tgz", + "integrity": "sha512-J7p63hRiAjw1NDEww1W7i37+ByIrOWO5XQQAzZ3VOcL0PNybwpfmV/N05zFAzwQ9USyEcX6t3UO+K5aqBQOIHw==", + "dev": true, + "dependencies": { + "brace-expansion": "^1.1.7" + }, + "engines": { + "node": "*" + } + }, + "node_modules/minimist": { + "version": "1.2.8", + "resolved": "https://registry.npmjs.org/minimist/-/minimist-1.2.8.tgz", + "integrity": "sha512-2yyAR8qBkN3YuheJanUpWC5U3bb5osDywNB8RzDVlDwDHbocAJveqqj1u8+SVD7jkWT4yvsHCpWqqWqAxb0zCA==", + "dev": true, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/mkdirp": { + "version": "0.5.6", + "resolved": "https://registry.npmjs.org/mkdirp/-/mkdirp-0.5.6.tgz", + "integrity": "sha512-FP+p8RB8OWpF3YZBCrP5gtADmtXApB5AMLn+vdyA+PyxCjrCs00mjyUozssO33cwDeT3wNGdLxJ5M//YqtHAJw==", + "dev": true, + "dependencies": { + "minimist": "^1.2.6" + }, + "bin": { + "mkdirp": "bin/cmd.js" + } + }, + "node_modules/mri": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/mri/-/mri-1.2.0.tgz", + "integrity": "sha512-tzzskb3bG8LvYGFF/mDTpq3jpI6Q9wc3LEmBaghu+DdCssd1FakN7Bc0hVNmEyGq1bq3RgfkCb3cmQLpNPOroA==", + "engines": { + "node": ">=4" + } + }, + "node_modules/mrmime": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/mrmime/-/mrmime-1.0.1.tgz", + "integrity": "sha512-hzzEagAgDyoU1Q6yg5uI+AorQgdvMCur3FcKf7NhMKWsaYg+RnbTyHRa/9IlLF9rf455MOCtcqqrQQ83pPP7Uw==", + "engines": { + "node": ">=10" + } + }, + "node_modules/ms": { + "version": "2.1.2", + "resolved": "https://registry.npmjs.org/ms/-/ms-2.1.2.tgz", + "integrity": "sha512-sGkPx+VjMtmA6MX27oA4FBFELFCZZ4S4XqeGOXCv68tT+jb3vk/RyaKWP0PTKyWtmLSM0b+adUTEvbs1PEaH2w==" + }, + "node_modules/mz": { + "version": "2.7.0", + "resolved": "https://registry.npmjs.org/mz/-/mz-2.7.0.tgz", + "integrity": "sha512-z81GNO7nnYMEhrGh9LeymoE4+Yr0Wn5McHIZMK5cfQCl+NDX08sCZgUc9/6MHni9IWuFLm1Z3HTCXu2z9fN62Q==", + "dev": true, + "dependencies": { + "any-promise": "^1.0.0", + "object-assign": "^4.0.1", + "thenify-all": "^1.0.0" + } + }, + "node_modules/nanoid": { + "version": "3.3.6", + "resolved": "https://registry.npmjs.org/nanoid/-/nanoid-3.3.6.tgz", + "integrity": "sha512-BGcqMMJuToF7i1rt+2PWSNVnWIkGCU78jBG3RxO/bZlnZPK2Cmi2QaffxGO/2RvWi9sL+FAiRiXMgsyxQ1DIDA==", + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "bin": { + "nanoid": "bin/nanoid.cjs" + }, + "engines": { + "node": "^10 || ^12 || ^13.7 || ^14 || >=15.0.1" + } + }, + "node_modules/node-releases": { + "version": "2.0.10", + "resolved": "https://registry.npmjs.org/node-releases/-/node-releases-2.0.10.tgz", + "integrity": "sha512-5GFldHPXVG/YZmFzJvKK2zDSzPKhEp0+ZR5SVaoSag9fsL5YgHbUHDfnG5494ISANDcK4KwPXAx2xqVEydmd7w==", + "dev": true + }, + "node_modules/normalize-path": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/normalize-path/-/normalize-path-3.0.0.tgz", + "integrity": "sha512-6eZs5Ls3WtCisHWp9S2GUy8dqkpGi4BVSz3GaqiE6ezub0512ESztXUwUB6C6IKbQkY2Pnb/mD4WYojCRwcwLA==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/normalize-range": { + "version": "0.1.2", + "resolved": "https://registry.npmjs.org/normalize-range/-/normalize-range-0.1.2.tgz", + "integrity": "sha512-bdok/XvKII3nUpklnV6P2hxtMNrCboOjAcyBuQnWEhO665FwrSNRxU+AqpsyvO6LgGYPspN+lu5CLtw4jPRKNA==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/object-assign": { + "version": "4.1.1", + "resolved": "https://registry.npmjs.org/object-assign/-/object-assign-4.1.1.tgz", + "integrity": "sha512-rJgTQnkUnH1sFw8yT6VSU3zD3sWmu6sZhIseY8VX+GRu3P6F7Fu+JNDoXfklElbLJSnc3FUQHVe4cU5hj+BcUg==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/object-hash": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/object-hash/-/object-hash-3.0.0.tgz", + "integrity": "sha512-RSn9F68PjH9HqtltsSnqYC1XXoWe9Bju5+213R98cNGttag9q9yAOTzdbsqvIa7aNm5WffBZFpWYr2aWrklWAw==", + "dev": true, + "engines": { + "node": ">= 6" + } + }, + "node_modules/once": { + "version": "1.4.0", + "resolved": "https://registry.npmjs.org/once/-/once-1.4.0.tgz", + "integrity": "sha512-lNaJgI+2Q5URQBkccEKHTQOPaXdUxnZZElQTZY0MFUAuaEqe1E+Nyvgdz/aIyNi6Z9MzO5dv1H8n58/GELp3+w==", + "dev": true, + "dependencies": { + "wrappy": "1" + } + }, + "node_modules/parent-module": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/parent-module/-/parent-module-1.0.1.tgz", + "integrity": "sha512-GQ2EWRpQV8/o+Aw8YqtfZZPfNRWZYkbidE9k5rpl/hC3vtHHBfGm2Ifi6qWV+coDGkrUKZAxE3Lot5kcsRlh+g==", + "dev": true, + "dependencies": { + "callsites": "^3.0.