sl_num
int64 1
315
| Poymer name
stringlengths 6
94
| SMILES (Atoms Ce and Th are placeholders for head and tail information, respectively)
stringlengths 10
130
| Experiment Tg (K)
int64 130
685
| Calculated Tg (K)
float64 138
951
| Calculated Tg std. dev. (K)
float64 1.76
74.7
| Experiment density at 300K (g/cc)
float64 0.84
1.95
⌀ | Calculated density at 300K (g/cc)
float64 0.82
2.05
| Calulated density at 300K std. dev. (g/cc)
float64 0
0.01
| Calculated glass CTE (10-6/K)
null 104
484
⌀ | Calculated glass CTE std. dev. (10-6/K)
null 2.66
19.5
⌀ | Calculated rubber CTE (10-6/K)
float64 268
1.68k
| Calculated rubber CTE std. dev. (10-6/K)
float64 12.9
290
|
|---|---|---|---|---|---|---|---|---|---|---|---|---|
1 | Poly[oxy(diethylsilylene)] | [Ce]O[Si](CC)(CC)[Th] | 130 | 137.978175 | 3.824788 | null | 0.954614 | 0.000939 | null | null | 1,047.653419 | 77.990209 |
2 | Poly(dimethyl siloxane) | [Ce][Si](C)(C)O[Th] | 152 | 193.259048 | 51.121747 | 0.965 | 0.961513 | 0.001071 | null | null | 1,459.12224 | 227.550412 |
3 | Poly(1,4-butadiene) (cis) | [Ce]C/C=C\C[Th] | 171 | 211.733492 | 3.06755 | 0.89 | 0.887429 | 0.000594 | null | null | 1,389.39266 | 196.658388 |
4 | Poly(dimethylsilylenemethylene) | [Ce][Si](C)(C)C[Th] | 173 | 258.6721 | 4.670864 | 0.892 | 0.930085 | 0.00202 | null | null | 1,386.070674 | 197.839449 |
5 | Poly[oxy(methylphenylsilylene)] | [Ce][Si](C)(C1=CC=CC=C1)O[Th] | 187 | 286.91057 | 5.818429 | 1.11 | 1.123117 | 0.00177 | null | null | 875.99196 | 55.277668 |
6 | Poly(3-hexoxypropylene oxide) | [Ce]OC(COCCCCCC)C[Th] | 188 | 229.018353 | 5.086611 | null | 0.939581 | 0.001881 | null | null | 1,493.153989 | 155.44061 |
7 | Polyoxytetramethylene | [Ce]OCCCC[Th] | 190 | 237.969287 | 5.104028 | 0.98 | 0.964877 | 0.002438 | null | null | 1,617.554155 | 258.308924 |
8 | Poly(1 , 1 -dimethylsilazane) | [Ce][Si](C)(C)N[Th] | 191 | 267.197134 | 5.708977 | null | 1.062117 | 0.001588 | null | null | 1,261.458013 | 174.652678 |
9 | Poly(2-n-butyl- 1 ,4-butadiene) | [Ce]CC(CCCC)=CC[Th] | 192 | 232.562648 | 9.657347 | null | 0.864194 | 0.002632 | null | null | 1,503.694188 | 185.307585 |
10 | Poly(vinyl n-octyl ether) | [Ce]CC(OCCCCCCCC)[Th] | 194 | 221.110334 | 5.334717 | 0.914 | 0.883741 | 0.001188 | null | null | 1,351.257217 | 120.59577 |
11 | Poly(3-butoxypropylene oxide) | [Ce]OC(COCCCC)C[Th] | 194 | 233.769643 | 3.954385 | null | 0.969658 | 0.00177 | null | null | 1,518.658676 | 162.495182 |
12 | Polyethylene | [Ce]CC[Th] | 195 | 237.055294 | 3.198584 | 0.85 | 0.841803 | 0.002191 | null | null | 1,622.064678 | 263.587926 |
13 | Polyoxytrimethylene | [Ce]CCCO[Th] | 195 | 245.830316 | 6.077746 | null | 1.005866 | 0.002412 | null | null | 1,578.814103 | 266.124898 |
14 | Poly(2-n-propyl-1 ,4-butadiene) | [Ce]CC(CCC)=CC[Th] | 196 | 240.574272 | 4.514069 | null | 0.86862 | 0.00155 | null | null | 1,468.882554 | 174.570656 |
15 | Poly(2-ethyl- 1 ,4-butadiene) | [Ce]CC(CC)=CC[Th] | 197 | 220.72978 | 7.099916 | 0.883 | 0.876147 | 0.001799 | null | null | 1,364.95827 | 126.34485 |
16 | Poly(vinyl n-decyl ether) | [Ce]CC(OCCCCCCCCCC)[Th] | 197 | 251.161379 | 8.978124 | null | 0.879235 | 0.002576 | null | null | 1,436.029322 | 166.078618 |
17 | Polyisobutylene | [Ce]CC(C)(C)[Th] | 199 | 198.569299 | 37.74087 | 1.3 | 1.294287 | 0.002368 | null | null | 1,137.003623 | 65.601734 |
18 | Poly[oxy(methyl y-trifluoropropylsilylene)] | [Ce][Si](C)(CCC(F)(F)F)O[Th] | 199 | 396.052375 | 11.45786 | 0.84 | 0.881919 | 0.003471 | null | null | 957.076594 | 97.891112 |
19 | Poly(dimethylsilylenetrimethylene) | [Ce][Si](C)(C)CCC[Th] | 203 | 239.977865 | 7.615075 | null | 0.861389 | 0.001958 | null | null | 1,667.82801 | 225.856807 |
20 | Polyisoprene | [Ce]CC=C(C)C[Th] | 203 | 236.074222 | 6.188813 | null | 0.903158 | 0.001612 | null | null | 1,641.031256 | 263.902553 |
21 | Polyoxyoctamethylene | [Ce]CCCCCCCCO[Th] | 203 | 276.535781 | 5.336303 | 0.906 | 0.886887 | 0.00123 | null | null | 1,403.948305 | 168.296045 |
22 | Polyoxyhexamethylene | [Ce]CCCCCCO[Th] | 204 | 234.925596 | 3.935306 | 0.932 | 0.92464 | 0.00108 | null | null | 1,676.089364 | 290.264797 |
23 | Poly(tetramethylene adipate) | [Ce]CCCCOC(=O)CCCCC(=O)O[Th] | 205 | 249.242179 | 5.029932 | 1.219 | 1.13093 | 0.002553 | null | null | 1,043.588431 | 113.714583 |
24 | Poly(propylene oxide) | [Ce]CC(C)O[Th] | 206 | 260.271678 | 3.399885 | 1.125 | 1.110345 | 0.001123 | null | null | 1,602.740952 | 265.110271 |
25 | Polyoxyethylene | [Ce]OCC[Th] | 206 | 273.950722 | 6.679879 | 1 | 0.996621 | 0.001789 | null | null | 1,582.722818 | 208.289181 |
26 | Poly(vinyl 2-ethylhexyl ether) | [Ce]CC(OCC(CC)CCCC)[Th] | 207 | 227.817197 | 10.498303 | 0.918 | 0.903581 | 0.002773 | null | null | 1,373.75092 | 121.625601 |
27 | Poly(vinyl n-pentyl ether) | [Ce]CC(OCCCCC)[Th] | 207 | 240.027794 | 30.264565 | 0.904 | 0.886508 | 0.001923 | null | null | 1,059.818007 | 46.838925 |
28 | Poly(n-octyl acrylate) | [Ce]CC(C(=O)OCCCCCCCC)[Th] | 208 | 221.878548 | 6.018879 | 0.971 | 0.958225 | 0.002234 | null | null | 1,208.083507 | 100.039553 |
29 | Poly(vinyl n-hexyl ether) | [Ce]CC(OCCCCCC)[Th] | 209 | 224.946735 | 8.828727 | 0.925 | 0.894876 | 0.001871 | null | null | 1,358.412602 | 114.550462 |
30 | Poly(3-methoxypropylene oxide) | [Ce]OC(COC)C[Th] | 211 | 277.724725 | 6.685037 | null | 1.083427 | 0.00198 | null | null | 1,543.931547 | 198.847921 |
31 | Polypentadiene | [Ce]C(C=CC)C[Th] | 213 | 316.047287 | 15.437379 | 0.89 | 0.851235 | 0.003467 | null | null | 1,499.117512 | 151.789655 |
32 | Poly(n-heptyl acrylate) | [Ce]CC(C(=O)OCCCCCCC)[Th] | 213 | 227.200966 | 6.994417 | null | 0.971211 | 0.00141 | null | null | 1,190.658282 | 96.483214 |