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/path-is-absolute": { + "version": "1.0.1", + "resolved": "https://registry.npmjs.org/path-is-absolute/-/path-is-absolute-1.0.1.tgz", + "integrity": "sha512-AVbw3UJ2e9bq64vSaS9Am0fje1Pa8pbGqTTsmXfaIiMpnr5DlDhfJOuLj9Sf95ZPVDAUerDfEk88MPmPe7UCQg==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/path-parse": { + "version": "1.0.7", + "resolved": "https://registry.npmjs.org/path-parse/-/path-parse-1.0.7.tgz", + "integrity": "sha512-LDJzPVEEEPR+y48z93A0Ed0yXb8pAByGWo/k5YYdYgpY2/2EsOsksJrq7lOHxryrVOn1ejG6oAp8ahvOIQD8sw==", + "dev": true + }, + "node_modules/picocolors": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/picocolors/-/picocolors-1.0.0.tgz", + "integrity": "sha512-1fygroTLlHu66zi26VoTDv8yRgm0Fccecssto+MhsZ0D/DGW2sm8E8AjW7NU5VVTRt5GxbeZ5qBuJr+HyLYkjQ==" + }, + "node_modules/picomatch": { + "version": "2.3.1", + "resolved": "https://registry.npmjs.org/picomatch/-/picomatch-2.3.1.tgz", + "integrity": "sha512-JU3teHTNjmE2VCGFzuY8EXzCDVwEqB2a8fsIvwaStHhAWJEeVd1o1QD80CU6+ZdEXXSLbSsuLwJjkCBWqRQUVA==", + "dev": true, + "engines": { + "node": ">=8.6" + }, + "funding": { + "url": "https://github.com/sponsors/jonschlinkert" + } + }, + "node_modules/pify": { + "version": "2.3.0", + "resolved": "https://registry.npmjs.org/pify/-/pify-2.3.0.tgz", + "integrity": "sha512-udgsAY+fTnvv7kI7aaxbqwWNb0AHiB0qBO89PZKPkoTmGOgdbrHDKD+0B2X4uTfJ/FT1R09r9gTsjUjNJotuog==", + "dev": true, + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/pirates": { + "version": "4.0.5", + "resolved": "https://registry.npmjs.org/pirates/-/pirates-4.0.5.tgz", + "integrity": "sha512-8V9+HQPupnaXMA23c5hvl69zXvTwTzyAYasnkb0Tts4XvO4CliqONMOnvlq26rkhLC3nWDFBJf73LU1e1VZLaQ==", + "dev": true, + "engines": { + "node": ">= 6" + } + }, + "node_modules/postcss": { + "version": "8.4.23", + "resolved": "https://registry.npmjs.org/postcss/-/postcss-8.4.23.tgz", + "integrity": "sha512-bQ3qMcpF6A/YjR55xtoTr0jGOlnPOKAIMdOWiv0EIT6HVPEaJiJB4NLljSbiHoC2RX7DN5Uvjtpbg1NPdwv1oA==", + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/postcss/" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/postcss" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "dependencies": { + "nanoid": "^3.3.6", + "picocolors": "^1.0.0", + "source-map-js": "^1.0.2" + }, + "engines": { + "node": "^10 || ^12 || >=14" + } + }, + "node_modules/postcss-import": { + "version": "15.1.0", + "resolved": "https://registry.npmjs.org/postcss-import/-/postcss-import-15.1.0.tgz", + "integrity": "sha512-hpr+J05B2FVYUAXHeK1YyI267J/dDDhMU6B6civm8hSY1jYJnBXxzKDKDswzJmtLHryrjhnDjqqp/49t8FALew==", + "dev": true, + "dependencies": { + "postcss-value-parser": "^4.0.0", + "read-cache": "^1.0.0", + "resolve": "^1.1.7" + }, + "engines": { + "node": ">=14.0.0" + }, + "peerDependencies": { + "postcss": "^8.0.0" + } + }, + "node_modules/postcss-js": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/postcss-js/-/postcss-js-4.0.1.tgz", + "integrity": "sha512-dDLF8pEO191hJMtlHFPRa8xsizHaM82MLfNkUHdUtVEV3tgTp5oj+8qbEqYM57SLfc74KSbw//4SeJma2LRVIw==", + "dev": true, + "dependencies": { + "camelcase-css": "^2.0.1" + }, + "engines": { + "node": "^12 || ^14 || >= 16" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/postcss/" + }, + "peerDependencies": { + "postcss": "^8.4.21" + } + }, + "node_modules/postcss-load-config": { + "version": "4.0.1", + "resolved": "https://registry.npmjs.org/postcss-load-config/-/postcss-load-config-4.0.1.tgz", + "integrity": "sha512-vEJIc8RdiBRu3oRAI0ymerOn+7rPuMvRXslTvZUKZonDHFIczxztIyJ1urxM1x9JXEikvpWWTUUqal5j/8QgvA==", + "dev": true, + "dependencies": { + "lilconfig": "^2.0.5", + "yaml": "^2.1.1" + }, + "engines": { + "node": ">= 14" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/postcss/" + }, + "peerDependencies": { + "postcss": ">=8.0.9", + "ts-node": ">=9.0.0" + }, + "peerDependenciesMeta": { + "postcss": { + "optional": true + }, + "ts-node": { + "optional": true + } + } + }, + "node_modules/postcss-nested": { + "version": "6.0.1", + "resolved": "https://registry.npmjs.org/postcss-nested/-/postcss-nested-6.0.1.tgz", + "integrity": "sha512-mEp4xPMi5bSWiMbsgoPfcP74lsWLHkQbZc3sY+jWYd65CUwXrUaTp0fmNpa01ZcETKlIgUdFN/MpS2xZtqL9dQ==", + "dev": true, + "dependencies": { + "postcss-selector-parser": "^6.0.11" + }, + "engines": { + "node": ">=12.0" + }, + "funding": { + "type": "opencollective", + "url": "https://opencollective.com/postcss/" + }, + "peerDependencies": { + "postcss": "^8.2.14" + } + }, + "node_modules/postcss-selector-parser": { + "version": "6.0.12", + "resolved": "https://registry.npmjs.org/postcss-selector-parser/-/postcss-selector-parser-6.0.12.tgz", + "integrity": "sha512-NdxGCAZdRrwVI1sy59+Wzrh+pMMHxapGnpfenDVlMEXoOcvt4pGE0JLK9YY2F5dLxcFYA/YbVQKhcGU+FtSYQg==", + "dev": true, + "dependencies": { + "cssesc": "^3.0.0", + "util-deprecate": "^1.0.2" + }, + "engines": { + "node": ">=4" + } + }, + "node_modules/postcss-value-parser": { + "version": "4.2.0", + "resolved": "https://registry.npmjs.org/postcss-value-parser/-/postcss-value-parser-4.2.0.tgz", + "integrity": "sha512-1NNCs6uurfkVbeXG4S8JFT9t19m45ICnif8zWLd5oPSZ50QnwMfK+H3jv408d4jw/7Bttv5axS5IiHoLaVNHeQ==", + "dev": true + }, + "node_modules/queue-microtask": { + "version": "1.2.3", + "resolved": "https://registry.npmjs.org/queue-microtask/-/queue-microtask-1.2.3.tgz", + "integrity": "sha512-NuaNSa6flKT5JaSYQzJok04JzTL1CA6aGhv5rfLW3PgqA+M2ChpZQnAC8h8i4ZFkBS8X5RqkDBHA7r4hej3K9A==", + "dev": true, + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/feross" + }, + { + "type": "patreon", + "url": "https://www.patreon.com/feross" + }, + { + "type": "consulting", + "url": "https://feross.org/support" + } + ] + }, + "node_modules/read-cache": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/read-cache/-/read-cache-1.0.0.tgz", + "integrity": "sha512-Owdv/Ft7IjOgm/i0xvNDZ1LrRANRfew4b2prF3OWMQLxLfu3bS8FVhCsrSCMK4lR56Y9ya+AThoTpDCTxCmpRA==", + "dev": true, + "dependencies": { + "pify": "^2.3.0" + } + }, + "node_modules/readdirp": { + "version": "3.6.0", + "resolved": "https://registry.npmjs.org/readdirp/-/readdirp-3.6.0.tgz", + "integrity": "sha512-hOS089on8RduqdbhvQ5Z37A0ESjsqz6qnRcffsMU3495FuTdqSm+7bhJ29JvIOsBDEEnan5DPu9t3To9VRlMzA==", + "dev": true, + "dependencies": { + "picomatch": "^2.2.1" + }, + "engines": { + "node": ">=8.10.0" + } + }, + "node_modules/resolve": { + "version": "1.22.2", + "resolved": "https://registry.npmjs.org/resolve/-/resolve-1.22.2.tgz", + "integrity": "sha512-Sb+mjNHOULsBv818T40qSPeRiuWLyaGMa5ewydRLFimneixmVy2zdivRl+AF6jaYPC8ERxGDmFSiqui6SfPd+g==", + "dev": true, + "dependencies": { + "is-core-module": "^2.11.0", + "path-parse": "^1.0.7", + "supports-preserve-symlinks-flag": "^1.0.0" + }, + "bin": { + "resolve": "bin/resolve" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/resolve-from": { + "version": "4.0.0", + "resolved": "https://registry.npmjs.org/resolve-from/-/resolve-from-4.0.0.tgz", + "integrity": "sha512-pb/MYmXstAkysRFx8piNI1tGFNQIFA3vkE3Gq4EuA1dF6gHp/+vgZqsCGJapvy8N3Q+4o7FwvquPJcnZ7RYy4g==", + "dev": true, + "engines": { + "node": ">=4" + } + }, + "node_modules/reusify": { + "version": "1.0.4", + "resolved": "https://registry.npmjs.org/reusify/-/reusify-1.0.4.tgz", + "integrity": "sha512-U9nH88a3fc/ekCF1l0/UP1IosiuIjyTh7hBvXVMHYgVcfGvt897Xguj2UOLDeI5BG2m7/uwyaLVT6fbtCwTyzw==", + "dev": true, + "engines": { + "iojs": ">=1.0.0", + "node": ">=0.10.0" + } + }, + "node_modules/rimraf": { + "version": "2.7.1", + "resolved": "https://registry.npmjs.org/rimraf/-/rimraf-2.7.1.tgz", + "integrity": "sha512-uWjbaKIK3T1OSVptzX7Nl6PvQ3qAGtKEtVRjRuazjfL3Bx5eI409VZSqgND+4UNnmzLVdPj9FqFJNPqBZFve4w==", + "dev": true, + "dependencies": { + "glob": "^7.1.3" + }, + "bin": { + "rimraf": "bin.js" + } + }, + "node_modules/rollup": { + "version": "3.21.6", + "resolved": "https://registry.npmjs.org/rollup/-/rollup-3.21.6.tgz", + "integrity": "sha512-SXIICxvxQxR3D4dp/3LDHZIJPC8a4anKMHd4E3Jiz2/JnY+2bEjqrOokAauc5ShGVNFHlEFjBXAXlaxkJqIqSg==", + "bin": { + "rollup": "dist/bin/rollup" + }, + "engines": { + "node": ">=14.18.0", + "npm": ">=8.0.0" + }, + "optionalDependencies": { + "fsevents": "~2.3.2" + } + }, + "node_modules/run-parallel": { + "version": "1.2.0", + "resolved": "https://registry.npmjs.org/run-parallel/-/run-parallel-1.2.0.tgz", + "integrity": "sha512-5l4VyZR86LZ/lDxZTR6jqL8AFE2S0IFLMP26AbjsLVADxHdhB/c0GUsH+y39UfCi3dzz8OlQuPmnaJOMoDHQBA==", + "dev": true, + "funding": [ + { + "type": "github", + "url": "https://github.com/sponsors/feross" + }, + { + "type": "patreon", + "url": "https://www.patreon.com/feross" + }, + { + "type": "consulting", + "url": "https://feross.org/support" + } + ], + "dependencies": { + "queue-microtask": "^1.2.2" + } + }, + "node_modules/sade": { + "version": "1.8.1", + "resolved": "https://registry.npmjs.org/sade/-/sade-1.8.1.tgz", + "integrity": "sha512-xal3CZX1Xlo/k4ApwCFrHVACi9fBqJ7V+mwhBsuf/1IOKbBy098Fex+Wa/5QMubw09pSZ/u8EY8PWgevJsXp1A==", + "dependencies": { + "mri": "^1.1.0" + }, + "engines": { + "node": ">=6" + } + }, + "node_modules/sander": { + "version": "0.5.1", + "resolved": "https://registry.npmjs.org/sander/-/sander-0.5.1.tgz", + "integrity": "sha512-3lVqBir7WuKDHGrKRDn/1Ye3kwpXaDOMsiRP1wd6wpZW56gJhsbp5RqQpA6JG/P+pkXizygnr1dKR8vzWaVsfA==", + "dev": true, + "dependencies": { + "es6-promise": "^3.1.2", + "graceful-fs": "^4.1.3", + "mkdirp": "^0.5.1", + "rimraf": "^2.5.2" + } + }, + "node_modules/set-cookie-parser": { + "version": "2.6.0", + "resolved": "https://registry.npmjs.org/set-cookie-parser/-/set-cookie-parser-2.6.0.tgz", + "integrity": "sha512-RVnVQxTXuerk653XfuliOxBP81Sf0+qfQE73LIYKcyMYHG94AuH0kgrQpRDuTZnSmjpysHmzxJXKNfa6PjFhyQ==" + }, + "node_modules/sirv": { + "version": "2.0.3", + "resolved": "https://registry.npmjs.org/sirv/-/sirv-2.0.3.tgz", + "integrity": "sha512-O9jm9BsID1P+0HOi81VpXPoDxYP374pkOLzACAoyUQ/3OUVndNpsz6wMnY2z+yOxzbllCKZrM+9QrWsv4THnyA==", + "dependencies": { + "@polka/url": "^1.0.0-next.20", + "mrmime": "^1.0.0", + "totalist": "^3.0.0" + }, + "engines": { + "node": ">= 10" + } + }, + "node_modules/sorcery": { + "version": "0.11.0", + "resolved": "https://registry.npmjs.org/sorcery/-/sorcery-0.11.0.tgz", + "integrity": "sha512-J69LQ22xrQB1cIFJhPfgtLuI6BpWRiWu1Y3vSsIwK/eAScqJxd/+CJlUuHQRdX2C9NGFamq+KqNywGgaThwfHw==", + "dev": true, + "dependencies": { + "@jridgewell/sourcemap-codec": "^1.4.14", + "buffer-crc32": "^0.2.5", + "minimist": "^1.2.0", + "sander": "^0.5.0" + }, + "bin": { + "sorcery": "bin/sorcery" + } + }, + "node_modules/source-map-js": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/source-map-js/-/source-map-js-1.0.2.tgz", + "integrity": "sha512-R0XvVJ9WusLiqTCEiGCmICCMplcCkIwwR11mOSD9CR5u+IXYdiseeEuXCVAjS54zqwkLcPNnmU4OeJ6tUrWhDw==", + "engines": { + "node": ">=0.10.0" + } + }, + "node_modules/streamsearch": { + "version": "1.1.0", + "resolved": "https://registry.npmjs.org/streamsearch/-/streamsearch-1.1.0.tgz", + "integrity": "sha512-Mcc5wHehp9aXz1ax6bZUyY5afg9u2rv5cqQI3mRrYkGC8rW2hM02jWuwjtL++LS5qinSyhj2QfLyNsuc+VsExg==", + "engines": { + "node": ">=10.0.0" + } + }, + "node