33 | Poly(e-caprolactone) | [Ce]OCCCCCC(=O)[Th] | 213 | 248.725426 | 4.385918 | 1.095 | 1.083278 | 0.001409 | null | null | 1,121.765941 | 132.654283 |
34 | Poly(n-nonyl acrylate) | [Ce]CC(C(=O)OCCCCCCCCC)[Th] | 215 | 221.429829 | 6.399678 | null | 0.947696 | 0.001739 | null | null | 1,227.352525 | 105.683964 |
35 | Poly(n-hexyl acrylate) | [Ce]CC(C(=O)OCCCCCC)[Th] | 216 | 231.802937 | 6.830616 | null | 0.98525 | 0.001781 | null | null | 1,156.873034 | 80.940492 |
36 | Poly(decamethylene adipate) | [Ce]CCCCCCCCCCOC(=O)CCCCC(=O)O[Th] | 217 | 240.192835 | 4.923891 | null | 1.023555 | 0.001819 | null | null | 1,231.325671 | 159.254248 |
37 | Poly(n-dodecyl methacrylate) | [Ce]CC(C)(C(=O)OCCCCCCCCCCCC)[Th] | 218 | 255.137966 | 7.304309 | 1.25 | 1.298711 | 0.001387 | null | null | 1,186.192479 | 161.148961 |
38 | Polyoxymethylene | [Ce]OC[Th] | 218 | 238.446937 | 7.32702 | 0.929 | 0.933459 | 0.001384 | null | null | 1,195.443319 | 110.913575 |
39 | Poly(n-butyl acrylate) | [Ce]CC(C(=O)OCCCC)[Th] | 219 | 234.962605 | 8.682496 | 1.087 | 1.02726 | 0.003253 | null | null | 1,129.835197 | 91.648437 |
40 | Poly (1 -heptene) | [Ce]CC(CCCCC)[Th] | 220 | 234.874526 | 6.864212 | null | 0.834624 | 0.001463 | null | null | 1,331.820622 | 124.20375 |
41 | Poly(oxycarbonyl-3-methylpentamethylene) | [Ce]CCC(C)CCC(=O)O[Th] | 220 | 264.984095 | 5.82418 | null | 1.05569 | 0.001955 | null | null | 1,117.35734 | 126.002126 |
42 | Poly(2-isopropyl-1 ,4-butadiene) | [Ce]CC(C(C)C)=CC[Th] | 221 | 242.679353 | 9.402977 | 0.927 | 0.912142 | 0.002126 | null | null | 1,390.167695 | 123.002002 |
43 | Poly(vinyl n-butyl ether) | [Ce]CC(OCCCC)[Th] | 221 | 278.419333 | 7.802022 | null | 0.871915 | 0.00206 | null | null | 1,346.165892 | 137.047722 |
44 | Poly(1-pentene) | [Ce]CC(CCC)[Th] | 223 | 260.385008 | 14.153175 | 0.86 | 0.834295 | 0.00221 | null | null | 1,333.263236 | 114.140805 |
45 | Poly(1-hexene) | [Ce]CC(CCCC)[Th] | 223 | 291.3859 | 15.504051 | 0.85 | 0.832354 | 0.002412 | null | null | 1,335.960542 | 132.570313 |
46 | Polychloroprene | [Ce]CC=C(Cl)C[Th] | 225 | 293.661188 | 5.293475 | 1.243 | 1.216631 | 0.001857 | null | null | 1,046.18269 | 111.748743 |
47 | Poly(propylene sulfide) | [Ce]SC(C)C[Th] | 226 | 320.970198 | 3.415403 | null | 1.130447 | 0.001715 | null | null | 947.231142 | 103.643381 |
48 | Poly(1-butene) | [Ce]CC(CC)[Th] | 228 | 295.376874 | 10.814433 | 0.86 | 0.843531 | 0.001582 | null | null | 1,310.041686 | 148.076589 |
49 | Poly(2-octyl acrylate) | [Ce]CC(C(=O)OC(C)CCCCCC)[Th] | 228 | 256.14346 | 3.426701 | 1.183 | 1.107463 | 0.001634 | null | null | 1,085.725868 | 122.89217 |
50 | Poly(ethylene azelate) | [Ce]CCOC(=O)CCCCCCCC(=O)O[Th] | 228 | 241.079173 | 14.04002 | null | 0.953964 | 0.001226 | null | null | 1,072.645339 | 59.137398 |