_modules/strip-indent": { + "version": "3.0.0", + "resolved": "https://registry.npmjs.org/strip-indent/-/strip-indent-3.0.0.tgz", + "integrity": "sha512-laJTa3Jb+VQpaC6DseHhF7dXVqHTfJPCRDaEbid/drOhgitgYku/letMUqOXFoWV0zIIUbjpdH2t+tYj4bQMRQ==", + "dev": true, + "dependencies": { + "min-indent": "^1.0.0" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/sucrase": { + "version": "3.32.0", + "resolved": "https://registry.npmjs.org/sucrase/-/sucrase-3.32.0.tgz", + "integrity": "sha512-ydQOU34rpSyj2TGyz4D2p8rbktIOZ8QY9s+DGLvFU1i5pWJE8vkpruCjGCMHsdXwnD7JDcS+noSwM/a7zyNFDQ==", + "dev": true, + "dependencies": { + "@jridgewell/gen-mapping": "^0.3.2", + "commander": "^4.0.0", + "glob": "7.1.6", + "lines-and-columns": "^1.1.6", + "mz": "^2.7.0", + "pirates": "^4.0.1", + "ts-interface-checker": "^0.1.9" + }, + "bin": { + "sucrase": "bin/sucrase", + "sucrase-node": "bin/sucrase-node" + }, + "engines": { + "node": ">=8" + } + }, + "node_modules/sucrase/node_modules/glob": { + "version": "7.1.6", + "resolved": "https://registry.npmjs.org/glob/-/glob-7.1.6.tgz", + "integrity": "sha512-LwaxwyZ72Lk7vZINtNNrywX0ZuLyStrdDtabefZKAY5ZGJhVtgdznluResxNmPitE0SAO+O26sWTHeKSI2wMBA==", + "dev": true, + "dependencies": { + "fs.realpath": "^1.0.0", + "inflight": "^1.0.4", + "inherits": "2", + "minimatch": "^3.0.4", + "once": "^1.3.0", + "path-is-absolute": "^1.0.0" + }, + "engines": { + "node": "*" + }, + "funding": { + "url": "https://github.com/sponsors/isaacs" + } + }, + "node_modules/supports-preserve-symlinks-flag": { + "version": "1.0.0", + "resolved": "https://registry.npmjs.org/supports-preserve-symlinks-flag/-/supports-preserve-symlinks-flag-1.0.0.tgz", + "integrity": "sha512-ot0WnXS9fgdkgIcePe6RHNk1WA8+muPa6cSjeR3V8K27q9BB1rTE3R1p7Hv0z1ZyAc8s6Vvv8DIyWf681MAt0w==", + "dev": true, + "engines": { + "node": ">= 0.4" + }, + "funding": { + "url": "https://github.com/sponsors/ljharb" + } + }, + "node_modules/svelte": { + "version": "3.59.1", + "resolved": "https://registry.npmjs.org/svelte/-/svelte-3.59.1.tgz", + "integrity": "sha512-pKj8fEBmqf6mq3/NfrB9SLtcJcUvjYSWyePlfCqN9gujLB25RitWK8PvFzlwim6hD/We35KbPlRteuA6rnPGcQ==", + "engines": { + "node": ">= 8" + } + }, + "node_modules/svelte-check": { + "version": "3.3.2", + "resolved": "https://registry.npmjs.org/svelte-check/-/svelte-check-3.3.2.tgz", + "integrity": "sha512-67j3rI0LDc2DvL0ON/2pvCasVVD3nHDrTkZNr4eITNfo2oFXdw7SIyMOiFj4swu+pjmFQAigytBK1IWyik8dBw==", + "dev": true, + "dependencies": { + "@jridgewell/trace-mapping": "^0.3.17", + "chokidar": "^3.4.1", + "fast-glob": "^3.2.7", + "import-fresh": "^3.2.1", + "picocolors": "^1.0.0", + "sade": "^1.7.4", + "svelte-preprocess": "^5.0.3", + "typescript": "^5.0.3" + }, + "bin": { + "svelte-check": "bin/svelte-check" + }, + "peerDependencies": { + "svelte": "^3.55.0" + } + }, + "node_modules/svelte-hmr": { + "version": "0.15.1", + "resolved": "https://registry.npmjs.org/svelte-hmr/-/svelte-hmr-0.15.1.tgz", + "integrity": "sha512-BiKB4RZ8YSwRKCNVdNxK/GfY+r4Kjgp9jCLEy0DuqAKfmQtpL38cQK3afdpjw4sqSs4PLi3jIPJIFp259NkZtA==", + "engines": { + "node": "^12.20 || ^14.13.1 || >= 16" + }, + "peerDependencies": { + "svelte": ">=3.19.0" + } + }, + "node_modules/svelte-preprocess": { + "version": "5.0.3", + "resolved": "https://registry.npmjs.org/svelte-preprocess/-/svelte-preprocess-5.0.3.tgz", + "integrity": "sha512-GrHF1rusdJVbOZOwgPWtpqmaexkydznKzy5qIC2FabgpFyKN57bjMUUUqPRfbBXK5igiEWn1uO/DXsa2vJ5VHA==", + "dev": true, + "hasInstallScript": true, + "dependencies": { + "@types/pug": "^2.0.6", + "detect-indent": "^6.1.0", + "magic-string": "^0.27.0", + "sorcery": "^0.11.0", + "strip-indent": "^3.0.0" + }, + "engines": { + "node": ">= 14.10.0" + }, + "peerDependencies": { + "@babel/core": "^7.10.2", + "coffeescript": "^2.5.1", + "less": "^3.11.3 || ^4.0.0", + "postcss": "^7 || ^8", + "postcss-load-config": "^2.1.0 || ^3.0.0 || ^4.0.0", + "pug": "^3.0.0", + "sass": "^1.26.8", + "stylus": "^0.55.0", + "sugarss": "^2.0.0 || ^3.0.0 || ^4.0.0", + "svelte": "^3.23.0", + "typescript": ">=3.9.5 || ^4.0.0 || ^5.0.0" + }, + "peerDependenciesMeta": { + "@babel/core": { + "optional": true + }, + "coffeescript": { + "optional": true + }, + "less": { + "optional": true + }, + "postcss": { + "optional": true + }, + "postcss-load-config": { + "optional": true + }, + "pug": { + "optional": true + }, + "sass": { + "optional": true + }, + "stylus": { + "optional": true + }, + "sugarss": { + "optional": true + }, + "typescript": { + "optional": true + } + } + }, + "node_modules/svelte-preprocess/node_modules/magic-string": { + "version": "0.27.0", + "resolved": "https://registry.npmjs.org/magic-string/-/magic-string-0.27.0.tgz", + "integrity": "sha512-8UnnX2PeRAPZuN12svgR9j7M1uWMovg/CEnIwIG0LFkXSJJe4PdfUGiTGl8V9bsBHFUtfVINcSyYxd7q+kx9fA==", + "dev": true, + "dependencies": { + "@jridgewell/sourcemap-codec": "^1.4.13" + }, + "engines": { + "node": ">=12" + } + }, + "node_modules/tailwindcss": { + "version": "3.3.2", + "resolved": "https://registry.npmjs.org/tailwindcss/-/tailwindcss-3.3.2.tgz", + "integrity": "sha512-9jPkMiIBXvPc2KywkraqsUfbfj+dHDb+JPWtSJa9MLFdrPyazI7q6WX2sUrm7R9eVR7qqv3Pas7EvQFzxKnI6w==", + "dev": true, + "dependencies": { + "@alloc/quick-lru": "^5.2.0", + "arg": "^5.0.2", + "chokidar": "^3.5.3", + "didyoumean": "^1.2.2", + "dlv": "^1.1.3", + "fast-glob": "^3.2.12", + "glob-parent": "^6.0.2", + "is-glob": "^4.0.3", + "jiti": "^1.18.2", + "lilconfig": "^2.1.0", + "micromatch": "^4.0.5", + "normalize-path": "^3.0.0", + "object-hash": "^3.0.0", + "picocolors": "^1.0.0", + "postcss": "^8.4.23", + "postcss-import": "^15.1.0", + "postcss-js": "^4.0.1", + "postcss-load-config": "^4.0.1", + "postcss-nested": "^6.0.1", + "postcss-selector-parser": "^6.0.11", + "postcss-value-parser": "^4.2.0", + "resolve": "^1.22.2", + "sucrase": "^3.32.0" + }, + "bin": { + "tailwind": "lib/cli.js", + "tailwindcss": "lib/cli.js" + }, + "engines": { + "node": ">=14.0.0" + } + }, + "node_modules/tailwindcss/node_modules/glob-parent": { + "version": "6.0.2", + "resolved": "https://registry.npmjs.org/glob-parent/-/glob-parent-6.0.2.tgz", + "integrity": "sha512-XxwI8EOhVQgWp6iDL+3b0r86f4d6AX6zSU55HfB4ydCEuXLXc5FcYeOu+nnGftS4TEju/11rt4KJPTMgbfmv4A==", + "dev": true, + "dependencies": { + "is-glob": "^4.0.3" + }, + "engines": { + "node": ">=10.13.0" + } + }, + "node_modules/thenify": { + "version": "3.3.1", + "resolved": "https://registry.npmjs.org/thenify/-/thenify-3.3.1.tgz", + "integrity": "sha512-RVZSIV5IG10Hk3enotrhvz0T9em6cyHBLkH/YAZuKqd8hRkKhSfCGIcP2KUY0EPxndzANBmNllzWPwak+bheSw==", + "dev": true, + "dependencies": { + "any-promise": "^1.0.0" + } + }, + "node_modules/thenify-all": { + "version": "1.6.0", + "resolved": "https://registry.npmjs.org/thenify-all/-/thenify-all-1.6.0.tgz", + "integrity": "sha512-RNxQH/qI8/t3thXJDwcstUO4zeqo64+Uy/+sNVRBx4Xn2OX+OZ9oP+iJnNFqplFra2ZUVeKCSa2oVWi3T4uVmA==", + "dev": true, + "dependencies": { + "thenify": ">= 3.1.0 < 4" + }, + "engines": { + "node": ">=0.8" + } + }, + "node_modules/tiny-glob": { + "version": "0.2.9", + "resolved": "https://registry.npmjs.org/tiny-glob/-/tiny-glob-0.2.9.tgz", + "integrity": "sha512-g/55ssRPUjShh+xkfx9UPDXqhckHEsHr4Vd9zX55oSdGZc/MD0m3sferOkwWtp98bv+kcVfEHtRJgBVJzelrzg==", + "dependencies": { + "globalyzer": "0.1.0", + "globrex": "^0.1.2" + } + }, + "node_modules/to-regex-range": { + "version": "5.0.1", + "resolved": "https://registry.npmjs.org/to-regex-range/-/to-regex-range-5.0.1.tgz", + "integrity": "sha512-65P7iz6X5yEr1cwcgvQxbbIw7Uk3gOy5dIdtZ4rDveLqhrdJP+Li/Hx6tyK0NEb+2GCyneCMJiGqrADCSNk8sQ==", + "dev": true, + "dependencies": { + "is-number": "^7.0.0" + }, + "engines": { + "node": ">=8.0" + } + }, + "node_modules/totalist": { + "version": "3.0.1", + "resolved": "https://registry.npmjs.org/totalist/-/totalist-3.0.1.tgz", + "integrity": "sha512-sf4i37nQ2LBx4m3wB74y+ubopq6W/dIzXg0FDGjsYnZHVa1Da8FH853wlL2gtUhg+xJXjfk3kUZS3BRoQeoQBQ==", + "engines": { + "node": ">=6" + } + }, + "node_modules/ts-interface-checker": { + "version": "0.1.13", + "resolved": "https://registry.npmjs.org/ts-interface-checker/-/ts-interface-checker-0.1.13.tgz", + "integrity": "sha512-Y/arvbn+rrz3JCKl9C4kVNfTfSm2/mEp5FSz5EsZSANGPSlQrpRI5M4PKF+mJnE52jOO90PnPSc3Ur3bTQw0gA==", + "dev": true + }, + "node_modules/tslib": { + "version": "2.5.0", + "resolved": "https://registry.npmjs.org/tslib/-/tslib-2.5.0.tgz", + "integrity": "sha512-336iVw3rtn2BUK7ORdIAHTyxHGRIHVReokCR3XjbckJMK7ms8FysBfhLR8IXnAgy7T0PTPNBWKiH514FOW/WSg==", + "dev": true + }, + "node_modules/typescript": { + "version": "5.0.4", + "resolved": "https://registry.npmjs.org/typescript/-/typescript-5.0.4.tgz", + "integrity": "sha512-cW9T5W9xY37cc+jfEnaUvX91foxtHkza3Nw3wkoF4sSlKn0MONdkdEndig/qPBWXNkmplh3NzayQzCiHM4/hqw==", + "dev": true, + "bin": { + "tsc": "bin/tsc", + "tsserver": "bin/tsserver" + }, + "engines": { + "node": ">=12.20" + } + }, + "node_modules/undici": { + "version": "5.22.1", + "resolved": "https://registry.npmjs.org/undici/-/undici-5.22.1.tgz", + "integrity": "sha512-Ji2IJhFXZY0x/0tVBXeQwgPlLWw13GVzpsWPQ3rV50IFMMof2I55PZZxtm4P6iNq+L5znYN9nSTAq0ZyE6lSJw==", + "dependencies": { + "busboy": "^1.6.0" + }, + "engines": { + "node": ">=14.0" + } + }, + "node_modules/update-browserslist-db": { + "version": "1.0.11", + "resolved": "https://registry.npmjs.org/update-browserslist-db/-/update-browserslist-db-1.0.11.tgz", + "integrity": "sha512-dCwEFf0/oT85M1fHBg4F0jtLwJrutGoHSQXCh7u4o2t1drG+c0a9Flnqww6XUKSfQMPpJBRjU8d4RXB09qtvaA==", + "dev": true, + "funding": [ + { + "type": "opencollective", + "url": "https://opencollective.com/browserslist" + }, + { + "type": "tidelift", + "url": "https://tidelift.com/funding/github/npm/browserslist" + }, + { + "type": "github", + "url": "https://github.com/sponsors/ai" + } + ], + "dependencies": { + "escalade": "^3.1.1", + "picocolors": "^1.0.0" + }, + "bin": { + "update-browserslist-db": "cli.js" + }, + "peerDependencies": { + "browserslist": ">= 4.21.0" + } + }, + "node_modules/util-deprecate": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/util-deprecate/-/util-deprecate-1.0.2.tgz", + "integrity": "sha512-EPD5q1uXyFxJpCrLnCc1nHnq3gOa6DZBocAIiI2TaSCA7VCJ1UJDMagCzIkXNsUYfD1daK//LTEQ8xiIbrHtcw==", + "dev": true + }, + "node_modules/vite": { + "version": "4.3.5", + "resolved": "https://registry.npmjs.org/vite/-/vite-4.3.5.tgz", + "integrity": "sha512-0gEnL9wiRFxgz40o/i/eTBwm+NEbpUeTWhzKrZDSdKm6nplj+z4lKz8ANDgildxHm47Vg8EUia0aicKbawUVVA==", + "dependencies": { + "esbuild": "^0.17.5", + "postcss": "^8.4.23", + "rollup": "^3.21.0" + }, + "bin": { + "vite": "bin/vite.js" + }, + "engines": { + "node": "^14.18.0 || >=16.0.0" + }, + "optionalDependencies": { + "fsevents": "~2.3.2" + }, + "peerDependencies": { + "@types/node": ">= 14", + "less": "*", + "sass": "*", + "stylus": "*", + "sugarss": "*", + "terser": "^5.4.0" + }, + "peerDependenciesMeta": { + "@types/node": { + "optional": true + }, + "less": { + "optional": true + }, + "sass": { + "optional": true + }, + "stylus": { + "optional": true + }, + "sugarss": { + "optional": true + }, + "terser": { + "optional": true + } + } + }, + "node_modules/vitefu": { + "version": "0.2.4", + "resolved": "https://registry.npmjs.org/vitefu/-/vitefu-0.2.4.tgz", + "integrity": "sha512-fanAXjSaf9xXtOOeno8wZXIhgia+CZury481LsDaV++lSvcU2R9Ch2bPh3PYFyoHW+w9LqAeYRISVQjUIew14g==", + "peerDependencies": { + "vite": "^3.0.0 || ^4.0.0" + }, + "peerDependenciesMeta": { + "vite": { + "optional": true + } + } + }, + "node_modules/wrappy": { + "version": "1.0.2", + "resolved": "https://registry.npmjs.org/wrappy/-/wrappy-1.0.2.tgz", + "integrity": "sha512-l4Sp/DRseor9wL6EvV2+TuQn63dMkPjZ/sp9XkghTEbV9KlPS1xUsZ3u7/IQO4wxtcFB4bgpQPRcR3QCvezPcQ==", + "dev": true + }, + "node_modules/yaml": { + "version": "2.2.2", + "resolved": "https://registry.npmjs.org/yaml/-/yaml-2.2.2.tgz", + "integrity": "sha512-CBKFWExMn46Foo4cldiChEzn7S7SRV+wqiluAb6xmueD/fGyRHIhX8m14vVGgeFWjN540nKCNVj6P21eQjgTuA==", + "dev": true, + "engines": { + "node": ">= 14" + } + } + } +} diff --git a/package.json b/package.json new file mode 100644 index 0000000000000000000000000000000000000000..48c2ab5cd2805ab5d355ea9cb9fb95defcebebbf --- /dev/null +++ b/package.json @@ -0,0 +1,28 @@ +{ + "name": "my-app", + "version": "0.0.1", + "private": true, + "scripts": { + "dev": "vite dev", + "build": "vite build", + "preview": "vite preview", + "check": "svelte-kit sync && svelte-check --tsconfig ./tsconfig.json", + "check:watch": "svelte-kit sync && svelte-check --tsconfig ./tsconfig.json --watch" + }, + "devDependencies": { + "@sveltejs/adapter-auto": "^2.0.0", + "@sveltejs/kit": "^1.5.0", + "autoprefixer": "^10.4.14", + "postcss": "^8.4.23", + "svelte": "^3.54.0", + "svelte-check": "^3.0.1", + "tailwindcss": "^3.3.2", + "tslib": "^2.4.1", + "typescript": "^5.0.0", + "vite": "^4.3.0" + }, + "type": "module", + "dependencies": { + "@sveltejs/adapter-static": "^2.0.2" + } +} diff --git a/postcss.config.js b/postcss.config.js new file mode 100644 index 0000000000000000000000000000000000000000..2e7af2b7f1a6f391da1631d93968a9d487ba977d --- /dev/null +++ b/postcss.config.js @@ -0,0 +1,6 @@ +export default { + plugins: { + tailwindcss: {}, + autoprefixer: {}, + }, +} diff --git a/src/app.css b/src/app.css new file mode 100644 index 0000000000000000000000000000000000000000..6155d5df62ef089fd9fced5266de10df57e1c670 --- /dev/null +++ b/src/app.css @@ -0,0 +1,14 @@ +@tailwind base; +@tailwind components; +@tailwind utilities; + +@layer base { + + @font-face { + font-family: "Hellovetica"; + font-weight: 300; + src : local("Hellovetica"), url("/fonts/hellovetica.ttf"); + font-display: swap; + } + + } \ No newline at end of file diff --git a/src/app.d.ts b/src/app.d.ts new file mode 100644 index 0000000000000000000000000000000000000000..f59b884c51ed3c31fc0738fd38d0d75b580df5e4 --- /dev/null +++ b/src/app.d.ts @@ -0,0 +1,12 @@ +// See https://kit.svelte.dev/docs/types#app +// for information about these interfaces +declare global { + namespace App { + // interface Error {} + // interface Locals {} + // interface PageData {} + // interface Platform {} + } +} + +export {}; diff --git a/src/app.html b/src/app.html new file mode 100644 index 0000000000000000000000000000000000000000..625b6a8148a16090ce7ac33ced6bc4fd5193c869 --- /dev/null +++ b/src/app.html @@ -0,0 +1,14 @@ + + + + Spaceship freeride + + + + + %sveltekit.head% + + +
%sveltekit.body%
+ + diff --git a/src/lib/images/preview.png b/src/lib/images/preview.png new file mode 100644 index 0000000000000000000000000000000000000000..cc908bd4ef728ce78d75d2970c9cc9f0ee36c5f4 Binary files /dev/null and b/src/lib/images/preview.png differ diff --git a/src/routes/+layout.svelte b/src/routes/+layout.svelte new file mode 100644 index 0000000000000000000000000000000000000000..9e20eb0fc379dbee624fcdcd13f2f1fe697afd0b --- /dev/null +++ b/src/routes/+layout.svelte @@ -0,0 +1,5 @@ + + + diff --git a/src/routes/+layout.ts b/src/routes/+layout.ts new file mode 100644 index 0000000000000000000000000000000000000000..c8cacf0895342e5b27842850d40b3efc28f5a4ab --- /dev/null +++ b/src/routes/+layout.ts @@ -0,0 +1 @@ +export const prerender = true; \ No newline at end of file diff --git a/src/routes/+page.svelte b/src/routes/+page.svelte new file mode 100644 index 0000000000000000000000000000000000000000..099031f634c9062bb68d72f60792d6222d53ce93 --- /dev/null +++ b/src/routes/+page.svelte @@ -0,0 +1,104 @@ + + + +
+ +
+ Game title +
+ + {#if !isMobile} +
+ +