51 | Poly(n-propyl acrylate) | [Ce]CC(C(=O)OCCC)[Th] | 229 | 243.069684 | 6.043603 | 1.08 | 1.06026 | 0.002265 | null | null | 1,077.581493 | 84.829302 |
52 | Polypropylene | [Ce]CC(C)[Th] | 233 | 318.070134 | 6.763765 | 0.85 | 0.840785 | 0.002216 | null | null | 1,376.500581 | 177.547832 |
53 | Poly(ethylene adipate) | [Ce]CCOC(=O)CCCCC(=O)O[Th] | 233 | 362.930764 | 9.837341 | 1.6 | 1.611145 | 0.004306 | null | null | 1,398.140796 | 250.293928 |
54 | Poly(vinylidene fluoride) | [Ce]CC(F)(F)[Th] | 233 | 263.246421 | 2.594225 | 1.188 | 1.199368 | 0.002228 | null | null | 947.792049 | 89.368718 |
55 | Poly(2-heptyl acrylate) | [Ce]CC(C(=O)OC(C)CCCCC)[Th] | 235 | 248.021718 | 9.395159 | null | 0.96546 | 0.001657 | null | null | 1,059.322407 | 66.892566 |
56 | Poly(6-methyl-1 -heptene) | [Ce]CC(CCCC(C)C)[Th] | 239 | 262.534933 | 15.942295 | null | 0.835796 | 0.002215 | null | null | 1,222.508534 | 85.20893 |
57 | Poly(2-bromo-1 ,4-butadiene) | [Ce]CC(Br)=CC[Th] | 241 | 301.297896 | 7.493851 | null | 1.771987 | 0.003646 | null | null | 893.123746 | 81.128822 |
58 | Poly[(methyl)phenylsilylenetrimethylene] | [Ce][Si](C)(C1=CC=CC=C1)CCC[Th] | 243 | 254.673074 | 1.764332 | 1.085 | 1.085322 | 0.001807 | null | null | 1,126.359995 | 136.157928 |
59 | Poly(ethylene sebacate) | [Ce]CCOC(=O)CCCCCCCCC(=O)O[Th] | 243 | 290.654417 | 6.696844 | null | 0.999098 | 0.002256 | null | null | 1,122.668963 | 106.276295 |
60 | Poly(isobutyl acrylate) | [Ce]CC(C(=O)OCC(C)C)[Th] | 249 | 268.909514 | 5.457443 | 1.06 | 1.026507 | 0.002488 | null | null | 1,048.070808 | 72.255363 |
61 | Poly(vinyl isobutyl ether) | [Ce]CC(OCC(C)C)[Th] | 251 | 277.660757 | 6.912552 | 0.93 | 0.901931 | 0.003188 | null | null | 1,250.869396 | 84.37027 |
62 | Poly(ethyl acrylate) | [Ce]CC(C(=O)OCC)[Th] | 251 | 301.424399 | 9.601955 | 1.12 | 1.09999 | 0.002577 | null | null | 1,014.132215 | 77.664188 |
63 | Poly(vinyl sec-butyl ether) | C(C)(CC)OC(C[Th])[Ce] | 253 | 252.134088 | 8.988978 | 0.971 | 0.963015 | 0.001844 | null | null | 1,139.515624 | 97.965049 |
64 | Poly(n-octyl methacrylate) | [Ce]CC(C)(C(=O)OCCCCCCCC)[Th] | 253 | 272.487977 | 10.250159 | 0.92 | 0.912959 | 0.00304 | null | null | 1,093.308169 | 62.518098 |
65 | Poly(sec-butyl acrylate) | [Ce]CC(C(=O)OC(C)CC)[Th] | 253 | 270.09244 | 11.08606 | 1.052 | 1.022266 | 0.002291 | null | null | 975.226273 | 58.611521 |
66 | Poly(vinyl ethyl ether) | [Ce]CC(OCC)[Th] | 254 | 320.861319 | 9.171141 | 0.94 | 0.94901 | 0.002504 | null | null | 1,464.424201 | 156.542206 |
67 | Perfluoropolymer 2 | [Ce]C(F)(F)C(F)(F)C(F)(F)C(F)(F)C1(=NC(C(F)(F)C(F)(F)OC(F)(F)F)=NC([Th])=N1) | 255 | 345.364312 | 9.710753 | null | 1.858281 | 0.004957 | null | null | 1,245.87468 | 76.731688 |
68 | Poly(vinylidene chloride) | [Ce]CC(Cl)(Cl)[Th] | 256 | 473.340869 | 26.517213 | 1.63 | 1.733841 | 0.003095 | null | null | 588.999455 | 41.312506 |
69 | Poly(3-pentyl acrylate) | [Ce]CC(C(=O)OC(CC)CC)[Th] | 257 | 263.296464 | 8.03153 | null | 1.003905 | 0.001887 | null | null | 942.841291 | 43.784076 |
70 | Poly(5-methyl-1-hexene) | [Ce]CC(CCC(C)C)[Th] | 259 | 283.596651 | 9.941957 | null | 0.833445 | 0.002596 | null | null | 1,195.593678 | 83.465637 |
71 | Perfluoropolymer 1 | [Ce]C(F)(C(F)(F)F)OC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)OC(F)(C(F)(F)F)C1(=NC(C(F)(F)F)=NC([Th])=N1) | 260 | 364.001399 | 6.480278 | null | 1.853526 | 0.004785 | null | null | 1,286.271381 | 68.427722 |
72 | Poly(oxy-2,2-dichloromethyltrimethylene) | [Ce]CC(CCl)(CCl)CO[Th] | 265 | 408.466566 | 12.198672 | 1.386 | 1.327613 | 0.003592 | null | null | 763.54701 | 62.934351 |
73 | Poly[(4-dimethylaminophenyl)methylsilylenetrimethylene] | [Ce][Si](C)(C1=CC=C(N(C)C)C=C1)CCC[Th] | 267 | 339.630783 | 10.653825 | null | 1.001459 | 0.002051 | null | null | 1,241.809693 | 134.471288 |
74 | Poly(n-hexyl methacrylate) | [Ce]CC(C)(C(=O)OCCCCCC)[Th] | 268 | 259.415964 | 12.302543 | 1.01 | 0.987942 | 0.002113 | null | null | 1,083.04706 | 85.585391 |
75 | Poly(1,2-butadiene) | [Ce]CC(C=C)[Th] | 269 | 286.545332 | 9.161656 | 0.909 | 0.890494 | 0.002534 | null | null | 1,291.547286 | 134.420096 |
76 | Poly(vinyl isopropyl ether) | [Ce]CC(OC(C)C)[Th] | 270 | 307.70354 | 15.718956 | 0.924 | 0.927469 | 0.003382 | null | null | 1,202.937382 | 93.322148 |
77 | Poly(vinyl methyl sulfide) | [Ce]CC(SC)[Th] | 272 | 288.143866 | 6.257504 | 1.175 | 1.300395 | 0.001773 | null | null | 838.342092 | 70.732806 |
78 | Poly(ethylene succinate) | [Ce]OCCOC(=O)CCC(=O)[Th] | 272 | 355.280621 | 8.2914 | 1.18 | 1.139525 | 0.00175 | null | null | 853.65321 | 82.132269 |
79 | Poly(oxydiphenylsilyleneoxydimethylsilylene-1,4-phenylenedimethylsilylene) | [Ce]O[Si](C1=CC=CC=C1)(C1=CC=CC=C1)O[Si](C)(C)C1=CC=C(C=C1)[Si](C)(C)[Th] | 273 | 322.821493 | 5.609141 | null | 1.07631 | 0.002017 | null | null | 1,059.934164 | 79.499329 |
80 | Poly(p-n-hexoxymethyl styrene) | [Ce]CC(C1=CC=C(COCCCCCC)C=C1)[Th] | 278 | 313.225503 | 25.999063 | null | 1.058799 | 0.002377 | null | null | 1,109.571725 | 96.260658 |
81 | Poly(vinyl butyrate) | [Ce]CC(OC(=O)CCC)[Th] | 278 | 288.038621 | 12.636257 | null | 0.970379 | 0.002005 | null | null | 1,191.983494 | 104.684599 |
82 | Poly(p-n-butyl styrene) | [Ce]CC(C1=CC=C(CCCC)C=C1)[Th] | 279 | 281.498307 | 33.003887 | null | 0.950425 | 0.002403 | null | null | 1,101.758143 | 85.296055 |
83 | Poly(methyl acrylate) | [Ce]CC(C(=O)OC)[Th] | 281 | 360.828623 | 10.971235 | 1.22 | 1.164863 | 0.002204 | null | null | 936.412763 | 76.764556 |
84 | Poly(vinyl propionate) | [Ce]CC(OC(=O)CC)[Th] | 283 | 328.609316 | 14.297559 | 1.02 | 1.094098 | 0.002341 | null | null | 1,048.568426 | 87.331907 |
85 | Poly(2-ethylbutyl methacrylate) | [Ce]CC(C)(C(=O)OCC(CC)CC)[Th] | 284 | 294.43593 | 17.329466 | 1.04 | 0.984583 | 0.002872 | null | null | 947.485164 | 53.03462 |
86 | Poly(o-n-octoxy styrene) | [Ce]CC(C1=C(OCCCCCCCC)C=CC=C1)[Th] | 286 | 292.841611 | 20.57408 | null | 0.958984 | 0.00224 | null | null | 948.119245 | 44.232754 |
87 | Poly(2-t-butyl-1,4-butadiene) | [Ce]CC(C(C)(C)C)=CC[Th] | 293 | 369.294568 | 11.591723 | null | 0.865623 | 0.003384 | null | null | 1,125.151946 | 98.043323 |
88 | Poly(n-butyl methacrylate) | [Ce]CC(C)(C(=O)OCCCC)[Th] | 293 | 296.026245 | 20.271757 | 1.055 | 1.018625 | 0.003225 | null | null | 1,007.985873 | 75.509717 |
89 | Poly(2-methoxyethyl methacrylate) | [Ce]CC(C)(C(=O)OCCOC)[Th] | 293 | 334.79721 | 16.002659 | null | 1.126867 | 0.002571 | null | null | 952.463084 | 76.107789 |
90 | Poly(p-n-propoxymethyl styrene) | [Ce]CC(C1=CC=C(COCCC)C=C1)[Th] | 295 | 323.752995 | 23.39455 | null | 1.007508 | 0.002364 | null | null | 1,151.259766 | 98.412289 |
91 | Poly(ethyl-p-xylylene) | [Ce]CC1=CC=C(C(CC)=C1)C[Th] | 298 | 371.885684 | 16.422694 | null | 0.995463 | 0.001958 | null | null | 1,062.812038 | 112.488415 |
92 | Poly(3,3,3-trifluoropropylene) | [Ce]CC(C(F)(F)F)[Th] | 300 | 365.34992 | 8.314628 | 1.58 | 1.520077 | 0.004896 | null | null | 1,199.823786 | 89.098414 |
93 | Poly(vinyl acetate) | [Ce]CC(OC(=O)C)[Th] | 301 | 406.30132 | 12.682652 | 1.19 | 1.149828 | 0.003717 | null | null | 950.748114 | 84.027398 |
94 | Poly(4-methyl-1-pentene) | [Ce]CC(CC(C)C)[Th] | 302 | 330.03616 | 10.665252 | 0.838 | 0.824079 | 0.002646 | null | null | 1,135.584703 | 89.249999 |
95 | Poly(vinyl formate) | [Ce]CC(OC(=O))[Th] | 304 | 388.49875 | 8.087948 | null | 1.24575 | 0.002318 | null | null | 680.999709 | 50.221492 |
96 | Poly(vinyl chloroacetate) | [Ce]CC(OC(=O)CCl)[Th] | 304 | 361.66181 | 18.14971 | 1.45 | 1.417121 | 0.002669 | null | null | 696.279189 | 47.840439 |
97 | Poly(neopentyl methacrylate) | [Ce]CC(C)(C(=O)OCC(C)(C)C)[Th] | 306 | 507.577029 | 12.18449 | 0.993 | 0.954323 | 0.004041 | null | null | 889.384653 | 54.874483 |
98 | Poly(n-propyl methacrylate) | [Ce]CC(C)(C(=O)OCCC)[Th] | 308 | 336.094028 | 32.729725 | 1.08 | 1.039431 | 0.002377 | null | null | 956.394231 | 68.26368 |
99 | Poly(12-aminododecanoic acid) | [Ce]NCCCCCCCCCCCC(=O)[Th] | 310 | 285.249495 | 12.644836 | 0.99 | 0.958694 | 0.001795 | null | null | 1,165.432297 | 145.582012 |
100 | Poly[di(p-tolyl)silylenetrimethylene] | [Ce][Si](C1=CC=C(C)C=C1)(C1=CC=C(C)C=C1)CCC[Th] | 311 | 382.990191 | 8.054553 | null | 1.018509 | 0.001989 | null | null | 1,023.767144 | 85.54103 |
End of preview. Expand
in Dataset Viewer.
README.md exists but content is empty.
Use the Edit dataset card button to edit it.
- Downloads last month
- 40